Merge branch 'develop'
This commit is contained in:
commit
2469978ac9
124 changed files with 7399 additions and 3778 deletions
129
CHANGELOG.md
129
CHANGELOG.md
|
|
@ -1,9 +1,126 @@
|
||||||
# Clixon Changelog
|
# Clixon Changelog
|
||||||
|
|
||||||
|
## 3.6.0 (Upcoming)
|
||||||
|
|
||||||
|
### Major changes:
|
||||||
|
* Experimental NACM RFC8341 Network Configuration Access Control Model, see [NACM](README_NACM.md).
|
||||||
|
* New CLICON_NACM_MODE config option, default is disabled.
|
||||||
|
* New CLICON_NACM_FILE config option, if CLICON_NACM_MODE is "external"
|
||||||
|
* Added username attribute to all internal RPC:s from frontend to backend
|
||||||
|
* Added NACM backend module in example
|
||||||
|
* Restructure and more generic plugin API for cli, backend, restconf, and netconf. See example further down and the [example](example/README.md)
|
||||||
|
* Changed `plugin_init()` to `clixon_plugin_init()` returning an api struct with function pointers. There are no other hardcoded plugin functions.
|
||||||
|
* Master plugins have been removed. Plugins are loaded alphabetically. You can ensure plugin load order by prefixing them with an ordering number, for example.
|
||||||
|
* Plugin RPC callback interface have been unified between backend, netconf and restconf.
|
||||||
|
* Backend RPC register callback function (Netconf RPC or restconf operation POST) has been changed from:
|
||||||
|
`backend_rpc_cb_register()` to `rpc_callback_register()`
|
||||||
|
* Backend RPC callback signature has been changed from:
|
||||||
|
`int cb(clicon_handle h, cxobj *xe, struct client_entry *ce, cbuf *cbret, void *arg)`
|
||||||
|
to:
|
||||||
|
`int cb(clicon_handle h, cxobj *xe, struct client_entry *ce, cbuf *cbret, void *arg)`
|
||||||
|
* Frontend netconf and restconf plugins can register callbacks as well with same API as backends.
|
||||||
|
* Moved specific plugin functions from apps/ to generic functions in lib/
|
||||||
|
* New config option CLICON_BACKEND_REGEXP to match backend plugins (if you do not want to load all).
|
||||||
|
* Added authentication plugin callback (ca_auth)
|
||||||
|
* Added clicon_username_get() / clicon_username_set()
|
||||||
|
* Removed some obscure plugin code that seem not to be used (please report if needed!)
|
||||||
|
* CLI parse hook
|
||||||
|
* CLICON_FIND_PLUGIN
|
||||||
|
* clicon_valcb()
|
||||||
|
* CLIXON_BACKEND_SYSDIR
|
||||||
|
* CLIXON_CLI_SYSDIR
|
||||||
|
* CLICON_MASTER_PLUGIN config variable
|
||||||
|
* Example of migrating a backend plugin module:
|
||||||
|
* Add all callbacks in a clixon_plugin_api struct
|
||||||
|
* Rename plugin_init() -> clixon_plugin_init() and return api as function value
|
||||||
|
* Rename backend_rpc_cb_register() -> rpc_callback_register() for any RPC/restconf operation POST calls
|
||||||
|
```
|
||||||
|
/* This is old style with hardcoded function names (eg plugin_start) */
|
||||||
|
int plugin_start(clicon_handle h, int argc, char **argv)
|
||||||
|
{
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
int
|
||||||
|
plugin_init(clicon_handle h)
|
||||||
|
{
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* This is new style with all function names in api struct */
|
||||||
|
clixon_plugin_api *clixon_plugin_init(clicon_handle h);
|
||||||
|
|
||||||
|
static clixon_plugin_api api = {
|
||||||
|
"example", /* name */
|
||||||
|
clixon_plugin_init, /* init */
|
||||||
|
NULL, /* start */
|
||||||
|
NULL, /* exit */
|
||||||
|
.ca_auth=plugin_credentials /* restconf specific: auth */
|
||||||
|
};
|
||||||
|
|
||||||
|
clixon_plugin_api *clixon_plugin_init(clicon_handle h)
|
||||||
|
{
|
||||||
|
return &api; /* Return NULL on error */
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
* Builds and installs a new restconf library: `libclixon_restconf.so` and clixon_restconf.h
|
||||||
|
* The restconf library can be included by a restconf plugin.
|
||||||
|
* Example code in example/Makefile.in and example/restconf_lib.c
|
||||||
|
* Restconf error handling for get, put and post. (thanks Stephen Jones, Netgate)
|
||||||
|
* Available both as xml and json (set accept header).
|
||||||
|
* Proper RFC 6241 Netconf error handling
|
||||||
|
* New functions added in clixon_netconf_lib.[ch]
|
||||||
|
* Datastore code modified for RFC 6241
|
||||||
|
|
||||||
|
### Minor changes:
|
||||||
|
|
||||||
|
* INSTALLFLAGS added with default value -s(strip).
|
||||||
|
* For debug do: CFLAGS=-g INSTALLFLAGS= ./configure
|
||||||
|
* plugin_start() callbacks added for restconf
|
||||||
|
* Authentication
|
||||||
|
* Example extended with http basic authentication for restconf
|
||||||
|
* Documentation in FAQ.md
|
||||||
|
* Updated ietf-netconf-acm to ietf-netconf-acm@2018-02-14.yang from RFC 8341
|
||||||
|
* The Clixon example has changed name from "routing" to "example" affecting all config files, plugins, tests, etc.
|
||||||
|
* Secondary backend plugin added
|
||||||
|
* Removed username to rpc calls (added below)
|
||||||
|
* README.md extended with new yang, netconf, restconf, datastore, and auth sections.
|
||||||
|
* The key-value datastore is no longer supported. Use the default text datastore.
|
||||||
|
* Added username to rpc calls to prepare for authorization for backend:
|
||||||
|
* clicon_rpc_config_get(h, db, xpath, xt) --> clicon_rpc_config_get(h, db, xpath, username, xt)
|
||||||
|
* clicon_rpc_get(h, xpath, xt) --> clicon_rpc_get(h, xpath, username, xt)
|
||||||
|
* Experimental: Added CLICON_TRANSACTION_MOD configuration option. If set,
|
||||||
|
modifications in validation and commit callbacks are written back
|
||||||
|
into the datastore. Requested by Stephen Jones, Netgate.
|
||||||
|
* Invalid key to api_path2xml gives warning instead of error and quit.
|
||||||
|
* Added restconf/operations get, see RFC8040 Sec 3.3.2:
|
||||||
|
* yang_find_topnode() and api_path2xml() schemanode parameter replaced with yang_class. Replace as follows: 0 -> YC_DATANODE, 1 -> YC_SCHEMANODE
|
||||||
|
|
||||||
|
* xml2json: include prefix in translation, so <a:b> is translated to {"a:b" ..}
|
||||||
|
* Use `<config>` instead of `<data>` when save/load configuration to file. This
|
||||||
|
enables saved files to be used as datastore without any editing. Thanks Matt, Netgate.
|
||||||
|
|
||||||
|
* Added Yang "extension" statement. This includes parsing unknown
|
||||||
|
statements and identifying them as extensions or not. However,
|
||||||
|
semantics for specific extensions must still be added.
|
||||||
|
|
||||||
|
* Renamed ytype_id and ytype_prefix to yarg_id and yarg_prefix, respectively
|
||||||
|
|
||||||
|
* Added cli_show_version()
|
||||||
|
|
||||||
|
### Corrected Bugs
|
||||||
|
* Showing syntax using CLI commands was broekn and is fixed.
|
||||||
|
* Fixed issue https://github.com/clicon/clixon/issues/18 RPC response issues reported by Stephen Jones at Netgate
|
||||||
|
* Fixed issue https://github.com/clicon/clixon/issues/17 special character in strings can break RPCs reported by David Cornejo at Netgate.
|
||||||
|
* This was a large rewrite of XML parsing and output due to CharData not correctly encoded according to https://www.w3.org/TR/2008/REC-xml-20081126.
|
||||||
|
* Fixed three-key list entry problem (reported by jdl@netgate)
|
||||||
|
* Translate xml->json \n correctly
|
||||||
|
* Fix issue: https://github.com/clicon/clixon/issues/15 Replace whole config
|
||||||
|
|
||||||
## 3.5.0 (12 February 2018)
|
## 3.5.0 (12 February 2018)
|
||||||
|
|
||||||
### Major changes:
|
### Major changes:
|
||||||
* Major Restconf feature update to compy to RFC 8040. Thanks Stephen Jones for getting right.
|
* Major Restconf feature update to comply to RFC 8040. Thanks Stephen Jones of Netgate for getting right.
|
||||||
* GET: Always return object referenced (and nothing else). ie, GET /restconf/data/X returns X.
|
* GET: Always return object referenced (and nothing else). ie, GET /restconf/data/X returns X.
|
||||||
* GET Added support for the following resources: Well-known, top-level resource, and yang library version,
|
* GET Added support for the following resources: Well-known, top-level resource, and yang library version,
|
||||||
* GET Single element JSON lists use {list:[element]}, not {list:element}.
|
* GET Single element JSON lists use {list:[element]}, not {list:element}.
|
||||||
|
|
@ -42,7 +159,7 @@
|
||||||
* New CLICON_XML_SORT configuration option. Default is true. Disable by setting to false.
|
* New CLICON_XML_SORT configuration option. Default is true. Disable by setting to false.
|
||||||
* Added yang ordered-by user. The default (ordered-by system) will now sort lists and leaf-lists alphabetically to increase search performance. Note that this may change outputs.
|
* Added yang ordered-by user. The default (ordered-by system) will now sort lists and leaf-lists alphabetically to increase search performance. Note that this may change outputs.
|
||||||
* If you need legacy order, either set CLICON_XML_SORT to false, or set that list to "ordered-by user".
|
* If you need legacy order, either set CLICON_XML_SORT to false, or set that list to "ordered-by user".
|
||||||
* This replaces XML hash experimental code, ie xml_child_hash variables and all xml_hash_ functions have been removed.
|
* This replaces XML hash experimental code, ie xml_child_hash variables and all xmlv_hash_ functions have been removed.
|
||||||
* Implementation detail: Cached keys are stored in in yang Y_LIST nodes as cligen vector, see ys_populate_list()
|
* Implementation detail: Cached keys are stored in in yang Y_LIST nodes as cligen vector, see ys_populate_list()
|
||||||
|
|
||||||
* Datastore cache introduced: cache XML tree in memory for faster get access.
|
* Datastore cache introduced: cache XML tree in memory for faster get access.
|
||||||
|
|
@ -102,11 +219,11 @@ SUNET for support, requests, debugging, bugfixes and proposed solutions.
|
||||||
* In backward compatible mode both .xml and .conf works
|
* In backward compatible mode both .xml and .conf works
|
||||||
* For migration from old to new, a utility is clixon_cli -x to print new format. Run the command and save in configuration file with .xml suffix instead.
|
* For migration from old to new, a utility is clixon_cli -x to print new format. Run the command and save in configuration file with .xml suffix instead.
|
||||||
```
|
```
|
||||||
> clixon_cli -f /usr/local/etc/routing.conf -1x
|
> clixon_cli -f /usr/local/etc/example.conf -1x
|
||||||
<config>
|
<config>
|
||||||
<CLICON_CONFIGFILE>/usr/local/etc/routing.xml</CLICON_CONFIGFILE>
|
<CLICON_CONFIGFILE>/usr/local/etc/example.xml</CLICON_CONFIGFILE>
|
||||||
<CLICON_YANG_DIR>/usr/local/share/routing/yang</CLICON_YANG_DIR>
|
<CLICON_YANG_DIR>/usr/local/share/example/yang</CLICON_YANG_DIR>
|
||||||
<CLICON_BACKEND_DIR>/usr/local/lib/routing/backend</CLICON_BACKEND_DIR>
|
<CLICON_BACKEND_DIR>/usr/local/lib/example/backend</CLICON_BACKEND_DIR>
|
||||||
...
|
...
|
||||||
</config>
|
</config>
|
||||||
```
|
```
|
||||||
|
|
|
||||||
|
|
@ -47,7 +47,7 @@ CC = @CC@
|
||||||
CFLAGS = @CFLAGS@
|
CFLAGS = @CFLAGS@
|
||||||
LDFLAGS = @LDFLAGS@
|
LDFLAGS = @LDFLAGS@
|
||||||
LIBS = @LIBS@
|
LIBS = @LIBS@
|
||||||
#INSTALL = @INSTALL@
|
INSTALL = @INSTALL@
|
||||||
|
|
||||||
INCLUDES = -I. -I@srcdir@ @INCLUDES@
|
INCLUDES = -I. -I@srcdir@ @INCLUDES@
|
||||||
SHELL = /bin/sh
|
SHELL = /bin/sh
|
||||||
|
|
@ -69,8 +69,8 @@ clixon.mk: clixon.mk.cpp
|
||||||
$(CPP) -P -traditional-cpp -x assembler-with-cpp -Dprefix=$(prefix) -Dlocalstatedir=$(localstatedir) -Dsysconfdir=$(sysconfdir) -Ddatadir=$(datadir) -Dlibdir=$(libdir) $< > $@
|
$(CPP) -P -traditional-cpp -x assembler-with-cpp -Dprefix=$(prefix) -Dlocalstatedir=$(localstatedir) -Dsysconfdir=$(sysconfdir) -Ddatadir=$(datadir) -Dlibdir=$(libdir) $< > $@
|
||||||
|
|
||||||
install: clixon.mk
|
install: clixon.mk
|
||||||
install -d -m 755 $(DESTDIR)$(datadir)/clixon
|
install -d -m 0755 $(DESTDIR)$(datadir)/clixon
|
||||||
install -m 755 clixon.mk $(DESTDIR)$(datadir)/clixon
|
install -m 0644 clixon.mk $(DESTDIR)$(datadir)/clixon
|
||||||
for i in $(SUBDIRS) doc; \
|
for i in $(SUBDIRS) doc; \
|
||||||
do (cd $$i; $(MAKE) $(MFLAGS) $@)||exit 1; done; \
|
do (cd $$i; $(MAKE) $(MFLAGS) $@)||exit 1; done; \
|
||||||
echo "Install for compilation by: make install-include"
|
echo "Install for compilation by: make install-include"
|
||||||
|
|
|
||||||
201
README.md
201
README.md
|
|
@ -4,26 +4,39 @@ Clixon is an automatic configuration manager where you generate
|
||||||
interactive CLI, NETCONF, RESTCONF and embedded databases with
|
interactive CLI, NETCONF, RESTCONF and embedded databases with
|
||||||
transaction support from a YANG specification.
|
transaction support from a YANG specification.
|
||||||
|
|
||||||
Table of contents
|
|
||||||
=================
|
|
||||||
* [Documentation](#documentation)
|
|
||||||
* [Installation](#installation)
|
|
||||||
* [Dependencies](#dependencies)
|
|
||||||
* [Licenses](#licenses)
|
|
||||||
* [Background](#background)
|
* [Background](#background)
|
||||||
* [Clixon SDK](#SDK)
|
* [Frequently asked questions](doc/FAQ.md)
|
||||||
|
* [Installation](#installation)
|
||||||
|
* [Licenses](#licenses)
|
||||||
|
* [Support](#support)
|
||||||
|
* [Dependencies](#dependencies)
|
||||||
|
* [Extending](#extending)
|
||||||
|
* [Yang](#yang)
|
||||||
|
* [Netconf](#netconf)
|
||||||
|
* [Restconf](#restconf)
|
||||||
|
* [Datastore](datastore/README.md)
|
||||||
|
* [Authentication and Authorization](#auth)
|
||||||
|
* [Example](example/)
|
||||||
|
* [Changelog](CHANGELOG.md)
|
||||||
|
* [Runtime](#runtime)
|
||||||
|
* [Clixon project page](http://www.clicon.org)
|
||||||
|
* [Tests](test/)
|
||||||
|
* [Reference manual](http://www.clicon.org/doxygen/index.html) (Note: the link may not be up-to-date. It is better to build your own: `cd doc; make doc`)
|
||||||
|
|
||||||
Documentation
|
Background
|
||||||
=============
|
==========
|
||||||
- [Frequently asked questions](doc/FAQ.md)
|
|
||||||
- [CHANGELOG](CHANGELOG.md) recent changes.
|
Clixon was implemented to provide an open-source generic configuration
|
||||||
- [XML datastore](datastore/README.md)
|
tool. The existing [CLIgen](http://www.cligen.se) tool was for command-lines only, whilke clixon is a system with config-db, xml and rest interfaces. Most of the projects using clixon are for embedded network and measuring devices. But Clixon is more generic than that.
|
||||||
- [Netconf support](apps/netconf/README.md)
|
|
||||||
- [Restconf support](apps/restconf/README.md)
|
Users of clixon currently include:
|
||||||
- [Reference manual](http://www.clicon.org/doxygen/index.html) (Note: the link may not be up-to-date. It is better to build your own: `cd doc; make doc`)
|
* [Netgate](https://www.netgate.com)
|
||||||
- [Routing example](example/README.md)
|
* [CloudMon360](http://cloudmon360.com)
|
||||||
- [Clicon and Clixon project page](http://www.clicon.org)
|
* [Grideye](http://hagsand.se/grideye)
|
||||||
- [Tests](test/README.md)
|
* [Netclean](https://www.netclean.com/solutions/whitebox) # only CLIgen
|
||||||
|
* [Prosilient's PTAnalyzer](https://prosilient.com) # only CLIgen
|
||||||
|
|
||||||
|
See also [Clicon project page](http://clicon.org).
|
||||||
|
|
||||||
Installation
|
Installation
|
||||||
============
|
============
|
||||||
|
|
@ -36,13 +49,19 @@ A typical installation is as follows:
|
||||||
```
|
```
|
||||||
|
|
||||||
One [example application](example/README.md) is provided, a IETF IP YANG datamodel with
|
One [example application](example/README.md) is provided, a IETF IP YANG datamodel with
|
||||||
generated CLI and configuration interface.
|
generated CLI, Netconf and restconf interface.
|
||||||
|
|
||||||
|
Licenses
|
||||||
|
========
|
||||||
|
Clixon is open-source and dual licensed. Either Apache License, Version 2.0 or GNU
|
||||||
|
General Public License Version 2; you choose.
|
||||||
|
|
||||||
|
See [LICENSE.md](LICENSE.md) for the license.
|
||||||
|
|
||||||
Dependencies
|
Dependencies
|
||||||
============
|
============
|
||||||
Clixon depends on the following software packages, which need to exist on the target machine.
|
Clixon depends on the following software packages, which need to exist on the target machine.
|
||||||
- [CLIgen](http://www.cligen.se) is required for building Clixon. If you need
|
- [CLIgen](http://www.cligen.se) If you need to build and install CLIgen:
|
||||||
to build and install CLIgen:
|
|
||||||
```
|
```
|
||||||
git clone https://github.com/olofhagsand/cligen.git
|
git clone https://github.com/olofhagsand/cligen.git
|
||||||
cd cligen; configure; make; make install
|
cd cligen; configure; make; make install
|
||||||
|
|
@ -50,53 +69,115 @@ to build and install CLIgen:
|
||||||
- Yacc/bison
|
- Yacc/bison
|
||||||
- Lex/Flex
|
- Lex/Flex
|
||||||
- Fcgi (if restconf is enabled)
|
- Fcgi (if restconf is enabled)
|
||||||
- [Qdbm](http://fallabs.com/qdbm/) key-value store (if keyvalue datastore is enabled)
|
|
||||||
|
|
||||||
There is no yum/apt/ostree package for Clixon (please help?)
|
There is no yum/apt/ostree package for Clixon (please help?)
|
||||||
|
|
||||||
Licenses
|
Support
|
||||||
|
=======
|
||||||
|
Clixon interaction is best done posting issues, pull requests, or joining the
|
||||||
|
[slack channel](https://clixondev.slack.com).
|
||||||
|
[Slack invite](https://join.slack.com/t/clixondev/shared_invite/enQtMzI3OTM4MzA3Nzk3LTA3NWM4OWYwYWMxZDhiYTNhNjRkNjQ1NWI1Zjk5M2JjMDk4MTUzMTljYTZiYmNhODkwMDI2ZTkyNWU3ZWMyN2U).
|
||||||
|
|
||||||
|
Extending
|
||||||
|
=========
|
||||||
|
Clixon provides a core system and can be used as-is using available
|
||||||
|
Yang specifications. However, an application very quickly needs to
|
||||||
|
specialize functions. Clixon is extended by writing
|
||||||
|
plugins for cli and backend. Extensions for netconf and restconf
|
||||||
|
are also available.
|
||||||
|
|
||||||
|
Plugins are written in C and easiest is to look at
|
||||||
|
[example](example/README.md) or consulting the [FAQ](doc/FAQ.md).
|
||||||
|
|
||||||
|
Yang
|
||||||
|
====
|
||||||
|
|
||||||
|
YANG and XML is at the heart of Clixon. Yang modules are used as a
|
||||||
|
specification for handling XML configuration data. The YANG spec is
|
||||||
|
used to generate an interactive CLI, netconf and restconf clients. It
|
||||||
|
also manages an XML datastore.
|
||||||
|
|
||||||
|
Clixon mainly follows [YANG 1.0 RFC 6020](https://www.rfc-editor.org/rfc/rfc6020.txt) with some exceptions:
|
||||||
|
- conformance: feature, if-feature, deviation
|
||||||
|
- identity, base, identityref
|
||||||
|
- list features: min/max-elements, unique
|
||||||
|
|
||||||
|
The aim is also to cover new features in YANG 1.1 [YANG RFC 7950](https://www.rfc-editor.org/rfc/rfc7950.txt)
|
||||||
|
|
||||||
|
Clixon has its own XML library designed for performance.
|
||||||
|
|
||||||
|
Netconf
|
||||||
|
=======
|
||||||
|
Clixon implements the following NETCONF proposals or standards:
|
||||||
|
- [NETCONF Configuration Protocol](http://www.rfc-base.org/txt/rfc-4741.txt)
|
||||||
|
- [Using the NETCONF Configuration Protocol over Secure Shell (SSH)](http://www.rfc-base.org/txt/rfc-4742.txt)
|
||||||
|
- [NETCONF Event Notifications](http://www.rfc-base.org/txt/rfc-5277.txt)
|
||||||
|
|
||||||
|
Some updates are being made to RFC 6241 and RFC 6242.
|
||||||
|
|
||||||
|
Clixon does not yet support the following netconf features:
|
||||||
|
|
||||||
|
- :url capability
|
||||||
|
- copy-config source config
|
||||||
|
- edit-config testopts
|
||||||
|
- edit-config erropts
|
||||||
|
- edit-config config-text
|
||||||
|
|
||||||
|
Restconf
|
||||||
========
|
========
|
||||||
Clixon is dual licensed. Either Apache License, Version 2.0 or GNU
|
Clixon restconf is a daemon based on FASTCGI. Instructions are available to
|
||||||
General Public License Version 2; you choose.
|
run with NGINX.
|
||||||
|
The implementatation is based on [RFC 8040: RESTCONF Protocol](https://tools.ietf.org/html/rfc8040).
|
||||||
|
The following features are supported:
|
||||||
|
- OPTIONS, HEAD, GET, POST, PUT, DELETE
|
||||||
|
The following are not implemented
|
||||||
|
- PATCH
|
||||||
|
- query parameters (section 4.9)
|
||||||
|
- notifications (sec 6)
|
||||||
|
- schema resource
|
||||||
|
|
||||||
See [LICENSE.md](LICENSE.md) for the license.
|
See [more detailed instructions](apps/restconf/README.md).
|
||||||
|
|
||||||
Background
|
Datastore
|
||||||
==========
|
=========
|
||||||
We implemented Clixon since we needed a generic configuration tool in
|
The Clixon datastore is a stand-alone XML based datastore. The idea is
|
||||||
several projects, including
|
to be able to use different datastores backends with the same
|
||||||
[KTH](http://www.csc.kth.se/~olofh/10G_OSR). Most of these projects
|
API.
|
||||||
were for embedded network and measuring-probe devices. We started with
|
|
||||||
something called Clicon which was based on a key-value specification
|
|
||||||
and data-store. But as time passed new standards evolved and we
|
|
||||||
started adapting it to XML, Yang and netconf. Finally we made Clixon,
|
|
||||||
where the legacy key specification has been replaced completely by
|
|
||||||
YANG and using XML as configuration data. This means that legacy
|
|
||||||
Clicon applications do not run on Clixon.
|
|
||||||
|
|
||||||
SDK
|
Update: There used to be a key-value plugin based on qdbm but isnow obsoleted. Only a text datastore is implemented.
|
||||||
===
|
|
||||||
|
|
||||||
<img src="doc/clixon_example_sdk.png" alt="clixon sdk" style="width: 200px;"/>
|
The datastore is primarily designed to be used by Clixon but can be used
|
||||||
|
separately.
|
||||||
|
|
||||||
|
See [more detailed instructions](datastore/README.md).
|
||||||
|
|
||||||
|
Auth
|
||||||
|
====
|
||||||
|
|
||||||
|
Authentication is managed outside Clixon using SSH, SSL, Oauth2, etc.
|
||||||
|
|
||||||
|
For CLI, login is typically made via SSH. For netconf, SSH netconf
|
||||||
|
subsystem can be used.
|
||||||
|
|
||||||
|
Restconf however needs credentials. This is done by writing a credentials callback in a restconf plugin. See:
|
||||||
|
* [FAQ](doc/FAQ.md#how-do-i-write-an-authentication-callback).
|
||||||
|
* [Example](example/README.md) has an example how to do this with HTTP basic auth.
|
||||||
|
* I have done this for another project using Oauth2 or (https://github.com/CESNET/Netopeer2/tree/master/server/configuration)
|
||||||
|
|
||||||
|
The clients send the ID of the user using a "username" attribute with
|
||||||
|
the RPC calls to the backend. Note that the backend trusts the clients
|
||||||
|
so the clients can in principle fake a username.
|
||||||
|
|
||||||
|
There is an ongoing effort to implement authorization for Clixon
|
||||||
|
according to [RFC8341(NACM)](https://tools.ietf.org/html/rfc8341), at
|
||||||
|
least a subset of the functionality. See more information here:
|
||||||
|
[NACM](README_NACM.md).
|
||||||
|
|
||||||
|
|
||||||
|
Runtime
|
||||||
|
=======
|
||||||
|
|
||||||
|
<img src="doc/clixon_example_sdk.png" alt="clixon sdk" style="width: 180px;"/>
|
||||||
|
|
||||||
The figure shows the SDK runtime of Clixon.
|
The figure shows the SDK runtime of Clixon.
|
||||||
|
|
||||||
YANG and XML is at the heart of Clixon. Yang modules are used as a
|
|
||||||
specification for handling XML configuration data. The spec is also
|
|
||||||
used to generate an interactive CLI client as well as provide
|
|
||||||
[Netconf](apps/netconf/README.md) and
|
|
||||||
[Restconf](apps/restconf/README.md) clients.
|
|
||||||
|
|
||||||
The [YANG RFC 6020](https://www.rfc-editor.org/rfc/rfc6020.txt) is implemented with the following exceptions:
|
|
||||||
- conformance: feature, if-feature, deviation
|
|
||||||
- identity, base, identityref
|
|
||||||
- list features: min/max-elements, unique, ordered-by
|
|
||||||
|
|
||||||
There are also new features in YANG 1.1 [YANG RFC
|
|
||||||
7950](https://www.rfc-editor.org/rfc/rfc7950.txt), most of which are
|
|
||||||
not implemented.
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -1,11 +1,12 @@
|
||||||
# README for developers Clixon developers
|
# README for Clixon developers
|
||||||
|
|
||||||
1. How to document the code
|
* [Code documentation](#documentation)
|
||||||
2. How to work in git (branching)
|
* [How to work in git (branching)](#branching)
|
||||||
3. How the meta-configure stuff works
|
* [How the meta-configure stuff works](#meta-configure)
|
||||||
4. How to debug
|
* [How to debug](#debug)
|
||||||
|
|
||||||
## How to document the code
|
## Documentation
|
||||||
|
How to document the code
|
||||||
|
|
||||||
```
|
```
|
||||||
/*! This is a small comment on one line
|
/*! This is a small comment on one line
|
||||||
|
|
@ -26,7 +27,8 @@
|
||||||
*/
|
*/
|
||||||
```
|
```
|
||||||
|
|
||||||
## How to work in git (branching)
|
## Branching
|
||||||
|
How to work in git (branching)
|
||||||
|
|
||||||
Basically follows: http://nvie.com/posts/a-successful-git-branching-model/
|
Basically follows: http://nvie.com/posts/a-successful-git-branching-model/
|
||||||
only somewhat simplified:
|
only somewhat simplified:
|
||||||
|
|
@ -49,11 +51,16 @@ configure.ac --.
|
||||||
Makefile.in ---' `-> Makefile ---'
|
Makefile.in ---' `-> Makefile ---'
|
||||||
```
|
```
|
||||||
|
|
||||||
## How to debug
|
## Debug
|
||||||
|
How to debug
|
||||||
|
|
||||||
|
### Configure in debug mode
|
||||||
|
```
|
||||||
|
CFLAGS="-g -Wall" INSTALLFLAGS="" ./configure
|
||||||
|
```
|
||||||
|
|
||||||
### Make your own simplified yang and configuration file.
|
### Make your own simplified yang and configuration file.
|
||||||
```
|
```
|
||||||
|
|
||||||
cat <<EOF > /tmp/my.yang
|
cat <<EOF > /tmp/my.yang
|
||||||
module mymodule{
|
module mymodule{
|
||||||
container x {
|
container x {
|
||||||
|
|
@ -69,11 +76,11 @@ EOF
|
||||||
cat <<EOF > /tmp/myconf.xml
|
cat <<EOF > /tmp/myconf.xml
|
||||||
<config>
|
<config>
|
||||||
<CLICON_CONFIGFILE>/tmp/myconf.xml</CLICON_CONFIGFILE>
|
<CLICON_CONFIGFILE>/tmp/myconf.xml</CLICON_CONFIGFILE>
|
||||||
<CLICON_YANG_DIR>/usr/local/share/routing/yang</CLICON_YANG_DIR>
|
<CLICON_YANG_DIR>/usr/local/share/example/yang</CLICON_YANG_DIR>
|
||||||
<CLICON_YANG_MODULE_MAIN>example</CLICON_YANG_MODULE_MAIN>
|
<CLICON_YANG_MODULE_MAIN>example</CLICON_YANG_MODULE_MAIN>
|
||||||
<CLICON_SOCK>/usr/local/var/routing/routing.sock</CLICON_SOCK>
|
<CLICON_SOCK>/usr/local/var/example/example.sock</CLICON_SOCK>
|
||||||
<CLICON_BACKEND_PIDFILE>/usr/local/var/routing/routing.pidfile</CLICON_BACKEND_PIDFILE>
|
<CLICON_BACKEND_PIDFILE>/usr/local/var/example/example.pidfile</CLICON_BACKEND_PIDFILE>
|
||||||
<CLICON_XMLDB_DIR>/usr/local/var/routing</CLICON_XMLDB_DIR>
|
<CLICON_XMLDB_DIR>/usr/local/var/example</CLICON_XMLDB_DIR>
|
||||||
<CLICON_XMLDB_PLUGIN>/usr/local/lib/xmldb/text.so</CLICON_XMLDB_PLUGIN>
|
<CLICON_XMLDB_PLUGIN>/usr/local/lib/xmldb/text.so</CLICON_XMLDB_PLUGIN>
|
||||||
</config>
|
</config>
|
||||||
EOF
|
EOF
|
||||||
34
README_NACM.md
Normal file
34
README_NACM.md
Normal file
|
|
@ -0,0 +1,34 @@
|
||||||
|
# NACM
|
||||||
|
|
||||||
|
Clixon includes an experimental NACM implementation according to [RFC8341(NACM)](https://tools.ietf.org/html/rfc8341).
|
||||||
|
|
||||||
|
The support is as follows:
|
||||||
|
|
||||||
|
* There is a yang config variable `CLICON_NACM_MODE` to set whether NACM is disabled, uses internal(embedded) NACM configuration, or external configuration. (See yang/clixon-config.yang)
|
||||||
|
* If the mode is internal, NACM configurations is expected to be in the regular configuration, managed by regular candidate/runing/commit procedures. This mode may have some problems with bootstrapping.
|
||||||
|
* If the mode is `external`, the `CLICON_NACM_FILE` yang config variable contains the name of a separate configuration file containing the NACM configurations. After changes in this file, the backend needs to be restarted.
|
||||||
|
* The [example](example/README.md) contains a http basic auth and a NACM backend callback for mandatory state variables.
|
||||||
|
* There are two [tests](test/README.md) using internal and external NACM config
|
||||||
|
* The backend provides a limited NACM support (when enabled) described below
|
||||||
|
|
||||||
|
NACM functionality
|
||||||
|
==================
|
||||||
|
|
||||||
|
NACM is implemented in the backend and a single access check is made
|
||||||
|
in from_client_msg() when an internal netconf RPC has
|
||||||
|
just been received and decoded. The code is in nacm_access().
|
||||||
|
|
||||||
|
The functionality is as follows:
|
||||||
|
* Notification is not supported
|
||||||
|
* Groups are supported
|
||||||
|
* Rule-lists are supported
|
||||||
|
* Rules are supported as follows
|
||||||
|
* module-name: Only '*' supported
|
||||||
|
* access-operations: only '*' and 'exec' supported
|
||||||
|
* rpc-name: fully supported (eg edit-config/get-config, etc)
|
||||||
|
* action: fully supported (permit/deny)
|
||||||
|
|
||||||
|
The tests outlines an example of three groups (taken from the RFC): admin, limited and guest:
|
||||||
|
* admin: Full access
|
||||||
|
* limited: Read access (get and get-config)
|
||||||
|
* guest: No access
|
||||||
|
|
@ -36,6 +36,7 @@ srcdir = @srcdir@
|
||||||
top_srcdir = @top_srcdir@
|
top_srcdir = @top_srcdir@
|
||||||
CC = @CC@
|
CC = @CC@
|
||||||
CFLAGS = @CFLAGS@
|
CFLAGS = @CFLAGS@
|
||||||
|
INSTALLFLAGS = @INSTALLFLAGS@
|
||||||
LDFLAGS = @LDFLAGS@
|
LDFLAGS = @LDFLAGS@
|
||||||
|
|
||||||
prefix = @prefix@
|
prefix = @prefix@
|
||||||
|
|
@ -55,8 +56,6 @@ CLIXON_MINOR = @CLIXON_VERSION_MINOR@
|
||||||
|
|
||||||
# Use this clixon lib for linking
|
# Use this clixon lib for linking
|
||||||
CLIXON_LIB = libclixon.so.$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
CLIXON_LIB = libclixon.so.$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
||||||
# Location of system plugins
|
|
||||||
CLIXON_BACKEND_SYSDIR = $(libdir)/clixon/plugins/backend
|
|
||||||
|
|
||||||
# For dependency. A little strange that we rely on it being built in the src dir
|
# For dependency. A little strange that we rely on it being built in the src dir
|
||||||
# even though it may exist in $(libdir). But the new version may not have been installed yet.
|
# even though it may exist in $(libdir). But the new version may not have been installed yet.
|
||||||
|
|
@ -66,23 +65,27 @@ LIBS = -L$(top_srcdir)/lib/src @LIBS@ $(top_srcdir)/lib/src/$(CLIXON_LIB) -l
|
||||||
CPPFLAGS = @CPPFLAGS@ -fPIC
|
CPPFLAGS = @CPPFLAGS@ -fPIC
|
||||||
INCLUDES = -I. -I$(top_srcdir)/lib/src -I$(top_srcdir)/lib -I$(top_srcdir)/include -I$(top_srcdir) @INCLUDES@
|
INCLUDES = -I. -I$(top_srcdir)/lib/src -I$(top_srcdir)/lib -I$(top_srcdir)/include -I$(top_srcdir) @INCLUDES@
|
||||||
|
|
||||||
# Not accessible from plugin
|
# Name of application
|
||||||
APPSRC = backend_main.c backend_socket.c backend_client.c \
|
|
||||||
backend_commit.c backend_plugin.c
|
|
||||||
|
|
||||||
APPOBJ = $(APPSRC:.c=.o)
|
|
||||||
APPL = clixon_backend
|
APPL = clixon_backend
|
||||||
|
|
||||||
#SHLIB = clixon_backend
|
# Not accessible from plugin
|
||||||
MYNAME = clixon_backend
|
APPSRC = backend_main.c
|
||||||
MYLIBLINK = lib$(MYNAME)$(SH_SUFFIX)
|
APPSRC += backend_socket.c
|
||||||
MYLIB = $(MYLIBLINK).$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
APPSRC += backend_client.c
|
||||||
MYLIBSO = $(MYLIBLINK).$(CLIXON_MAJOR)
|
APPSRC += backend_commit.c
|
||||||
|
APPSRC += backend_plugin.c
|
||||||
|
APPOBJ = $(APPSRC:.c=.o)
|
||||||
|
|
||||||
# Accessible from plugin
|
# Accessible from plugin
|
||||||
LIBSRC = clixon_backend_transaction.c clixon_backend_handle.c
|
LIBSRC = clixon_backend_transaction.c clixon_backend_handle.c
|
||||||
LIBOBJ = $(LIBSRC:.c=.o)
|
LIBOBJ = $(LIBSRC:.c=.o)
|
||||||
|
|
||||||
|
# Name of lib
|
||||||
|
MYNAME = clixon_backend
|
||||||
|
MYLIBLINK = lib$(MYNAME)$(SH_SUFFIX)
|
||||||
|
MYLIB = $(MYLIBLINK).$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
||||||
|
MYLIBSO = $(MYLIBLINK).$(CLIXON_MAJOR)
|
||||||
|
|
||||||
all: $(MYLIB) $(APPL) test
|
all: $(MYLIB) $(APPL) test
|
||||||
|
|
||||||
clean:
|
clean:
|
||||||
|
|
@ -96,15 +99,15 @@ distclean: clean
|
||||||
# Also create a libexec/ directory for writeable/temporary files.
|
# Also create a libexec/ directory for writeable/temporary files.
|
||||||
# Put config file in etc/
|
# Put config file in etc/
|
||||||
install: install-lib $(APPL)
|
install: install-lib $(APPL)
|
||||||
install -d $(DESTDIR)$(sbindir)
|
install -d -m 0755 $(DESTDIR)$(sbindir)
|
||||||
install $(APPL) $(DESTDIR)$(sbindir)
|
install -m 0755 $(INSTALLFLAGS) $(APPL) $(DESTDIR)$(sbindir)
|
||||||
|
|
||||||
install-lib: $(MYLIB)
|
install-lib: $(MYLIB)
|
||||||
install -d $(DESTDIR)$(libdir)
|
install -d -m 0755 $(DESTDIR)$(libdir)
|
||||||
install $(MYLIB) $(DESTDIR)$(libdir)
|
install -m 0644 $(INSTALLFLAGS) $(MYLIB) $(DESTDIR)$(libdir)
|
||||||
ln -sf $(MYLIB) $(DESTDIR)$(libdir)/$(MYLIBSO) # -l:libclixon_config.so.2
|
ln -sf $(MYLIB) $(DESTDIR)$(libdir)/$(MYLIBSO) # -l:libclixon_config.so.2
|
||||||
ln -sf $(MYLIBSO) $(DESTDIR)$(libdir)/$(MYLIBLINK) # -l:libclixon_config.so
|
ln -sf $(MYLIBSO) $(DESTDIR)$(libdir)/$(MYLIBLINK) # -l:libclixon_config.so
|
||||||
install -d $(DESTDIR)$(libdir)/clixon/plugins/backend
|
install -d -m 0755 $(DESTDIR)$(libdir)/clixon/plugins/backend
|
||||||
|
|
||||||
uninstall:
|
uninstall:
|
||||||
rm -f $(DESTDIR)$(sbindir)/$(APPL)
|
rm -f $(DESTDIR)$(sbindir)/$(APPL)
|
||||||
|
|
@ -112,14 +115,14 @@ uninstall:
|
||||||
rm -f $(DESTDIR)$(includedir)/clixon/*
|
rm -f $(DESTDIR)$(includedir)/clixon/*
|
||||||
|
|
||||||
install-include: clixon_backend.h clixon_backend_handle.h clixon_backend_transaction.h
|
install-include: clixon_backend.h clixon_backend_handle.h clixon_backend_transaction.h
|
||||||
install -d $(DESTDIR)$(includedir)/clixon
|
install -d -m 0755 $(DESTDIR)$(includedir)/clixon
|
||||||
install -m 644 $^ $(DESTDIR)$(includedir)/clixon
|
install -m 0644 $^ $(DESTDIR)$(includedir)/clixon
|
||||||
|
|
||||||
.SUFFIXES:
|
.SUFFIXES:
|
||||||
.SUFFIXES: .c .o
|
.SUFFIXES: .c .o
|
||||||
|
|
||||||
.c.o:
|
.c.o:
|
||||||
$(CC) $(INCLUDES) -D__PROGRAM__=\"$(APPL)\" -DCLIXON_BACKEND_SYSDIR=\"$(CLIXON_BACKEND_SYSDIR)\" $(CPPFLAGS) $(CFLAGS) -c $<
|
$(CC) $(INCLUDES) -D__PROGRAM__=\"$(APPL)\" $(CPPFLAGS) $(CFLAGS) -c $<
|
||||||
|
|
||||||
# Just link test programs
|
# Just link test programs
|
||||||
test.c :
|
test.c :
|
||||||
|
|
@ -129,7 +132,7 @@ test: test.c $(LIBOBJ)
|
||||||
$(CC) $(INCLUDES) $(LDFLAGS) $< $(LIBOBJ) -L. $(MYLIB) $(LIBS) -o $@
|
$(CC) $(INCLUDES) $(LDFLAGS) $< $(LIBOBJ) -L. $(MYLIB) $(LIBS) -o $@
|
||||||
|
|
||||||
$(APPL) : $(APPOBJ) $(MYLIBLINK) $(LIBDEPS)
|
$(APPL) : $(APPOBJ) $(MYLIBLINK) $(LIBDEPS)
|
||||||
$(CC) $(LDFLAGS) $(APPOBJ) $(OBJS) -L. $(MYLIB) $(LIBS) -o $@
|
$(CC) $(LDFLAGS) $(APPOBJ) -L. $(MYLIB) $(LIBS) -o $@
|
||||||
|
|
||||||
$(MYLIB): $(LIBOBJ)
|
$(MYLIB): $(LIBOBJ)
|
||||||
ifeq ($(HOST_VENDOR),apple)
|
ifeq ($(HOST_VENDOR),apple)
|
||||||
|
|
@ -147,7 +150,7 @@ TAGS:
|
||||||
find . -name '*.[chyl]' -print | etags -
|
find . -name '*.[chyl]' -print | etags -
|
||||||
|
|
||||||
depend:
|
depend:
|
||||||
$(CC) $(DEPENDFLAGS) @DEFS@ $(INCLUDES) $(CFLAGS) -MM $(SRC) $(APPSRC) > .depend
|
$(CC) $(DEPENDFLAGS) @DEFS@ $(INCLUDES) $(CFLAGS) -MM $(LIBSRC) $(APPSRC) > .depend
|
||||||
|
|
||||||
#include .depend
|
#include .depend
|
||||||
|
|
||||||
|
|
|
||||||
File diff suppressed because it is too large
Load diff
|
|
@ -239,13 +239,20 @@ candidate_commit(clicon_handle h,
|
||||||
if (plugin_transaction_commit(h, td) < 0)
|
if (plugin_transaction_commit(h, td) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
||||||
/* 8. Success: Copy candidate to running */
|
/* Optionally write (potentially modified) tree back to candidate */
|
||||||
|
if (clicon_option_bool(h, "CLICON_TRANSACTION_MOD"))
|
||||||
|
if (xmldb_put(h, candidate, OP_REPLACE, td->td_target, NULL) < 0)
|
||||||
|
goto done;
|
||||||
|
/* 8. Success: Copy candidate to running
|
||||||
|
*/
|
||||||
|
|
||||||
if (xmldb_copy(h, candidate, "running") < 0)
|
if (xmldb_copy(h, candidate, "running") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
||||||
/* 9. Call plugin transaction end callbacks */
|
/* 9. Call plugin transaction end callbacks */
|
||||||
plugin_transaction_end(h, td);
|
plugin_transaction_end(h, td);
|
||||||
|
|
||||||
|
|
||||||
/* 8. Copy running back to candidate in case end functions updated running */
|
/* 8. Copy running back to candidate in case end functions updated running */
|
||||||
if (xmldb_copy(h, "running", candidate) < 0){
|
if (xmldb_copy(h, "running", candidate) < 0){
|
||||||
/* ignore errors or signal major setback ? */
|
/* ignore errors or signal major setback ? */
|
||||||
|
|
@ -275,35 +282,32 @@ from_client_commit(clicon_handle h,
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
int piddb;
|
int piddb;
|
||||||
|
cbuf *cbx = NULL; /* Assist cbuf */
|
||||||
|
|
||||||
/* Check if target locked by other client */
|
/* Check if target locked by other client */
|
||||||
piddb = xmldb_islocked(h, "running");
|
piddb = xmldb_islocked(h, "running");
|
||||||
if (piddb && mypid != piddb){
|
if (piddb && mypid != piddb){
|
||||||
cprintf(cbret, "<rpc-reply><rpc-error>"
|
if ((cbx = cbuf_new()) == NULL){
|
||||||
"<error-tag>lock-denied</error-tag>"
|
clicon_err(OE_XML, errno, "cbuf_new");
|
||||||
"<error-type>protocol</error-type>"
|
goto done;
|
||||||
"<error-severity>error</error-severity>"
|
}
|
||||||
"<error-message>Operation failed, lock is already held</error-message>"
|
cprintf(cbx, "<session-id>%d</session-id>", piddb);
|
||||||
"<error-info><session-id>%d</session-id></error-info>"
|
if (netconf_lock_denied(cbret, cbuf_get(cbx), "Operation failed, lock is already held") < 0)
|
||||||
"</rpc-error></rpc-reply>",
|
goto done;
|
||||||
piddb);
|
|
||||||
goto ok;
|
goto ok;
|
||||||
}
|
}
|
||||||
if (candidate_commit(h, "candidate") < 0){ /* Assume validation fail, nofatal */
|
if (candidate_commit(h, "candidate") < 0){ /* Assume validation fail, nofatal */
|
||||||
clicon_debug(1, "Commit candidate failed");
|
clicon_debug(1, "Commit candidate failed");
|
||||||
cprintf(cbret, "<rpc-reply><rpc-error>"
|
if (netconf_invalid_value(cbret, "protocol", clicon_err_reason)< 0)
|
||||||
"<error-tag>invalid-value</error-tag>"
|
goto done;
|
||||||
"<error-type>protocol</error-type>"
|
|
||||||
"<error-severity>error</error-severity>"
|
|
||||||
"<error-message>%s</error-message>"
|
|
||||||
"</rpc-error></rpc-reply>",
|
|
||||||
clicon_err_reason);
|
|
||||||
goto ok;
|
goto ok;
|
||||||
}
|
}
|
||||||
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
||||||
ok:
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
// done:
|
done:
|
||||||
|
if (cbx)
|
||||||
|
cbuf_free(cbx);
|
||||||
return retval; /* may be zero if we ignoring errors from commit */
|
return retval; /* may be zero if we ignoring errors from commit */
|
||||||
} /* from_client_commit */
|
} /* from_client_commit */
|
||||||
|
|
||||||
|
|
@ -321,33 +325,31 @@ from_client_discard_changes(clicon_handle h,
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
int piddb;
|
int piddb;
|
||||||
|
cbuf *cbx = NULL; /* Assist cbuf */
|
||||||
|
|
||||||
/* Check if target locked by other client */
|
/* Check if target locked by other client */
|
||||||
piddb = xmldb_islocked(h, "candidate");
|
piddb = xmldb_islocked(h, "candidate");
|
||||||
if (piddb && mypid != piddb){
|
if (piddb && mypid != piddb){
|
||||||
cprintf(cbret, "<rpc-reply><rpc-error>"
|
if ((cbx = cbuf_new()) == NULL){
|
||||||
"<error-tag>lock-denied</error-tag>"
|
clicon_err(OE_XML, errno, "cbuf_new");
|
||||||
"<error-type>protocol</error-type>"
|
goto done;
|
||||||
"<error-severity>error</error-severity>"
|
}
|
||||||
"<error-message>Operation failed, lock is already held</error-message>"
|
cprintf(cbx, "<session-id>%d</session-id>", piddb);
|
||||||
"<error-info><session-id>%d</session-id></error-info>"
|
if (netconf_lock_denied(cbret, cbuf_get(cbx), "Operation failed, lock is already held") < 0)
|
||||||
"</rpc-error></rpc-reply>",
|
goto done;
|
||||||
piddb);
|
|
||||||
goto ok;
|
goto ok;
|
||||||
}
|
}
|
||||||
if (xmldb_copy(h, "running", "candidate") < 0){
|
if (xmldb_copy(h, "running", "candidate") < 0){
|
||||||
cprintf(cbret, "<rpc-reply><rpc-error>"
|
if (netconf_operation_failed(cbret, "application", clicon_err_reason)< 0)
|
||||||
"<error-tag>operation-failed</error-tag>"
|
goto done;
|
||||||
"<error-type>application</error-type>"
|
|
||||||
"<error-severity>error</error-severity>"
|
|
||||||
"<error-info>read-registry</error-info>"
|
|
||||||
"</rpc-error></rpc-reply>");
|
|
||||||
goto ok;
|
goto ok;
|
||||||
}
|
}
|
||||||
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
||||||
ok:
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
// done:
|
done:
|
||||||
|
if (cbx)
|
||||||
|
cbuf_free(cbx);
|
||||||
return retval; /* may be zero if we ignoring errors from commit */
|
return retval; /* may be zero if we ignoring errors from commit */
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
@ -367,11 +369,8 @@ from_client_validate(clicon_handle h,
|
||||||
transaction_data_t *td = NULL;
|
transaction_data_t *td = NULL;
|
||||||
|
|
||||||
if (strcmp(db, "candidate") != 0 && strcmp(db, "tmp") != 0){
|
if (strcmp(db, "candidate") != 0 && strcmp(db, "tmp") != 0){
|
||||||
cprintf(cbret, "<rpc-reply><rpc-error>"
|
if (netconf_invalid_value(cbret, "protocol", "No such database")< 0)
|
||||||
"<error-tag>invalid-value</error-tag>"
|
goto done;
|
||||||
"<error-type>protocol</error-type>"
|
|
||||||
"<error-severity>error</error-severity>"
|
|
||||||
"</rpc-error></rpc-reply>");
|
|
||||||
goto ok;
|
goto ok;
|
||||||
}
|
}
|
||||||
clicon_debug(1, "Validate %s", db);
|
clicon_debug(1, "Validate %s", db);
|
||||||
|
|
@ -383,15 +382,14 @@ from_client_validate(clicon_handle h,
|
||||||
if (validate_common(h, db, td) < 0){
|
if (validate_common(h, db, td) < 0){
|
||||||
clicon_debug(1, "Validate %s failed", db);
|
clicon_debug(1, "Validate %s failed", db);
|
||||||
/* XXX: candidate_validate should have proper error handling */
|
/* XXX: candidate_validate should have proper error handling */
|
||||||
cprintf(cbret, "<rpc-reply><rpc-error>"
|
if (netconf_operation_failed(cbret, "application", clicon_err_reason)< 0)
|
||||||
"<error-tag>missing-attribute</error-tag>"
|
goto done;
|
||||||
"<error-type>protocol</error-type>"
|
|
||||||
"<error-severity>error</error-severity>"
|
|
||||||
"<error-message>%s</error-message>"
|
|
||||||
"</rpc-error></rpc-reply>",
|
|
||||||
clicon_err_reason);
|
|
||||||
goto ok;
|
goto ok;
|
||||||
}
|
}
|
||||||
|
/* Optionally write (potentially modified) tree back to candidate */
|
||||||
|
if (clicon_option_bool(h, "CLICON_TRANSACTION_MOD"))
|
||||||
|
if (xmldb_put(h, "candidate", OP_REPLACE, td->td_target, NULL) < 0)
|
||||||
|
goto done;
|
||||||
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
||||||
ok:
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
|
|
|
||||||
|
|
@ -52,4 +52,8 @@ struct client_entry *backend_client_list(clicon_handle h);
|
||||||
|
|
||||||
int backend_client_delete(clicon_handle h, struct client_entry *ce);
|
int backend_client_delete(clicon_handle h, struct client_entry *ce);
|
||||||
|
|
||||||
|
int backend_nacm_list_set(clicon_handle h, cxobj *xnacm);
|
||||||
|
|
||||||
|
cxobj * backend_nacm_list_get(clicon_handle h);
|
||||||
|
|
||||||
#endif /* _BACKEND_HANDLE_H_ */
|
#endif /* _BACKEND_HANDLE_H_ */
|
||||||
|
|
|
||||||
|
|
@ -86,9 +86,9 @@ backend_terminate(clicon_handle h)
|
||||||
clicon_debug(1, "%s", __FUNCTION__);
|
clicon_debug(1, "%s", __FUNCTION__);
|
||||||
if ((yspec = clicon_dbspec_yang(h)) != NULL)
|
if ((yspec = clicon_dbspec_yang(h)) != NULL)
|
||||||
yspec_free(yspec);
|
yspec_free(yspec);
|
||||||
plugin_finish(h);
|
clixon_plugin_exit(h);
|
||||||
/* Delete all backend plugin RPC callbacks */
|
/* Delete all backend plugin RPC callbacks */
|
||||||
backend_rpc_cb_delete_all();
|
rpc_callback_delete_all();
|
||||||
if (pidfile)
|
if (pidfile)
|
||||||
unlink(pidfile);
|
unlink(pidfile);
|
||||||
if (sockpath)
|
if (sockpath)
|
||||||
|
|
@ -174,8 +174,8 @@ db_merge(clicon_handle h,
|
||||||
/* Get data as xml from db1 */
|
/* Get data as xml from db1 */
|
||||||
if (xmldb_get(h, (char*)db1, NULL, 1, &xt) < 0)
|
if (xmldb_get(h, (char*)db1, NULL, 1, &xt) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Merge xml into db2. WIthout commit */
|
/* Merge xml into db2. Without commit */
|
||||||
if (xmldb_put(h, (char*)db2, OP_MERGE, xt) < 0)
|
if (xmldb_put(h, (char*)db2, OP_MERGE, xt, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
|
@ -254,12 +254,65 @@ plugin_start_useroptions(clicon_handle h,
|
||||||
|
|
||||||
tmp = *(argv-1);
|
tmp = *(argv-1);
|
||||||
*(argv-1) = argv0;
|
*(argv-1) = argv0;
|
||||||
if (plugin_start_argv(h, argc+1, argv-1) < 0)
|
if (clixon_plugin_start(h, argc+1, argv-1) < 0)
|
||||||
return -1;
|
return -1;
|
||||||
*(argv-1) = tmp;
|
*(argv-1) = tmp;
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*! Load external NACM file
|
||||||
|
*/
|
||||||
|
static int
|
||||||
|
nacm_load_external(clicon_handle h)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *filename; /* NACM config file */
|
||||||
|
yang_spec *yspec = NULL;
|
||||||
|
cxobj *xt = NULL;
|
||||||
|
struct stat st;
|
||||||
|
FILE *f = NULL;
|
||||||
|
int fd;
|
||||||
|
|
||||||
|
filename = clicon_option_str(h, "CLICON_NACM_FILE");
|
||||||
|
if (filename == NULL || strlen(filename)==0){
|
||||||
|
clicon_err(OE_UNIX, errno, "CLICON_NACM_FILE not set in NACM external mode");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
if (stat(filename, &st) < 0){
|
||||||
|
clicon_err(OE_UNIX, errno, "%s", filename);
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
if (!S_ISREG(st.st_mode)){
|
||||||
|
clicon_err(OE_UNIX, 0, "%s is not a regular file", filename);
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
if ((f = fopen(filename, "r")) == NULL) {
|
||||||
|
clicon_err(OE_UNIX, errno, "configure file: %s", filename);
|
||||||
|
return -1;
|
||||||
|
}
|
||||||
|
if ((yspec = yspec_new()) == NULL)
|
||||||
|
goto done;
|
||||||
|
if (yang_parse(h, CLIXON_DATADIR, "ietf-netconf-acm", NULL, yspec) < 0)
|
||||||
|
goto done;
|
||||||
|
fd = fileno(f);
|
||||||
|
/* Read configfile */
|
||||||
|
if (xml_parse_file(fd, "</clicon>", yspec, &xt) < 0)
|
||||||
|
goto done;
|
||||||
|
if (xt == NULL){
|
||||||
|
clicon_err(OE_XML, 0, "No xml tree in %s", filename);
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
if (backend_nacm_list_set(h, xt) < 0)
|
||||||
|
goto done;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (yspec) /* The clixon yang-spec is not used after this */
|
||||||
|
yspec_free(yspec);
|
||||||
|
if (f)
|
||||||
|
fclose(f);
|
||||||
|
return retval;
|
||||||
|
}
|
||||||
|
|
||||||
/*! Merge xml in filename into database
|
/*! Merge xml in filename into database
|
||||||
*/
|
*/
|
||||||
static int
|
static int
|
||||||
|
|
@ -283,7 +336,7 @@ load_extraxml(clicon_handle h,
|
||||||
if (xml_rootchild(xt, 0, &xt) < 0)
|
if (xml_rootchild(xt, 0, &xt) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Merge user reset state */
|
/* Merge user reset state */
|
||||||
if (xmldb_put(h, (char*)db, OP_MERGE, xt) < 0)
|
if (xmldb_put(h, (char*)db, OP_MERGE, xt, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
|
@ -306,7 +359,7 @@ startup_mode_none(clicon_handle h)
|
||||||
if (xmldb_copy(h, "running", "candidate") < 0)
|
if (xmldb_copy(h, "running", "candidate") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Load plugins and call plugin_init() */
|
/* Load plugins and call plugin_init() */
|
||||||
if (plugin_initiate(h) != 0)
|
if (backend_plugin_initiate(h) != 0)
|
||||||
goto done;
|
goto done;
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
|
@ -328,7 +381,7 @@ startup_mode_init(clicon_handle h)
|
||||||
if (xmldb_copy(h, "running", "candidate") < 0)
|
if (xmldb_copy(h, "running", "candidate") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Load plugins and call plugin_init() */
|
/* Load plugins and call plugin_init() */
|
||||||
if (plugin_initiate(h) != 0)
|
if (backend_plugin_initiate(h) != 0)
|
||||||
goto done;
|
goto done;
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
|
@ -364,13 +417,13 @@ startup_mode_running(clicon_handle h,
|
||||||
if (xmldb_copy(h, "running", "candidate") < 0)
|
if (xmldb_copy(h, "running", "candidate") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Load plugins and call plugin_init() */
|
/* Load plugins and call plugin_init() */
|
||||||
if (plugin_initiate(h) != 0)
|
if (backend_plugin_initiate(h) != 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Clear tmp db */
|
/* Clear tmp db */
|
||||||
if (db_reset(h, "tmp") < 0)
|
if (db_reset(h, "tmp") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Application may define extra xml in its reset function*/
|
/* Application may define extra xml in its reset function*/
|
||||||
if (plugin_reset_state(h, "tmp") < 0)
|
if (clixon_plugin_reset(h, "tmp") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Get application extra xml from file */
|
/* Get application extra xml from file */
|
||||||
if (load_extraxml(h, extraxml_file, "tmp") < 0)
|
if (load_extraxml(h, extraxml_file, "tmp") < 0)
|
||||||
|
|
@ -437,13 +490,13 @@ startup_mode_startup(clicon_handle h,
|
||||||
if (xmldb_create(h, "startup") < 0) /* diff */
|
if (xmldb_create(h, "startup") < 0) /* diff */
|
||||||
return -1;
|
return -1;
|
||||||
/* Load plugins and call plugin_init() */
|
/* Load plugins and call plugin_init() */
|
||||||
if (plugin_initiate(h) != 0)
|
if (backend_plugin_initiate(h) != 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Clear tmp db */
|
/* Clear tmp db */
|
||||||
if (db_reset(h, "tmp") < 0)
|
if (db_reset(h, "tmp") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Application may define extra xml in its reset function*/
|
/* Application may define extra xml in its reset function*/
|
||||||
if (plugin_reset_state(h, "tmp") < 0)
|
if (clixon_plugin_reset(h, "tmp") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Get application extra xml from file */
|
/* Get application extra xml from file */
|
||||||
if (load_extraxml(h, extraxml_file, "tmp") < 0)
|
if (load_extraxml(h, extraxml_file, "tmp") < 0)
|
||||||
|
|
@ -475,7 +528,8 @@ startup_mode_startup(clicon_handle h,
|
||||||
}
|
}
|
||||||
|
|
||||||
int
|
int
|
||||||
main(int argc, char **argv)
|
main(int argc,
|
||||||
|
char **argv)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
char c;
|
char c;
|
||||||
|
|
@ -497,14 +551,13 @@ main(int argc, char **argv)
|
||||||
int xml_cache;
|
int xml_cache;
|
||||||
int xml_pretty;
|
int xml_pretty;
|
||||||
char *xml_format;
|
char *xml_format;
|
||||||
|
char *nacm_mode;
|
||||||
|
|
||||||
/* In the startup, logs to stderr & syslog and debug flag set later */
|
/* In the startup, logs to stderr & syslog and debug flag set later */
|
||||||
clicon_log_init(__PROGRAM__, LOG_INFO, CLICON_LOG_STDERR|CLICON_LOG_SYSLOG);
|
clicon_log_init(__PROGRAM__, LOG_INFO, CLICON_LOG_STDERR|CLICON_LOG_SYSLOG);
|
||||||
/* Initiate CLICON handle */
|
/* Initiate CLICON handle */
|
||||||
if ((h = backend_handle_init()) == NULL)
|
if ((h = backend_handle_init()) == NULL)
|
||||||
return -1;
|
return -1;
|
||||||
if (backend_plugin_init(h) != 0)
|
|
||||||
return -1;
|
|
||||||
foreground = 0;
|
foreground = 0;
|
||||||
once = 0;
|
once = 0;
|
||||||
zap = 0;
|
zap = 0;
|
||||||
|
|
@ -552,6 +605,11 @@ main(int argc, char **argv)
|
||||||
usage(argv[0], h);
|
usage(argv[0], h);
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
|
/* External NACM file? */
|
||||||
|
nacm_mode = clicon_option_str(h, "CLICON_NACM_MODE");
|
||||||
|
if (nacm_mode && strcmp(nacm_mode, "external") == 0)
|
||||||
|
if (nacm_load_external(h) < 0)
|
||||||
|
goto done;
|
||||||
|
|
||||||
/* Now run through the operational args */
|
/* Now run through the operational args */
|
||||||
opterr = 1;
|
opterr = 1;
|
||||||
|
|
@ -703,13 +761,12 @@ main(int argc, char **argv)
|
||||||
if ((xml_pretty = clicon_option_bool(h, "CLICON_XMLDB_PRETTY")) >= 0)
|
if ((xml_pretty = clicon_option_bool(h, "CLICON_XMLDB_PRETTY")) >= 0)
|
||||||
if (xmldb_setopt(h, "pretty", (void*)(intptr_t)xml_pretty) < 0)
|
if (xmldb_setopt(h, "pretty", (void*)(intptr_t)xml_pretty) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* If startup mode is not defined, eg via OPTION or -s, assume old method */
|
/* Startup mode needs to be defined, */
|
||||||
startup_mode = clicon_startup_mode(h);
|
startup_mode = clicon_startup_mode(h);
|
||||||
if (startup_mode == -1){
|
if (startup_mode == -1){
|
||||||
clicon_log(LOG_ERR, "Startup mode undefined. Specify option CLICON_STARTUP_MODE or specify -s option to clicon_backend.\n");
|
clicon_log(LOG_ERR, "Startup mode undefined. Specify option CLICON_STARTUP_MODE or specify -s option to clicon_backend.\n");
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
else {
|
|
||||||
/* Init running db if it is not there
|
/* Init running db if it is not there
|
||||||
*/
|
*/
|
||||||
if (xmldb_exists(h, "running") != 1)
|
if (xmldb_exists(h, "running") != 1)
|
||||||
|
|
@ -736,10 +793,9 @@ main(int argc, char **argv)
|
||||||
/* Initiate the shared candidate. */
|
/* Initiate the shared candidate. */
|
||||||
if (xmldb_copy(h, "running", "candidate") < 0)
|
if (xmldb_copy(h, "running", "candidate") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Call plugin_start with user -- options */
|
/* Call backend plugin_start with user -- options */
|
||||||
if (plugin_start_useroptions(h, argv0, argc, argv) <0)
|
if (plugin_start_useroptions(h, argv0, argc, argv) <0)
|
||||||
goto done;
|
goto done;
|
||||||
}
|
|
||||||
if (once)
|
if (once)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -64,402 +64,137 @@
|
||||||
#include "backend_plugin.h"
|
#include "backend_plugin.h"
|
||||||
#include "backend_commit.h"
|
#include "backend_commit.h"
|
||||||
|
|
||||||
/*
|
|
||||||
* Types
|
|
||||||
*/
|
|
||||||
/* Following are specific to backend. For common see clicon_plugin.h
|
|
||||||
* @note the following should match the prototypes in clixon_backend.h
|
|
||||||
*/
|
|
||||||
#define PLUGIN_RESET "plugin_reset"
|
|
||||||
typedef int (plgreset_t)(clicon_handle h, const char *db); /* Reset system status */
|
|
||||||
|
|
||||||
/*! Plugin callback, if defined called to get state data from plugin
|
|
||||||
* @param[in] h Clicon handle
|
|
||||||
* @param[in] xpath String with XPATH syntax. or NULL for all
|
|
||||||
* @param[in] xtop XML tree, <config/> on entry.
|
|
||||||
* @retval 0 OK
|
|
||||||
* @retval -1 Error
|
|
||||||
* @see xmldb_get
|
|
||||||
*/
|
|
||||||
#define PLUGIN_STATEDATA "plugin_statedata"
|
|
||||||
typedef int (plgstatedata_t)(clicon_handle h, char *xpath, cxobj *xtop);
|
|
||||||
|
|
||||||
#define PLUGIN_TRANS_BEGIN "transaction_begin"
|
|
||||||
#define PLUGIN_TRANS_VALIDATE "transaction_validate"
|
|
||||||
#define PLUGIN_TRANS_COMPLETE "transaction_complete"
|
|
||||||
#define PLUGIN_TRANS_COMMIT "transaction_commit"
|
|
||||||
#define PLUGIN_TRANS_END "transaction_end"
|
|
||||||
#define PLUGIN_TRANS_ABORT "transaction_abort"
|
|
||||||
|
|
||||||
|
|
||||||
typedef int (trans_cb_t)(clicon_handle h, transaction_data td); /* Transaction cbs */
|
|
||||||
|
|
||||||
/* Backend (config) plugins */
|
|
||||||
struct plugin {
|
|
||||||
char p_name[PATH_MAX]; /* Plugin name */
|
|
||||||
void *p_handle; /* Dynamic object handle */
|
|
||||||
plginit_t *p_init; /* Init */
|
|
||||||
plgstart_t *p_start; /* Start */
|
|
||||||
plgexit_t *p_exit; /* Exit */
|
|
||||||
plgreset_t *p_reset; /* Reset state */
|
|
||||||
plgstatedata_t *p_statedata; /* State-data callback */
|
|
||||||
trans_cb_t *p_trans_begin; /* Transaction start */
|
|
||||||
trans_cb_t *p_trans_validate; /* Transaction validation */
|
|
||||||
trans_cb_t *p_trans_complete; /* Transaction validation complete */
|
|
||||||
trans_cb_t *p_trans_commit; /* Transaction commit */
|
|
||||||
trans_cb_t *p_trans_end; /* Transaction completed */
|
|
||||||
trans_cb_t *p_trans_abort; /* Transaction aborted */
|
|
||||||
|
|
||||||
};
|
|
||||||
|
|
||||||
/*
|
|
||||||
* Local variables
|
|
||||||
*/
|
|
||||||
static int _nplugins = 0;
|
|
||||||
static struct plugin *_plugins = NULL;
|
|
||||||
|
|
||||||
/*! Find a plugin by name and return the dlsym handl
|
|
||||||
* Used by libclicon code to find callback funcctions in plugins.
|
|
||||||
* @param[in] h Clicon handle
|
|
||||||
* @param[in] h Name of plugin
|
|
||||||
* @retval handle Plugin handle if found
|
|
||||||
* @retval NULL Not found
|
|
||||||
*/
|
|
||||||
static void *
|
|
||||||
config_find_plugin(clicon_handle h,
|
|
||||||
char *name)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
struct plugin *p;
|
|
||||||
|
|
||||||
for (i = 0; i < _nplugins; i++){
|
|
||||||
p = &_plugins[i];
|
|
||||||
if (strcmp(p->p_name, name) == 0)
|
|
||||||
return p->p_handle;
|
|
||||||
}
|
|
||||||
return NULL;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Initialize plugin code (not the plugins themselves)
|
|
||||||
* @param[in] h Clicon handle
|
|
||||||
* @retval 0 OK
|
|
||||||
* @retval -1 Error
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
backend_plugin_init(clicon_handle h)
|
|
||||||
{
|
|
||||||
find_plugin_t *fp = config_find_plugin;
|
|
||||||
clicon_hash_t *data = clicon_data(h);
|
|
||||||
|
|
||||||
/* Register CLICON_FIND_PLUGIN in data hash */
|
|
||||||
if (hash_add(data, "CLICON_FIND_PLUGIN", &fp, sizeof(fp)) == NULL) {
|
|
||||||
clicon_err(OE_UNIX, errno, "failed to register CLICON_FIND_PLUGIN");
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Unload a plugin
|
|
||||||
* @param[in] h Clicon handle
|
|
||||||
* @param[in] plg Plugin structure
|
|
||||||
* @retval 0 OK
|
|
||||||
* @retval -1 Error
|
|
||||||
*/
|
|
||||||
static int
|
|
||||||
backend_plugin_unload(clicon_handle h,
|
|
||||||
struct plugin *plg)
|
|
||||||
{
|
|
||||||
int retval=-1;
|
|
||||||
char *error;
|
|
||||||
|
|
||||||
/* Call exit function is it exists */
|
|
||||||
if (plg->p_exit)
|
|
||||||
plg->p_exit(h);
|
|
||||||
|
|
||||||
dlerror(); /* Clear any existing error */
|
|
||||||
if (dlclose(plg->p_handle) != 0) {
|
|
||||||
error = (char*)dlerror();
|
|
||||||
clicon_err(OE_UNIX, 0, "dlclose: %s", error?error:"Unknown error");
|
|
||||||
goto done;
|
|
||||||
/* Just report */
|
|
||||||
}
|
|
||||||
else
|
|
||||||
clicon_debug(1, "Plugin '%s' unloaded.", plg->p_name);
|
|
||||||
retval = 0;
|
|
||||||
done:
|
|
||||||
return retval;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/*! Load a dynamic plugin and call its init-function
|
|
||||||
* @param[in] h Clicon handle
|
|
||||||
* @param[in] file The plugin (.so) to load
|
|
||||||
* @param[in] dlflags Arguments to dlopen(3)
|
|
||||||
* @retval plugin Plugin struct
|
|
||||||
* @retval NULL Error
|
|
||||||
*/
|
|
||||||
static struct plugin *
|
|
||||||
backend_plugin_load (clicon_handle h,
|
|
||||||
char *file,
|
|
||||||
int dlflags)
|
|
||||||
{
|
|
||||||
void *handle;
|
|
||||||
char *name;
|
|
||||||
struct plugin *new = NULL;
|
|
||||||
|
|
||||||
if ((handle = plugin_load(h, file, dlflags)) == NULL)
|
|
||||||
goto done;
|
|
||||||
if ((new = malloc(sizeof(*new))) == NULL) {
|
|
||||||
clicon_err(OE_UNIX, errno, "dhunk: %s", strerror(errno));
|
|
||||||
dlclose(handle);
|
|
||||||
return NULL;
|
|
||||||
}
|
|
||||||
memset(new, 0, sizeof(*new));
|
|
||||||
name = strrchr(file, '/') ? strrchr(file, '/')+1 : file;
|
|
||||||
clicon_debug(2, "Loading plugin '%s'.", name);
|
|
||||||
snprintf(new->p_name, sizeof(new->p_name), "%*s",
|
|
||||||
(int)strlen(name)-2, name);
|
|
||||||
new->p_handle = handle;
|
|
||||||
if ((new->p_start = dlsym(handle, PLUGIN_START)) != NULL)
|
|
||||||
clicon_debug(2, "%s callback registered.", PLUGIN_START);
|
|
||||||
if ((new->p_exit = dlsym(handle, PLUGIN_EXIT)) != NULL)
|
|
||||||
clicon_debug(2, "%s callback registered.", PLUGIN_EXIT);
|
|
||||||
if ((new->p_reset = dlsym(handle, PLUGIN_RESET)) != NULL)
|
|
||||||
clicon_debug(2, "%s callback registered.", PLUGIN_RESET);
|
|
||||||
if ((new->p_statedata = dlsym(handle, PLUGIN_STATEDATA)) != NULL)
|
|
||||||
clicon_debug(2, "%s callback registered.", PLUGIN_STATEDATA);
|
|
||||||
if ((new->p_trans_begin = dlsym(handle, PLUGIN_TRANS_BEGIN)) != NULL)
|
|
||||||
clicon_debug(2, "%s callback registered.", PLUGIN_TRANS_BEGIN);
|
|
||||||
if ((new->p_trans_validate = dlsym(handle, PLUGIN_TRANS_VALIDATE)) != NULL)
|
|
||||||
clicon_debug(2, "%s callback registered.", PLUGIN_TRANS_VALIDATE);
|
|
||||||
if ((new->p_trans_complete = dlsym(handle, PLUGIN_TRANS_COMPLETE)) != NULL)
|
|
||||||
clicon_debug(2, "%s callback registered.", PLUGIN_TRANS_COMPLETE);
|
|
||||||
if ((new->p_trans_commit = dlsym(handle, PLUGIN_TRANS_COMMIT)) != NULL)
|
|
||||||
clicon_debug(2, "%s callback registered.", PLUGIN_TRANS_COMMIT);
|
|
||||||
if ((new->p_trans_end = dlsym(handle, PLUGIN_TRANS_END)) != NULL)
|
|
||||||
clicon_debug(2, "%s callback registered.", PLUGIN_TRANS_END);
|
|
||||||
if ((new->p_trans_abort = dlsym(handle, PLUGIN_TRANS_ABORT)) != NULL)
|
|
||||||
clicon_debug(2, "%s callback registered.", PLUGIN_TRANS_ABORT);
|
|
||||||
clicon_debug(2, "Plugin '%s' loaded.\n", name);
|
|
||||||
done:
|
|
||||||
return new;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Request plugins to reset system state
|
|
||||||
* The system 'state' should be the same as the contents of running_db
|
|
||||||
* @param[in] h Clicon handle
|
|
||||||
* @param[in] dbname Name of database
|
|
||||||
* @retval 0 OK
|
|
||||||
* @retval -1 Error
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
plugin_reset_state(clicon_handle h,
|
|
||||||
const char *db)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
struct plugin *p;
|
|
||||||
|
|
||||||
for (i = 0; i < _nplugins; i++) {
|
|
||||||
p = &_plugins[i];
|
|
||||||
if (p->p_reset) {
|
|
||||||
clicon_debug(1, "Calling plugin_reset() for %s\n",
|
|
||||||
p->p_name);
|
|
||||||
if (((p->p_reset)(h, db)) < 0) {
|
|
||||||
clicon_err(OE_FATAL, 0, "plugin_reset() failed for %s\n",
|
|
||||||
p->p_name);
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Call plugin_start in all plugins
|
|
||||||
* @param[in] h Clicon handle
|
|
||||||
* @param[in] argc Command-line arguments
|
|
||||||
* @param[in] argv Command-line arguments
|
|
||||||
* @retval 0 OK
|
|
||||||
* @retval -1 Error
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
plugin_start_argv(clicon_handle h,
|
|
||||||
int argc,
|
|
||||||
char **argv)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
struct plugin *p;
|
|
||||||
|
|
||||||
for (i = 0; i < _nplugins; i++) {
|
|
||||||
p = &_plugins[i];
|
|
||||||
if (p->p_start) {
|
|
||||||
optind = 0;
|
|
||||||
if (((p->p_start)(h, argc, argv)) < 0) {
|
|
||||||
clicon_err(OE_FATAL, 0, "plugin_start() failed for %s\n",
|
|
||||||
p->p_name);
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Append plugin to list
|
|
||||||
* @param[in] p Plugin
|
|
||||||
* @retval 0 OK
|
|
||||||
* @retval -1 Error
|
|
||||||
*/
|
|
||||||
static int
|
|
||||||
plugin_append(struct plugin *p)
|
|
||||||
{
|
|
||||||
struct plugin *new;
|
|
||||||
|
|
||||||
if ((new = realloc(_plugins, (_nplugins+1) * sizeof (*p))) == NULL) {
|
|
||||||
clicon_err(OE_UNIX, errno, "realloc");
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
|
|
||||||
memset (&new[_nplugins], 0, sizeof(new[_nplugins]));
|
|
||||||
memcpy (&new[_nplugins], p, sizeof(new[_nplugins]));
|
|
||||||
_plugins = new;
|
|
||||||
_nplugins++;
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Load backend plugins found in a directory
|
|
||||||
* The plugins must have the '.so' suffix
|
|
||||||
* @param[in] h Clicon handle
|
|
||||||
* @param[in] dir Backend plugin directory
|
|
||||||
* @retval 0 OK
|
|
||||||
* @retval -1 Error
|
|
||||||
*/
|
|
||||||
static int
|
|
||||||
backend_plugin_load_dir(clicon_handle h,
|
|
||||||
const char *dir)
|
|
||||||
{
|
|
||||||
int retval = -1;
|
|
||||||
int i;
|
|
||||||
int np = 0;
|
|
||||||
int ndp;
|
|
||||||
struct stat st;
|
|
||||||
char filename[MAXPATHLEN];
|
|
||||||
struct dirent *dp = NULL;
|
|
||||||
struct plugin *new;
|
|
||||||
struct plugin *p = NULL;
|
|
||||||
char master[MAXPATHLEN];
|
|
||||||
char *master_plugin;
|
|
||||||
|
|
||||||
/* Format master plugin path */
|
|
||||||
if ((master_plugin = clicon_master_plugin(h)) == NULL){
|
|
||||||
clicon_err(OE_PLUGIN, 0, "clicon_master_plugin option not set");
|
|
||||||
goto quit;
|
|
||||||
}
|
|
||||||
snprintf(master, MAXPATHLEN-1, "%s.so", master_plugin);
|
|
||||||
|
|
||||||
/* Allocate plugin group object */
|
|
||||||
/* Get plugin objects names from plugin directory */
|
|
||||||
if((ndp = clicon_file_dirent(dir, &dp, "(.so)$", S_IFREG))<0)
|
|
||||||
goto quit;
|
|
||||||
|
|
||||||
/* reset num plugins */
|
|
||||||
np = 0;
|
|
||||||
|
|
||||||
/* Master plugin must be loaded first if it exists. */
|
|
||||||
snprintf(filename, MAXPATHLEN-1, "%s/%s", dir, master);
|
|
||||||
if (stat(filename, &st) == 0) {
|
|
||||||
clicon_debug(1, "Loading master plugin '%.*s' ...",
|
|
||||||
(int)strlen(filename), filename);
|
|
||||||
|
|
||||||
new = backend_plugin_load(h, filename, RTLD_NOW|RTLD_GLOBAL);
|
|
||||||
if (new == NULL)
|
|
||||||
goto quit;
|
|
||||||
if (plugin_append(new) < 0)
|
|
||||||
goto quit;
|
|
||||||
free(new);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Now load the rest. Note plugins is the global variable */
|
|
||||||
for (i = 0; i < ndp; i++) {
|
|
||||||
if (strcmp(dp[i].d_name, master) == 0)
|
|
||||||
continue; /* Skip master now */
|
|
||||||
snprintf(filename, MAXPATHLEN-1, "%s/%s", dir, dp[i].d_name);
|
|
||||||
clicon_debug(1, "Loading plugin '%.*s' ...", (int)strlen(filename), filename);
|
|
||||||
new = backend_plugin_load(h, filename, RTLD_NOW);
|
|
||||||
if (new == NULL)
|
|
||||||
goto quit;
|
|
||||||
/* Append to 'plugins' */
|
|
||||||
if (plugin_append(new) < 0)
|
|
||||||
goto quit;
|
|
||||||
free(new);
|
|
||||||
}
|
|
||||||
|
|
||||||
/* All good. */
|
|
||||||
retval = 0;
|
|
||||||
|
|
||||||
quit:
|
|
||||||
if (retval != 0) {
|
|
||||||
/* XXX p is always NULL */
|
|
||||||
if (_plugins) {
|
|
||||||
while (--np >= 0){
|
|
||||||
if ((p = &_plugins[np]) == NULL)
|
|
||||||
continue;
|
|
||||||
backend_plugin_unload(h, p);
|
|
||||||
free(p);
|
|
||||||
}
|
|
||||||
free(_plugins);
|
|
||||||
_plugins=0;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
if (dp)
|
|
||||||
free(dp);
|
|
||||||
return retval;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/*! Load a plugin group.
|
/*! Load a plugin group.
|
||||||
* @param[in] h Clicon handle
|
* @param[in] h Clicon handle
|
||||||
* @retval 0 OK
|
* @retval 0 OK
|
||||||
* @retval -1 Error
|
* @retval -1 Error
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
plugin_initiate(clicon_handle h)
|
backend_plugin_initiate(clicon_handle h)
|
||||||
{
|
{
|
||||||
char *dir;
|
char *dir;
|
||||||
|
|
||||||
/* First load CLICON system plugins */
|
/* Load application plugins */
|
||||||
if (backend_plugin_load_dir(h, CLIXON_BACKEND_SYSDIR) < 0)
|
if ((dir = clicon_backend_dir(h)) == NULL)
|
||||||
return -1;
|
|
||||||
|
|
||||||
/* Then load application plugins */
|
|
||||||
dir = clicon_backend_dir(h);
|
|
||||||
/* If backend directory, load the backend plugisn */
|
|
||||||
if (dir && backend_plugin_load_dir(h, dir) < 0)
|
|
||||||
return -1;
|
|
||||||
|
|
||||||
return 0;
|
return 0;
|
||||||
|
return clixon_plugins_load(h, CLIXON_PLUGIN_INIT, dir,
|
||||||
|
clicon_option_str(h, "CLICON_BACKEND_REGEXP"));
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Unload and deallocate all backend plugins
|
/*! Request plugins to reset system state
|
||||||
|
* The system 'state' should be the same as the contents of running_db
|
||||||
* @param[in] h Clicon handle
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] db Name of database
|
||||||
* @retval 0 OK
|
* @retval 0 OK
|
||||||
* @retval -1 Error
|
* @retval -1 Error
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
plugin_finish(clicon_handle h)
|
clixon_plugin_reset(clicon_handle h,
|
||||||
|
char *db)
|
||||||
{
|
{
|
||||||
int i;
|
clixon_plugin *cp = NULL;
|
||||||
struct plugin *p;
|
plgreset_t *resetfn; /* Plugin auth */
|
||||||
|
int retval = 1;
|
||||||
|
|
||||||
for (i = 0; i < _nplugins; i++) {
|
while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
p = &_plugins[i];
|
if ((resetfn = cp->cp_api.ca_reset) == NULL)
|
||||||
backend_plugin_unload(h, p);
|
continue;
|
||||||
|
if ((retval = resetfn(h, db)) < 0) {
|
||||||
|
clicon_debug(1, "plugin_start() failed\n");
|
||||||
|
return -1;
|
||||||
}
|
}
|
||||||
if (_plugins){
|
break;
|
||||||
free(_plugins);
|
|
||||||
_plugins = NULL;
|
|
||||||
}
|
}
|
||||||
_nplugins = 0;
|
return retval;
|
||||||
return 0;
|
}
|
||||||
|
|
||||||
|
/*! Go through all backend statedata callbacks and collect state data
|
||||||
|
* This is internal system call, plugin is invoked (does not call) this function
|
||||||
|
* Backend plugins can register
|
||||||
|
* @param[in] h clicon handle
|
||||||
|
* @param[in] xpath String with XPATH syntax. or NULL for all
|
||||||
|
* @param[in,out] xtop State XML tree is merged with existing tree.
|
||||||
|
* @retval -1 Error
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval 1 Statedata callback failed
|
||||||
|
* @note xtop can be replaced
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
clixon_plugin_statedata(clicon_handle h,
|
||||||
|
char *xpath,
|
||||||
|
cxobj **xtop)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
int i;
|
||||||
|
cxobj *x = NULL;
|
||||||
|
yang_spec *yspec;
|
||||||
|
cxobj **xvec = NULL;
|
||||||
|
size_t xlen;
|
||||||
|
cxobj *xc;
|
||||||
|
clixon_plugin *cp = NULL;
|
||||||
|
plgstatedata_t *fn; /* Plugin statedata fn */
|
||||||
|
char *reason = NULL;
|
||||||
|
|
||||||
|
if ((yspec = clicon_dbspec_yang(h)) == NULL){
|
||||||
|
clicon_err(OE_YANG, ENOENT, "No yang spec");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
if (*xtop==NULL){
|
||||||
|
clicon_err(OE_CFG, ENOENT, "XML tree expected");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
|
if ((fn = cp->cp_api.ca_statedata) == NULL)
|
||||||
|
continue;
|
||||||
|
if ((x = xml_new("config", NULL, NULL)) == NULL)
|
||||||
|
goto done;
|
||||||
|
if (fn(h, xpath, x) < 0){
|
||||||
|
retval = 1;
|
||||||
|
goto done; /* Dont quit here on user callbacks */
|
||||||
|
}
|
||||||
|
if (xml_merge(*xtop, x, yspec, &reason) < 0)
|
||||||
|
goto done;
|
||||||
|
if (reason){
|
||||||
|
while ((xc = xml_child_i(*xtop, 0)) != NULL)
|
||||||
|
xml_purge(xc);
|
||||||
|
if (netconf_operation_failed_xml(xtop, "rpc", reason)< 0)
|
||||||
|
goto done;
|
||||||
|
goto ok;
|
||||||
|
}
|
||||||
|
if (x){
|
||||||
|
xml_free(x);
|
||||||
|
x = NULL;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
/* Code complex to filter out anything that is outside of xpath */
|
||||||
|
if (xpath_vec(*xtop, xpath?xpath:"/", &xvec, &xlen) < 0)
|
||||||
|
goto done;
|
||||||
|
|
||||||
|
/* If vectors are specified then mark the nodes found and
|
||||||
|
* then filter out everything else,
|
||||||
|
* otherwise return complete tree.
|
||||||
|
*/
|
||||||
|
if (xvec != NULL){
|
||||||
|
for (i=0; i<xlen; i++)
|
||||||
|
xml_flag_set(xvec[i], XML_FLAG_MARK);
|
||||||
|
}
|
||||||
|
/* Remove everything that is not marked */
|
||||||
|
if (!xml_flag(*xtop, XML_FLAG_MARK))
|
||||||
|
if (xml_tree_prune_flagged_sub(*xtop, XML_FLAG_MARK, 1, NULL) < 0)
|
||||||
|
goto done;
|
||||||
|
/* reset flag */
|
||||||
|
if (xml_apply(*xtop, CX_ELMNT, (xml_applyfn_t*)xml_flag_reset, (void*)XML_FLAG_MARK) < 0)
|
||||||
|
goto done;
|
||||||
|
ok:
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (reason)
|
||||||
|
free(reason);
|
||||||
|
if (x)
|
||||||
|
xml_free(x);
|
||||||
|
if (xvec)
|
||||||
|
free(xvec);
|
||||||
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Create and initialize transaction */
|
/*! Create and initialize transaction */
|
||||||
|
|
@ -510,21 +245,20 @@ int
|
||||||
plugin_transaction_begin(clicon_handle h,
|
plugin_transaction_begin(clicon_handle h,
|
||||||
transaction_data_t *td)
|
transaction_data_t *td)
|
||||||
{
|
{
|
||||||
int i;
|
|
||||||
int retval = 0;
|
int retval = 0;
|
||||||
struct plugin *p;
|
clixon_plugin *cp = NULL;
|
||||||
|
trans_cb_t *fn;
|
||||||
|
|
||||||
for (i = 0; i < _nplugins; i++) {
|
while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
p = &_plugins[i];
|
if ((fn = cp->cp_api.ca_trans_begin) == NULL)
|
||||||
if (p->p_trans_begin)
|
continue;
|
||||||
if ((retval = (p->p_trans_begin)(h, (transaction_data)td)) < 0){
|
if ((retval = fn(h, (transaction_data)td)) < 0){
|
||||||
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
||||||
clicon_log(LOG_NOTICE, "%s: Plugin '%s' %s callback does not make clicon_err call on error",
|
clicon_log(LOG_NOTICE, "%s: Plugin '%s' transaction_begin callback does not make clicon_err call on error",
|
||||||
__FUNCTION__, p->p_name, PLUGIN_TRANS_BEGIN);
|
__FUNCTION__, cp->cp_name);
|
||||||
|
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
@ -540,18 +274,16 @@ plugin_transaction_validate(clicon_handle h,
|
||||||
transaction_data_t *td)
|
transaction_data_t *td)
|
||||||
{
|
{
|
||||||
int retval = 0;
|
int retval = 0;
|
||||||
int i;
|
clixon_plugin *cp = NULL;
|
||||||
|
trans_cb_t *fn;
|
||||||
|
|
||||||
struct plugin *p;
|
while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
|
if ((fn = cp->cp_api.ca_trans_validate) == NULL)
|
||||||
for (i = 0; i < _nplugins; i++){
|
continue;
|
||||||
p = &_plugins[i];
|
if ((retval = fn(h, (transaction_data)td)) < 0){
|
||||||
if (p->p_trans_validate)
|
|
||||||
if ((retval = (p->p_trans_validate)(h, (transaction_data)td)) < 0){
|
|
||||||
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
||||||
clicon_log(LOG_NOTICE, "%s: Plugin '%s' %s callback does not make clicon_err call on error",
|
clicon_log(LOG_NOTICE, "%s: Plugin '%s' transaction_validate callback does not make clicon_err call on error",
|
||||||
__FUNCTION__, p->p_name, PLUGIN_TRANS_VALIDATE);
|
__FUNCTION__, cp->cp_name);
|
||||||
|
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
@ -570,17 +302,17 @@ int
|
||||||
plugin_transaction_complete(clicon_handle h,
|
plugin_transaction_complete(clicon_handle h,
|
||||||
transaction_data_t *td)
|
transaction_data_t *td)
|
||||||
{
|
{
|
||||||
int i;
|
|
||||||
int retval = 0;
|
int retval = 0;
|
||||||
struct plugin *p;
|
clixon_plugin *cp = NULL;
|
||||||
|
trans_cb_t *fn;
|
||||||
|
|
||||||
for (i = 0; i < _nplugins; i++){
|
while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
p = &_plugins[i];
|
if ((fn = cp->cp_api.ca_trans_complete) == NULL)
|
||||||
if (p->p_trans_complete)
|
continue;
|
||||||
if ((retval = (p->p_trans_complete)(h, (transaction_data)td)) < 0){
|
if ((retval = fn(h, (transaction_data)td)) < 0){
|
||||||
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
||||||
clicon_log(LOG_NOTICE, "%s: Plugin '%s' %s callback does not make clicon_err call on error",
|
clicon_log(LOG_NOTICE, "%s: Plugin '%s' trans_complete callback does not make clicon_err call on error",
|
||||||
__FUNCTION__, p->p_name, PLUGIN_TRANS_COMPLETE);
|
__FUNCTION__, cp->cp_name);
|
||||||
|
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
|
@ -604,8 +336,8 @@ plugin_transaction_revert(clicon_handle h,
|
||||||
{
|
{
|
||||||
int retval = 0;
|
int retval = 0;
|
||||||
transaction_data_t tr; /* revert transaction */
|
transaction_data_t tr; /* revert transaction */
|
||||||
int i;
|
clixon_plugin *cp = NULL;
|
||||||
struct plugin *p;
|
trans_cb_t *fn;
|
||||||
|
|
||||||
/* Create a new reversed transaction from the original where src and target
|
/* Create a new reversed transaction from the original where src and target
|
||||||
are swapped */
|
are swapped */
|
||||||
|
|
@ -620,12 +352,12 @@ plugin_transaction_revert(clicon_handle h,
|
||||||
tr.td_scvec = td->td_tcvec;
|
tr.td_scvec = td->td_tcvec;
|
||||||
tr.td_tcvec = td->td_scvec;
|
tr.td_tcvec = td->td_scvec;
|
||||||
|
|
||||||
for (i = nr-1; i>=0; i--){
|
while ((cp = clixon_plugin_each_revert(h, cp, nr)) != NULL) {
|
||||||
p = &_plugins[i];
|
if ((fn = cp->cp_api.ca_trans_commit) == NULL)
|
||||||
if (p->p_trans_commit)
|
continue;
|
||||||
if ((p->p_trans_commit)(h, (transaction_data)&tr) < 0){
|
if ((retval = fn(h, (transaction_data)td)) < 0){
|
||||||
clicon_log(LOG_NOTICE, "Plugin '%s' %s revert callback failed",
|
clicon_log(LOG_NOTICE, "%s: Plugin '%s' trans_commit revert callback failed",
|
||||||
p->p_name, PLUGIN_TRANS_COMMIT);
|
__FUNCTION__, cp->cp_name);
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
@ -646,18 +378,20 @@ plugin_transaction_commit(clicon_handle h,
|
||||||
transaction_data_t *td)
|
transaction_data_t *td)
|
||||||
{
|
{
|
||||||
int retval = 0;
|
int retval = 0;
|
||||||
int i;
|
clixon_plugin *cp = NULL;
|
||||||
struct plugin *p;
|
trans_cb_t *fn;
|
||||||
|
int i=0;
|
||||||
|
|
||||||
for (i = 0; i < _nplugins; i++){
|
while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
p = &_plugins[i];
|
i++;
|
||||||
if (p->p_trans_commit)
|
if ((fn = cp->cp_api.ca_trans_commit) == NULL)
|
||||||
if ((retval = (p->p_trans_commit)(h, (transaction_data)td)) < 0){
|
continue;
|
||||||
|
if ((retval = fn(h, (transaction_data)td)) < 0){
|
||||||
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
||||||
clicon_log(LOG_NOTICE, "%s: Plugin '%s' %s callback does not make clicon_err call on error",
|
clicon_log(LOG_NOTICE, "%s: Plugin '%s' trans_commit callback does not make clicon_err call on error",
|
||||||
__FUNCTION__, p->p_name, PLUGIN_TRANS_COMMIT);
|
__FUNCTION__, cp->cp_name);
|
||||||
/* Make an effort to revert transaction */
|
/* Make an effort to revert transaction */
|
||||||
plugin_transaction_revert(h, td, i);
|
plugin_transaction_revert(h, td, i-1);
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
@ -675,17 +409,16 @@ plugin_transaction_end(clicon_handle h,
|
||||||
transaction_data_t *td)
|
transaction_data_t *td)
|
||||||
{
|
{
|
||||||
int retval = 0;
|
int retval = 0;
|
||||||
int i;
|
clixon_plugin *cp = NULL;
|
||||||
struct plugin *p;
|
trans_cb_t *fn;
|
||||||
|
|
||||||
for (i = 0; i < _nplugins; i++) {
|
while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
p = &_plugins[i];
|
if ((fn = cp->cp_api.ca_trans_end) == NULL)
|
||||||
if (p->p_trans_end)
|
continue;
|
||||||
if ((retval = (p->p_trans_end)(h, (transaction_data)td)) < 0){
|
if ((retval = fn(h, (transaction_data)td)) < 0){
|
||||||
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
||||||
clicon_log(LOG_NOTICE, "%s: Plugin '%s' %s callback does not make clicon_err call on error",
|
clicon_log(LOG_NOTICE, "%s: Plugin '%s' trans_end callback does not make clicon_err call on error",
|
||||||
__FUNCTION__, p->p_name, PLUGIN_TRANS_END);
|
__FUNCTION__, cp->cp_name);
|
||||||
|
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
@ -703,94 +436,14 @@ plugin_transaction_abort(clicon_handle h,
|
||||||
transaction_data_t *td)
|
transaction_data_t *td)
|
||||||
{
|
{
|
||||||
int retval = 0;
|
int retval = 0;
|
||||||
int i;
|
clixon_plugin *cp = NULL;
|
||||||
struct plugin *p;
|
trans_cb_t *fn;
|
||||||
|
|
||||||
for (i = 0; i < _nplugins; i++) {
|
while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
p = &_plugins[i];
|
if ((fn = cp->cp_api.ca_trans_abort) == NULL)
|
||||||
if (p->p_trans_abort)
|
continue;
|
||||||
(p->p_trans_abort)(h, (transaction_data)td); /* dont abort on error */
|
fn(h, (transaction_data)td); /* dont abort on error */
|
||||||
}
|
}
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*----------------------------------------------------------------------
|
|
||||||
* Backend state data callbacks
|
|
||||||
*/
|
|
||||||
|
|
||||||
/*! Go through all backend statedata callbacks and collect state data
|
|
||||||
* This is internal system call, plugin is invoked (does not call) this function
|
|
||||||
* Backend plugins can register
|
|
||||||
* @param[in] h clicon handle
|
|
||||||
* @param[in] xpath String with XPATH syntax. or NULL for all
|
|
||||||
* @param[in,out] xml XML tree.
|
|
||||||
* @retval -1 Error
|
|
||||||
* @retval 0 OK
|
|
||||||
* @retval 1 Statedata callback failed
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
backend_statedata_call(clicon_handle h,
|
|
||||||
char *xpath,
|
|
||||||
cxobj *xtop)
|
|
||||||
{
|
|
||||||
int retval = -1;
|
|
||||||
struct plugin *p;
|
|
||||||
int i;
|
|
||||||
cxobj *x = NULL;
|
|
||||||
yang_spec *yspec;
|
|
||||||
cxobj **xvec = NULL;
|
|
||||||
size_t xlen;
|
|
||||||
|
|
||||||
if ((yspec = clicon_dbspec_yang(h)) == NULL){
|
|
||||||
clicon_err(OE_YANG, ENOENT, "No yang spec");
|
|
||||||
goto done;
|
|
||||||
}
|
|
||||||
if (xtop==NULL){
|
|
||||||
clicon_err(OE_CFG, ENOENT, "XML tree expected");
|
|
||||||
goto done;
|
|
||||||
}
|
|
||||||
for (i = 0; i < _nplugins; i++) {
|
|
||||||
p = &_plugins[i];
|
|
||||||
if (p->p_statedata) {
|
|
||||||
if ((x = xml_new("config", NULL, NULL)) == NULL)
|
|
||||||
goto done;
|
|
||||||
if ((p->p_statedata)(h, xpath, x) < 0){
|
|
||||||
retval = 1;
|
|
||||||
goto done; /* Dont quit here on user callbacks */
|
|
||||||
}
|
|
||||||
if (xml_merge(xtop, x, yspec) < 0)
|
|
||||||
goto done;
|
|
||||||
if (x){
|
|
||||||
xml_free(x);
|
|
||||||
x = NULL;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
/* Code complex to filter out anything that is outside of xpath */
|
|
||||||
if (xpath_vec(xtop, xpath?xpath:"/", &xvec, &xlen) < 0)
|
|
||||||
goto done;
|
|
||||||
|
|
||||||
/* If vectors are specified then mark the nodes found and
|
|
||||||
* then filter out everything else,
|
|
||||||
* otherwise return complete tree.
|
|
||||||
*/
|
|
||||||
if (xvec != NULL){
|
|
||||||
for (i=0; i<xlen; i++)
|
|
||||||
xml_flag_set(xvec[i], XML_FLAG_MARK);
|
|
||||||
}
|
|
||||||
/* Remove everything that is not marked */
|
|
||||||
if (!xml_flag(xtop, XML_FLAG_MARK))
|
|
||||||
if (xml_tree_prune_flagged_sub(xtop, XML_FLAG_MARK, 1, NULL) < 0)
|
|
||||||
goto done;
|
|
||||||
/* reset flag */
|
|
||||||
if (xml_apply(xtop, CX_ELMNT, (xml_applyfn_t*)xml_flag_reset, (void*)XML_FLAG_MARK) < 0)
|
|
||||||
goto done;
|
|
||||||
retval = 0;
|
|
||||||
done:
|
|
||||||
if (x)
|
|
||||||
xml_free(x);
|
|
||||||
if (xvec)
|
|
||||||
free(xvec);
|
|
||||||
return retval;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -67,14 +67,11 @@ typedef struct {
|
||||||
/*
|
/*
|
||||||
* Prototypes
|
* Prototypes
|
||||||
*/
|
*/
|
||||||
int backend_plugin_init(clicon_handle h);
|
int backend_plugin_initiate(clicon_handle h);
|
||||||
int plugin_initiate(clicon_handle h);
|
|
||||||
int plugin_finish(clicon_handle h);
|
|
||||||
|
|
||||||
int plugin_reset_state(clicon_handle h, const char *db);
|
int clixon_plugin_reset(clicon_handle h, char *db);
|
||||||
int plugin_start_argv(clicon_handle h, int argc, char **argv);
|
|
||||||
|
|
||||||
int backend_statedata_call(clicon_handle h, char *xpath, cxobj *xml);
|
int clixon_plugin_statedata(clicon_handle h, char *xpath, cxobj **xtop);
|
||||||
|
|
||||||
transaction_data_t * transaction_new(void);
|
transaction_data_t * transaction_new(void);
|
||||||
int transaction_free(transaction_data_t *);
|
int transaction_free(transaction_data_t *);
|
||||||
|
|
|
||||||
|
|
@ -49,62 +49,4 @@
|
||||||
#include <clixon/clixon_backend_handle.h>
|
#include <clixon/clixon_backend_handle.h>
|
||||||
#include <clixon/clixon_backend_transaction.h>
|
#include <clixon/clixon_backend_transaction.h>
|
||||||
|
|
||||||
/*! Clicon Backend plugin callbacks: use these in your backend plugin code
|
|
||||||
*/
|
|
||||||
|
|
||||||
/*! Called when plugin loaded. Only mandadory callback. All others optional
|
|
||||||
* @see plginit_t
|
|
||||||
*/
|
|
||||||
int plugin_init(clicon_handle h);
|
|
||||||
|
|
||||||
/* Called when backend started with cmd-line arguments from daemon call.
|
|
||||||
* @see plgstart_t
|
|
||||||
*/
|
|
||||||
int plugin_start(clicon_handle h, int argc, char **argv);
|
|
||||||
|
|
||||||
/* Called just before plugin unloaded.
|
|
||||||
* @see plgexit_t
|
|
||||||
*/
|
|
||||||
int plugin_exit(clicon_handle h);
|
|
||||||
|
|
||||||
/*! Reset system state to original state. Eg at reboot before running thru config.
|
|
||||||
* @see plgreset_t
|
|
||||||
*/
|
|
||||||
int plugin_reset(clicon_handle h, const char *db);
|
|
||||||
|
|
||||||
/*! Retreive statedata, add statedata to XML tree
|
|
||||||
* @see plgstatedata_ t
|
|
||||||
*/
|
|
||||||
int plugin_statedata(clicon_handle h, char *xpath, cxobj *xtop);
|
|
||||||
|
|
||||||
/*! Called before a commit/validate sequence begins. Eg setup state before commit
|
|
||||||
* @see trans_cb_t
|
|
||||||
*/
|
|
||||||
int transaction_begin(clicon_handle h, transaction_data td);
|
|
||||||
|
|
||||||
/*! Validate.
|
|
||||||
* @see trans_cb_t
|
|
||||||
*/
|
|
||||||
int transaction_validate(clicon_handle h, transaction_data td);
|
|
||||||
|
|
||||||
/* Called after a validation completed succesfully (but before commit).
|
|
||||||
* @see trans_cb_t
|
|
||||||
*/
|
|
||||||
int transaction_complete(clicon_handle h, transaction_data td);
|
|
||||||
|
|
||||||
/* Commit.
|
|
||||||
* @see trans_cb_t
|
|
||||||
*/
|
|
||||||
int transaction_commit(clicon_handle h, transaction_data td);
|
|
||||||
|
|
||||||
/* Called after a commit sequence completed succesfully.
|
|
||||||
* @see trans_cb_t
|
|
||||||
*/
|
|
||||||
int transaction_end(clicon_handle h, transaction_data td);
|
|
||||||
|
|
||||||
/* Called if commit or validate sequence fails. After eventual rollback.
|
|
||||||
* @see trans_cb_t
|
|
||||||
*/
|
|
||||||
int transaction_abort(clicon_handle h, transaction_data td);
|
|
||||||
|
|
||||||
#endif /* _CLIXON_BACKEND_H_ */
|
#endif /* _CLIXON_BACKEND_H_ */
|
||||||
|
|
|
||||||
|
|
@ -52,6 +52,7 @@
|
||||||
#include <regex.h>
|
#include <regex.h>
|
||||||
#include <syslog.h>
|
#include <syslog.h>
|
||||||
#include <netinet/in.h>
|
#include <netinet/in.h>
|
||||||
|
#include <limits.h>
|
||||||
|
|
||||||
/* cligen */
|
/* cligen */
|
||||||
#include <cligen/cligen.h>
|
#include <cligen/cligen.h>
|
||||||
|
|
@ -89,6 +90,7 @@ struct backend_handle {
|
||||||
struct client_entry *bh_ce_list; /* The client list */
|
struct client_entry *bh_ce_list; /* The client list */
|
||||||
int bh_ce_nr; /* Number of clients, just increment */
|
int bh_ce_nr; /* Number of clients, just increment */
|
||||||
struct handle_subscription *bh_subscription; /* Event subscription list */
|
struct handle_subscription *bh_subscription; /* Event subscription list */
|
||||||
|
cxobj *bh_nacm; /* NACM external struct */
|
||||||
};
|
};
|
||||||
|
|
||||||
/*! Creates and returns a clicon config handle for other CLICON API calls
|
/*! Creates and returns a clicon config handle for other CLICON API calls
|
||||||
|
|
@ -105,11 +107,14 @@ backend_handle_init(void)
|
||||||
int
|
int
|
||||||
backend_handle_exit(clicon_handle h)
|
backend_handle_exit(clicon_handle h)
|
||||||
{
|
{
|
||||||
|
struct backend_handle *bh = handle(h);
|
||||||
struct client_entry *ce;
|
struct client_entry *ce;
|
||||||
|
|
||||||
/* only delete client structs, not close sockets, etc, see backend_client_rm */
|
/* only delete client structs, not close sockets, etc, see backend_client_rm */
|
||||||
while ((ce = backend_client_list(h)) != NULL)
|
while ((ce = backend_client_list(h)) != NULL)
|
||||||
backend_client_delete(h, ce);
|
backend_client_delete(h, ce);
|
||||||
|
if (bh->bh_nacm)
|
||||||
|
xml_free(bh->bh_nacm);
|
||||||
clicon_handle_exit(h); /* frees h and options */
|
clicon_handle_exit(h); /* frees h and options */
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
@ -430,110 +435,22 @@ subscription_each(clicon_handle h,
|
||||||
return hs;
|
return hs;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*--------------------------------------------------------------------
|
|
||||||
* Backend netconf rpc callbacks
|
|
||||||
*/
|
|
||||||
typedef struct {
|
|
||||||
qelem_t rc_qelem; /* List header */
|
|
||||||
backend_rpc_cb rc_callback; /* RPC Callback */
|
|
||||||
void *rc_arg; /* Application specific argument to cb */
|
|
||||||
char *rc_tag; /* Xml tag when matched, callback called */
|
|
||||||
} backend_rpc_cb_entry;
|
|
||||||
|
|
||||||
/* List of backend rpc callback entries */
|
|
||||||
static backend_rpc_cb_entry *rpc_cb_list = NULL;
|
|
||||||
|
|
||||||
/*! Register netconf backend rpc callback
|
|
||||||
* Called from plugin to register a callback for a specific netconf XML tag.
|
|
||||||
*
|
|
||||||
* @param[in] h clicon handle
|
|
||||||
* @param[in] cb, Callback called
|
|
||||||
* @param[in] arg, Arg to send to callback
|
|
||||||
* @param[in] tag Xml tag when callback is made
|
|
||||||
* @see backend_rpc_cb_call
|
|
||||||
*/
|
|
||||||
int
|
int
|
||||||
backend_rpc_cb_register(clicon_handle h,
|
backend_nacm_list_set(clicon_handle h,
|
||||||
backend_rpc_cb cb,
|
cxobj *xnacm)
|
||||||
void *arg,
|
|
||||||
char *tag)
|
|
||||||
{
|
{
|
||||||
backend_rpc_cb_entry *rc;
|
struct backend_handle *bh = handle(h);
|
||||||
|
|
||||||
if ((rc = malloc(sizeof(backend_rpc_cb_entry))) == NULL) {
|
if (bh->bh_nacm)
|
||||||
clicon_err(OE_DB, errno, "malloc: %s", strerror(errno));
|
xml_free(bh->bh_nacm);
|
||||||
goto catch;
|
bh->bh_nacm = xnacm;
|
||||||
}
|
|
||||||
memset (rc, 0, sizeof (*rc));
|
|
||||||
rc->rc_callback = cb;
|
|
||||||
rc->rc_arg = arg;
|
|
||||||
rc->rc_tag = strdup(tag); /* XXX strdup memleak */
|
|
||||||
INSQ(rc, rpc_cb_list);
|
|
||||||
return 0;
|
|
||||||
catch:
|
|
||||||
if (rc){
|
|
||||||
if (rc->rc_tag)
|
|
||||||
free(rc->rc_tag);
|
|
||||||
free(rc);
|
|
||||||
}
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Search netconf backend callbacks and invoke if match
|
|
||||||
* This is internal system call, plugin is invoked (does not call) this functino
|
|
||||||
* @param[in] h clicon handle
|
|
||||||
* @param[in] xe Sub-tree (under xorig) at child of rpc: <rpc><xn></rpc>.
|
|
||||||
* @param[in] ce Client (session) entry
|
|
||||||
* @param[out] cbret Return XML, error or OK as cbuf
|
|
||||||
*
|
|
||||||
* @retval -1 Error
|
|
||||||
* @retval 0 OK, not found handler.
|
|
||||||
* @retval 1 OK, handler called
|
|
||||||
* @see backend_rpc_cb_register
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
backend_rpc_cb_call(clicon_handle h,
|
|
||||||
cxobj *xe,
|
|
||||||
struct client_entry *ce,
|
|
||||||
cbuf *cbret)
|
|
||||||
{
|
|
||||||
backend_rpc_cb_entry *rc;
|
|
||||||
int retval = -1;
|
|
||||||
|
|
||||||
if (rpc_cb_list == NULL)
|
|
||||||
return 0;
|
|
||||||
rc = rpc_cb_list;
|
|
||||||
do {
|
|
||||||
if (strcmp(rc->rc_tag, xml_name(xe)) == 0){
|
|
||||||
if ((retval = rc->rc_callback(h, xe, ce, cbret, rc->rc_arg)) < 0){
|
|
||||||
clicon_debug(1, "%s Error in: %s", __FUNCTION__, rc->rc_tag);
|
|
||||||
goto done;
|
|
||||||
}
|
|
||||||
else{
|
|
||||||
retval = 1; /* handled */
|
|
||||||
goto done;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
rc = NEXTQ(backend_rpc_cb_entry *, rc);
|
|
||||||
} while (rc != rpc_cb_list);
|
|
||||||
retval = 0;
|
|
||||||
done:
|
|
||||||
return retval;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Delete all state data callbacks.
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
backend_rpc_cb_delete_all(void)
|
|
||||||
{
|
|
||||||
backend_rpc_cb_entry *rc;
|
|
||||||
|
|
||||||
while((rc = rpc_cb_list) != NULL) {
|
|
||||||
DELQ(rc, rpc_cb_list, backend_rpc_cb_entry *);
|
|
||||||
if (rc->rc_tag)
|
|
||||||
free(rc->rc_tag);
|
|
||||||
free(rc);
|
|
||||||
}
|
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
cxobj *
|
||||||
|
backend_nacm_list_get(clicon_handle h)
|
||||||
|
{
|
||||||
|
struct backend_handle *bh = handle(h);
|
||||||
|
|
||||||
|
return bh->bh_nacm;
|
||||||
|
}
|
||||||
|
|
|
||||||
|
|
@ -43,30 +43,6 @@
|
||||||
/*
|
/*
|
||||||
* Types
|
* Types
|
||||||
*/
|
*/
|
||||||
struct client_entry;
|
|
||||||
typedef int (*backend_rpc_cb)(
|
|
||||||
clicon_handle h, /* CLicon handle */
|
|
||||||
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
|
||||||
struct client_entry *ce, /* Client session */
|
|
||||||
cbuf *cbret,/* Reply eg <rpc-reply>... */
|
|
||||||
void *arg /* Argument given at register */
|
|
||||||
);
|
|
||||||
typedef backend_rpc_cb backend_netconf_cb_t; /* XXX backward compat */
|
|
||||||
|
|
||||||
|
|
||||||
/*! Generic downcall registration.
|
|
||||||
* Enables any function to be called from (cli) frontend
|
|
||||||
* to backend. Like an RPC on application-level.
|
|
||||||
*/
|
|
||||||
typedef int (*downcall_cb)(clicon_handle h, uint16_t op, uint16_t len,
|
|
||||||
void *arg, uint16_t *retlen, void **retarg);
|
|
||||||
|
|
||||||
/*
|
|
||||||
* Log for netconf notify function (config_client.c)
|
|
||||||
*/
|
|
||||||
int backend_notify(clicon_handle h, char *stream, int level, char *txt);
|
|
||||||
int backend_notify_xml(clicon_handle h, char *stream, int level, cxobj *x);
|
|
||||||
|
|
||||||
/* subscription callback */
|
/* subscription callback */
|
||||||
typedef int (*subscription_fn_t)(clicon_handle, void *filter, void *arg);
|
typedef int (*subscription_fn_t)(clicon_handle, void *filter, void *arg);
|
||||||
|
|
||||||
|
|
@ -82,6 +58,14 @@ struct handle_subscription{
|
||||||
void *hs_arg; /* Callback argument */
|
void *hs_arg; /* Callback argument */
|
||||||
};
|
};
|
||||||
|
|
||||||
|
/*
|
||||||
|
* Prototypes
|
||||||
|
*/
|
||||||
|
/* Log for netconf notify function (config_client.c) */
|
||||||
|
int backend_notify(clicon_handle h, char *stream, int level, char *txt);
|
||||||
|
int backend_notify_xml(clicon_handle h, char *stream, int level, cxobj *x);
|
||||||
|
|
||||||
|
|
||||||
struct handle_subscription *subscription_add(clicon_handle h, char *stream,
|
struct handle_subscription *subscription_add(clicon_handle h, char *stream,
|
||||||
enum format_enum format, char *filter,
|
enum format_enum format, char *filter,
|
||||||
subscription_fn_t fn, void *arg);
|
subscription_fn_t fn, void *arg);
|
||||||
|
|
@ -92,14 +76,4 @@ int subscription_delete(clicon_handle h, char *stream,
|
||||||
struct handle_subscription *subscription_each(clicon_handle h,
|
struct handle_subscription *subscription_each(clicon_handle h,
|
||||||
struct handle_subscription *hprev);
|
struct handle_subscription *hprev);
|
||||||
|
|
||||||
/* XXX backward compat */
|
|
||||||
#define backend_netconf_register_callback(a,b,c,d) backend_rpc_cb_register(a,b,c,d)
|
|
||||||
int backend_rpc_cb_register(clicon_handle h, backend_rpc_cb cb, void *arg,
|
|
||||||
char *tag);
|
|
||||||
|
|
||||||
int backend_rpc_cb_call(clicon_handle h, cxobj *xe, struct client_entry *ce,
|
|
||||||
cbuf *cbret);
|
|
||||||
|
|
||||||
int backend_rpc_cb_delete_all(void);
|
|
||||||
|
|
||||||
#endif /* _CLIXON_BACKEND_HANDLE_H_ */
|
#endif /* _CLIXON_BACKEND_HANDLE_H_ */
|
||||||
|
|
|
||||||
|
|
@ -50,6 +50,7 @@
|
||||||
#include <sys/types.h>
|
#include <sys/types.h>
|
||||||
#include <regex.h>
|
#include <regex.h>
|
||||||
#include <netinet/in.h>
|
#include <netinet/in.h>
|
||||||
|
#include <limits.h>
|
||||||
|
|
||||||
/* cligen */
|
/* cligen */
|
||||||
#include <cligen/cligen.h>
|
#include <cligen/cligen.h>
|
||||||
|
|
|
||||||
|
|
@ -41,21 +41,12 @@
|
||||||
#define _CLIXON_BACKEND_TRANSACTION_H_
|
#define _CLIXON_BACKEND_TRANSACTION_H_
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Types
|
* Prototypes
|
||||||
*/
|
*/
|
||||||
|
|
||||||
/*! Generic downcall registration.
|
|
||||||
* Enables any function to be called from (cli) frontend
|
|
||||||
* to backend. Like an RPC on application-level.
|
|
||||||
*/
|
|
||||||
typedef int (*downcall_cb)(clicon_handle h, uint16_t op, uint16_t len,
|
|
||||||
void *arg, uint16_t *retlen, void **retarg);
|
|
||||||
|
|
||||||
/* Transaction callback data accessors for client plugins
|
/* Transaction callback data accessors for client plugins
|
||||||
* (defined in config_dbdep.c)
|
* (defined in config_dbdep.c)
|
||||||
* @see transaction_data_t internal structure
|
* @see transaction_data_t internal structure
|
||||||
*/
|
*/
|
||||||
typedef void *transaction_data;
|
|
||||||
uint64_t transaction_id(transaction_data td);
|
uint64_t transaction_id(transaction_data td);
|
||||||
void *transaction_arg(transaction_data td);
|
void *transaction_arg(transaction_data td);
|
||||||
cxobj *transaction_src(transaction_data td);
|
cxobj *transaction_src(transaction_data td);
|
||||||
|
|
|
||||||
|
|
@ -36,6 +36,7 @@ srcdir = @srcdir@
|
||||||
top_srcdir = @top_srcdir@
|
top_srcdir = @top_srcdir@
|
||||||
CC = @CC@
|
CC = @CC@
|
||||||
CFLAGS = @CFLAGS@
|
CFLAGS = @CFLAGS@
|
||||||
|
INSTALLFLAGS = @INSTALLFLAGS@
|
||||||
LDFLAGS = @LDFLAGS@
|
LDFLAGS = @LDFLAGS@
|
||||||
|
|
||||||
prefix = @prefix@
|
prefix = @prefix@
|
||||||
|
|
@ -56,8 +57,6 @@ CLIXON_MINOR = @CLIXON_VERSION_MINOR@
|
||||||
|
|
||||||
# Use this clixon lib for linking
|
# Use this clixon lib for linking
|
||||||
CLIXON_LIB = libclixon.so.$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
CLIXON_LIB = libclixon.so.$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
||||||
# Location of system plugins
|
|
||||||
CLIXON_CLI_SYSDIR = $(libdir)/clixon/plugins/cli
|
|
||||||
|
|
||||||
# For dependency. A little strange that we rely on it being built in the src dir
|
# For dependency. A little strange that we rely on it being built in the src dir
|
||||||
# even though it may exist in $(libdir). But the new version may not have been installed yet.
|
# even though it may exist in $(libdir). But the new version may not have been installed yet.
|
||||||
|
|
@ -68,22 +67,33 @@ LIBS = -L$(top_srcdir)/lib/src @LIBS@ $(top_srcdir)/lib/src/$(CLIXON_L
|
||||||
CPPFLAGS = @CPPFLAGS@ -fPIC
|
CPPFLAGS = @CPPFLAGS@ -fPIC
|
||||||
INCLUDES = -I. -I$(top_srcdir)/lib -I$(top_srcdir)/include -I$(top_srcdir) @INCLUDES@
|
INCLUDES = -I. -I$(top_srcdir)/lib -I$(top_srcdir)/include -I$(top_srcdir) @INCLUDES@
|
||||||
|
|
||||||
|
# Name of application
|
||||||
APPL = clixon_cli
|
APPL = clixon_cli
|
||||||
SRC = cli_main.c
|
|
||||||
OBJS = $(SRC:.c=.o)
|
|
||||||
|
|
||||||
|
# Not accessible from plugin
|
||||||
|
APPSRC = cli_main.c
|
||||||
|
APPSRC += cli_generate.c
|
||||||
|
APPOBJ = $(APPSRC:.c=.o)
|
||||||
|
|
||||||
|
# Accessible from plugin
|
||||||
|
LIBSRC = cli_common.c
|
||||||
|
LIBSRC += cli_show.c
|
||||||
|
LIBSRC += cli_handle.c
|
||||||
|
LIBSRC += cli_plugin.c
|
||||||
|
LIBOBJ = $(LIBSRC:.c=.o)
|
||||||
|
|
||||||
|
# Name of lib
|
||||||
MYNAME = clixon_cli
|
MYNAME = clixon_cli
|
||||||
MYLIBLINK = lib$(MYNAME)$(SH_SUFFIX)
|
MYLIBLINK = lib$(MYNAME)$(SH_SUFFIX)
|
||||||
MYLIB = $(MYLIBLINK).$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
MYLIB = $(MYLIBLINK).$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
||||||
MYLIBSO = $(MYLIBLINK).$(CLIXON_MAJOR)
|
MYLIBSO = $(MYLIBLINK).$(CLIXON_MAJOR)
|
||||||
|
|
||||||
LIBSRC = cli_plugin.c cli_common.c cli_show.c cli_handle.c cli_generate.c
|
|
||||||
LIBOBJS = $(LIBSRC:.c=.o)
|
|
||||||
|
|
||||||
all: $(MYLIB) $(APPL) test
|
all: $(MYLIB) $(APPL) test
|
||||||
|
|
||||||
clean:
|
clean:
|
||||||
rm -f $(OBJS) $(LIBOBJS) *.core $(APPL) $(MYLIB) $(MYLIBSO) $(MYLIBLINK)
|
rm -f $(LIBOBJ) $(APPOBJ) *.core $(APPL) $(MYLIB) $(MYLIBSO) $(MYLIBLINK)
|
||||||
|
|
||||||
distclean: clean
|
distclean: clean
|
||||||
rm -f Makefile *~ .depend test test.c
|
rm -f Makefile *~ .depend test test.c
|
||||||
|
|
@ -93,19 +103,19 @@ distclean: clean
|
||||||
# Also create a libexec/ directory for writeable/temporary files.
|
# Also create a libexec/ directory for writeable/temporary files.
|
||||||
# Put config file in etc/
|
# Put config file in etc/
|
||||||
install: install-lib $(APPL)
|
install: install-lib $(APPL)
|
||||||
install -d $(DESTDIR)$(bindir)
|
install -d -m 0755 $(DESTDIR)$(bindir)
|
||||||
install $(APPL) $(DESTDIR)$(bindir)
|
install -m 0755 $(INSTALLFLAGS) $(APPL) $(DESTDIR)$(bindir)
|
||||||
|
|
||||||
install-lib: $(MYLIB)
|
install-lib: $(MYLIB)
|
||||||
install -d $(DESTDIR)$(libdir)
|
install -d -m 0755 $(DESTDIR)$(libdir)
|
||||||
install $(MYLIB) $(DESTDIR)$(libdir)
|
install -m 0644 $(INSTALLFLAGS) $(MYLIB) $(DESTDIR)$(libdir)
|
||||||
ln -sf $(MYLIB) $(DESTDIR)$(libdir)/$(MYLIBSO) # -l:libclixon_cli.so.2
|
ln -sf $(MYLIB) $(DESTDIR)$(libdir)/$(MYLIBSO) # -l:libclixon_cli.so.2
|
||||||
ln -sf $(MYLIBSO) $(DESTDIR)$(libdir)/$(MYLIBLINK) # -l:libclixon_cli.so
|
ln -sf $(MYLIBSO) $(DESTDIR)$(libdir)/$(MYLIBLINK) # -l:libclixon_cli.so
|
||||||
install -d $(DESTDIR)$(libdir)/clixon/plugins/cli
|
install -d -m 0755 $(DESTDIR)$(libdir)/clixon/plugins/cli
|
||||||
|
|
||||||
install-include: clixon_cli.h clixon_cli_api.h
|
install-include: clixon_cli.h clixon_cli_api.h
|
||||||
install -d $(DESTDIR)$(includedir)/clixon
|
install -d -m 0755 $(DESTDIR)$(includedir)/clixon
|
||||||
install -m 644 $^ $(DESTDIR)$(includedir)/clixon
|
install -m 0644 $^ $(DESTDIR)$(includedir)/clixon
|
||||||
|
|
||||||
uninstall:
|
uninstall:
|
||||||
rm -f $(DESTDIR)$(bindir)/$(APPL)
|
rm -f $(DESTDIR)$(bindir)/$(APPL)
|
||||||
|
|
@ -116,7 +126,7 @@ uninstall:
|
||||||
.SUFFIXES: .c .o
|
.SUFFIXES: .c .o
|
||||||
|
|
||||||
.c.o:
|
.c.o:
|
||||||
$(CC) $(INCLUDES) $(CPPFLAGS) -D__PROGRAM__=\"$(APPL)\" -DCLIXON_CLI_SYSDIR=\"$(CLIXON_CLI_SYSDIR)\" $(CFLAGS) -c $<
|
$(CC) $(INCLUDES) $(CPPFLAGS) -D__PROGRAM__=\"$(APPL)\" $(CFLAGS) -c $<
|
||||||
|
|
||||||
# Just link test programs
|
# Just link test programs
|
||||||
test.c :
|
test.c :
|
||||||
|
|
@ -125,14 +135,14 @@ test.c :
|
||||||
test: test.c $(LIBOBJ)
|
test: test.c $(LIBOBJ)
|
||||||
$(CC) $(INCLUDES) $(LDFLAGS) $< $(LIBOBJ) -L. $(MYLIB) $(LIBS) -o $@
|
$(CC) $(INCLUDES) $(LDFLAGS) $< $(LIBOBJ) -L. $(MYLIB) $(LIBS) -o $@
|
||||||
|
|
||||||
$(APPL): $(OBJS) $(MYLIBLINK) $(LIBDEPS)
|
$(APPL): $(APPOBJ) $(MYLIBLINK) $(LIBDEPS)
|
||||||
$(CC) $(LDFLAGS) $(OBJS) -L. $(MYLIB) $(LIBS) -o $@
|
$(CC) $(LDFLAGS) $(APPOBJ) -L. $(MYLIB) $(LIBS) -o $@
|
||||||
|
|
||||||
$(MYLIB) : $(LIBOBJS)
|
$(MYLIB) : $(LIBOBJ)
|
||||||
ifeq ($(HOST_VENDOR),apple)
|
ifeq ($(HOST_VENDOR),apple)
|
||||||
$(CC) $(LDFLAGS) -shared -undefined dynamic_lookup -o $@ $(LIBOBJS) $(LIBS)
|
$(CC) $(LDFLAGS) -shared -undefined dynamic_lookup -o $@ $(LIBOBJ) $(LIBS)
|
||||||
else
|
else
|
||||||
$(CC) $(LDFLAGS) -shared -Wl,-soname,$(MYLIBSO) -o $@ $(LIBOBJS) $(LIBS) -Wl,-soname=$(MYLIBSO)
|
$(CC) $(LDFLAGS) -shared -Wl,-soname,$(MYLIBSO) -o $@ $(LIBOBJ) $(LIBS) -Wl,-soname=$(MYLIBSO)
|
||||||
endif
|
endif
|
||||||
|
|
||||||
# link-name is needed for application linking, eg for clixon_cli and clixon_config
|
# link-name is needed for application linking, eg for clixon_cli and clixon_config
|
||||||
|
|
@ -144,7 +154,7 @@ TAGS:
|
||||||
find . -name '*.[chyl]' -print | etags -
|
find . -name '*.[chyl]' -print | etags -
|
||||||
|
|
||||||
depend:
|
depend:
|
||||||
$(CC) $(DEPENDFLAGS) @DEFS@ $(INCLUDES) $(CFLAGS) -MM $(SRC) $(APPSRC) > .depend
|
$(CC) $(DEPENDFLAGS) @DEFS@ $(INCLUDES) $(CFLAGS) -MM $(LIBSRC) $(APPSRC) > .depend
|
||||||
|
|
||||||
#include .depend
|
#include .depend
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -236,7 +236,7 @@ cli_dbxml(clicon_handle h,
|
||||||
if ((xtop = xml_new("config", NULL, NULL)) == NULL)
|
if ((xtop = xml_new("config", NULL, NULL)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
xbot = xtop;
|
xbot = xtop;
|
||||||
if (api_path && api_path2xml(api_path, yspec, xtop, 0, &xbot, &y) < 0)
|
if (api_path && api_path2xml(api_path, yspec, xtop, YC_DATANODE, &xbot, &y) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if ((xa = xml_new("operation", xbot, NULL)) == NULL)
|
if ((xa = xml_new("operation", xbot, NULL)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -829,10 +829,19 @@ save_config_file(clicon_handle h,
|
||||||
filename = cv_string_get(cv);
|
filename = cv_string_get(cv);
|
||||||
if (clicon_rpc_get_config(h, dbstr,"/", &xt) < 0)
|
if (clicon_rpc_get_config(h, dbstr,"/", &xt) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
if (xt == NULL){
|
||||||
|
clicon_err(OE_CFG, 0, "get config: empty tree"); /* Shouldnt happen */
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
if ((xerr = xpath_first(xt, "/rpc-error")) != NULL){
|
if ((xerr = xpath_first(xt, "/rpc-error")) != NULL){
|
||||||
clicon_rpc_generate_error("Get configuration", xerr);
|
clicon_rpc_generate_error("Get configuration", xerr);
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
|
/* get-config returns a <data> tree. Save as <config> tree so it can be used
|
||||||
|
* as data-store.
|
||||||
|
*/
|
||||||
|
if (xml_name_set(xt, "config") < 0)
|
||||||
|
goto done;
|
||||||
if ((f = fopen(filename, "w")) == NULL){
|
if ((f = fopen(filename, "w")) == NULL){
|
||||||
clicon_err(OE_CFG, errno, "Creating file %s", filename);
|
clicon_err(OE_CFG, errno, "Creating file %s", filename);
|
||||||
goto done;
|
goto done;
|
||||||
|
|
|
||||||
|
|
@ -238,7 +238,6 @@ yang2cli_var_sub(clicon_handle h,
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
else{ /* Cligen does not have 'max' keyword in range so need to find actual
|
else{ /* Cligen does not have 'max' keyword in range so need to find actual
|
||||||
max value of type if yang range expression is 0..max
|
max value of type if yang range expression is 0..max
|
||||||
*/
|
*/
|
||||||
|
|
|
||||||
|
|
@ -172,12 +172,22 @@ cli_parse_file(clicon_handle h,
|
||||||
}
|
}
|
||||||
|
|
||||||
int
|
int
|
||||||
cli_susp_hook(clicon_handle h, cli_susphook_t *fn)
|
cli_susp_hook(clicon_handle h,
|
||||||
|
cligen_susp_cb_t *fn)
|
||||||
{
|
{
|
||||||
cligen_handle ch = cligen(h);
|
cligen_handle ch = cligen(h);
|
||||||
|
|
||||||
/* This assume first arg of fn can be treated as void* */
|
/* This assume first arg of fn can be treated as void* */
|
||||||
return cligen_susp_hook(ch, (cligen_susp_cb_t*)fn);
|
return cligen_susp_hook(ch, fn);
|
||||||
|
}
|
||||||
|
int
|
||||||
|
cli_interrupt_hook(clicon_handle h,
|
||||||
|
cligen_interrupt_cb_t *fn)
|
||||||
|
{
|
||||||
|
cligen_handle ch = cligen(h);
|
||||||
|
|
||||||
|
/* This assume first arg of fn can be treated as void* */
|
||||||
|
return cligen_interrupt_hook(ch, fn);
|
||||||
}
|
}
|
||||||
|
|
||||||
char *
|
char *
|
||||||
|
|
|
||||||
|
|
@ -39,7 +39,7 @@
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Prototypes
|
* Prototypes
|
||||||
* Internal prototypes. For exported functions see clicon_cli_api.h
|
* Internal prototypes. For exported functions see clixon_cli_api.h
|
||||||
*/
|
*/
|
||||||
int cli_parse_file(clicon_handle h,
|
int cli_parse_file(clicon_handle h,
|
||||||
FILE *f,
|
FILE *f,
|
||||||
|
|
@ -47,7 +47,9 @@ int cli_parse_file(clicon_handle h,
|
||||||
parse_tree *pt,
|
parse_tree *pt,
|
||||||
cvec *globals);
|
cvec *globals);
|
||||||
|
|
||||||
int cli_susp_hook(clicon_handle h, cli_susphook_t *fn);
|
int cli_susp_hook(clicon_handle h, cligen_susp_cb_t *fn);
|
||||||
|
|
||||||
|
int cli_interrupt_hook(clicon_handle h, cligen_interrupt_cb_t *fn);
|
||||||
|
|
||||||
char *cli_nomatch(clicon_handle h);
|
char *cli_nomatch(clicon_handle h);
|
||||||
|
|
||||||
|
|
@ -56,8 +58,8 @@ int cli_prompt_set(clicon_handle h, char *prompt);
|
||||||
int cli_logsyntax_set(clicon_handle h, int status);
|
int cli_logsyntax_set(clicon_handle h, int status);
|
||||||
|
|
||||||
/* Internal functions for handling cli groups */
|
/* Internal functions for handling cli groups */
|
||||||
|
|
||||||
cli_syntax_t *cli_syntax(clicon_handle h);
|
cli_syntax_t *cli_syntax(clicon_handle h);
|
||||||
|
|
||||||
int cli_syntax_set(clicon_handle h, cli_syntax_t *stx);
|
int cli_syntax_set(clicon_handle h, cli_syntax_t *stx);
|
||||||
|
|
||||||
#endif /* _CLI_HANDLE_H_ */
|
#endif /* _CLI_HANDLE_H_ */
|
||||||
|
|
|
||||||
|
|
@ -53,6 +53,7 @@
|
||||||
#include <sys/stat.h>
|
#include <sys/stat.h>
|
||||||
#include <sys/param.h>
|
#include <sys/param.h>
|
||||||
#include <netinet/in.h>
|
#include <netinet/in.h>
|
||||||
|
#include <pwd.h>
|
||||||
#include <assert.h>
|
#include <assert.h>
|
||||||
#include <libgen.h>
|
#include <libgen.h>
|
||||||
|
|
||||||
|
|
@ -243,17 +244,24 @@ main(int argc, char **argv)
|
||||||
char *restarg = NULL; /* what remains after options */
|
char *restarg = NULL; /* what remains after options */
|
||||||
int dump_configfile_xml = 0;
|
int dump_configfile_xml = 0;
|
||||||
yang_spec *yspec;
|
yang_spec *yspec;
|
||||||
|
struct passwd *pw;
|
||||||
|
|
||||||
/* Defaults */
|
/* Defaults */
|
||||||
|
once = 0;
|
||||||
|
|
||||||
/* In the startup, logs to stderr & debug flag set later */
|
/* In the startup, logs to stderr & debug flag set later */
|
||||||
clicon_log_init(__PROGRAM__, LOG_INFO, logdst);
|
clicon_log_init(__PROGRAM__, LOG_INFO, logdst);
|
||||||
/* Initiate CLICON handle */
|
/* Initiate CLICON handle */
|
||||||
if ((h = cli_handle_init()) == NULL)
|
if ((h = cli_handle_init()) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
|
/* Set username to clicon handle. Use in all communication to backend */
|
||||||
if (cli_plugin_init(h) != 0)
|
if ((pw = getpwuid(getuid())) == NULL){
|
||||||
|
clicon_err(OE_UNIX, errno, "getpwuid");
|
||||||
goto done;
|
goto done;
|
||||||
once = 0;
|
}
|
||||||
|
if (clicon_username_set(h, pw->pw_name) < 0)
|
||||||
|
goto done;
|
||||||
|
|
||||||
cligen_comment_set(cli_cligen(h), '#'); /* Default to handle #! clicon_cli scripts */
|
cligen_comment_set(cli_cligen(h), '#'); /* Default to handle #! clicon_cli scripts */
|
||||||
|
|
||||||
/*
|
/*
|
||||||
|
|
@ -460,7 +468,7 @@ main(int argc, char **argv)
|
||||||
*/
|
*/
|
||||||
tmp = *(argv-1);
|
tmp = *(argv-1);
|
||||||
*(argv-1) = argv0;
|
*(argv-1) = argv0;
|
||||||
cli_plugin_start(h, argc+1, argv-1);
|
clixon_plugin_start(h, argc+1, argv-1);
|
||||||
*(argv-1) = tmp;
|
*(argv-1) = tmp;
|
||||||
|
|
||||||
cligen_line_scrolling_set(cli_cligen(h), clicon_option_int(h,"CLICON_CLI_LINESCROLLING"));
|
cligen_line_scrolling_set(cli_cligen(h), clicon_option_int(h,"CLICON_CLI_LINESCROLLING"));
|
||||||
|
|
|
||||||
|
|
@ -66,15 +66,6 @@
|
||||||
#include "cli_plugin.h"
|
#include "cli_plugin.h"
|
||||||
#include "cli_handle.h"
|
#include "cli_handle.h"
|
||||||
|
|
||||||
|
|
||||||
/*! Name of master plugin functions
|
|
||||||
* More in clicon_plugin.h
|
|
||||||
* @note not really used consider documenting or remove
|
|
||||||
*/
|
|
||||||
#define PLUGIN_PROMPT_HOOK "plugin_prompt_hook"
|
|
||||||
#define PLUGIN_PARSE_HOOK "plugin_parse_hook"
|
|
||||||
#define PLUGIN_SUSP_HOOK "plugin_susp_hook"
|
|
||||||
|
|
||||||
/*
|
/*
|
||||||
*
|
*
|
||||||
* CLI PLUGIN INTERFACE, INTERNAL SECTION
|
* CLI PLUGIN INTERFACE, INTERNAL SECTION
|
||||||
|
|
@ -84,7 +75,9 @@
|
||||||
/*! Find syntax mode named 'mode'. Create if specified
|
/*! Find syntax mode named 'mode'. Create if specified
|
||||||
*/
|
*/
|
||||||
static cli_syntaxmode_t *
|
static cli_syntaxmode_t *
|
||||||
syntax_mode_find(cli_syntax_t *stx, const char *mode, int create)
|
syntax_mode_find(cli_syntax_t *stx,
|
||||||
|
const char *mode,
|
||||||
|
int create)
|
||||||
{
|
{
|
||||||
cli_syntaxmode_t *m;
|
cli_syntaxmode_t *m;
|
||||||
|
|
||||||
|
|
@ -113,34 +106,20 @@ syntax_mode_find(cli_syntax_t *stx, const char *mode, int create)
|
||||||
return m;
|
return m;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Find plugin by name
|
|
||||||
*/
|
|
||||||
static struct cli_plugin *
|
|
||||||
plugin_find_cli(cli_syntax_t *stx, char *plgnam)
|
|
||||||
{
|
|
||||||
struct cli_plugin *p;
|
|
||||||
|
|
||||||
if ((p = stx->stx_plugins) != NULL)
|
|
||||||
do {
|
|
||||||
if (strcmp (p->cp_name, plgnam) == 0)
|
|
||||||
return p;
|
|
||||||
p = NEXTQ(struct cli_plugin *, p);
|
|
||||||
} while (p && p != stx->stx_plugins);
|
|
||||||
|
|
||||||
return NULL;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Generate parse tree for syntax mode
|
/*! Generate parse tree for syntax mode
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] m Syntax mode struct
|
||||||
*/
|
*/
|
||||||
static int
|
static int
|
||||||
gen_parse_tree(clicon_handle h, cli_syntaxmode_t *m)
|
gen_parse_tree(clicon_handle h,
|
||||||
|
cli_syntaxmode_t *m)
|
||||||
{
|
{
|
||||||
cligen_tree_add(cli_cligen(h), m->csm_name, m->csm_pt);
|
cligen_tree_add(cli_cligen(h), m->csm_name, m->csm_pt);
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
/*! Append syntax
|
/*! Append syntax
|
||||||
|
* @param[in] h Clicon handle
|
||||||
*/
|
*/
|
||||||
static int
|
static int
|
||||||
syntax_append(clicon_handle h,
|
syntax_append(clicon_handle h,
|
||||||
|
|
@ -159,27 +138,18 @@ syntax_append(clicon_handle h,
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Unload all plugins in a group
|
/*! Remove all cligen syntax modes
|
||||||
|
* @param[in] h Clicon handle
|
||||||
*/
|
*/
|
||||||
static int
|
static int
|
||||||
cli_syntax_unload(clicon_handle h)
|
cli_syntax_unload(clicon_handle h)
|
||||||
{
|
{
|
||||||
cli_syntax_t *stx = cli_syntax(h);
|
cli_syntax_t *stx = cli_syntax(h);
|
||||||
struct cli_plugin *p;
|
|
||||||
cli_syntaxmode_t *m;
|
cli_syntaxmode_t *m;
|
||||||
|
|
||||||
if (stx == NULL)
|
if (stx == NULL)
|
||||||
return 0;
|
return 0;
|
||||||
|
|
||||||
while (stx->stx_nplugins > 0) {
|
|
||||||
p = stx->stx_plugins;
|
|
||||||
plugin_unload(h, p->cp_handle);
|
|
||||||
clicon_debug(1, "DEBUG: Plugin '%s' unloaded.", p->cp_name);
|
|
||||||
DELQ(p, stx->stx_plugins, struct cli_plugin *);
|
|
||||||
if (p)
|
|
||||||
free(p);
|
|
||||||
stx->stx_nplugins--;
|
|
||||||
}
|
|
||||||
while (stx->stx_nmodes > 0) {
|
while (stx->stx_nmodes > 0) {
|
||||||
m = stx->stx_modes;
|
m = stx->stx_modes;
|
||||||
DELQ(m, stx->stx_modes, cli_syntaxmode_t *);
|
DELQ(m, stx->stx_modes, cli_syntaxmode_t *);
|
||||||
|
|
@ -239,34 +209,6 @@ clixon_str2fn(char *name,
|
||||||
return NULL;
|
return NULL;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Load a dynamic plugin object and call it's init-function
|
|
||||||
* Note 'file' may be destructively modified
|
|
||||||
* @retval plugin-handle should be freed after use
|
|
||||||
*/
|
|
||||||
static plghndl_t
|
|
||||||
cli_plugin_load(clicon_handle h,
|
|
||||||
char *file,
|
|
||||||
int dlflags)
|
|
||||||
{
|
|
||||||
char *name;
|
|
||||||
plghndl_t handle = NULL;
|
|
||||||
struct cli_plugin *cp = NULL;
|
|
||||||
|
|
||||||
if ((handle = plugin_load(h, file, dlflags)) == NULL)
|
|
||||||
goto quit;
|
|
||||||
if ((cp = malloc(sizeof (struct cli_plugin))) == NULL) {
|
|
||||||
perror("malloc");
|
|
||||||
goto quit;
|
|
||||||
}
|
|
||||||
memset (cp, 0, sizeof(*cp));
|
|
||||||
name = basename(file);
|
|
||||||
snprintf(cp->cp_name, sizeof(cp->cp_name), "%.*s", (int)strlen(name)-3, name);
|
|
||||||
cp->cp_handle = handle;
|
|
||||||
|
|
||||||
quit:
|
|
||||||
return cp;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Append to syntax mode from file
|
/*! Append to syntax mode from file
|
||||||
* @param[in] h Clixon handle
|
* @param[in] h Clixon handle
|
||||||
* @param[in] filename Name of file where syntax is specified (in syntax-group dir)
|
* @param[in] filename Name of file where syntax is specified (in syntax-group dir)
|
||||||
|
|
@ -288,7 +230,7 @@ cli_load_syntax(clicon_handle h,
|
||||||
char **vec = NULL;
|
char **vec = NULL;
|
||||||
int i, nvec;
|
int i, nvec;
|
||||||
char *plgnam;
|
char *plgnam;
|
||||||
struct cli_plugin *p;
|
clixon_plugin *cp;
|
||||||
|
|
||||||
if (dir)
|
if (dir)
|
||||||
snprintf(filepath, MAXPATHLEN-1, "%s/%s", dir, filename);
|
snprintf(filepath, MAXPATHLEN-1, "%s/%s", dir, filename);
|
||||||
|
|
@ -318,8 +260,8 @@ cli_load_syntax(clicon_handle h,
|
||||||
mode = cvec_find_str(cvv, "CLICON_MODE");
|
mode = cvec_find_str(cvv, "CLICON_MODE");
|
||||||
|
|
||||||
if (plgnam != NULL) { /* Find plugin for callback resolving */
|
if (plgnam != NULL) { /* Find plugin for callback resolving */
|
||||||
if ((p = plugin_find_cli (cli_syntax(h), plgnam)) != NULL)
|
if ((cp = clixon_plugin_find(h, plgnam)) != NULL)
|
||||||
handle = p->cp_handle;
|
handle = cp->cp_handle;
|
||||||
if (handle == NULL){
|
if (handle == NULL){
|
||||||
clicon_err(OE_PLUGIN, 0, "CLICON_PLUGIN set to '%s' in %s but plugin %s.so not found in %s\n",
|
clicon_err(OE_PLUGIN, 0, "CLICON_PLUGIN set to '%s' in %s but plugin %s.so not found in %s\n",
|
||||||
plgnam, filename, plgnam,
|
plgnam, filename, plgnam,
|
||||||
|
|
@ -327,7 +269,6 @@ cli_load_syntax(clicon_handle h,
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Resolve callback names to function pointers. */
|
/* Resolve callback names to function pointers. */
|
||||||
if (cligen_callbackv_str2fn(pt, (cgv_str2fn_t*)clixon_str2fn, handle) < 0){
|
if (cligen_callbackv_str2fn(pt, (cgv_str2fn_t*)clixon_str2fn, handle) < 0){
|
||||||
clicon_err(OE_PLUGIN, 0, "Mismatch between CLIgen file '%s' and CLI plugin file '%s'. Some possible errors:\n\t1. A function given in the CLIgen file does not exist in the plugin (ie link error)\n\t2. The CLIgen spec does not point to the correct plugin .so file (CLICON_PLUGIN=\"%s\" is wrong)",
|
clicon_err(OE_PLUGIN, 0, "Mismatch between CLIgen file '%s' and CLI plugin file '%s'. Some possible errors:\n\t1. A function given in the CLIgen file does not exist in the plugin (ie link error)\n\t2. The CLIgen spec does not point to the correct plugin .so file (CLICON_PLUGIN=\"%s\" is wrong)",
|
||||||
|
|
@ -345,7 +286,10 @@ cli_load_syntax(clicon_handle h,
|
||||||
if ((vec = clicon_strsep(mode, ":", &nvec)) == NULL)
|
if ((vec = clicon_strsep(mode, ":", &nvec)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
for (i = 0; i < nvec; i++) {
|
for (i = 0; i < nvec; i++) {
|
||||||
if (syntax_append(h, cli_syntax(h), vec[i], pt) < 0) {
|
if (syntax_append(h,
|
||||||
|
cli_syntax(h),
|
||||||
|
vec[i],
|
||||||
|
pt) < 0) {
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
if (prompt)
|
if (prompt)
|
||||||
|
|
@ -363,77 +307,7 @@ done:
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Load plugins within a directory
|
/*! Load a syntax group. Includes both CLI plugin and CLIgen spec syntax files.
|
||||||
*/
|
|
||||||
static int
|
|
||||||
cli_plugin_load_dir(clicon_handle h,
|
|
||||||
char *dir,
|
|
||||||
cli_syntax_t *stx)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
int ndp;
|
|
||||||
struct dirent *dp = NULL;
|
|
||||||
char *master_plugin;
|
|
||||||
char master[MAXPATHLEN];
|
|
||||||
char filename[MAXPATHLEN];
|
|
||||||
struct cli_plugin *cp;
|
|
||||||
struct stat st;
|
|
||||||
int retval = -1;
|
|
||||||
|
|
||||||
|
|
||||||
/* Format master plugin path */
|
|
||||||
if ((master_plugin = clicon_master_plugin(h)) == NULL){
|
|
||||||
clicon_err(OE_PLUGIN, 0, "clicon_master_plugin option not set");
|
|
||||||
goto quit;
|
|
||||||
}
|
|
||||||
snprintf(master, MAXPATHLEN-1, "%s.so", master_plugin);
|
|
||||||
|
|
||||||
/* Get plugin objects names from plugin directory */
|
|
||||||
ndp = clicon_file_dirent(dir, &dp, "(.so)$", S_IFREG);
|
|
||||||
if (ndp < 0)
|
|
||||||
goto quit;
|
|
||||||
|
|
||||||
/* Load master plugin first */
|
|
||||||
snprintf(filename, MAXPATHLEN-1, "%s/%s", dir, master);
|
|
||||||
if (stat(filename, &st) == 0) {
|
|
||||||
clicon_debug(1, "DEBUG: Loading master plugin '%s'", master);
|
|
||||||
cp = cli_plugin_load(h, filename, RTLD_NOW|RTLD_GLOBAL);
|
|
||||||
if (cp == NULL)
|
|
||||||
goto quit;
|
|
||||||
/* Look up certain call-backs in master plugin */
|
|
||||||
stx->stx_prompt_hook =
|
|
||||||
dlsym(cp->cp_handle, PLUGIN_PROMPT_HOOK);
|
|
||||||
stx->stx_parse_hook =
|
|
||||||
dlsym(cp->cp_handle, PLUGIN_PARSE_HOOK);
|
|
||||||
stx->stx_susp_hook =
|
|
||||||
dlsym(cp->cp_handle, PLUGIN_SUSP_HOOK);
|
|
||||||
INSQ(cp, stx->stx_plugins);
|
|
||||||
stx->stx_nplugins++;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Load the rest */
|
|
||||||
for (i = 0; i < ndp; i++) {
|
|
||||||
if (strcmp (dp[i].d_name, master) == 0)
|
|
||||||
continue; /* Skip master now */
|
|
||||||
snprintf(filename, MAXPATHLEN-1, "%s/%s", dir, dp[i].d_name);
|
|
||||||
clicon_debug(1, "DEBUG: Loading plugin '%s'", dp[i].d_name);
|
|
||||||
|
|
||||||
if ((cp = cli_plugin_load (h, filename, RTLD_NOW)) == NULL)
|
|
||||||
goto quit;
|
|
||||||
INSQ(cp, stx->stx_plugins);
|
|
||||||
stx->stx_nplugins++;
|
|
||||||
}
|
|
||||||
|
|
||||||
retval = 0;
|
|
||||||
|
|
||||||
quit:
|
|
||||||
if (dp)
|
|
||||||
free(dp);
|
|
||||||
return retval;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/*! Load a syntax group.
|
|
||||||
* @param[in] h Clicon handle
|
* @param[in] h Clicon handle
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
|
|
@ -448,6 +322,9 @@ cli_syntax_load (clicon_handle h)
|
||||||
struct dirent *dp = NULL;
|
struct dirent *dp = NULL;
|
||||||
cli_syntax_t *stx;
|
cli_syntax_t *stx;
|
||||||
cli_syntaxmode_t *m;
|
cli_syntaxmode_t *m;
|
||||||
|
cligen_susp_cb_t *fns = NULL;
|
||||||
|
cligen_interrupt_cb_t *fni = NULL;
|
||||||
|
clixon_plugin *cp;
|
||||||
|
|
||||||
/* Syntax already loaded. XXX should we re-load?? */
|
/* Syntax already loaded. XXX should we re-load?? */
|
||||||
if ((stx = cli_syntax(h)) != NULL)
|
if ((stx = cli_syntax(h)) != NULL)
|
||||||
|
|
@ -461,59 +338,62 @@ cli_syntax_load (clicon_handle h)
|
||||||
/* Allocate plugin group object */
|
/* Allocate plugin group object */
|
||||||
if ((stx = malloc(sizeof(*stx))) == NULL) {
|
if ((stx = malloc(sizeof(*stx))) == NULL) {
|
||||||
clicon_err(OE_UNIX, errno, "malloc");
|
clicon_err(OE_UNIX, errno, "malloc");
|
||||||
goto quit;
|
goto done;
|
||||||
}
|
}
|
||||||
memset (stx, 0, sizeof (*stx)); /* Zero out all */
|
memset (stx, 0, sizeof (*stx)); /* Zero out all */
|
||||||
|
|
||||||
cli_syntax_set(h, stx);
|
cli_syntax_set(h, stx);
|
||||||
|
|
||||||
/* First load CLICON system plugins. CLIXON_CLI_SYSDIR is defined
|
/* Load cli plugins */
|
||||||
in Makefile*/
|
if (plugin_dir &&
|
||||||
if (cli_plugin_load_dir(h, CLIXON_CLI_SYSDIR, stx) < 0)
|
clixon_plugins_load(h, CLIXON_PLUGIN_INIT, plugin_dir, NULL)< 0)
|
||||||
goto quit;
|
goto done;
|
||||||
|
|
||||||
/* Then load application plugins */
|
|
||||||
if (plugin_dir && cli_plugin_load_dir(h, plugin_dir, stx) < 0)
|
|
||||||
goto quit;
|
|
||||||
|
|
||||||
if (clispec_file){
|
if (clispec_file){
|
||||||
if (cli_load_syntax(h, clispec_file, NULL) < 0)
|
if (cli_load_syntax(h, clispec_file, NULL) < 0)
|
||||||
goto quit;
|
goto done;
|
||||||
}
|
}
|
||||||
if (clispec_dir){
|
if (clispec_dir){
|
||||||
/* load syntaxfiles */
|
/* load syntaxfiles */
|
||||||
if ((ndp = clicon_file_dirent(clispec_dir, &dp, "(.cli)$", S_IFREG)) < 0)
|
if ((ndp = clicon_file_dirent(clispec_dir, &dp, "(.cli)$", S_IFREG)) < 0)
|
||||||
goto quit;
|
goto done;
|
||||||
/* Load the rest */
|
/* Load the rest */
|
||||||
for (i = 0; i < ndp; i++) {
|
for (i = 0; i < ndp; i++) {
|
||||||
clicon_debug(1, "DEBUG: Loading syntax '%.*s'",
|
clicon_debug(1, "DEBUG: Loading syntax '%.*s'",
|
||||||
(int)strlen(dp[i].d_name)-4, dp[i].d_name);
|
(int)strlen(dp[i].d_name)-4, dp[i].d_name);
|
||||||
if (cli_load_syntax(h, dp[i].d_name, clispec_dir) < 0)
|
if (cli_load_syntax(h, dp[i].d_name, clispec_dir) < 0)
|
||||||
goto quit;
|
goto done;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
/* Did we successfully load any syntax modes? */
|
/* Did we successfully load any syntax modes? */
|
||||||
if (stx->stx_nmodes <= 0) {
|
if (stx->stx_nmodes <= 0) {
|
||||||
retval = 0;
|
retval = 0;
|
||||||
goto quit;
|
goto done;
|
||||||
}
|
}
|
||||||
/* Parse syntax tree for all modes */
|
/* Parse syntax tree for all modes */
|
||||||
m = stx->stx_modes;
|
m = stx->stx_modes;
|
||||||
do {
|
do {
|
||||||
if (gen_parse_tree(h, m) != 0)
|
if (gen_parse_tree(h, m) != 0)
|
||||||
goto quit;
|
goto done;
|
||||||
m = NEXTQ(cli_syntaxmode_t *, m);
|
m = NEXTQ(cli_syntaxmode_t *, m);
|
||||||
} while (m && m != stx->stx_modes);
|
} while (m && m != stx->stx_modes);
|
||||||
|
|
||||||
|
/* Set susp and interrupt callbacks into CLIgen */
|
||||||
/* Set callbacks into CLIgen */
|
cp = NULL;
|
||||||
cli_susp_hook(h, cli_syntax(h)->stx_susp_hook);
|
while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
|
if (fns==NULL && (fns = cp->cp_api.ca_suspend) != NULL)
|
||||||
|
if (cli_susp_hook(h, fns) < 0)
|
||||||
|
goto done;
|
||||||
|
if (fni==NULL && (fni = cp->cp_api.ca_interrupt) != NULL)
|
||||||
|
if (cli_susp_hook(h, fns) < 0)
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
/* All good. We can now proudly return a new group */
|
/* All good. We can now proudly return a new group */
|
||||||
retval = 0;
|
retval = 0;
|
||||||
|
|
||||||
quit:
|
done:
|
||||||
if (retval != 0) {
|
if (retval != 0) {
|
||||||
|
clixon_plugin_exit(h);
|
||||||
cli_syntax_unload(h);
|
cli_syntax_unload(h);
|
||||||
cli_syntax_set(h, NULL);
|
cli_syntax_set(h, NULL);
|
||||||
}
|
}
|
||||||
|
|
@ -522,34 +402,15 @@ quit:
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Call plugin_start() in all plugins
|
/*! Remove syntax modes and remove syntax
|
||||||
*/
|
* @param[in] h Clicon handle
|
||||||
int
|
|
||||||
cli_plugin_start(clicon_handle h, int argc, char **argv)
|
|
||||||
{
|
|
||||||
struct cli_plugin *p;
|
|
||||||
cli_syntax_t *stx;
|
|
||||||
plgstart_t *startfun;
|
|
||||||
// XXX int (*startfun)(clicon_handle, int, char **);
|
|
||||||
|
|
||||||
stx = cli_syntax(h);
|
|
||||||
|
|
||||||
if ((p = stx->stx_plugins) != NULL)
|
|
||||||
do {
|
|
||||||
startfun = dlsym(p->cp_handle, PLUGIN_START);
|
|
||||||
if (dlerror() == NULL)
|
|
||||||
startfun(h, argc, argv);
|
|
||||||
p = NEXTQ(struct cli_plugin *, p);
|
|
||||||
} while (p && p != stx->stx_plugins);
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*
|
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
cli_plugin_finish(clicon_handle h)
|
cli_plugin_finish(clicon_handle h)
|
||||||
{
|
{
|
||||||
|
/* Remove all CLI plugins */
|
||||||
|
clixon_plugin_exit(h);
|
||||||
|
/* Remove all cligen syntax modes */
|
||||||
cli_syntax_unload(h);
|
cli_syntax_unload(h);
|
||||||
cli_syntax_set(h, NULL);
|
cli_syntax_set(h, NULL);
|
||||||
return 0;
|
return 0;
|
||||||
|
|
@ -558,6 +419,7 @@ cli_plugin_finish(clicon_handle h)
|
||||||
/*! Help function to print a meaningful error string.
|
/*! Help function to print a meaningful error string.
|
||||||
* Sometimes the libraries specify an error string, if so print that.
|
* Sometimes the libraries specify an error string, if so print that.
|
||||||
* Otherwise just print 'command error'.
|
* Otherwise just print 'command error'.
|
||||||
|
* @param[in] f File handler to write error to.
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
cli_handler_err(FILE *f)
|
cli_handler_err(FILE *f)
|
||||||
|
|
@ -679,15 +541,6 @@ clicon_parse(clicon_handle h,
|
||||||
goto done;
|
goto done;
|
||||||
case CG_NOMATCH: /* no match */
|
case CG_NOMATCH: /* no match */
|
||||||
smode = NULL;
|
smode = NULL;
|
||||||
if (stx->stx_parse_hook) {
|
|
||||||
/* Try to find a match in upper modes, a'la IOS. */
|
|
||||||
if ((modename = stx->stx_parse_hook(h, cmd, modename)) != NULL) {
|
|
||||||
if ((smode = syntax_mode_find(stx, modename, 0)) != NULL)
|
|
||||||
continue;
|
|
||||||
else
|
|
||||||
cli_output(f, "Can't find syntax mode '%s'\n", modename);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
/* clicon_err(OE_CFG, 0, "CLI syntax error: \"%s\": %s",
|
/* clicon_err(OE_CFG, 0, "CLI syntax error: \"%s\": %s",
|
||||||
cmd, cli_nomatch(h));*/
|
cmd, cli_nomatch(h));*/
|
||||||
cli_output(f, "CLI syntax error: \"%s\": %s\n",
|
cli_output(f, "CLI syntax error: \"%s\": %s\n",
|
||||||
|
|
@ -718,6 +571,7 @@ done:
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Read command from CLIgen's cliread() using current syntax mode.
|
/*! Read command from CLIgen's cliread() using current syntax mode.
|
||||||
|
* @param[in] h Clicon handle
|
||||||
* @retval string char* buffer containing CLIgen command
|
* @retval string char* buffer containing CLIgen command
|
||||||
* @retval NULL Fatal error
|
* @retval NULL Fatal error
|
||||||
*/
|
*/
|
||||||
|
|
@ -728,12 +582,19 @@ clicon_cliread(clicon_handle h)
|
||||||
char *pfmt = NULL;
|
char *pfmt = NULL;
|
||||||
cli_syntaxmode_t *mode;
|
cli_syntaxmode_t *mode;
|
||||||
cli_syntax_t *stx;
|
cli_syntax_t *stx;
|
||||||
|
cli_prompthook_t *fn;
|
||||||
|
clixon_plugin *cp;
|
||||||
|
|
||||||
stx = cli_syntax(h);
|
stx = cli_syntax(h);
|
||||||
mode = stx->stx_active_mode;
|
mode = stx->stx_active_mode;
|
||||||
|
/* Get prompt from plugin callback? */
|
||||||
if (stx->stx_prompt_hook)
|
cp = NULL;
|
||||||
pfmt = stx->stx_prompt_hook(h, mode->csm_name);
|
while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
|
if ((fn = cp->cp_api.ca_prompt) == NULL)
|
||||||
|
continue;
|
||||||
|
pfmt = fn(h, mode->csm_name);
|
||||||
|
break;
|
||||||
|
}
|
||||||
if (clicon_quiet_mode(h))
|
if (clicon_quiet_mode(h))
|
||||||
cli_prompt_set(h, "");
|
cli_prompt_set(h, "");
|
||||||
else
|
else
|
||||||
|
|
@ -745,42 +606,6 @@ clicon_cliread(clicon_handle h)
|
||||||
return ret;
|
return ret;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
|
||||||
* cli_find_plugin
|
|
||||||
* Find a plugin by name and return the dlsym handl
|
|
||||||
* Used by libclicon code to find callback funcctions in plugins.
|
|
||||||
*/
|
|
||||||
static void *
|
|
||||||
cli_find_plugin(clicon_handle h, char *plugin)
|
|
||||||
{
|
|
||||||
struct cli_plugin *p;
|
|
||||||
|
|
||||||
p = plugin_find_cli(cli_syntax(h), plugin);
|
|
||||||
if (p)
|
|
||||||
return p->cp_handle;
|
|
||||||
|
|
||||||
return NULL;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/*! Initialize plugin code (not the plugins themselves)
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
cli_plugin_init(clicon_handle h)
|
|
||||||
{
|
|
||||||
find_plugin_t *fp = cli_find_plugin;
|
|
||||||
clicon_hash_t *data = clicon_data(h);
|
|
||||||
|
|
||||||
/* Register CLICON_FIND_PLUGIN in data hash */
|
|
||||||
if (hash_add(data, "CLICON_FIND_PLUGIN", &fp, sizeof(fp)) == NULL) {
|
|
||||||
clicon_err(OE_UNIX, errno, "failed to register CLICON_FIND_PLUGIN");
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/*
|
/*
|
||||||
*
|
*
|
||||||
* CLI PLUGIN INTERFACE, PUBLIC SECTION
|
* CLI PLUGIN INTERFACE, PUBLIC SECTION
|
||||||
|
|
@ -788,11 +613,12 @@ cli_plugin_init(clicon_handle h)
|
||||||
*/
|
*/
|
||||||
|
|
||||||
|
|
||||||
/*
|
/*! Set syntax mode mode for existing current plugin group.
|
||||||
* Set syntax mode mode for existing current plugin group.
|
* @param[in] h Clicon handle
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
cli_set_syntax_mode(clicon_handle h, const char *name)
|
cli_set_syntax_mode(clicon_handle h,
|
||||||
|
const char *name)
|
||||||
{
|
{
|
||||||
cli_syntaxmode_t *mode;
|
cli_syntaxmode_t *mode;
|
||||||
|
|
||||||
|
|
@ -803,8 +629,8 @@ cli_set_syntax_mode(clicon_handle h, const char *name)
|
||||||
return 1;
|
return 1;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
/*! Get syntax mode name
|
||||||
* Get syntax mode name
|
* @param[in] h Clicon handle
|
||||||
*/
|
*/
|
||||||
char *
|
char *
|
||||||
cli_syntax_mode(clicon_handle h)
|
cli_syntax_mode(clicon_handle h)
|
||||||
|
|
@ -816,15 +642,15 @@ cli_syntax_mode(clicon_handle h)
|
||||||
return csm->csm_name;
|
return csm->csm_name;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*! Callback from cli_set_prompt(). Set prompt format for syntax mode
|
||||||
/*
|
* @param[in] h Clicon handle
|
||||||
* Callback from cli_set_prompt(). Set prompt format for syntax mode
|
* @param[in] name Name of syntax mode
|
||||||
* Arguments:
|
* @param[in] prompt Prompt format
|
||||||
* name : Name of syntax mode
|
|
||||||
* prompt : Prompt format
|
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
cli_set_prompt(clicon_handle h, const char *name, const char *prompt)
|
cli_set_prompt(clicon_handle h,
|
||||||
|
const char *name,
|
||||||
|
const char *prompt)
|
||||||
{
|
{
|
||||||
cli_syntaxmode_t *m;
|
cli_syntaxmode_t *m;
|
||||||
|
|
||||||
|
|
@ -836,9 +662,14 @@ cli_set_prompt(clicon_handle h, const char *name, const char *prompt)
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Format prompt
|
/*! Format prompt
|
||||||
|
* @param[out] prompt Prompt string to be written
|
||||||
|
* @param[in] plen Length of prompt string
|
||||||
|
* @param[in] fmt Stdarg fmt string
|
||||||
*/
|
*/
|
||||||
static int
|
static int
|
||||||
prompt_fmt (char *prompt, size_t plen, char *fmt, ...)
|
prompt_fmt (char *prompt,
|
||||||
|
size_t plen,
|
||||||
|
char *fmt, ...)
|
||||||
{
|
{
|
||||||
va_list ap;
|
va_list ap;
|
||||||
char *s = fmt;
|
char *s = fmt;
|
||||||
|
|
@ -854,7 +685,6 @@ prompt_fmt (char *prompt, size_t plen, char *fmt, ...)
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Start with empty string */
|
/* Start with empty string */
|
||||||
cprintf(cb, "");
|
|
||||||
while(*s) {
|
while(*s) {
|
||||||
if (*s == '%' && *++s) {
|
if (*s == '%' && *++s) {
|
||||||
switch(*s) {
|
switch(*s) {
|
||||||
|
|
@ -881,7 +711,6 @@ prompt_fmt (char *prompt, size_t plen, char *fmt, ...)
|
||||||
cprintf(cb, "%c", *s);
|
cprintf(cb, "%c", *s);
|
||||||
s++;
|
s++;
|
||||||
}
|
}
|
||||||
|
|
||||||
done:
|
done:
|
||||||
if (cb)
|
if (cb)
|
||||||
fmt = cbuf_get(cb);
|
fmt = cbuf_get(cb);
|
||||||
|
|
@ -894,6 +723,7 @@ done:
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Return a formatted prompt string
|
/*! Return a formatted prompt string
|
||||||
|
* @param[in] fmt Format string
|
||||||
*/
|
*/
|
||||||
char *
|
char *
|
||||||
cli_prompt(char *fmt)
|
cli_prompt(char *fmt)
|
||||||
|
|
@ -906,55 +736,3 @@ cli_prompt(char *fmt)
|
||||||
return prompt;
|
return prompt;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Find a cli plugin based on name and resolve a function pointer in it.
|
|
||||||
* Callback from clicon_dbvars_parse()
|
|
||||||
* Find a cli plugin based on name if given and use dlsym to resolve a
|
|
||||||
* function pointer in it.
|
|
||||||
* Call the resolved function to get the cgv populated
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
clicon_valcb(void *arg, cvec *vars, cg_var *cgv, char *fname, cg_var *funcarg)
|
|
||||||
{
|
|
||||||
char *func;
|
|
||||||
char *plgnam = NULL;
|
|
||||||
void *handle;
|
|
||||||
struct cli_plugin *p;
|
|
||||||
cli_valcb_t *cb;
|
|
||||||
clicon_handle h = (clicon_handle)arg;
|
|
||||||
|
|
||||||
/* Make copy */
|
|
||||||
if ((fname = strdup(fname)) == NULL) {
|
|
||||||
clicon_err(OE_UNIX, errno, "strdup");
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Extract plugin name if any */
|
|
||||||
if ((func = strstr(fname, "::")) != NULL) {
|
|
||||||
*func = '\0';
|
|
||||||
func += 2;
|
|
||||||
plgnam = fname;
|
|
||||||
}
|
|
||||||
else
|
|
||||||
func = fname;
|
|
||||||
|
|
||||||
/* If we have specified a plugin name, find the handle to be used
|
|
||||||
* with dlsym()
|
|
||||||
*/
|
|
||||||
handle = NULL;
|
|
||||||
if (plgnam && (p = plugin_find_cli(cli_syntax(h), plgnam)))
|
|
||||||
handle = p->cp_handle;
|
|
||||||
|
|
||||||
/* Look up function pointer */
|
|
||||||
if ((cb = dlsym(handle, func)) == NULL) {
|
|
||||||
clicon_err(OE_UNIX, errno, "unable to find %s()", func);
|
|
||||||
free(fname);
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
free(fname);
|
|
||||||
|
|
||||||
if (cb(vars, cgv, funcarg) < 0)
|
|
||||||
return -1;
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -43,19 +43,7 @@
|
||||||
/* clicon generic callback pointer */
|
/* clicon generic callback pointer */
|
||||||
typedef void (clicon_callback_t)(clicon_handle h);
|
typedef void (clicon_callback_t)(clicon_handle h);
|
||||||
|
|
||||||
/* clicon_set value callback */
|
/* List of syntax modes */
|
||||||
typedef int (cli_valcb_t)(cvec *vars, cg_var *cgv, cg_var *arg);
|
|
||||||
|
|
||||||
/* specific to cli. For common see clicon_plugin.h */
|
|
||||||
/* Hook to get prompt format before each getline */
|
|
||||||
typedef char *(cli_prompthook_t)(clicon_handle, char *mode);
|
|
||||||
|
|
||||||
/* Ctrl-Z hook from getline() */
|
|
||||||
typedef int (cli_susphook_t)(clicon_handle, char *, int, int *);
|
|
||||||
|
|
||||||
/* CLIgen parse failure hook. Retry other mode? */
|
|
||||||
typedef char *(cli_parsehook_t)(clicon_handle, char *, char *);
|
|
||||||
|
|
||||||
typedef struct {
|
typedef struct {
|
||||||
qelem_t csm_qelem; /* List header */
|
qelem_t csm_qelem; /* List header */
|
||||||
char csm_name[256]; /* Syntax mode name */
|
char csm_name[256]; /* Syntax mode name */
|
||||||
|
|
@ -65,32 +53,16 @@ typedef struct {
|
||||||
|
|
||||||
} cli_syntaxmode_t;
|
} cli_syntaxmode_t;
|
||||||
|
|
||||||
/* A plugin list object */
|
/* Plugin group object. Just a single object, not list. part of cli_handle */
|
||||||
struct cli_plugin {
|
|
||||||
qelem_t cp_qelem; /* List header */
|
|
||||||
char cp_name[256]; /* Plugin name */
|
|
||||||
void *cp_handle; /* Dynamic object handle */
|
|
||||||
};
|
|
||||||
|
|
||||||
/* Plugin group object */
|
|
||||||
typedef struct {
|
typedef struct {
|
||||||
int stx_nplugins; /* Number of plugins */
|
|
||||||
struct cli_plugin *stx_plugins; /* List of plugins */
|
|
||||||
int stx_nmodes; /* Number of syntax modes */
|
int stx_nmodes; /* Number of syntax modes */
|
||||||
cli_syntaxmode_t *stx_active_mode; /* Current active syntax mode */
|
cli_syntaxmode_t *stx_active_mode; /* Current active syntax mode */
|
||||||
cli_syntaxmode_t *stx_modes; /* List of syntax modes */
|
cli_syntaxmode_t *stx_modes; /* List of syntax modes */
|
||||||
cli_prompthook_t *stx_prompt_hook; /* Prompt hook */
|
|
||||||
cli_parsehook_t *stx_parse_hook; /* Parse mode hook */
|
|
||||||
cli_susphook_t *stx_susp_hook; /* Ctrl-Z hook from getline() */
|
|
||||||
} cli_syntax_t;
|
} cli_syntax_t;
|
||||||
|
|
||||||
|
|
||||||
void *clixon_str2fn(char *name, void *handle, char **error);
|
void *clixon_str2fn(char *name, void *handle, char **error);
|
||||||
|
|
||||||
int cli_plugin_start(clicon_handle, int argc, char **argv);
|
|
||||||
|
|
||||||
int cli_plugin_init(clicon_handle h);
|
|
||||||
|
|
||||||
int clicon_eval(clicon_handle h, char *cmd, cg_obj *match_obj, cvec *vr);
|
int clicon_eval(clicon_handle h, char *cmd, cg_obj *match_obj, cvec *vr);
|
||||||
|
|
||||||
int clicon_parse(clicon_handle h, char *cmd, char **mode, int *result);
|
int clicon_parse(clicon_handle h, char *cmd, char **mode, int *result);
|
||||||
|
|
|
||||||
|
|
@ -120,6 +120,7 @@ expand_dbvar(void *h,
|
||||||
yang_stmt *ypath;
|
yang_stmt *ypath;
|
||||||
cxobj *xcur;
|
cxobj *xcur;
|
||||||
char *xpathcur;
|
char *xpathcur;
|
||||||
|
char *reason = NULL;
|
||||||
|
|
||||||
if (argv == NULL || cvec_len(argv) != 2){
|
if (argv == NULL || cvec_len(argv) != 2){
|
||||||
clicon_err(OE_PLUGIN, 0, "%s: requires arguments: <db> <xmlkeyfmt>",
|
clicon_err(OE_PLUGIN, 0, "%s: requires arguments: <db> <xmlkeyfmt>",
|
||||||
|
|
@ -171,8 +172,10 @@ expand_dbvar(void *h,
|
||||||
/* This is primarily to get "y",
|
/* This is primarily to get "y",
|
||||||
* xpath2xml would have worked!!
|
* xpath2xml would have worked!!
|
||||||
*/
|
*/
|
||||||
if (api_path && api_path2xml(api_path, yspec, xtop, 0, &xbot, &y) < 0)
|
if (api_path && api_path2xml(api_path, yspec, xtop, YC_DATANODE, &xbot, &y) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
if (y==NULL)
|
||||||
|
goto ok;
|
||||||
/* Special case for leafref. Detect leafref via Yang-type,
|
/* Special case for leafref. Detect leafref via Yang-type,
|
||||||
* Get Yang path element, tentatively add the new syntax to the whole
|
* Get Yang path element, tentatively add the new syntax to the whole
|
||||||
* tree and apply the path to that.
|
* tree and apply the path to that.
|
||||||
|
|
@ -188,8 +191,12 @@ expand_dbvar(void *h,
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
xpathcur = ypath->ys_argument;
|
xpathcur = ypath->ys_argument;
|
||||||
if (xml_merge(xt, xtop, yspec) < 0) /* Merge xtop into xt */
|
if (xml_merge(xt, xtop, yspec, &reason) < 0) /* Merge xtop into xt */
|
||||||
goto done;
|
goto done;
|
||||||
|
if (reason){
|
||||||
|
cli_output(stderr, "%s\n", reason);
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
if ((xcur = xpath_first(xt, xpath)) == NULL){
|
if ((xcur = xpath_first(xt, xpath)) == NULL){
|
||||||
clicon_err(OE_DB, 0, "xpath %s should return merged content", xpath);
|
clicon_err(OE_DB, 0, "xpath %s should return merged content", xpath);
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -236,8 +243,11 @@ expand_dbvar(void *h,
|
||||||
/* XXX RFC3986 decode */
|
/* XXX RFC3986 decode */
|
||||||
cvec_add_string(commands, NULL, bodystr);
|
cvec_add_string(commands, NULL, bodystr);
|
||||||
}
|
}
|
||||||
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
if (reason)
|
||||||
|
free(reason);
|
||||||
if (api_path)
|
if (api_path)
|
||||||
free(api_path);
|
free(api_path);
|
||||||
if (xvec)
|
if (xvec)
|
||||||
|
|
@ -506,12 +516,12 @@ cli_show_config(clicon_handle h,
|
||||||
xml2txt(stdout, xc, 0); /* tree-formed text */
|
xml2txt(stdout, xc, 0); /* tree-formed text */
|
||||||
break;
|
break;
|
||||||
case FORMAT_CLI:
|
case FORMAT_CLI:
|
||||||
xc = NULL; /* Dont print xt itself */
|
/* get CLI generatade mode: VARS|ALL */
|
||||||
while ((xc = xml_child_each(xt, xc, -1)) != NULL){
|
|
||||||
if ((gt = clicon_cli_genmodel_type(h)) == GT_ERR)
|
if ((gt = clicon_cli_genmodel_type(h)) == GT_ERR)
|
||||||
goto done;
|
goto done;
|
||||||
|
xc = NULL; /* Dont print xt itself */
|
||||||
|
while ((xc = xml_child_each(xt, xc, -1)) != NULL)
|
||||||
xml2cli(stdout, xc, NULL, gt); /* cli syntax */
|
xml2cli(stdout, xc, NULL, gt); /* cli syntax */
|
||||||
}
|
|
||||||
break;
|
break;
|
||||||
case FORMAT_NETCONF:
|
case FORMAT_NETCONF:
|
||||||
fprintf(stdout, "<rpc><edit-config><target><candidate/></target><config>\n");
|
fprintf(stdout, "<rpc><edit-config><target><candidate/></target><config>\n");
|
||||||
|
|
@ -587,7 +597,14 @@ done:
|
||||||
xml_free(xt);
|
xml_free(xt);
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
int show_confv_xpath(clicon_handle h, cvec *vars, cvec *argv)
|
int show_confv_xpath(clicon_handle h, cvec *vars, cvec *argv)
|
||||||
{
|
{
|
||||||
return show_conf_xpath(h, vars, argv);
|
return show_conf_xpath(h, vars, argv);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
int cli_show_version(clicon_handle h, cvec *vars, cvec *argv)
|
||||||
|
{
|
||||||
|
cli_output(stdout, "%s\n", CLIXON_VERSION_STRING);
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
|
||||||
|
|
@ -35,6 +35,7 @@ srcdir = @srcdir@
|
||||||
top_srcdir = @top_srcdir@
|
top_srcdir = @top_srcdir@
|
||||||
CC = @CC@
|
CC = @CC@
|
||||||
CFLAGS = @CFLAGS@
|
CFLAGS = @CFLAGS@
|
||||||
|
INSTALLFLAGS = @INSTALLFLAGS@
|
||||||
LDFLAGS = @LDFLAGS@
|
LDFLAGS = @LDFLAGS@
|
||||||
|
|
||||||
prefix = @prefix@
|
prefix = @prefix@
|
||||||
|
|
@ -44,6 +45,7 @@ bindir = @bindir@
|
||||||
libdir = @libdir@
|
libdir = @libdir@
|
||||||
mandir = @mandir@
|
mandir = @mandir@
|
||||||
libexecdir = @libexecdir@
|
libexecdir = @libexecdir@
|
||||||
|
wwwdir = /www-data
|
||||||
localstatedir = @localstatedir@
|
localstatedir = @localstatedir@
|
||||||
sysconfdir = @sysconfdir@
|
sysconfdir = @sysconfdir@
|
||||||
includedir = @includedir@
|
includedir = @includedir@
|
||||||
|
|
@ -64,22 +66,32 @@ LIBS = -L$(top_srcdir)/lib/src @LIBS@ $(top_srcdir)/lib/src/$(CLIXON_LI
|
||||||
CPPFLAGS = @CPPFLAGS@ -fPIC
|
CPPFLAGS = @CPPFLAGS@ -fPIC
|
||||||
INCLUDES = -I. -I$(top_srcdir)/lib/src -I$(top_srcdir)/lib -I$(top_srcdir)/include -I$(top_srcdir) @INCLUDES@
|
INCLUDES = -I. -I$(top_srcdir)/lib/src -I$(top_srcdir)/lib -I$(top_srcdir)/include -I$(top_srcdir) @INCLUDES@
|
||||||
|
|
||||||
|
# Name of application
|
||||||
APPL = clixon_netconf
|
APPL = clixon_netconf
|
||||||
SRC = netconf_main.c
|
|
||||||
OBJS = $(SRC:.c=.o)
|
|
||||||
|
|
||||||
|
# Not accessible from plugin
|
||||||
|
APPSRC = netconf_main.c
|
||||||
|
APPSRC += netconf_hello.c
|
||||||
|
APPSRC += netconf_rpc.c
|
||||||
|
APPSRC += netconf_filter.c
|
||||||
|
APPOBJ = $(APPSRC:.c=.o)
|
||||||
|
|
||||||
|
# Accessible from plugin
|
||||||
|
LIBSRC = netconf_lib.c
|
||||||
|
|
||||||
|
|
||||||
|
LIBOBJ = $(LIBSRC:.c=.o)
|
||||||
|
|
||||||
|
# Name of lib
|
||||||
MYNAME = clixon_netconf
|
MYNAME = clixon_netconf
|
||||||
MYLIBLINK = lib$(MYNAME)$(SH_SUFFIX)
|
MYLIBLINK = lib$(MYNAME)$(SH_SUFFIX)
|
||||||
MYLIB = $(MYLIBLINK).$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
MYLIB = $(MYLIBLINK).$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
||||||
MYLIBSO = $(MYLIBLINK).$(CLIXON_MAJOR)
|
MYLIBSO = $(MYLIBLINK).$(CLIXON_MAJOR)
|
||||||
|
|
||||||
LIBSRC = netconf_hello.c netconf_rpc.c netconf_filter.c netconf_lib.c netconf_plugin.c
|
|
||||||
LIBOBJS = $(LIBSRC:.c=.o)
|
|
||||||
|
|
||||||
all: $(MYLIB) $(APPL)
|
all: $(MYLIB) $(APPL)
|
||||||
|
|
||||||
clean:
|
clean:
|
||||||
rm -f $(OBJS) $(LIBOBJS) *.core $(APPL) $(MYLIB) $(MYLIBSO) $(MYLIBLINK)
|
rm -f $(APPL) $(APPOBJ) $(LIBOBJ) *.core $(MYLIB) $(MYLIBSO) $(MYLIBLINK)
|
||||||
|
|
||||||
distclean: clean
|
distclean: clean
|
||||||
rm -f Makefile *~ .depend
|
rm -f Makefile *~ .depend
|
||||||
|
|
@ -89,18 +101,18 @@ distclean: clean
|
||||||
# Also create a libexec/ directory for writeable/temporary files.
|
# Also create a libexec/ directory for writeable/temporary files.
|
||||||
# Put config file in etc/
|
# Put config file in etc/
|
||||||
install: install-lib $(APPL)
|
install: install-lib $(APPL)
|
||||||
install -d $(DESTDIR)$(bindir)
|
install -d -m 0755 $(DESTDIR)$(bindir)
|
||||||
install $(APPL) $(DESTDIR)$(bindir)
|
install -m 0755 $(INSTALLFLAGS) $(APPL) $(DESTDIR)$(bindir)
|
||||||
|
|
||||||
install-lib: $(MYLIB)
|
install-lib: $(MYLIB)
|
||||||
install -d $(DESTDIR)$(libdir)
|
install -d -m 0755 $(DESTDIR)$(libdir)
|
||||||
install $(MYLIB) $(DESTDIR)$(libdir)
|
install -m 0644 $(INSTALLFLAGS) $(MYLIB) $(DESTDIR)$(libdir)
|
||||||
ln -sf $(MYLIB) $(DESTDIR)$(libdir)/$(MYLIBSO) # -l:libclixon_netconf.so.2
|
ln -sf $(MYLIB) $(DESTDIR)$(libdir)/$(MYLIBSO) # -l:libclixon_netconf.so.2
|
||||||
ln -sf $(MYLIBSO) $(DESTDIR)$(libdir)/$(MYLIBLINK) # -l:libclixon_netconf.so
|
ln -sf $(MYLIBSO) $(DESTDIR)$(libdir)/$(MYLIBLINK) # -l:libclixon_netconf.so
|
||||||
|
|
||||||
install-include: clixon_netconf.h
|
install-include: clixon_netconf.h
|
||||||
install -d $(DESTDIR)$(includedir)/clixon
|
install -d -m 0755 $(DESTDIR)$(includedir)/clixon
|
||||||
install -m 644 $^ $(DESTDIR)$(includedir)/clixon
|
install -m 0644 $^ $(DESTDIR)$(includedir)/clixon
|
||||||
|
|
||||||
uninstall:
|
uninstall:
|
||||||
rm -f $(DESTDIR)$(bindir)/$(APPL)
|
rm -f $(DESTDIR)$(bindir)/$(APPL)
|
||||||
|
|
@ -113,14 +125,14 @@ uninstall:
|
||||||
.c.o:
|
.c.o:
|
||||||
$(CC) $(INCLUDES) $(CPPFLAGS) -D__PROGRAM__=\"$(APPL)\" $(CFLAGS) -c $<
|
$(CC) $(INCLUDES) $(CPPFLAGS) -D__PROGRAM__=\"$(APPL)\" $(CFLAGS) -c $<
|
||||||
|
|
||||||
$(APPL) : $(OBJS) $(MYLIBLINK) $(LIBDEPS)
|
$(APPL) : $(APPOBJ) $(MYLIBLINK) $(LIBDEPS)
|
||||||
$(CC) $(LDFLAGS) $(OBJS) -L. $(MYLIB) $(LIBS) -o $@
|
$(CC) $(LDFLAGS) $(APPOBJ) -L. $(MYLIB) $(LIBS) -o $@
|
||||||
|
|
||||||
$(MYLIB) : $(LIBOBJS)
|
$(MYLIB) : $(LIBOBJ)
|
||||||
ifeq ($(HOST_VENDOR),apple)
|
ifeq ($(HOST_VENDOR),apple)
|
||||||
$(CC) $(LDFLAGS) -shared -undefined dynamic_lookup -o $@ $(LIBOBJS) $(LIBS)
|
$(CC) $(LDFLAGS) -shared -undefined dynamic_lookup -o $@ $(LIBOBJ) $(LIBS)
|
||||||
else
|
else
|
||||||
$(CC) $(LDFLAGS) -shared -Wl,-soname,$(MYLIBSO) -o $@ $(LIBOBJS) $(LIBS) -Wl,-soname=$(MYLIBSO)
|
$(CC) $(LDFLAGS) -shared -Wl,-soname,$(MYLIBSO) -o $@ $(LIBOBJ) $(LIBS) -Wl,-soname=$(MYLIBSO)
|
||||||
endif
|
endif
|
||||||
|
|
||||||
# link-name is needed for application linking, eg for clixon_cli and clixon_config
|
# link-name is needed for application linking, eg for clixon_cli and clixon_config
|
||||||
|
|
@ -132,7 +144,7 @@ TAGS:
|
||||||
find . -name '*.[chyl]' -print | etags -
|
find . -name '*.[chyl]' -print | etags -
|
||||||
|
|
||||||
depend:
|
depend:
|
||||||
$(CC) $(DEPENDFLAGS) @DEFS@ $(INCLUDES) $(CFLAGS) -MM $(SRC) $(APPSRC) > .depend
|
$(CC) $(DEPENDFLAGS) @DEFS@ $(INCLUDES) $(CFLAGS) -MM $(LIBSRC) $(APPSRC) > .depend
|
||||||
|
|
||||||
#include .depend
|
#include .depend
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -39,27 +39,12 @@
|
||||||
#ifndef _CLIXON_NETCONF_H_
|
#ifndef _CLIXON_NETCONF_H_
|
||||||
#define _CLIXON_NETCONF_H_
|
#define _CLIXON_NETCONF_H_
|
||||||
|
|
||||||
/*
|
|
||||||
* Types
|
|
||||||
*/
|
|
||||||
typedef int (*netconf_cb_t)(
|
|
||||||
clicon_handle h,
|
|
||||||
cxobj *xn, /* Request: <rpc><xn></rpc> */
|
|
||||||
cxobj **xret, /* Return xml tree, eg <rpc-reply>... */
|
|
||||||
void *arg /* Argument given at netconf_register_callback() */
|
|
||||||
);
|
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Prototypes
|
* Prototypes
|
||||||
* (Duplicated. Also in netconf_*.h)
|
* (Duplicated. Also in netconf_*.h)
|
||||||
*/
|
*/
|
||||||
int netconf_output(int s, cbuf *xf, char *msg);
|
int netconf_output(int s, cbuf *xf, char *msg);
|
||||||
|
|
||||||
int netconf_register_callback(clicon_handle h,
|
|
||||||
netconf_cb_t cb, /* Callback called */
|
|
||||||
void *arg, /* Arg to send to callback */
|
|
||||||
char *tag); /* Xml tag when callback is made */
|
|
||||||
|
|
||||||
int netconf_xpath(cxobj *xsearch,
|
int netconf_xpath(cxobj *xsearch,
|
||||||
cxobj *xfilter,
|
cxobj *xfilter,
|
||||||
cbuf *xf, cbuf *xf_err,
|
cbuf *xf, cbuf *xf_err,
|
||||||
|
|
|
||||||
|
|
@ -122,7 +122,7 @@ netconf_create_hello(cbuf *xf, /* msg buffer */
|
||||||
cprintf(xf, "<capability>urn:ietf:params:netconf:capability:notification:1.0</capability>\n");
|
cprintf(xf, "<capability>urn:ietf:params:netconf:capability:notification:1.0</capability>\n");
|
||||||
cprintf(xf, "<capability>urn:ietf:params:netconf:capability:startup:1.0</capability>\n");
|
cprintf(xf, "<capability>urn:ietf:params:netconf:capability:startup:1.0</capability>\n");
|
||||||
cprintf(xf, "</capabilities>");
|
cprintf(xf, "</capabilities>");
|
||||||
cprintf(xf, "<session-id>%lu</session-id>", 42+session_id);
|
cprintf(xf, "<session-id>%lu</session-id>", (long unsigned int)42+session_id);
|
||||||
cprintf(xf, "</hello>");
|
cprintf(xf, "</hello>");
|
||||||
add_postamble(xf);
|
add_postamble(xf);
|
||||||
return retval;
|
return retval;
|
||||||
|
|
|
||||||
|
|
@ -71,45 +71,48 @@
|
||||||
enum transport_type transport = NETCONF_SSH; /* XXX Remove SOAP support */
|
enum transport_type transport = NETCONF_SSH; /* XXX Remove SOAP support */
|
||||||
int cc_closed = 0; /* XXX Please remove (or at least hide in handle) this global variable */
|
int cc_closed = 0; /* XXX Please remove (or at least hide in handle) this global variable */
|
||||||
|
|
||||||
|
/*! Add netconf xml postamble of message. I.e, xml after the body of the message.
|
||||||
|
* @param[in] cb Netconf packet (cligen buffer)
|
||||||
|
*/
|
||||||
int
|
int
|
||||||
add_preamble(cbuf *xf)
|
add_preamble(cbuf *cb)
|
||||||
{
|
{
|
||||||
if (transport == NETCONF_SOAP)
|
if (transport == NETCONF_SOAP)
|
||||||
cprintf(xf, "\n<soapenv:Envelope\n xmlns:soapenv=\"http://www.w3.org/2003/05/soap-envelope\">\n"
|
cprintf(cb, "\n<soapenv:Envelope\n xmlns:soapenv=\"http://www.w3.org/2003/05/soap-envelope\">\n"
|
||||||
"<soapenv:Body>");
|
"<soapenv:Body>");
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
/*! Add netconf xml postamble of message. I.e, xml after the body of the message.
|
||||||
* add_postamble
|
|
||||||
* add netconf xml postamble of message. That is, xml after the body of the message.
|
|
||||||
* for soap this is the envelope stuff, for ssh this is ]]>]]>
|
* for soap this is the envelope stuff, for ssh this is ]]>]]>
|
||||||
|
* @param[in] cb Netconf packet (cligen buffer)
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
add_postamble(cbuf *xf)
|
add_postamble(cbuf *cb)
|
||||||
{
|
{
|
||||||
switch (transport){
|
switch (transport){
|
||||||
case NETCONF_SSH:
|
case NETCONF_SSH:
|
||||||
cprintf(xf, "]]>]]>"); /* Add RFC4742 end-of-message marker */
|
cprintf(cb, "]]>]]>"); /* Add RFC4742 end-of-message marker */
|
||||||
break;
|
break;
|
||||||
case NETCONF_SOAP:
|
case NETCONF_SOAP:
|
||||||
cprintf(xf, "\n</soapenv:Body>" "</soapenv:Envelope>");
|
cprintf(cb, "\n</soapenv:Body>" "</soapenv:Envelope>");
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
/*! Add error_preamble
|
||||||
* add_error_preamble
|
|
||||||
* compared to regular messages (see add_preamble), error message differ in some
|
* compared to regular messages (see add_preamble), error message differ in some
|
||||||
* protocols (eg soap) by adding a longer and deeper header.
|
* protocols (eg soap) by adding a longer and deeper header.
|
||||||
|
* @param[in] cb Netconf packet (cligen buffer)
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
add_error_preamble(cbuf *xf, char *reason)
|
add_error_preamble(cbuf *cb,
|
||||||
|
char *reason)
|
||||||
{
|
{
|
||||||
switch (transport){
|
switch (transport){
|
||||||
case NETCONF_SOAP:
|
case NETCONF_SOAP:
|
||||||
cprintf(xf, "<soapenv:Envelope xmlns:soapenv=\"http://www.w3.org/2003/05/soap-envelope\" xmlns:xml=\"http://www.w3.org/XML/1998/namespace\">"
|
cprintf(cb, "<soapenv:Envelope xmlns:soapenv=\"http://www.w3.org/2003/05/soap-envelope\" xmlns:xml=\"http://www.w3.org/XML/1998/namespace\">"
|
||||||
"<soapenv:Body>"
|
"<soapenv:Body>"
|
||||||
"<soapenv:Fault>"
|
"<soapenv:Fault>"
|
||||||
"<soapenv:Code>"
|
"<soapenv:Code>"
|
||||||
|
|
@ -121,26 +124,26 @@ add_error_preamble(cbuf *xf, char *reason)
|
||||||
"<detail>", reason);
|
"<detail>", reason);
|
||||||
break;
|
break;
|
||||||
default:
|
default:
|
||||||
if (add_preamble(xf) < 0)
|
if (add_preamble(cb) < 0)
|
||||||
return -1;
|
return -1;
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
/*! Add error postamble
|
||||||
* add_error_postamble
|
|
||||||
* compared to regular messages (see add_postamble), error message differ in some
|
* compared to regular messages (see add_postamble), error message differ in some
|
||||||
* protocols (eg soap) by adding a longer and deeper header.
|
* protocols (eg soap) by adding a longer and deeper header.
|
||||||
|
* @param[in] cb Netconf packet (cligen buffer)
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
add_error_postamble(cbuf *xf)
|
add_error_postamble(cbuf *cb)
|
||||||
{
|
{
|
||||||
switch (transport){
|
switch (transport){
|
||||||
case NETCONF_SOAP:
|
case NETCONF_SOAP:
|
||||||
cprintf(xf, "</detail>" "</soapenv:Fault>");
|
cprintf(cb, "</detail>" "</soapenv:Fault>");
|
||||||
default: /* fall through */
|
default: /* fall through */
|
||||||
if (add_postamble(xf) < 0)
|
if (add_postamble(cb) < 0)
|
||||||
return -1;
|
return -1;
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
|
@ -150,6 +153,8 @@ add_error_postamble(cbuf *xf)
|
||||||
|
|
||||||
/*! Get "target" attribute, return actual database given candidate or running
|
/*! Get "target" attribute, return actual database given candidate or running
|
||||||
* Caller must do error handling
|
* Caller must do error handling
|
||||||
|
* @param[in] xn XML tree
|
||||||
|
* @param[in] path
|
||||||
* @retval dbname Actual database file name
|
* @retval dbname Actual database file name
|
||||||
*/
|
*/
|
||||||
char *
|
char *
|
||||||
|
|
@ -180,11 +185,11 @@ netconf_get_target(cxobj *xn,
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
netconf_output(int s,
|
netconf_output(int s,
|
||||||
cbuf *xf,
|
cbuf *cb,
|
||||||
char *msg)
|
char *msg)
|
||||||
{
|
{
|
||||||
char *buf = cbuf_get(xf);
|
char *buf = cbuf_get(cb);
|
||||||
int len = cbuf_len(xf);
|
int len = cbuf_len(cb);
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
|
|
||||||
clicon_debug(1, "SEND %s", msg);
|
clicon_debug(1, "SEND %s", msg);
|
||||||
|
|
@ -207,3 +212,4 @@ netconf_output(int s,
|
||||||
done:
|
done:
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -55,6 +55,7 @@
|
||||||
#include <netinet/in.h>
|
#include <netinet/in.h>
|
||||||
#include <arpa/inet.h>
|
#include <arpa/inet.h>
|
||||||
#include <assert.h>
|
#include <assert.h>
|
||||||
|
#include <pwd.h>
|
||||||
#include <netinet/in.h>
|
#include <netinet/in.h>
|
||||||
#include <libgen.h>
|
#include <libgen.h>
|
||||||
|
|
||||||
|
|
@ -67,7 +68,6 @@
|
||||||
#include "clixon_netconf.h"
|
#include "clixon_netconf.h"
|
||||||
#include "netconf_lib.h"
|
#include "netconf_lib.h"
|
||||||
#include "netconf_hello.h"
|
#include "netconf_hello.h"
|
||||||
#include "netconf_plugin.h"
|
|
||||||
#include "netconf_rpc.h"
|
#include "netconf_rpc.h"
|
||||||
|
|
||||||
/* Command line options to be passed to getopt(3) */
|
/* Command line options to be passed to getopt(3) */
|
||||||
|
|
@ -100,13 +100,9 @@ process_incoming_packet(clicon_handle h,
|
||||||
/* Parse incoming XML message */
|
/* Parse incoming XML message */
|
||||||
if (xml_parse_string(str, NULL, &xreq) < 0){
|
if (xml_parse_string(str, NULL, &xreq) < 0){
|
||||||
if ((cbret = cbuf_new()) == NULL){
|
if ((cbret = cbuf_new()) == NULL){
|
||||||
cprintf(cbret, "<rpc-reply><rpc-error>"
|
if (netconf_operation_failed(cbret, "rpc", "internal error")< 0)
|
||||||
"<error-tag>operation-failed</error-tag>"
|
goto done;
|
||||||
"<error-type>rpc</error-type>"
|
netconf_output(1, cbret, "rpc-error");
|
||||||
"<error-severity>error</error-severity>"
|
|
||||||
"<error-message>internal error</error-message>"
|
|
||||||
"</rpc-error></rpc-reply>");
|
|
||||||
netconf_output(1, cb, "rpc-error");
|
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
clicon_log(LOG_ERR, "%s: cbuf_new", __FUNCTION__);
|
clicon_log(LOG_ERR, "%s: cbuf_new", __FUNCTION__);
|
||||||
|
|
@ -205,7 +201,6 @@ netconf_input_cb(int s,
|
||||||
retval = 0;
|
retval = 0;
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
|
|
||||||
for (i=0; i<len; i++){
|
for (i=0; i<len; i++){
|
||||||
if (buf[i] == 0)
|
if (buf[i] == 0)
|
||||||
continue; /* Skip NULL chars (eg from terminals) */
|
continue; /* Skip NULL chars (eg from terminals) */
|
||||||
|
|
@ -268,6 +263,8 @@ netconf_terminate(clicon_handle h)
|
||||||
{
|
{
|
||||||
yang_spec *yspec;
|
yang_spec *yspec;
|
||||||
|
|
||||||
|
clixon_plugin_exit(h);
|
||||||
|
rpc_callback_delete_all();
|
||||||
clicon_rpc_close_session(h);
|
clicon_rpc_close_session(h);
|
||||||
if ((yspec = clicon_dbspec_yang(h)) != NULL)
|
if ((yspec = clicon_dbspec_yang(h)) != NULL)
|
||||||
yspec_free(yspec);
|
yspec_free(yspec);
|
||||||
|
|
@ -312,6 +309,8 @@ main(int argc,
|
||||||
int quiet = 0;
|
int quiet = 0;
|
||||||
clicon_handle h;
|
clicon_handle h;
|
||||||
int use_syslog;
|
int use_syslog;
|
||||||
|
char *dir;
|
||||||
|
struct passwd *pw;
|
||||||
|
|
||||||
/* Defaults */
|
/* Defaults */
|
||||||
use_syslog = 0;
|
use_syslog = 0;
|
||||||
|
|
@ -322,6 +321,14 @@ main(int argc,
|
||||||
if ((h = clicon_handle_init()) == NULL)
|
if ((h = clicon_handle_init()) == NULL)
|
||||||
return -1;
|
return -1;
|
||||||
|
|
||||||
|
/* Set username to clicon handle. Use in all communication to backend */
|
||||||
|
if ((pw = getpwuid(getuid())) == NULL){
|
||||||
|
clicon_err(OE_UNIX, errno, "getpwuid");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
if (clicon_username_set(h, pw->pw_name) < 0)
|
||||||
|
goto done;
|
||||||
|
|
||||||
while ((c = getopt(argc, argv, NETCONF_OPTS)) != -1)
|
while ((c = getopt(argc, argv, NETCONF_OPTS)) != -1)
|
||||||
switch (c) {
|
switch (c) {
|
||||||
case 'h' : /* help */
|
case 'h' : /* help */
|
||||||
|
|
@ -379,6 +386,8 @@ main(int argc,
|
||||||
argc -= optind;
|
argc -= optind;
|
||||||
argv += optind;
|
argv += optind;
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
/* Parse yang database spec file */
|
/* Parse yang database spec file */
|
||||||
if (yang_spec_main(h) == NULL)
|
if (yang_spec_main(h) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -388,13 +397,14 @@ main(int argc,
|
||||||
goto done;
|
goto done;
|
||||||
|
|
||||||
/* Initialize plugins group */
|
/* Initialize plugins group */
|
||||||
if (netconf_plugin_load(h) < 0)
|
if ((dir = clicon_netconf_dir(h)) != NULL)
|
||||||
|
if (clixon_plugins_load(h, CLIXON_PLUGIN_INIT, dir, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
||||||
/* Call start function is all plugins before we go interactive */
|
/* Call start function is all plugins before we go interactive */
|
||||||
tmp = *(argv-1);
|
tmp = *(argv-1);
|
||||||
*(argv-1) = argv0;
|
*(argv-1) = argv0;
|
||||||
netconf_plugin_start(h, argc+1, argv-1);
|
clixon_plugin_start(h, argc+1, argv-1);
|
||||||
*(argv-1) = tmp;
|
*(argv-1) = tmp;
|
||||||
|
|
||||||
if (!quiet)
|
if (!quiet)
|
||||||
|
|
@ -406,7 +416,6 @@ main(int argc,
|
||||||
if (event_loop() < 0)
|
if (event_loop() < 0)
|
||||||
goto done;
|
goto done;
|
||||||
done:
|
done:
|
||||||
netconf_plugin_unload(h);
|
|
||||||
netconf_terminate(h);
|
netconf_terminate(h);
|
||||||
clicon_log_init(__PROGRAM__, LOG_INFO, 0); /* Log on syslog no stderr */
|
clicon_log_init(__PROGRAM__, LOG_INFO, 0); /* Log on syslog no stderr */
|
||||||
clicon_log(LOG_NOTICE, "%s: %u Terminated\n", __PROGRAM__, getpid());
|
clicon_log(LOG_NOTICE, "%s: %u Terminated\n", __PROGRAM__, getpid());
|
||||||
|
|
|
||||||
|
|
@ -1,237 +0,0 @@
|
||||||
/*
|
|
||||||
*
|
|
||||||
***** BEGIN LICENSE BLOCK *****
|
|
||||||
|
|
||||||
Copyright (C) 2009-2018 Olof Hagsand and Benny Holmgren
|
|
||||||
|
|
||||||
This file is part of CLIXON.
|
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
you may not use this file except in compliance with the License.
|
|
||||||
You may obtain a copy of the License at
|
|
||||||
|
|
||||||
http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
|
|
||||||
Unless required by applicable law or agreed to in writing, software
|
|
||||||
distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
See the License for the specific language governing permissions and
|
|
||||||
limitations under the License.
|
|
||||||
|
|
||||||
Alternatively, the contents of this file may be used under the terms of
|
|
||||||
the GNU General Public License Version 3 or later (the "GPL"),
|
|
||||||
in which case the provisions of the GPL are applicable instead
|
|
||||||
of those above. If you wish to allow use of your version of this file only
|
|
||||||
under the terms of the GPL, and not to allow others to
|
|
||||||
use your version of this file under the terms of Apache License version 2,
|
|
||||||
indicate your decision by deleting the provisions above and replace them with
|
|
||||||
the notice and other provisions required by the GPL. If you do not delete
|
|
||||||
the provisions above, a recipient may use your version of this file under
|
|
||||||
the terms of any one of the Apache License version 2 or the GPL.
|
|
||||||
|
|
||||||
***** END LICENSE BLOCK *****
|
|
||||||
|
|
||||||
*
|
|
||||||
* handling netconf plugins
|
|
||||||
*/
|
|
||||||
|
|
||||||
#ifdef HAVE_CONFIG_H
|
|
||||||
#include "clixon_config.h" /* generated by config & autoconf */
|
|
||||||
#endif
|
|
||||||
|
|
||||||
#include <stdio.h>
|
|
||||||
#include <string.h>
|
|
||||||
#include <stdlib.h>
|
|
||||||
#include <unistd.h>
|
|
||||||
#include <stdarg.h>
|
|
||||||
#include <syslog.h>
|
|
||||||
#include <errno.h>
|
|
||||||
#include <assert.h>
|
|
||||||
#include <dlfcn.h>
|
|
||||||
#include <dirent.h>
|
|
||||||
#include <grp.h>
|
|
||||||
#include <sys/types.h>
|
|
||||||
#include <sys/stat.h>
|
|
||||||
#include <sys/param.h>
|
|
||||||
#include <netinet/in.h>
|
|
||||||
|
|
||||||
/* cligen */
|
|
||||||
#include <cligen/cligen.h>
|
|
||||||
|
|
||||||
/* clicon */
|
|
||||||
#include <clixon/clixon.h>
|
|
||||||
|
|
||||||
/* clicon netconf*/
|
|
||||||
#include "clixon_netconf.h"
|
|
||||||
#include "netconf_lib.h"
|
|
||||||
#include "netconf_plugin.h"
|
|
||||||
|
|
||||||
/* Database dependency description */
|
|
||||||
struct netconf_reg {
|
|
||||||
qelem_t nr_qelem; /* List header */
|
|
||||||
netconf_cb_t nr_callback; /* Validation/Commit Callback */
|
|
||||||
void *nr_arg; /* Application specific argument to cb */
|
|
||||||
char *nr_tag; /* Xml tag when matched, callback called */
|
|
||||||
};
|
|
||||||
typedef struct netconf_reg netconf_reg_t;
|
|
||||||
|
|
||||||
static int nplugins = 0;
|
|
||||||
static plghndl_t *plugins = NULL;
|
|
||||||
static netconf_reg_t *deps = NULL;
|
|
||||||
|
|
||||||
/*! Load all plugins you can find in CLICON_NETCONF_DIR
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
netconf_plugin_load(clicon_handle h)
|
|
||||||
{
|
|
||||||
int retval = -1;
|
|
||||||
char *dir;
|
|
||||||
int ndp;
|
|
||||||
struct dirent *dp = NULL;
|
|
||||||
int i;
|
|
||||||
char filename[MAXPATHLEN];
|
|
||||||
plghndl_t *handle;
|
|
||||||
|
|
||||||
/* If no DIR defined, then dont load plugins */
|
|
||||||
if ((dir = clicon_netconf_dir(h)) == NULL){
|
|
||||||
retval = 0;
|
|
||||||
goto quit;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Get plugin objects names from plugin directory */
|
|
||||||
if((ndp = clicon_file_dirent(dir, &dp, "(.so)$", S_IFREG))<0)
|
|
||||||
goto quit;
|
|
||||||
|
|
||||||
/* Load all plugins */
|
|
||||||
for (i = 0; i < ndp; i++) {
|
|
||||||
snprintf(filename, MAXPATHLEN-1, "%s/%s", dir, dp[i].d_name);
|
|
||||||
clicon_debug(1, "DEBUG: Loading plugin '%.*s' ...",
|
|
||||||
(int)strlen(filename), filename);
|
|
||||||
if ((handle = plugin_load(h, filename, RTLD_NOW)) == NULL)
|
|
||||||
goto quit;
|
|
||||||
if ((plugins = realloc(plugins, (nplugins+1) * sizeof (*plugins))) == NULL) {
|
|
||||||
clicon_err(OE_UNIX, errno, "realloc");
|
|
||||||
goto quit;
|
|
||||||
}
|
|
||||||
plugins[nplugins++] = handle;
|
|
||||||
}
|
|
||||||
retval = 0;
|
|
||||||
quit:
|
|
||||||
if (dp)
|
|
||||||
free(dp);
|
|
||||||
return retval;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Unload all netconf plugins */
|
|
||||||
int
|
|
||||||
netconf_plugin_unload(clicon_handle h)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
netconf_reg_t *nr;
|
|
||||||
|
|
||||||
while((nr = deps) != NULL) {
|
|
||||||
DELQ(nr, deps, netconf_reg_t *);
|
|
||||||
if (nr->nr_tag)
|
|
||||||
free(nr->nr_tag);
|
|
||||||
free(nr);
|
|
||||||
}
|
|
||||||
for (i = 0; i < nplugins; i++)
|
|
||||||
plugin_unload(h, plugins[i]);
|
|
||||||
if (plugins){
|
|
||||||
free(plugins);
|
|
||||||
plugins = NULL;
|
|
||||||
}
|
|
||||||
nplugins = 0;
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Call plugin_start in all plugins
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
netconf_plugin_start(clicon_handle h, int argc, char **argv)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
plgstart_t *startfn;
|
|
||||||
|
|
||||||
for (i = 0; i < nplugins; i++) {
|
|
||||||
/* Call exit function is it exists */
|
|
||||||
if ((startfn = dlsym(plugins[i], PLUGIN_START)) == NULL)
|
|
||||||
break;
|
|
||||||
optind = 0;
|
|
||||||
if (startfn(h, argc, argv) < 0) {
|
|
||||||
clicon_debug(1, "plugin_start() failed\n");
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/*! Register netconf callback
|
|
||||||
* Called from plugin to register a callback for a specific netconf XML tag.
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
netconf_register_callback(clicon_handle h,
|
|
||||||
netconf_cb_t cb, /* Callback called */
|
|
||||||
void *arg, /* Arg to send to callback */
|
|
||||||
char *tag) /* Xml tag when callback is made */
|
|
||||||
{
|
|
||||||
netconf_reg_t *nr;
|
|
||||||
|
|
||||||
if ((nr = malloc(sizeof(netconf_reg_t))) == NULL) {
|
|
||||||
clicon_err(OE_DB, errno, "malloc: %s", strerror(errno));
|
|
||||||
goto catch;
|
|
||||||
}
|
|
||||||
memset (nr, 0, sizeof (*nr));
|
|
||||||
nr->nr_callback = cb;
|
|
||||||
nr->nr_arg = arg;
|
|
||||||
nr->nr_tag = strdup(tag); /* strdup */
|
|
||||||
INSQ(nr, deps);
|
|
||||||
return 0;
|
|
||||||
catch:
|
|
||||||
if (nr){
|
|
||||||
if (nr->nr_tag)
|
|
||||||
free(nr->nr_tag);
|
|
||||||
free(nr);
|
|
||||||
}
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! See if there is any callback registered for this tag
|
|
||||||
*
|
|
||||||
* Look for local (client-side) netconf plugins. This feature may no
|
|
||||||
* longer be necessary as generic RPC:s should be handled by backend.
|
|
||||||
*
|
|
||||||
* @param[in] h clicon handle
|
|
||||||
* @param[in] xn Sub-tree (under xorig) at child of rpc: <rpc><xn></rpc>.
|
|
||||||
* @param[out] xret Return XML, error or OK
|
|
||||||
*
|
|
||||||
* @retval -1 Error
|
|
||||||
* @retval 0 OK, not found handler.
|
|
||||||
* @retval 1 OK, handler called
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
netconf_plugin_callbacks(clicon_handle h,
|
|
||||||
cxobj *xn,
|
|
||||||
cxobj **xret)
|
|
||||||
{
|
|
||||||
int retval = -1;
|
|
||||||
netconf_reg_t *nreg;
|
|
||||||
|
|
||||||
if (deps != NULL){
|
|
||||||
nreg = deps;
|
|
||||||
do {
|
|
||||||
if (strcmp(nreg->nr_tag, xml_name(xn)) == 0){
|
|
||||||
if ((retval = nreg->nr_callback(h, xn, xret, nreg->nr_arg)) < 0)
|
|
||||||
goto done;
|
|
||||||
retval = 1; /* handled */
|
|
||||||
goto done;
|
|
||||||
}
|
|
||||||
nreg = NEXTQ(netconf_reg_t *, nreg);
|
|
||||||
} while (nreg != deps);
|
|
||||||
}
|
|
||||||
retval = 0;
|
|
||||||
done:
|
|
||||||
return retval;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
@ -65,7 +65,6 @@
|
||||||
#include "clixon_netconf.h"
|
#include "clixon_netconf.h"
|
||||||
#include "netconf_lib.h"
|
#include "netconf_lib.h"
|
||||||
#include "netconf_filter.h"
|
#include "netconf_filter.h"
|
||||||
#include "netconf_plugin.h"
|
|
||||||
#include "netconf_rpc.h"
|
#include "netconf_rpc.h"
|
||||||
|
|
||||||
/*
|
/*
|
||||||
|
|
@ -850,8 +849,10 @@ netconf_create_subscription(clicon_handle h,
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! See if there is any callback registered for this tag
|
/*! See if there is any application defined RPC for this tag
|
||||||
*
|
*
|
||||||
|
* This may either be local client-side or backend. If backend send as netconf
|
||||||
|
* RPC.
|
||||||
* @param[in] h clicon handle
|
* @param[in] h clicon handle
|
||||||
* @param[in] xn Sub-tree (under xorig) at child of rpc: <rpc><xn></rpc>.
|
* @param[in] xn Sub-tree (under xorig) at child of rpc: <rpc><xn></rpc>.
|
||||||
* @param[out] xret Return XML, error or OK
|
* @param[out] xret Return XML, error or OK
|
||||||
|
|
@ -872,6 +873,8 @@ netconf_application_rpc(clicon_handle h,
|
||||||
yang_stmt *youtput;
|
yang_stmt *youtput;
|
||||||
cxobj *xoutput;
|
cxobj *xoutput;
|
||||||
cbuf *cb = NULL;
|
cbuf *cb = NULL;
|
||||||
|
cbuf *cbret = NULL;
|
||||||
|
int ret;
|
||||||
|
|
||||||
/* First check system / netconf RPC:s */
|
/* First check system / netconf RPC:s */
|
||||||
if ((cb = cbuf_new()) == NULL){
|
if ((cb = cbuf_new()) == NULL){
|
||||||
|
|
@ -890,11 +893,11 @@ netconf_application_rpc(clicon_handle h,
|
||||||
// else
|
// else
|
||||||
// cprintf(cb, "/%s", xml_name(xn)); /* XXX not accepdted by below */
|
// cprintf(cb, "/%s", xml_name(xn)); /* XXX not accepdted by below */
|
||||||
/* Find yang rpc statement, return yang rpc statement if found */
|
/* Find yang rpc statement, return yang rpc statement if found */
|
||||||
if (yang_abs_schema_nodeid(yspec, cbuf_get(cb), &yrpc) < 0)
|
if (yang_abs_schema_nodeid(yspec, cbuf_get(cb), Y_RPC, &yrpc) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
||||||
/* Check if found */
|
/* Check if found */
|
||||||
if (yrpc != NULL){
|
if (yrpc != NULL){
|
||||||
|
/* 1. Check xn arguments with input statement. */
|
||||||
if ((yinput = yang_find((yang_node*)yrpc, Y_INPUT, NULL)) != NULL){
|
if ((yinput = yang_find((yang_node*)yrpc, Y_INPUT, NULL)) != NULL){
|
||||||
xml_spec_set(xn, yinput); /* needed for xml_spec_populate */
|
xml_spec_set(xn, yinput); /* needed for xml_spec_populate */
|
||||||
if (xml_apply(xn, CX_ELMNT, xml_spec_populate, yinput) < 0)
|
if (xml_apply(xn, CX_ELMNT, xml_spec_populate, yinput) < 0)
|
||||||
|
|
@ -905,11 +908,18 @@ netconf_application_rpc(clicon_handle h,
|
||||||
if (xml_yang_validate_add(xn, NULL) < 0)
|
if (xml_yang_validate_add(xn, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
/*
|
if ((cbret = cbuf_new()) == NULL){
|
||||||
* 1. Check xn arguments with input statement.
|
clicon_err(OE_UNIX, 0, "cbuf_new");
|
||||||
* 2. Send to backend as clicon_msg-encode()
|
goto done;
|
||||||
* 3. In backend to similar but there call actual backend
|
}
|
||||||
*/
|
/* Look for local (client-side) netconf plugins. */
|
||||||
|
if ((ret = rpc_callback_call(h, xn, cbret, NULL)) < 0)
|
||||||
|
goto done;
|
||||||
|
if (ret == 1){ /* Handled locally */
|
||||||
|
if (xml_parse_string(cbuf_get(cbret), NULL, xret) < 0)
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
else /* Send to backend */
|
||||||
if (clicon_rpc_netconf_xml(h, xml_parent(xn), xret, NULL) < 0)
|
if (clicon_rpc_netconf_xml(h, xml_parent(xn), xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Sanity check of outgoing XML */
|
/* Sanity check of outgoing XML */
|
||||||
|
|
@ -931,11 +941,12 @@ netconf_application_rpc(clicon_handle h,
|
||||||
done:
|
done:
|
||||||
if (cb)
|
if (cb)
|
||||||
cbuf_free(cb);
|
cbuf_free(cb);
|
||||||
|
if (cbret)
|
||||||
|
cbuf_free(cbret);
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
/*! The central netconf rpc dispatcher. Look at first tag and dispach to sub-functions.
|
/*! The central netconf rpc dispatcher. Look at first tag and dispach to sub-functions.
|
||||||
* Call plugin handler if tag not found. If not handled by any handler, return
|
* Call plugin handler if tag not found. If not handled by any handler, return
|
||||||
* error.
|
* error.
|
||||||
|
|
@ -1018,12 +1029,8 @@ netconf_rpc_dispatch(clicon_handle h,
|
||||||
}
|
}
|
||||||
/* Others */
|
/* Others */
|
||||||
else {
|
else {
|
||||||
/* Look for local (client-side) netconf plugins. This feature may no
|
/* Look for application-defined RPC. This may either be local
|
||||||
* longer be necessary as generic RPC:s should be handled by backend.
|
client-side or backend. If backend send as netconf RPC. */
|
||||||
*/
|
|
||||||
if ((retval = netconf_plugin_callbacks(h, xe, xret)) < 0)
|
|
||||||
goto done;
|
|
||||||
if (retval == 0)
|
|
||||||
if ((retval = netconf_application_rpc(h, xe, xret)) < 0)
|
if ((retval = netconf_application_rpc(h, xe, xret)) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (retval == 0){ /* not handled by callback */
|
if (retval == 0){ /* not handled by callback */
|
||||||
|
|
|
||||||
|
|
@ -35,15 +35,21 @@ srcdir = @srcdir@
|
||||||
top_srcdir = @top_srcdir@
|
top_srcdir = @top_srcdir@
|
||||||
CC = @CC@
|
CC = @CC@
|
||||||
CFLAGS = @CFLAGS@
|
CFLAGS = @CFLAGS@
|
||||||
|
INSTALLFLAGS = @INSTALLFLAGS@
|
||||||
LDFLAGS = @LDFLAGS@
|
LDFLAGS = @LDFLAGS@
|
||||||
|
|
||||||
prefix = @prefix@
|
prefix = @prefix@
|
||||||
|
datarootdir = @datarootdir@
|
||||||
exec_prefix = @exec_prefix@
|
exec_prefix = @exec_prefix@
|
||||||
bindir = @bindir@
|
bindir = @bindir@
|
||||||
wwwdir = /www-data
|
libdir = @libdir@
|
||||||
|
mandir = @mandir@
|
||||||
libexecdir = @libexecdir@
|
libexecdir = @libexecdir@
|
||||||
|
wwwdir = /www-data
|
||||||
localstatedir = @localstatedir@
|
localstatedir = @localstatedir@
|
||||||
sysconfdir = @sysconfdir@
|
sysconfdir = @sysconfdir@
|
||||||
|
includedir = @includedir@
|
||||||
|
HOST_VENDOR = @host_vendor@
|
||||||
|
|
||||||
SH_SUFFIX = @SH_SUFFIX@
|
SH_SUFFIX = @SH_SUFFIX@
|
||||||
CLIXON_MAJOR = @CLIXON_VERSION_MAJOR@
|
CLIXON_MAJOR = @CLIXON_VERSION_MAJOR@
|
||||||
|
|
@ -57,23 +63,32 @@ LIBDEPS = $(top_srcdir)/lib/src/$(CLIXON_LIB)
|
||||||
|
|
||||||
LIBS = -L$(top_srcdir)/lib/src @LIBS@ -l:$(CLIXON_LIB)
|
LIBS = -L$(top_srcdir)/lib/src @LIBS@ -l:$(CLIXON_LIB)
|
||||||
|
|
||||||
CPPFLAGS = @CPPFLAGS@
|
CPPFLAGS = @CPPFLAGS@ -fPIC
|
||||||
|
|
||||||
INCLUDES = -I. -I$(top_srcdir)/lib/src -I$(top_srcdir)/lib -I$(top_srcdir)/include -I$(top_srcdir) @INCLUDES@
|
INCLUDES = -I. -I$(top_srcdir)/lib/src -I$(top_srcdir)/lib -I$(top_srcdir)/include -I$(top_srcdir) @INCLUDES@
|
||||||
|
|
||||||
SRC = restconf_lib.c
|
# Name of application
|
||||||
SRC += restconf_methods.c
|
|
||||||
|
|
||||||
OBJS = $(SRC:.c=.o)
|
|
||||||
|
|
||||||
APPSRC = restconf_main.c
|
|
||||||
APPOBJ = $(APPSRC:.c=.o)
|
|
||||||
APPL = clixon_restconf
|
APPL = clixon_restconf
|
||||||
|
|
||||||
all: $(APPL)
|
# Not accessible from plugin
|
||||||
|
APPSRC = restconf_main.c
|
||||||
|
APPSRC += restconf_methods.c
|
||||||
|
APPOBJ = $(APPSRC:.c=.o)
|
||||||
|
|
||||||
|
# Accessible from plugin
|
||||||
|
LIBSRC = restconf_lib.c
|
||||||
|
LIBOBJ = $(LIBSRC:.c=.o)
|
||||||
|
|
||||||
|
# Name of lib
|
||||||
|
MYNAME = clixon_restconf
|
||||||
|
MYLIBLINK = lib$(MYNAME)$(SH_SUFFIX)
|
||||||
|
MYLIB = $(MYLIBLINK).$(CLIXON_MAJOR).$(CLIXON_MINOR)
|
||||||
|
MYLIBSO = $(MYLIBLINK).$(CLIXON_MAJOR)
|
||||||
|
|
||||||
|
all: $(MYLIB) $(APPL)
|
||||||
|
|
||||||
clean:
|
clean:
|
||||||
rm -f $(OBJS) *.core $(APPL) $(APPOBJ)
|
rm -f $(LIBOBJ) *.core $(APPL) $(APPOBJ) $(MYLIB) $(MYLIBSO) $(MYLIBLINK)
|
||||||
|
|
||||||
distclean: clean
|
distclean: clean
|
||||||
rm -f Makefile *~ .depend
|
rm -f Makefile *~ .depend
|
||||||
|
|
@ -82,14 +97,23 @@ distclean: clean
|
||||||
# Put other executables in libexec/
|
# Put other executables in libexec/
|
||||||
# Also create a libexec/ directory for writeable/temporary files.
|
# Also create a libexec/ directory for writeable/temporary files.
|
||||||
# Put config file in etc/
|
# Put config file in etc/
|
||||||
install: $(APPL)
|
install: install-lib $(APPL)
|
||||||
install -d $(DESTDIR)$(wwwdir)
|
install -d -m 0755 $(DESTDIR)$(wwwdir)
|
||||||
install $(APPL) $(DESTDIR)$(wwwdir)
|
install -m 0755 $(INSTALLFLAGS) $(APPL) $(DESTDIR)$(wwwdir)
|
||||||
|
|
||||||
install-include:
|
install-lib: $(MYLIB)
|
||||||
|
install -d -m 0755 $(DESTDIR)$(libdir)
|
||||||
|
install -m 0644 $(INSTALLFLAGS) $(MYLIB) $(DESTDIR)$(libdir)
|
||||||
|
ln -sf $(MYLIB) $(DESTDIR)$(libdir)/$(MYLIBSO) # -l:libclixon_restconf.so.2
|
||||||
|
ln -sf $(MYLIBSO) $(DESTDIR)$(libdir)/$(MYLIBLINK) # -l:libclixon_restconf.so
|
||||||
|
|
||||||
|
install-include: clixon_restconf.h
|
||||||
|
install -d -m 0755 $(DESTDIR)$(includedir)/clixon
|
||||||
|
install -m 0644 $^ $(DESTDIR)$(includedir)/clixon
|
||||||
|
|
||||||
uninstall:
|
uninstall:
|
||||||
rm -f $(DESTDIR)$(wwwdir)/$(APPL)
|
rm -f $(DESTDIR)$(wwwdir)/$(APPL)
|
||||||
|
rm -f $(DESTDIR)$(libdir)/$(MYLIBLINK)*
|
||||||
|
|
||||||
.SUFFIXES:
|
.SUFFIXES:
|
||||||
.SUFFIXES: .c .o
|
.SUFFIXES: .c .o
|
||||||
|
|
@ -97,14 +121,24 @@ uninstall:
|
||||||
.c.o:
|
.c.o:
|
||||||
$(CC) $(INCLUDES) -D__PROGRAM__=\"$(APPL)\" $(CPPFLAGS) $(CFLAGS) -c $<
|
$(CC) $(INCLUDES) -D__PROGRAM__=\"$(APPL)\" $(CPPFLAGS) $(CFLAGS) -c $<
|
||||||
|
|
||||||
$(APPL) : $(APPOBJ) $(OBJS) $(LIBDEPS)
|
$(APPL) : $(APPOBJ) $(MYLIBLINK) $(LIBDEPS)
|
||||||
$(CC) $(LDFLAGS) $(APPOBJ) $(OBJS) $(LIBS) -o $@
|
$(CC) $(LDFLAGS) $(APPOBJ) -L. $(MYLIB) $(LIBS) -o $@
|
||||||
|
|
||||||
|
$(MYLIB) : $(LIBOBJ)
|
||||||
|
ifeq ($(HOST_VENDOR),apple)
|
||||||
|
$(CC) $(LDFLAGS) -shared -undefined dynamic_lookup -o $@ $(LIBOBJ) $(LIBS)
|
||||||
|
else
|
||||||
|
$(CC) $(LDFLAGS) -shared -Wl,-soname,$(MYLIBSO) -o $@ $(LIBOBJ) $(LIBS) -Wl,-soname=$(MYLIBSO)
|
||||||
|
endif
|
||||||
|
|
||||||
|
# link-name is needed for application linking, eg for clixon_cli and clixon_config
|
||||||
|
$(MYLIBLINK) : $(MYLIB)
|
||||||
|
|
||||||
TAGS:
|
TAGS:
|
||||||
find . -name '*.[chyl]' -print | etags -
|
find . -name '*.[chyl]' -print | etags -
|
||||||
|
|
||||||
depend:
|
depend:
|
||||||
$(CC) $(DEPENDFLAGS) @DEFS@ $(INCLUDES) $(CFLAGS) -MM $(SRC) $(APPSRC) > .depend
|
$(CC) $(DEPENDFLAGS) @DEFS@ $(INCLUDES) $(CFLAGS) -MM $(LIBSRC) $(APPSRC) > .depend
|
||||||
|
|
||||||
#include .depend
|
#include .depend
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -1,16 +1,4 @@
|
||||||
# Clixon Restconf
|
# Clixon Restconf
|
||||||
### Features
|
|
||||||
|
|
||||||
Clixon restconf is a daemon based on FASTCGI. Instructions are available to
|
|
||||||
run with NGINX.
|
|
||||||
The implementatation is based on [RFC 8040: RESTCONF Protocol](https://tools.ietf.org/html/rfc8040).
|
|
||||||
The following featires are supported:
|
|
||||||
- OPTIONS, HEAD, GET, POST, PUT, DELETE
|
|
||||||
The following are not implemented
|
|
||||||
- PATCH
|
|
||||||
- query parameters (section 4.9)
|
|
||||||
- notifications (sec 6)
|
|
||||||
- schema resource
|
|
||||||
|
|
||||||
### Installation using Nginx
|
### Installation using Nginx
|
||||||
|
|
||||||
|
|
@ -32,7 +20,7 @@ sudo /etc/init.d nginx start
|
||||||
|
|
||||||
Start clixon restconf daemon
|
Start clixon restconf daemon
|
||||||
```
|
```
|
||||||
olof@vandal> sudo su -c "/www-data/clixon_restconf -f /usr/local/etc/routing.xml " -s /bin/sh www-data
|
olof@vandal> sudo su -c "/www-data/clixon_restconf -f /usr/local/etc/example.xml " -s /bin/sh www-data
|
||||||
```
|
```
|
||||||
|
|
||||||
Make restconf calls with curl
|
Make restconf calls with curl
|
||||||
|
|
@ -68,7 +56,7 @@ curl -sX POST -d '{"interfaces":{"interface":{"name":"eth1","type":"eth","enable
|
||||||
|
|
||||||
Start the restconf fastcgi program with debug flag:
|
Start the restconf fastcgi program with debug flag:
|
||||||
```
|
```
|
||||||
sudo su -c "/www-data/clixon_restconf -Df /usr/local/etc/routing.xml" -s /bin/sh www-data
|
sudo su -c "/www-data/clixon_restconf -Df /usr/local/etc/example.xml" -s /bin/sh www-data
|
||||||
```
|
```
|
||||||
Look at syslog:
|
Look at syslog:
|
||||||
```
|
```
|
||||||
|
|
|
||||||
|
|
@ -31,26 +31,33 @@
|
||||||
|
|
||||||
***** END LICENSE BLOCK *****
|
***** END LICENSE BLOCK *****
|
||||||
|
|
||||||
*
|
* The exported interface to plugins. External apps (eg frontend restconf plugins)
|
||||||
* handling netconf plugins
|
* should only include this file (not the restconf_*.h)
|
||||||
*****************************************************************************/
|
|
||||||
#ifndef _NETCONF_PLUGIN_H_
|
|
||||||
#define _NETCONF_PLUGIN_H_
|
|
||||||
|
|
||||||
/*
|
|
||||||
* Types
|
|
||||||
*/
|
*/
|
||||||
|
|
||||||
|
#ifndef _CLIXON_RESTCONF_H_
|
||||||
|
#define _CLIXON_RESTCONF_H_
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Prototypes
|
* Prototypes (also in restconf_lib.h)
|
||||||
*/
|
*/
|
||||||
int netconf_plugin_load(clicon_handle h);
|
int restconf_err2code(char *tag);
|
||||||
|
const char *restconf_code2reason(int code);
|
||||||
|
|
||||||
int netconf_plugin_start(clicon_handle h, int argc, char **argv);
|
int badrequest(FCGX_Request *r);
|
||||||
|
int unauthorized(FCGX_Request *r);
|
||||||
|
int forbidden(FCGX_Request *r);
|
||||||
|
int notfound(FCGX_Request *r);
|
||||||
|
int conflict(FCGX_Request *r);
|
||||||
|
int internal_server_error(FCGX_Request *r);
|
||||||
|
int notimplemented(FCGX_Request *r);
|
||||||
|
|
||||||
int netconf_plugin_unload(clicon_handle h);
|
int clicon_debug_xml(int dbglevel, char *str, cxobj *cx);
|
||||||
|
int test(FCGX_Request *r, int dbg);
|
||||||
|
cbuf *readdata(FCGX_Request *r);
|
||||||
|
int get_user_cookie(char *cookiestr, char *attribute, char **val);
|
||||||
|
int api_return_err(clicon_handle h, FCGX_Request *r, cxobj *xerr,
|
||||||
|
int pretty, int use_xml);
|
||||||
|
|
||||||
int netconf_plugin_callbacks(clicon_handle h, cxobj *xn, cxobj **xret);
|
|
||||||
|
|
||||||
#endif /* _NETCONF_PLUGIN_H_ */
|
#endif /* _CLIXON_RESTCONF_H_ */
|
||||||
|
|
@ -42,7 +42,6 @@
|
||||||
#include <fcntl.h>
|
#include <fcntl.h>
|
||||||
#include <ctype.h>
|
#include <ctype.h>
|
||||||
#include <time.h>
|
#include <time.h>
|
||||||
#include <fcgi_stdio.h>
|
|
||||||
#include <signal.h>
|
#include <signal.h>
|
||||||
#include <dlfcn.h>
|
#include <dlfcn.h>
|
||||||
#include <sys/param.h>
|
#include <sys/param.h>
|
||||||
|
|
@ -55,6 +54,8 @@
|
||||||
/* clicon */
|
/* clicon */
|
||||||
#include <clixon/clixon.h>
|
#include <clixon/clixon.h>
|
||||||
|
|
||||||
|
#include <fcgi_stdio.h> /* Need to be after clixon_xml-h due to attribute format */
|
||||||
|
|
||||||
#include "restconf_lib.h"
|
#include "restconf_lib.h"
|
||||||
|
|
||||||
/* See RFC 8040 Section 7: Mapping from NETCONF<error-tag> to Status Code
|
/* See RFC 8040 Section 7: Mapping from NETCONF<error-tag> to Status Code
|
||||||
|
|
@ -211,8 +212,10 @@ notfound(FCGX_Request *r)
|
||||||
clicon_debug(1, "%s", __FUNCTION__);
|
clicon_debug(1, "%s", __FUNCTION__);
|
||||||
path = FCGX_GetParam("DOCUMENT_URI", r->envp);
|
path = FCGX_GetParam("DOCUMENT_URI", r->envp);
|
||||||
FCGX_FPrintF(r->out, "Status: 404\r\n"); /* 404 not found */
|
FCGX_FPrintF(r->out, "Status: 404\r\n"); /* 404 not found */
|
||||||
|
|
||||||
FCGX_FPrintF(r->out, "Content-Type: text/html\r\n\r\n");
|
FCGX_FPrintF(r->out, "Content-Type: text/html\r\n\r\n");
|
||||||
FCGX_FPrintF(r->out, "<h1>Not Found</h1>\n");
|
FCGX_FPrintF(r->out, "<h1>Not Found</h1>\n");
|
||||||
|
FCGX_FPrintF(r->out, "Not Found\n");
|
||||||
FCGX_FPrintF(r->out, "The requested URL %s was not found on this server.\n",
|
FCGX_FPrintF(r->out, "The requested URL %s was not found on this server.\n",
|
||||||
path);
|
path);
|
||||||
return 0;
|
return 0;
|
||||||
|
|
@ -326,6 +329,7 @@ test(FCGX_Request *r,
|
||||||
printparam(r, "HTTPS", dbg);
|
printparam(r, "HTTPS", dbg);
|
||||||
printparam(r, "HTTP_ACCEPT", dbg);
|
printparam(r, "HTTP_ACCEPT", dbg);
|
||||||
printparam(r, "HTTP_CONTENT_TYPE", dbg);
|
printparam(r, "HTTP_CONTENT_TYPE", dbg);
|
||||||
|
printparam(r, "HTTP_AUTHORIZATION", dbg);
|
||||||
#if 0 /* For debug */
|
#if 0 /* For debug */
|
||||||
clicon_debug(1, "All environment vars:");
|
clicon_debug(1, "All environment vars:");
|
||||||
{
|
{
|
||||||
|
|
@ -356,129 +360,6 @@ readdata(FCGX_Request *r)
|
||||||
return cb;
|
return cb;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
static int nplugins = 0;
|
|
||||||
static plghndl_t *plugins = NULL;
|
|
||||||
static plgcredentials_t *_credentials_fn = NULL; /* Credentials callback */
|
|
||||||
|
|
||||||
/*! Load all plugins you can find in CLICON_RESTCONF_DIR
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
restconf_plugin_load(clicon_handle h)
|
|
||||||
{
|
|
||||||
int retval = -1;
|
|
||||||
char *dir;
|
|
||||||
int ndp;
|
|
||||||
struct dirent *dp = NULL;
|
|
||||||
int i;
|
|
||||||
plghndl_t *handle;
|
|
||||||
char filename[MAXPATHLEN];
|
|
||||||
|
|
||||||
if ((dir = clicon_restconf_dir(h)) == NULL){
|
|
||||||
retval = 0;
|
|
||||||
goto quit;
|
|
||||||
}
|
|
||||||
/* Get plugin objects names from plugin directory */
|
|
||||||
if((ndp = clicon_file_dirent(dir, &dp, "(.so)$", S_IFREG))<0)
|
|
||||||
goto quit;
|
|
||||||
|
|
||||||
/* Load all plugins */
|
|
||||||
for (i = 0; i < ndp; i++) {
|
|
||||||
snprintf(filename, MAXPATHLEN-1, "%s/%s", dir, dp[i].d_name);
|
|
||||||
clicon_debug(1, "DEBUG: Loading plugin '%.*s' ...",
|
|
||||||
(int)strlen(filename), filename);
|
|
||||||
if ((handle = plugin_load(h, filename, RTLD_NOW)) == NULL)
|
|
||||||
goto quit;
|
|
||||||
if ((_credentials_fn = dlsym(handle, PLUGIN_CREDENTIALS)) == NULL)
|
|
||||||
clicon_debug(1, "Failed to load %s", PLUGIN_CREDENTIALS);
|
|
||||||
else
|
|
||||||
clicon_debug(1, "%s callback loaded", PLUGIN_CREDENTIALS);
|
|
||||||
if ((plugins = realloc(plugins, (nplugins+1) * sizeof (*plugins))) == NULL) {
|
|
||||||
clicon_err(OE_UNIX, errno, "realloc");
|
|
||||||
goto quit;
|
|
||||||
}
|
|
||||||
plugins[nplugins++] = handle;
|
|
||||||
}
|
|
||||||
retval = 0;
|
|
||||||
quit:
|
|
||||||
if (dp)
|
|
||||||
free(dp);
|
|
||||||
return retval;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/*! Unload all restconf plugins */
|
|
||||||
int
|
|
||||||
restconf_plugin_unload(clicon_handle h)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
|
|
||||||
for (i = 0; i < nplugins; i++)
|
|
||||||
plugin_unload(h, plugins[i]);
|
|
||||||
if (plugins){
|
|
||||||
free(plugins);
|
|
||||||
plugins = NULL;
|
|
||||||
}
|
|
||||||
nplugins = 0;
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Call plugin_start in all plugins
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
restconf_plugin_start(clicon_handle h,
|
|
||||||
int argc,
|
|
||||||
char **argv)
|
|
||||||
{
|
|
||||||
int i;
|
|
||||||
plgstart_t *startfn;
|
|
||||||
|
|
||||||
for (i = 0; i < nplugins; i++) {
|
|
||||||
/* Call exit function is it exists */
|
|
||||||
if ((startfn = dlsym(plugins[i], PLUGIN_START)) == NULL)
|
|
||||||
break;
|
|
||||||
optind = 0;
|
|
||||||
if (startfn(h, argc, argv) < 0) {
|
|
||||||
clicon_debug(1, "plugin_start() failed\n");
|
|
||||||
return -1;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Run the restconf user-defined credentials callback if present
|
|
||||||
* The callback is expected to return the authenticated user, or NULL if not
|
|
||||||
* authenticasted.
|
|
||||||
* If no callback exists, return user "none"
|
|
||||||
* @param[in] h Clicon handle
|
|
||||||
* @param[in] r Fastcgi request handle
|
|
||||||
* @param[out] user The authenticated user (or NULL). Malloced, must be freed.
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
restconf_credentials(clicon_handle h,
|
|
||||||
FCGX_Request *r,
|
|
||||||
char **user)
|
|
||||||
{
|
|
||||||
int retval = -1;
|
|
||||||
|
|
||||||
clicon_debug(1, "%s", __FUNCTION__);
|
|
||||||
/* If no authentication callback then allow anything. Is this OK? */
|
|
||||||
if (_credentials_fn == NULL){
|
|
||||||
if ((*user = strdup("none")) == NULL){
|
|
||||||
clicon_err(OE_XML, errno, "strdup");
|
|
||||||
goto done;
|
|
||||||
}
|
|
||||||
goto ok;
|
|
||||||
}
|
|
||||||
if (_credentials_fn(h, r, user) < 0)
|
|
||||||
*user = NULL;
|
|
||||||
ok:
|
|
||||||
retval = 0;
|
|
||||||
done:
|
|
||||||
clicon_debug(1, "%s retval:%d user:%s", __FUNCTION__, retval, *user);
|
|
||||||
return retval;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Parse a cookie string and return value of cookie attribute
|
/*! Parse a cookie string and return value of cookie attribute
|
||||||
* @param[in] cookiestr cookie string according to rfc6265 (modified)
|
* @param[in] cookiestr cookie string according to rfc6265 (modified)
|
||||||
* @param[in] attribute cookie attribute
|
* @param[in] attribute cookie attribute
|
||||||
|
|
@ -505,3 +386,82 @@ get_user_cookie(char *cookiestr,
|
||||||
cvec_free(cvv);
|
cvec_free(cvv);
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*! Return restconf error on get/head request
|
||||||
|
* @param[in] h Clixon handle
|
||||||
|
* @param[in] r Fastcgi request handle
|
||||||
|
* @param[in] xerr XML error message from backend
|
||||||
|
* @param[in] pretty Set to 1 for pretty-printed xml/json output
|
||||||
|
* @param[in] use_xml Set to 0 for JSON and 1 for XML
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
api_return_err(clicon_handle h,
|
||||||
|
FCGX_Request *r,
|
||||||
|
cxobj *xerr,
|
||||||
|
int pretty,
|
||||||
|
int use_xml)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
cbuf *cb = NULL;
|
||||||
|
cxobj *xtag;
|
||||||
|
char *tagstr;
|
||||||
|
int code;
|
||||||
|
const char *reason_phrase;
|
||||||
|
|
||||||
|
clicon_debug(1, "%s", __FUNCTION__);
|
||||||
|
if ((cb = cbuf_new()) == NULL)
|
||||||
|
goto done;
|
||||||
|
if ((xtag = xpath_first(xerr, "//error-tag")) == NULL){
|
||||||
|
notfound(r);
|
||||||
|
goto ok;
|
||||||
|
}
|
||||||
|
tagstr = xml_body(xtag);
|
||||||
|
code = restconf_err2code(tagstr);
|
||||||
|
if ((reason_phrase = restconf_code2reason(code)) == NULL)
|
||||||
|
reason_phrase="";
|
||||||
|
if (xml_name_set(xerr, "error") < 0)
|
||||||
|
goto done;
|
||||||
|
if (use_xml){
|
||||||
|
if (clicon_xml2cbuf(cb, xerr, 2, pretty) < 0)
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
else
|
||||||
|
if (xml2json_cbuf(cb, xerr, pretty) < 0)
|
||||||
|
goto done;
|
||||||
|
FCGX_FPrintF(r->out, "Status: %d %s\r\n", code, reason_phrase);
|
||||||
|
FCGX_FPrintF(r->out, "Content-Type: application/yang-data+%s\r\n\r\n",
|
||||||
|
use_xml?"xml":"json");
|
||||||
|
if (use_xml){
|
||||||
|
if (pretty){
|
||||||
|
FCGX_FPrintF(r->out, " <errors xmlns=\"urn:ietf:params:xml:ns:yang:ietf-restconf\">\n", cbuf_get(cb));
|
||||||
|
FCGX_FPrintF(r->out, "%s", cbuf_get(cb));
|
||||||
|
FCGX_FPrintF(r->out, " </errors>\r\n");
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
FCGX_FPrintF(r->out, "<errors xmlns=\"urn:ietf:params:xml:ns:yang:ietf-restconf\">", cbuf_get(cb));
|
||||||
|
FCGX_FPrintF(r->out, "%s", cbuf_get(cb));
|
||||||
|
FCGX_FPrintF(r->out, "</errors>\r\n");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else{
|
||||||
|
if (pretty){
|
||||||
|
FCGX_FPrintF(r->out, "{\n");
|
||||||
|
FCGX_FPrintF(r->out, " \"ietf-restconf:errors\" : %s\n",
|
||||||
|
cbuf_get(cb));
|
||||||
|
FCGX_FPrintF(r->out, "}\r\n");
|
||||||
|
}
|
||||||
|
else{
|
||||||
|
FCGX_FPrintF(r->out, "{");
|
||||||
|
FCGX_FPrintF(r->out, "\"ietf-restconf:errors\" : ");
|
||||||
|
FCGX_FPrintF(r->out, "%s", cbuf_get(cb));
|
||||||
|
FCGX_FPrintF(r->out, "}\r\n");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
ok:
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
clicon_debug(1, "%s retval:%d", __FUNCTION__, retval);
|
||||||
|
if (cb)
|
||||||
|
cbuf_free(cb);
|
||||||
|
return retval;
|
||||||
|
}
|
||||||
|
|
|
||||||
|
|
@ -37,11 +37,7 @@
|
||||||
#define _RESTCONF_LIB_H_
|
#define _RESTCONF_LIB_H_
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Constants
|
* Prototypes (also in clixon_restconf.h)
|
||||||
*/
|
|
||||||
|
|
||||||
/*
|
|
||||||
* Prototypes
|
|
||||||
*/
|
*/
|
||||||
int restconf_err2code(char *tag);
|
int restconf_err2code(char *tag);
|
||||||
const char *restconf_code2reason(int code);
|
const char *restconf_code2reason(int code);
|
||||||
|
|
@ -57,12 +53,8 @@ int notimplemented(FCGX_Request *r);
|
||||||
int clicon_debug_xml(int dbglevel, char *str, cxobj *cx);
|
int clicon_debug_xml(int dbglevel, char *str, cxobj *cx);
|
||||||
int test(FCGX_Request *r, int dbg);
|
int test(FCGX_Request *r, int dbg);
|
||||||
cbuf *readdata(FCGX_Request *r);
|
cbuf *readdata(FCGX_Request *r);
|
||||||
|
|
||||||
int restconf_plugin_load(clicon_handle h);
|
|
||||||
int restconf_plugin_start(clicon_handle h, int argc, char **argv);
|
|
||||||
int restconf_plugin_unload(clicon_handle h);
|
|
||||||
int restconf_credentials(clicon_handle h, FCGX_Request *r, char **user);
|
|
||||||
int get_user_cookie(char *cookiestr, char *attribute, char **val);
|
int get_user_cookie(char *cookiestr, char *attribute, char **val);
|
||||||
|
int api_return_err(clicon_handle h, FCGX_Request *r, cxobj *xerr,
|
||||||
|
int pretty, int use_xml);
|
||||||
|
|
||||||
#endif /* _RESTCONF_LIB_H_ */
|
#endif /* _RESTCONF_LIB_H_ */
|
||||||
|
|
|
||||||
|
|
@ -39,7 +39,7 @@
|
||||||
* sudo apt-get install libfcgi-dev
|
* sudo apt-get install libfcgi-dev
|
||||||
* gcc -o fastcgi fastcgi.c -lfcgi
|
* gcc -o fastcgi fastcgi.c -lfcgi
|
||||||
|
|
||||||
* sudo su -c "/www-data/clixon_restconf -Df /usr/local/etc/routing.xml " -s /bin/sh www-data
|
* sudo su -c "/www-data/clixon_restconf -Df /usr/local/etc/example.xml " -s /bin/sh www-data
|
||||||
|
|
||||||
* This is the interface:
|
* This is the interface:
|
||||||
* api/data/profile=<name>/metric=<name> PUT data:enable=<flag>
|
* api/data/profile=<name>/metric=<name> PUT data:enable=<flag>
|
||||||
|
|
@ -54,7 +54,8 @@
|
||||||
#include <syslog.h>
|
#include <syslog.h>
|
||||||
#include <fcntl.h>
|
#include <fcntl.h>
|
||||||
#include <time.h>
|
#include <time.h>
|
||||||
#include <fcgi_stdio.h>
|
#include <limits.h>
|
||||||
|
|
||||||
#include <signal.h>
|
#include <signal.h>
|
||||||
#include <sys/time.h>
|
#include <sys/time.h>
|
||||||
#include <sys/wait.h>
|
#include <sys/wait.h>
|
||||||
|
|
@ -66,6 +67,8 @@
|
||||||
/* clicon */
|
/* clicon */
|
||||||
#include <clixon/clixon.h>
|
#include <clixon/clixon.h>
|
||||||
|
|
||||||
|
#include <fcgi_stdio.h> /* Need to be after clixon_xml-h due to attribute format */
|
||||||
|
|
||||||
/* restconf */
|
/* restconf */
|
||||||
#include "restconf_lib.h"
|
#include "restconf_lib.h"
|
||||||
#include "restconf_methods.h"
|
#include "restconf_methods.h"
|
||||||
|
|
@ -89,7 +92,10 @@
|
||||||
* @param[in] pcvec Vector of path ie DOCUMENT_URI element
|
* @param[in] pcvec Vector of path ie DOCUMENT_URI element
|
||||||
* @param[in] pi Offset, where to start pcvec
|
* @param[in] pi Offset, where to start pcvec
|
||||||
* @param[in] qvec Vector of query string (QUERY_STRING)
|
* @param[in] qvec Vector of query string (QUERY_STRING)
|
||||||
* @param[in] dvec Stream input data
|
* @param[in] dvec Stream input daat
|
||||||
|
* @param[in] pretty Set to 1 for pretty-printed xml/json output
|
||||||
|
* @param[in] use_xml Set to 0 for JSON and 1 for XML
|
||||||
|
* @param[in] parse_xml Set to 0 for JSON and 1 for XML for input data
|
||||||
*/
|
*/
|
||||||
static int
|
static int
|
||||||
api_data(clicon_handle h,
|
api_data(clicon_handle h,
|
||||||
|
|
@ -98,7 +104,10 @@ api_data(clicon_handle h,
|
||||||
cvec *pcvec,
|
cvec *pcvec,
|
||||||
int pi,
|
int pi,
|
||||||
cvec *qvec,
|
cvec *qvec,
|
||||||
char *data)
|
char *data,
|
||||||
|
int pretty,
|
||||||
|
int use_xml,
|
||||||
|
int parse_xml)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
char *request_method;
|
char *request_method;
|
||||||
|
|
@ -109,17 +118,17 @@ api_data(clicon_handle h,
|
||||||
if (strcmp(request_method, "OPTIONS")==0)
|
if (strcmp(request_method, "OPTIONS")==0)
|
||||||
retval = api_data_options(h, r);
|
retval = api_data_options(h, r);
|
||||||
else if (strcmp(request_method, "HEAD")==0)
|
else if (strcmp(request_method, "HEAD")==0)
|
||||||
retval = api_data_head(h, r, pcvec, pi, qvec);
|
retval = api_data_head(h, r, pcvec, pi, qvec, pretty, use_xml);
|
||||||
else if (strcmp(request_method, "GET")==0)
|
else if (strcmp(request_method, "GET")==0)
|
||||||
retval = api_data_get(h, r, pcvec, pi, qvec);
|
retval = api_data_get(h, r, pcvec, pi, qvec, pretty, use_xml);
|
||||||
else if (strcmp(request_method, "POST")==0)
|
else if (strcmp(request_method, "POST")==0)
|
||||||
retval = api_data_post(h, r, api_path, pcvec, pi, qvec, data);
|
retval = api_data_post(h, r, api_path, pcvec, pi, qvec, data, pretty, use_xml, parse_xml);
|
||||||
else if (strcmp(request_method, "PUT")==0)
|
else if (strcmp(request_method, "PUT")==0)
|
||||||
retval = api_data_put(h, r, api_path, pcvec, pi, qvec, data);
|
retval = api_data_put(h, r, api_path, pcvec, pi, qvec, data, pretty, use_xml, parse_xml);
|
||||||
else if (strcmp(request_method, "PATCH")==0)
|
else if (strcmp(request_method, "PATCH")==0)
|
||||||
retval = api_data_patch(h, r, api_path, pcvec, pi, qvec, data);
|
retval = api_data_patch(h, r, api_path, pcvec, pi, qvec, data);
|
||||||
else if (strcmp(request_method, "DELETE")==0)
|
else if (strcmp(request_method, "DELETE")==0)
|
||||||
retval = api_data_delete(h, r, api_path, pi);
|
retval = api_data_delete(h, r, api_path, pi, pretty, use_xml);
|
||||||
else
|
else
|
||||||
retval = notfound(r);
|
retval = notfound(r);
|
||||||
clicon_debug(1, "%s retval:%d", __FUNCTION__, retval);
|
clicon_debug(1, "%s retval:%d", __FUNCTION__, retval);
|
||||||
|
|
@ -129,11 +138,12 @@ api_data(clicon_handle h,
|
||||||
/*! Operations REST method, POST
|
/*! Operations REST method, POST
|
||||||
* @param[in] h CLIXON handle
|
* @param[in] h CLIXON handle
|
||||||
* @param[in] r Fastcgi request handle
|
* @param[in] r Fastcgi request handle
|
||||||
* @param[in] api_path According to restconf (Sec 3.5.1.1 in [draft])
|
* @param[in] path According to restconf (Sec 3.5.1.1 in [draft])
|
||||||
* @param[in] pcvec Vector of path ie DOCUMENT_URI element
|
* @param[in] pcvec Vector of path ie DOCUMENT_URI element
|
||||||
* @param[in] pi Offset, where to start pcvec
|
* @param[in] pi Offset, where to start pcvec
|
||||||
* @param[in] qvec Vector of query string (QUERY_STRING)
|
* @param[in] qvec Vector of query string (QUERY_STRING)
|
||||||
* @param[in] dvec Stream input data
|
* @param[in] data Stream input data
|
||||||
|
* @param[in] parse_xml Set to 0 for JSON and 1 for XML for input data
|
||||||
*/
|
*/
|
||||||
static int
|
static int
|
||||||
api_operations(clicon_handle h,
|
api_operations(clicon_handle h,
|
||||||
|
|
@ -143,7 +153,9 @@ api_operations(clicon_handle h,
|
||||||
int pi,
|
int pi,
|
||||||
cvec *qvec,
|
cvec *qvec,
|
||||||
char *data,
|
char *data,
|
||||||
char *username)
|
int pretty,
|
||||||
|
int use_xml,
|
||||||
|
int parse_xml)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
char *request_method;
|
char *request_method;
|
||||||
|
|
@ -152,16 +164,43 @@ api_operations(clicon_handle h,
|
||||||
request_method = FCGX_GetParam("REQUEST_METHOD", r->envp);
|
request_method = FCGX_GetParam("REQUEST_METHOD", r->envp);
|
||||||
clicon_debug(1, "%s method:%s", __FUNCTION__, request_method);
|
clicon_debug(1, "%s method:%s", __FUNCTION__, request_method);
|
||||||
if (strcmp(request_method, "GET")==0)
|
if (strcmp(request_method, "GET")==0)
|
||||||
retval = api_operation_get(h, r, path, pcvec, pi, qvec, data);
|
retval = api_operations_get(h, r, path, pcvec, pi, qvec, data, pretty, use_xml);
|
||||||
else if (strcmp(request_method, "POST")==0)
|
else if (strcmp(request_method, "POST")==0)
|
||||||
retval = api_operation_post(h, r, path, pcvec, pi, qvec, data, username);
|
retval = api_operations_post(h, r, path, pcvec, pi, qvec, data,
|
||||||
|
pretty, use_xml, parse_xml);
|
||||||
else
|
else
|
||||||
retval = notfound(r);
|
retval = notfound(r);
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*! Determine the root of the RESTCONF API
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] r Fastcgi request handle
|
||||||
|
* @note Hardcoded to "/restconf"
|
||||||
|
* Return see RFC8040 3.1 and RFC7320
|
||||||
|
* In line with the best practices defined by [RFC7320], RESTCONF
|
||||||
|
* enables deployments to specify where the RESTCONF API is located.
|
||||||
|
*/
|
||||||
|
static int
|
||||||
|
api_well_known(clicon_handle h,
|
||||||
|
FCGX_Request *r)
|
||||||
|
{
|
||||||
|
clicon_debug(1, "%s", __FUNCTION__);
|
||||||
|
FCGX_FPrintF(r->out, "Content-Type: application/xrd+xml\r\n");
|
||||||
|
FCGX_FPrintF(r->out, "\r\n");
|
||||||
|
FCGX_SetExitStatus(200, r->out); /* OK */
|
||||||
|
FCGX_FPrintF(r->out, "<XRD xmlns='http://docs.oasis-open.org/ns/xri/xrd-1.0'>\n");
|
||||||
|
FCGX_FPrintF(r->out, " <Link rel='restconf' href='/restconf'/>\n");
|
||||||
|
FCGX_FPrintF(r->out, "</XRD>\r\n");
|
||||||
|
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
/*! Retrieve the Top-Level API Resource
|
/*! Retrieve the Top-Level API Resource
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] r Fastcgi request handle
|
||||||
* @note Only returns null for operations and data,...
|
* @note Only returns null for operations and data,...
|
||||||
|
* See RFC8040 3.3
|
||||||
*/
|
*/
|
||||||
static int
|
static int
|
||||||
api_root(clicon_handle h,
|
api_root(clicon_handle h,
|
||||||
|
|
@ -179,9 +218,11 @@ api_root(clicon_handle h,
|
||||||
media_accept = FCGX_GetParam("HTTP_ACCEPT", r->envp);
|
media_accept = FCGX_GetParam("HTTP_ACCEPT", r->envp);
|
||||||
if (strcmp(media_accept, "application/yang-data+xml")==0)
|
if (strcmp(media_accept, "application/yang-data+xml")==0)
|
||||||
use_xml++;
|
use_xml++;
|
||||||
|
clicon_debug(1, "%s use-xml:%d media-accept:%s", __FUNCTION__, use_xml, media_accept);
|
||||||
FCGX_SetExitStatus(200, r->out); /* OK */
|
FCGX_SetExitStatus(200, r->out); /* OK */
|
||||||
FCGX_FPrintF(r->out, "Content-Type: application/yang-data+%s\r\n", use_xml?"xml":"json");
|
FCGX_FPrintF(r->out, "Content-Type: application/yang-data+%s\r\n", use_xml?"xml":"json");
|
||||||
FCGX_FPrintF(r->out, "\r\n");
|
FCGX_FPrintF(r->out, "\r\n");
|
||||||
|
|
||||||
if (xml_parse_string("<restconf><data></data><operations></operations><yang-library-version>2016-06-21</yang-library-version></restconf>", NULL, &xt) < 0)
|
if (xml_parse_string("<restconf><data></data><operations></operations><yang-library-version>2016-06-21</yang-library-version></restconf>", NULL, &xt) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if ((cb = cbuf_new()) == NULL){
|
if ((cb = cbuf_new()) == NULL){
|
||||||
|
|
@ -235,7 +276,6 @@ api_yang_library_version(clicon_handle h,
|
||||||
if (xml_rootchild(xt, 0, &xt) < 0)
|
if (xml_rootchild(xt, 0, &xt) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if ((cb = cbuf_new()) == NULL){
|
if ((cb = cbuf_new()) == NULL){
|
||||||
clicon_err(OE_XML, errno, "cbuf_new");
|
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
if (use_xml){
|
if (use_xml){
|
||||||
|
|
@ -247,8 +287,8 @@ api_yang_library_version(clicon_handle h,
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
clicon_debug(1, "%s cb%s", __FUNCTION__, cbuf_get(cb));
|
clicon_debug(1, "%s cb%s", __FUNCTION__, cbuf_get(cb));
|
||||||
FCGX_FPrintF(r->out, "%s\r\n", cb?cbuf_get(cb):"");
|
FCGX_FPrintF(r->out, "%s\n", cb?cbuf_get(cb):"");
|
||||||
FCGX_FPrintF(r->out, "\r\n\r\n");
|
FCGX_FPrintF(r->out, "\n\n");
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
if (cb)
|
if (cb)
|
||||||
|
|
@ -276,17 +316,34 @@ api_restconf(clicon_handle h,
|
||||||
cvec *pcvec = NULL; /* for rest api */
|
cvec *pcvec = NULL; /* for rest api */
|
||||||
cbuf *cb = NULL;
|
cbuf *cb = NULL;
|
||||||
char *data;
|
char *data;
|
||||||
char *username = NULL;
|
int authenticated = 0;
|
||||||
|
char *media_accept;
|
||||||
|
char *media_content_type;
|
||||||
|
int pretty;
|
||||||
|
int parse_xml = 0; /* By default expect and parse JSON */
|
||||||
|
int use_xml = 0; /* By default use JSON */
|
||||||
|
cbuf *cbret = NULL;
|
||||||
|
cxobj *xret = NULL;
|
||||||
|
cxobj *xerr;
|
||||||
|
|
||||||
clicon_debug(1, "%s", __FUNCTION__);
|
clicon_debug(1, "%s", __FUNCTION__);
|
||||||
path = FCGX_GetParam("REQUEST_URI", r->envp);
|
path = FCGX_GetParam("REQUEST_URI", r->envp);
|
||||||
query = FCGX_GetParam("QUERY_STRING", r->envp);
|
query = FCGX_GetParam("QUERY_STRING", r->envp);
|
||||||
|
pretty = clicon_option_bool(h, "CLICON_RESTCONF_PRETTY");
|
||||||
|
/* get xml/json in put and output */
|
||||||
|
media_accept = FCGX_GetParam("HTTP_ACCEPT", r->envp);
|
||||||
|
if (media_accept && strcmp(media_accept, "application/yang-data+xml")==0)
|
||||||
|
use_xml++;
|
||||||
|
media_content_type = FCGX_GetParam("HTTP_CONTENT_TYPE", r->envp);
|
||||||
|
if (media_content_type &&
|
||||||
|
strcmp(media_content_type, "application/yang-data+xml")==0)
|
||||||
|
parse_xml++;
|
||||||
if ((pvec = clicon_strsep(path, "/", &pn)) == NULL)
|
if ((pvec = clicon_strsep(path, "/", &pn)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
/* Sanity check of path. Should be /restconf/ */
|
/* Sanity check of path. Should be /restconf/ */
|
||||||
if (pn < 2){
|
if (pn < 2){
|
||||||
retval = notfound(r);
|
notfound(r);
|
||||||
goto done;
|
goto ok;
|
||||||
}
|
}
|
||||||
if (strlen(pvec[0]) != 0){
|
if (strlen(pvec[0]) != 0){
|
||||||
retval = notfound(r);
|
retval = notfound(r);
|
||||||
|
|
@ -296,6 +353,8 @@ api_restconf(clicon_handle h,
|
||||||
retval = notfound(r);
|
retval = notfound(r);
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
|
test(r, 1);
|
||||||
|
|
||||||
if (pn == 2){
|
if (pn == 2){
|
||||||
retval = api_root(h, r);
|
retval = api_root(h, r);
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -304,7 +363,7 @@ api_restconf(clicon_handle h,
|
||||||
retval = notfound(r);
|
retval = notfound(r);
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
clicon_debug(1, "method=%s", method);
|
clicon_debug(1, "%s: method=%s", __FUNCTION__, method);
|
||||||
if (str2cvec(query, '&', '=', &qvec) < 0)
|
if (str2cvec(query, '&', '=', &qvec) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (str2cvec(path, '/', '=', &pcvec) < 0) /* rest url eg /album=ricky/foo */
|
if (str2cvec(path, '/', '=', &pcvec) < 0) /* rest url eg /album=ricky/foo */
|
||||||
|
|
@ -313,33 +372,45 @@ api_restconf(clicon_handle h,
|
||||||
if ((cb = readdata(r)) == NULL)
|
if ((cb = readdata(r)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
data = cbuf_get(cb);
|
data = cbuf_get(cb);
|
||||||
clicon_debug(1, "DATA=%s", data);
|
clicon_debug(1, "%s DATA=%s", __FUNCTION__, data);
|
||||||
|
|
||||||
if (str2cvec(data, '&', '=', &dvec) < 0)
|
if (str2cvec(data, '&', '=', &dvec) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
||||||
test(r, 1);
|
|
||||||
/* If present, check credentials. See "plugin_credentials" in plugin
|
/* If present, check credentials. See "plugin_credentials" in plugin
|
||||||
* See RFC 8040 section 2.5
|
* See RFC 8040 section 2.5
|
||||||
*/
|
*/
|
||||||
if (restconf_credentials(h, r, &username) < 0)
|
if ((authenticated = clixon_plugin_auth(h, r)) < 0)
|
||||||
|
goto done;
|
||||||
|
clicon_debug(1, "%s auth:%d %s", __FUNCTION__, authenticated, clicon_username_get(h));
|
||||||
|
|
||||||
|
/* If set but no user, we set a dummy user */
|
||||||
|
if (authenticated){
|
||||||
|
if (clicon_username_get(h) == NULL)
|
||||||
|
clicon_username_set(h, "none");
|
||||||
|
}
|
||||||
|
else{
|
||||||
|
if (netconf_access_denied_xml(&xret, "protocol", "The requested URL was unauthorized") < 0)
|
||||||
|
goto done;
|
||||||
|
if ((xerr = xpath_first(xret, "//rpc-error")) != NULL){
|
||||||
|
if (api_return_err(h, r, xerr, pretty, use_xml) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
clicon_debug(1, "%s username:%s", __FUNCTION__, username);
|
|
||||||
clicon_debug(1, "%s credentials ok username:%s (should be non-NULL)",
|
|
||||||
__FUNCTION__, username);
|
|
||||||
if (username == NULL){
|
|
||||||
unauthorized(r);
|
|
||||||
goto ok;
|
goto ok;
|
||||||
}
|
}
|
||||||
|
goto ok;
|
||||||
|
}
|
||||||
|
clicon_debug(1, "%s auth2:%d %s", __FUNCTION__, authenticated, clicon_username_get(h));
|
||||||
if (strcmp(method, "yang-library-version")==0){
|
if (strcmp(method, "yang-library-version")==0){
|
||||||
if (api_yang_library_version(h, r) < 0)
|
if (api_yang_library_version(h, r) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
else if (strcmp(method, "data") == 0){ /* restconf, skip /api/data */
|
else if (strcmp(method, "data") == 0){ /* restconf, skip /api/data */
|
||||||
if (api_data(h, r, path, pcvec, 2, qvec, data) < 0)
|
if (api_data(h, r, path, pcvec, 2, qvec, data,
|
||||||
|
pretty, use_xml, parse_xml) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
else if (strcmp(method, "operations") == 0){ /* rpc */
|
else if (strcmp(method, "operations") == 0){ /* rpc */
|
||||||
if (api_operations(h, r, path, pcvec, 2, qvec, data, username) < 0)
|
if (api_operations(h, r, path, pcvec, 2, qvec, data,
|
||||||
|
pretty, use_xml, parse_xml) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
else if (strcmp(method, "test") == 0)
|
else if (strcmp(method, "test") == 0)
|
||||||
|
|
@ -360,35 +431,20 @@ api_restconf(clicon_handle h,
|
||||||
cvec_free(pcvec);
|
cvec_free(pcvec);
|
||||||
if (cb)
|
if (cb)
|
||||||
cbuf_free(cb);
|
cbuf_free(cb);
|
||||||
if (username)
|
if (cbret)
|
||||||
free(username);
|
cbuf_free(cbret);
|
||||||
|
if (xret)
|
||||||
|
xml_free(xret);
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Process a FastCGI request
|
|
||||||
* @param[in] r Fastcgi request handle
|
|
||||||
*/
|
|
||||||
static int
|
|
||||||
api_well_known(clicon_handle h,
|
|
||||||
FCGX_Request *r)
|
|
||||||
{
|
|
||||||
clicon_debug(1, "%s", __FUNCTION__);
|
|
||||||
FCGX_FPrintF(r->out, "Content-Type: application/xrd+xml\r\n");
|
|
||||||
FCGX_FPrintF(r->out, "\r\n");
|
|
||||||
FCGX_SetExitStatus(200, r->out); /* OK */
|
|
||||||
FCGX_FPrintF(r->out, "<XRD xmlns='http://docs.oasis-open.org/ns/xri/xrd-1.0'>\r\n");
|
|
||||||
FCGX_FPrintF(r->out, " <Link rel='restconf' href='/restconf'/>\r\n");
|
|
||||||
FCGX_FPrintF(r->out, "</XRD>\r\n");
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
static int
|
static int
|
||||||
restconf_terminate(clicon_handle h)
|
restconf_terminate(clicon_handle h)
|
||||||
{
|
{
|
||||||
yang_spec *yspec;
|
yang_spec *yspec;
|
||||||
|
|
||||||
clicon_debug(0, "%s", __FUNCTION__);
|
clixon_plugin_exit(h);
|
||||||
|
rpc_callback_delete_all();
|
||||||
clicon_rpc_close_session(h);
|
clicon_rpc_close_session(h);
|
||||||
if ((yspec = clicon_dbspec_yang(h)) != NULL)
|
if ((yspec = clicon_dbspec_yang(h)) != NULL)
|
||||||
yspec_free(yspec);
|
yspec_free(yspec);
|
||||||
|
|
@ -447,6 +503,7 @@ main(int argc,
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
int sock;
|
int sock;
|
||||||
|
char *argv0 = argv[0];
|
||||||
FCGX_Request request;
|
FCGX_Request request;
|
||||||
FCGX_Request *r = &request;
|
FCGX_Request *r = &request;
|
||||||
char c;
|
char c;
|
||||||
|
|
@ -454,6 +511,8 @@ main(int argc,
|
||||||
char *path;
|
char *path;
|
||||||
clicon_handle h;
|
clicon_handle h;
|
||||||
char *yangspec=NULL;
|
char *yangspec=NULL;
|
||||||
|
char *dir;
|
||||||
|
char *tmp;
|
||||||
|
|
||||||
/* In the startup, logs to stderr & debug flag set later */
|
/* In the startup, logs to stderr & debug flag set later */
|
||||||
clicon_log_init(__PROGRAM__, LOG_INFO, CLICON_LOG_SYSLOG);
|
clicon_log_init(__PROGRAM__, LOG_INFO, CLICON_LOG_SYSLOG);
|
||||||
|
|
@ -510,13 +569,22 @@ main(int argc,
|
||||||
clicon_option_str_set(h, "CLICON_YANG_MODULE_MAIN", yangspec);
|
clicon_option_str_set(h, "CLICON_YANG_MODULE_MAIN", yangspec);
|
||||||
|
|
||||||
/* Initialize plugins group */
|
/* Initialize plugins group */
|
||||||
if (restconf_plugin_load(h) < 0)
|
if ((dir = clicon_restconf_dir(h)) != NULL)
|
||||||
|
if (clixon_plugins_load(h, CLIXON_PLUGIN_INIT, dir, NULL) < 0)
|
||||||
return -1;
|
return -1;
|
||||||
|
|
||||||
/* Parse yang database spec file */
|
/* Parse yang database spec file */
|
||||||
if (yang_spec_main(h) == NULL)
|
if (yang_spec_main(h) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
||||||
|
/* Call start function in all plugins before we go interactive
|
||||||
|
Pass all args after the standard options to plugin_start
|
||||||
|
*/
|
||||||
|
tmp = *(argv-1);
|
||||||
|
*(argv-1) = argv0;
|
||||||
|
clixon_plugin_start(h, argc+1, argv-1);
|
||||||
|
*(argv-1) = tmp;
|
||||||
|
|
||||||
if ((sockpath = clicon_option_str(h, "CLICON_RESTCONF_PATH")) == NULL){
|
if ((sockpath = clicon_option_str(h, "CLICON_RESTCONF_PATH")) == NULL){
|
||||||
clicon_err(OE_CFG, errno, "No CLICON_RESTCONF_PATH in clixon configure file");
|
clicon_err(OE_CFG, errno, "No CLICON_RESTCONF_PATH in clixon configure file");
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -545,13 +613,12 @@ main(int argc,
|
||||||
if (strncmp(path, RESTCONF_API_ROOT, strlen(RESTCONF_API_ROOT)) == 0)
|
if (strncmp(path, RESTCONF_API_ROOT, strlen(RESTCONF_API_ROOT)) == 0)
|
||||||
api_restconf(h, r); /* This is the function */
|
api_restconf(h, r); /* This is the function */
|
||||||
else if (strncmp(path, RESTCONF_WELL_KNOWN, strlen(RESTCONF_WELL_KNOWN)) == 0) {
|
else if (strncmp(path, RESTCONF_WELL_KNOWN, strlen(RESTCONF_WELL_KNOWN)) == 0) {
|
||||||
api_well_known(h, r); /* This is the function */
|
api_well_known(h, r); /* */
|
||||||
}
|
}
|
||||||
else{
|
else{
|
||||||
clicon_debug(1, "top-level %s not found", path);
|
clicon_debug(1, "top-level %s not found", path);
|
||||||
notfound(r);
|
notfound(r);
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
clicon_debug(1, "NULL URI");
|
clicon_debug(1, "NULL URI");
|
||||||
|
|
@ -559,7 +626,6 @@ main(int argc,
|
||||||
}
|
}
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
restconf_plugin_unload(h);
|
|
||||||
restconf_terminate(h);
|
restconf_terminate(h);
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
|
||||||
File diff suppressed because it is too large
Load diff
|
|
@ -46,27 +46,31 @@
|
||||||
*/
|
*/
|
||||||
int api_data_options(clicon_handle h, FCGX_Request *r);
|
int api_data_options(clicon_handle h, FCGX_Request *r);
|
||||||
int api_data_head(clicon_handle h, FCGX_Request *r, cvec *pcvec, int pi,
|
int api_data_head(clicon_handle h, FCGX_Request *r, cvec *pcvec, int pi,
|
||||||
cvec *qvec);
|
cvec *qvec, int pretty, int use_xml);
|
||||||
int api_data_get(clicon_handle h, FCGX_Request *r, cvec *pcvec, int pi,
|
int api_data_get(clicon_handle h, FCGX_Request *r, cvec *pcvec, int pi,
|
||||||
cvec *qvec);
|
cvec *qvec, int pretty, int use_xml);
|
||||||
int api_data_post(clicon_handle h, FCGX_Request *r, char *api_path,
|
int api_data_post(clicon_handle h, FCGX_Request *r, char *api_path,
|
||||||
cvec *pcvec, int pi,
|
cvec *pcvec, int pi,
|
||||||
cvec *qvec, char *data);
|
cvec *qvec, char *data,
|
||||||
|
int pretty, int use_xml, int parse_xml);
|
||||||
int api_data_put(clicon_handle h, FCGX_Request *r, char *api_path,
|
int api_data_put(clicon_handle h, FCGX_Request *r, char *api_path,
|
||||||
cvec *pcvec, int pi,
|
cvec *pcvec, int pi,
|
||||||
cvec *qvec, char *data);
|
cvec *qvec, char *data,
|
||||||
|
int pretty, int use_xml, int parse_xml);
|
||||||
int api_data_patch(clicon_handle h, FCGX_Request *r, char *api_path,
|
int api_data_patch(clicon_handle h, FCGX_Request *r, char *api_path,
|
||||||
cvec *pcvec, int pi,
|
cvec *pcvec, int pi,
|
||||||
cvec *qvec, char *data);
|
cvec *qvec, char *data);
|
||||||
int api_data_delete(clicon_handle h, FCGX_Request *r, char *api_path, int pi);
|
int api_data_delete(clicon_handle h, FCGX_Request *r, char *api_path, int pi,
|
||||||
|
int pretty, int use_xml);
|
||||||
|
|
||||||
int api_operation_get(clicon_handle h, FCGX_Request *r,
|
int api_operations_get(clicon_handle h, FCGX_Request *r,
|
||||||
char *path,
|
|
||||||
cvec *pcvec, int pi, cvec *qvec, char *data);
|
|
||||||
|
|
||||||
int api_operation_post(clicon_handle h, FCGX_Request *r,
|
|
||||||
char *path,
|
char *path,
|
||||||
cvec *pcvec, int pi, cvec *qvec, char *data,
|
cvec *pcvec, int pi, cvec *qvec, char *data,
|
||||||
char *username);
|
int pretty, int use_xml);
|
||||||
|
|
||||||
|
int api_operations_post(clicon_handle h, FCGX_Request *r,
|
||||||
|
char *path,
|
||||||
|
cvec *pcvec, int pi, cvec *qvec, char *data,
|
||||||
|
int pretty, int use_xml, int parse_xml);
|
||||||
|
|
||||||
#endif /* _RESTCONF_METHODS_H_ */
|
#endif /* _RESTCONF_METHODS_H_ */
|
||||||
|
|
|
||||||
|
|
@ -1,129 +0,0 @@
|
||||||
#
|
|
||||||
# ***** BEGIN LICENSE BLOCK *****
|
|
||||||
#
|
|
||||||
# Copyright (C) 2009-2018 Olof Hagsand and Benny Holmgren
|
|
||||||
#
|
|
||||||
# This file is part of CLIXON
|
|
||||||
#
|
|
||||||
# Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
# you may not use this file except in compliance with the License.
|
|
||||||
# You may obtain a copy of the License at
|
|
||||||
#
|
|
||||||
# http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
#
|
|
||||||
# Unless required by applicable law or agreed to in writing, software
|
|
||||||
# distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
# See the License for the specific language governing permissions and
|
|
||||||
# limitations under the License.
|
|
||||||
#
|
|
||||||
# Alternatively, the contents of this file may be used under the terms of
|
|
||||||
# the GNU General Public License Version 3 or later (the "GPL"),
|
|
||||||
# in which case the provisions of the GPL are applicable instead
|
|
||||||
# of those above. If you wish to allow use of your version of this file only
|
|
||||||
# under the terms of the GPL, and not to allow others to
|
|
||||||
# use your version of this file under the terms of Apache License version 2,
|
|
||||||
# indicate your decision by deleting the provisions above and replace them with
|
|
||||||
# the notice and other provisions required by the GPL. If you do not delete
|
|
||||||
# the provisions above, a recipient may use your version of this file under
|
|
||||||
# the terms of any one of the Apache License version 2 or the GPL.
|
|
||||||
#
|
|
||||||
# ***** END LICENSE BLOCK *****
|
|
||||||
#
|
|
||||||
|
|
||||||
#
|
|
||||||
# CLIXON options - Default values
|
|
||||||
# The origin of this file is run a _first_ time through a pre-processor at
|
|
||||||
# clixon make install time causing autoconf constants (such as "prefix" and
|
|
||||||
# "localstatedir") to be replaced with their installed values.
|
|
||||||
# It should be run a _second_ time as a part of installation of the application,
|
|
||||||
# in case clixon.mk is included in the application include file, and
|
|
||||||
# "$(APPNAME).conf" rule is accessed.
|
|
||||||
#
|
|
||||||
# See clicon_tutorial for more documentation
|
|
||||||
|
|
||||||
# Location of configuration-file for default values (this file)
|
|
||||||
CLICON_CONFIGFILE sysconfdir/APPNAME.conf
|
|
||||||
|
|
||||||
# Location of YANG module and submodule files.
|
|
||||||
CLICON_YANG_DIR prefix/share/APPNAME/yang
|
|
||||||
|
|
||||||
# Main yang module or absolute filename. If module then search as follows:
|
|
||||||
# <yangdir>/<module>[@<revision>]
|
|
||||||
# CLICON_YANG_MODULE_MAIN clicon
|
|
||||||
|
|
||||||
# Option used to construct initial yang file:
|
|
||||||
# <module>[@<revision>]
|
|
||||||
CLICON_YANG_MODULE_REVISION
|
|
||||||
|
|
||||||
# Location of backend .so plugins
|
|
||||||
CLICON_BACKEND_DIR libdir/APPNAME/backend
|
|
||||||
|
|
||||||
# Location of netconf (frontend) .so plugins
|
|
||||||
CLICON_NETCONF_DIR libdir/APPNAME/netconf
|
|
||||||
|
|
||||||
# Location of restconf (frontend) .so plugins
|
|
||||||
CLICON_RESTCONF_DIR libdir/APPNAME/restconf
|
|
||||||
|
|
||||||
# Location of cli frontend .so plugins
|
|
||||||
CLICON_CLI_DIR libdir/APPNAME/cli
|
|
||||||
|
|
||||||
# Location of frontend .cli cligen spec files
|
|
||||||
CLICON_CLISPEC_DIR libdir/APPNAME/clispec
|
|
||||||
|
|
||||||
# Enabled uses "startup" configuration on boot
|
|
||||||
CLICON_USE_STARTUP_CONFIG 0
|
|
||||||
|
|
||||||
# Address family for communicating with clixon_backend (UNIX|IPv4|IPv6)
|
|
||||||
CLICON_SOCK_FAMILY UNIX
|
|
||||||
|
|
||||||
# If family above is AF_UNIX: Unix socket for communicating with clixon_backend
|
|
||||||
# If family above is AF_INET: IPv4 address
|
|
||||||
CLICON_SOCK localstatedir/APPNAME/APPNAME.sock
|
|
||||||
|
|
||||||
# Inet socket port for communicating with clixon_backend (only IPv4|IPv6)
|
|
||||||
CLICON_SOCK_PORT 4535
|
|
||||||
|
|
||||||
# Process-id file
|
|
||||||
CLICON_BACKEND_PIDFILE localstatedir/APPNAME/APPNAME.pidfile
|
|
||||||
|
|
||||||
# Group membership to access clixon_backend unix socket
|
|
||||||
# CLICON_SOCK_GROUP clicon
|
|
||||||
|
|
||||||
# Set if all configuration changes are committed directly, commit command unnecessary
|
|
||||||
# CLICON_AUTOCOMMIT 0
|
|
||||||
|
|
||||||
# Name of master plugin (both frontend and backend). Master plugin has special
|
|
||||||
# callbacks for frontends. See clicon user manual for more info.
|
|
||||||
# CLICON_MASTER_PLUGIN master
|
|
||||||
|
|
||||||
# Startup CLI mode. This should match the CLICON_MODE in your startup clispec file
|
|
||||||
# CLICON_CLI_MODE base
|
|
||||||
|
|
||||||
# Generate code for CLI completion of existing db symbols. Add name="myspec" in
|
|
||||||
# datamodel spec and reference as @myspec.
|
|
||||||
# CLICON_CLI_GENMODEL 1
|
|
||||||
|
|
||||||
# Generate code for CLI completion of existing db symbols
|
|
||||||
# CLICON_CLI_GENMODEL_COMPLETION 1
|
|
||||||
|
|
||||||
# How to generate and show CLI syntax: VARS|ALL
|
|
||||||
# CLICON_CLI_GENMODEL_TYPE VARS
|
|
||||||
|
|
||||||
# Directory where "running", "candidate" and "startup" are placed
|
|
||||||
CLICON_XMLDB_DIR localstatedir/APPNAME
|
|
||||||
|
|
||||||
# XMLDB datastore plugin filename (see datastore/ and clixon_xml_db.[ch])
|
|
||||||
CLICON_XMLDB_PLUGIN libdir/xmldb/text.so
|
|
||||||
|
|
||||||
# Dont include keys in cvec in cli vars callbacks, ie a & k in 'a <b> k <c>' ignored
|
|
||||||
# CLICON_CLI_VARONLY 1
|
|
||||||
|
|
||||||
# Set to 0 if you want CLI to wrap to next line.
|
|
||||||
# Set to 1 if you want CLI to scroll sideways when approaching right margin
|
|
||||||
# CLICON_CLI_LINESCROLLING 1
|
|
||||||
|
|
||||||
# FastCGI unix socket. Should be specified in webserver
|
|
||||||
# Eg in nginx: fastcgi_pass unix:/www-data/clicon_restconf.sock;
|
|
||||||
CLICON_RESTCONF_PATH /www-data/fastcgi_restconf.sock
|
|
||||||
|
|
||||||
124
configure
vendored
124
configure
vendored
|
|
@ -632,7 +632,6 @@ CPP
|
||||||
OBJEXT
|
OBJEXT
|
||||||
EXEEXT
|
EXEEXT
|
||||||
ac_ct_CC
|
ac_ct_CC
|
||||||
with_keyvalue
|
|
||||||
with_restconf
|
with_restconf
|
||||||
RANLIB
|
RANLIB
|
||||||
AR
|
AR
|
||||||
|
|
@ -640,6 +639,7 @@ EXE_SUFFIX
|
||||||
SH_SUFFIX
|
SH_SUFFIX
|
||||||
AR_SUFFIX
|
AR_SUFFIX
|
||||||
OBJ_SUFFIX
|
OBJ_SUFFIX
|
||||||
|
INSTALLFLAGS
|
||||||
CPPFLAGS
|
CPPFLAGS
|
||||||
INCLUDES
|
INCLUDES
|
||||||
LDFLAGS
|
LDFLAGS
|
||||||
|
|
@ -707,8 +707,6 @@ ac_user_opts='
|
||||||
enable_option_checking
|
enable_option_checking
|
||||||
with_cligen
|
with_cligen
|
||||||
with_restconf
|
with_restconf
|
||||||
with_keyvalue
|
|
||||||
with_qdbm
|
|
||||||
with_configfile
|
with_configfile
|
||||||
'
|
'
|
||||||
ac_precious_vars='build_alias
|
ac_precious_vars='build_alias
|
||||||
|
|
@ -1346,8 +1344,6 @@ Optional Packages:
|
||||||
--without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no)
|
--without-PACKAGE do not use PACKAGE (same as --with-PACKAGE=no)
|
||||||
--with-cligen=dir Use CLIGEN here
|
--with-cligen=dir Use CLIGEN here
|
||||||
--without-restconf disable support for restconf
|
--without-restconf disable support for restconf
|
||||||
--with-keyvalue enable support for key-value xmldb datastore
|
|
||||||
--with-qdbm=dir Use QDBM here, if keyvalue
|
|
||||||
--with-configfile=FILE set default path to config file
|
--with-configfile=FILE set default path to config file
|
||||||
|
|
||||||
Some influential environment variables:
|
Some influential environment variables:
|
||||||
|
|
@ -2146,13 +2142,14 @@ ac_compiler_gnu=$ac_cv_c_compiler_gnu
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
# Default CFLAGS unless set by environment.
|
# Default CFLAGS unless set by environment
|
||||||
: ${CFLAGS="-O2"}
|
: ${CFLAGS="-O2 -Wall"}
|
||||||
|
: ${INSTALLFLAGS="-s"}
|
||||||
|
|
||||||
CLIXON_VERSION_MAJOR="3"
|
CLIXON_VERSION_MAJOR="3"
|
||||||
CLIXON_VERSION_MINOR="5"
|
CLIXON_VERSION_MINOR="6"
|
||||||
CLIXON_VERSION_PATCH="0"
|
CLIXON_VERSION_PATCH="0"
|
||||||
CLIXON_VERSION="\"${CLIXON_VERSION_MAJOR}.${CLIXON_VERSION_MINOR}.${CLIXON_VERSION_PATCH}\""
|
CLIXON_VERSION="\"${CLIXON_VERSION_MAJOR}.${CLIXON_VERSION_MINOR}.${CLIXON_VERSION_PATCH}.PRE\""
|
||||||
# Fix to specific version (eg 3.5) or head (3)
|
# Fix to specific version (eg 3.5) or head (3)
|
||||||
CLIGEN_VERSION="3"
|
CLIGEN_VERSION="3"
|
||||||
if test "$prefix" = "NONE"; then
|
if test "$prefix" = "NONE"; then
|
||||||
|
|
@ -2348,8 +2345,8 @@ test -n "$target_alias" &&
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
# If yes, compile apps/restconf
|
# If yes, compile apps/restconf
|
||||||
# If yes, compile datastore/keyvalue
|
|
||||||
#
|
#
|
||||||
ac_ext=c
|
ac_ext=c
|
||||||
ac_cpp='$CPP $CPPFLAGS'
|
ac_cpp='$CPP $CPPFLAGS'
|
||||||
|
|
@ -3283,12 +3280,12 @@ CPPFLAGS="-DHAVE_CONFIG_H ${CPPFLAGS}"
|
||||||
{ $as_echo "$as_me:${as_lineno-$LINENO}: result: compiler is $CC" >&5
|
{ $as_echo "$as_me:${as_lineno-$LINENO}: result: compiler is $CC" >&5
|
||||||
$as_echo "compiler is $CC" >&6; }
|
$as_echo "compiler is $CC" >&6; }
|
||||||
|
|
||||||
CFLAGS="${CFLAGS} -Wall"
|
|
||||||
|
|
||||||
{ $as_echo "$as_me:${as_lineno-$LINENO}: result: CPPFLAGS is $CPPFLAGS" >&5
|
{ $as_echo "$as_me:${as_lineno-$LINENO}: result: CPPFLAGS is $CPPFLAGS" >&5
|
||||||
$as_echo "CPPFLAGS is $CPPFLAGS" >&6; }
|
$as_echo "CPPFLAGS is $CPPFLAGS" >&6; }
|
||||||
{ $as_echo "$as_me:${as_lineno-$LINENO}: result: CFLAGS is $CFLAGS" >&5
|
{ $as_echo "$as_me:${as_lineno-$LINENO}: result: CFLAGS is $CFLAGS" >&5
|
||||||
$as_echo "CFLAGS is $CFLAGS" >&6; }
|
$as_echo "CFLAGS is $CFLAGS" >&6; }
|
||||||
|
{ $as_echo "$as_me:${as_lineno-$LINENO}: result: INSTALLFLAGS is $INSTALLFLAGS" >&5
|
||||||
|
$as_echo "INSTALLFLAGS is $INSTALLFLAGS" >&6; }
|
||||||
|
|
||||||
for ac_prog in 'bison -y' byacc
|
for ac_prog in 'bison -y' byacc
|
||||||
do
|
do
|
||||||
|
|
@ -3946,107 +3943,6 @@ fi
|
||||||
|
|
||||||
fi
|
fi
|
||||||
|
|
||||||
# This is for keyvalue datastore (and qdbm)
|
|
||||||
|
|
||||||
# Check whether --with-keyvalue was given.
|
|
||||||
if test "${with_keyvalue+set}" = set; then :
|
|
||||||
withval=$with_keyvalue;
|
|
||||||
else
|
|
||||||
with_keyvalue=no
|
|
||||||
fi
|
|
||||||
|
|
||||||
if test "x${with_keyvalue}" == xyes; then
|
|
||||||
# This is for qdbm
|
|
||||||
|
|
||||||
# Check whether --with-qdbm was given.
|
|
||||||
if test "${with_qdbm+set}" = set; then :
|
|
||||||
withval=$with_qdbm;
|
|
||||||
fi
|
|
||||||
|
|
||||||
if test "${with_qdbm}"; then
|
|
||||||
echo "Using QDBM here: ${with_qdbm}"
|
|
||||||
CPPFLAGS="-I${with_qdbm}/include ${CPPFLAGS}"
|
|
||||||
LDFLAGS="-L${with_qdbm}/lib ${LDFLAGS}"
|
|
||||||
fi
|
|
||||||
# Problem: depot.h may be in qdbm/depot.h.
|
|
||||||
for ac_header in depot.h
|
|
||||||
do :
|
|
||||||
ac_fn_c_check_header_mongrel "$LINENO" "depot.h" "ac_cv_header_depot_h" "$ac_includes_default"
|
|
||||||
if test "x$ac_cv_header_depot_h" = xyes; then :
|
|
||||||
cat >>confdefs.h <<_ACEOF
|
|
||||||
#define HAVE_DEPOT_H 1
|
|
||||||
_ACEOF
|
|
||||||
|
|
||||||
else
|
|
||||||
for ac_header in qdbm/depot.h
|
|
||||||
do :
|
|
||||||
ac_fn_c_check_header_mongrel "$LINENO" "qdbm/depot.h" "ac_cv_header_qdbm_depot_h" "$ac_includes_default"
|
|
||||||
if test "x$ac_cv_header_qdbm_depot_h" = xyes; then :
|
|
||||||
cat >>confdefs.h <<_ACEOF
|
|
||||||
#define HAVE_QDBM_DEPOT_H 1
|
|
||||||
_ACEOF
|
|
||||||
|
|
||||||
else
|
|
||||||
as_fn_error $? "libqdbm-dev required" "$LINENO" 5
|
|
||||||
fi
|
|
||||||
|
|
||||||
done
|
|
||||||
|
|
||||||
fi
|
|
||||||
|
|
||||||
done
|
|
||||||
|
|
||||||
{ $as_echo "$as_me:${as_lineno-$LINENO}: checking for dpopen in -lqdbm" >&5
|
|
||||||
$as_echo_n "checking for dpopen in -lqdbm... " >&6; }
|
|
||||||
if ${ac_cv_lib_qdbm_dpopen+:} false; then :
|
|
||||||
$as_echo_n "(cached) " >&6
|
|
||||||
else
|
|
||||||
ac_check_lib_save_LIBS=$LIBS
|
|
||||||
LIBS="-lqdbm $LIBS"
|
|
||||||
cat confdefs.h - <<_ACEOF >conftest.$ac_ext
|
|
||||||
/* end confdefs.h. */
|
|
||||||
|
|
||||||
/* Override any GCC internal prototype to avoid an error.
|
|
||||||
Use char because int might match the return type of a GCC
|
|
||||||
builtin and then its argument prototype would still apply. */
|
|
||||||
#ifdef __cplusplus
|
|
||||||
extern "C"
|
|
||||||
#endif
|
|
||||||
char dpopen ();
|
|
||||||
int
|
|
||||||
main ()
|
|
||||||
{
|
|
||||||
return dpopen ();
|
|
||||||
;
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
_ACEOF
|
|
||||||
if ac_fn_c_try_link "$LINENO"; then :
|
|
||||||
ac_cv_lib_qdbm_dpopen=yes
|
|
||||||
else
|
|
||||||
ac_cv_lib_qdbm_dpopen=no
|
|
||||||
fi
|
|
||||||
rm -f core conftest.err conftest.$ac_objext \
|
|
||||||
conftest$ac_exeext conftest.$ac_ext
|
|
||||||
LIBS=$ac_check_lib_save_LIBS
|
|
||||||
fi
|
|
||||||
{ $as_echo "$as_me:${as_lineno-$LINENO}: result: $ac_cv_lib_qdbm_dpopen" >&5
|
|
||||||
$as_echo "$ac_cv_lib_qdbm_dpopen" >&6; }
|
|
||||||
if test "x$ac_cv_lib_qdbm_dpopen" = xyes; then :
|
|
||||||
cat >>confdefs.h <<_ACEOF
|
|
||||||
#define HAVE_LIBQDBM 1
|
|
||||||
_ACEOF
|
|
||||||
|
|
||||||
LIBS="-lqdbm $LIBS"
|
|
||||||
|
|
||||||
else
|
|
||||||
as_fn_error $? "libqdbm-dev required" "$LINENO" 5
|
|
||||||
fi
|
|
||||||
|
|
||||||
ac_config_files="$ac_config_files datastore/keyvalue/Makefile"
|
|
||||||
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Set default config file location
|
# Set default config file location
|
||||||
|
|
||||||
# Check whether --with-configfile was given.
|
# Check whether --with-configfile was given.
|
||||||
|
|
@ -4311,7 +4207,6 @@ _ACEOF
|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
# See also datastore/keyvalue/Makefile in with_keyvalue clause above
|
|
||||||
ac_config_files="$ac_config_files Makefile lib/Makefile lib/src/Makefile lib/clixon/Makefile apps/Makefile apps/cli/Makefile apps/backend/Makefile apps/netconf/Makefile apps/restconf/Makefile include/Makefile etc/Makefile etc/clixonrc example/Makefile example/docker/Makefile extras/rpm/Makefile docker/Makefile docker/cli/Makefile docker/cli/Dockerfile docker/backend/Makefile docker/backend/Dockerfile docker/netconf/Makefile docker/netconf/Dockerfile datastore/Makefile datastore/text/Makefile yang/Makefile doc/Makefile"
|
ac_config_files="$ac_config_files Makefile lib/Makefile lib/src/Makefile lib/clixon/Makefile apps/Makefile apps/cli/Makefile apps/backend/Makefile apps/netconf/Makefile apps/restconf/Makefile include/Makefile etc/Makefile etc/clixonrc example/Makefile example/docker/Makefile extras/rpm/Makefile docker/Makefile docker/cli/Makefile docker/cli/Dockerfile docker/backend/Makefile docker/backend/Dockerfile docker/netconf/Makefile docker/netconf/Dockerfile datastore/Makefile datastore/text/Makefile yang/Makefile doc/Makefile"
|
||||||
|
|
||||||
cat >confcache <<\_ACEOF
|
cat >confcache <<\_ACEOF
|
||||||
|
|
@ -5005,7 +4900,6 @@ do
|
||||||
case $ac_config_target in
|
case $ac_config_target in
|
||||||
"include/clixon_config.h") CONFIG_HEADERS="$CONFIG_HEADERS include/clixon_config.h" ;;
|
"include/clixon_config.h") CONFIG_HEADERS="$CONFIG_HEADERS include/clixon_config.h" ;;
|
||||||
"lib/clixon/clixon.h") CONFIG_HEADERS="$CONFIG_HEADERS lib/clixon/clixon.h" ;;
|
"lib/clixon/clixon.h") CONFIG_HEADERS="$CONFIG_HEADERS lib/clixon/clixon.h" ;;
|
||||||
"datastore/keyvalue/Makefile") CONFIG_FILES="$CONFIG_FILES datastore/keyvalue/Makefile" ;;
|
|
||||||
"Makefile") CONFIG_FILES="$CONFIG_FILES Makefile" ;;
|
"Makefile") CONFIG_FILES="$CONFIG_FILES Makefile" ;;
|
||||||
"lib/Makefile") CONFIG_FILES="$CONFIG_FILES lib/Makefile" ;;
|
"lib/Makefile") CONFIG_FILES="$CONFIG_FILES lib/Makefile" ;;
|
||||||
"lib/src/Makefile") CONFIG_FILES="$CONFIG_FILES lib/src/Makefile" ;;
|
"lib/src/Makefile") CONFIG_FILES="$CONFIG_FILES lib/src/Makefile" ;;
|
||||||
|
|
|
||||||
34
configure.ac
34
configure.ac
|
|
@ -38,13 +38,14 @@
|
||||||
|
|
||||||
AC_INIT(lib/clixon/clixon.h.in)
|
AC_INIT(lib/clixon/clixon.h.in)
|
||||||
|
|
||||||
# Default CFLAGS unless set by environment.
|
# Default CFLAGS unless set by environment
|
||||||
: ${CFLAGS="-O2"}
|
: ${CFLAGS="-O2 -Wall"}
|
||||||
|
: ${INSTALLFLAGS="-s"}
|
||||||
|
|
||||||
CLIXON_VERSION_MAJOR="3"
|
CLIXON_VERSION_MAJOR="3"
|
||||||
CLIXON_VERSION_MINOR="5"
|
CLIXON_VERSION_MINOR="6"
|
||||||
CLIXON_VERSION_PATCH="0"
|
CLIXON_VERSION_PATCH="0"
|
||||||
CLIXON_VERSION="\"${CLIXON_VERSION_MAJOR}.${CLIXON_VERSION_MINOR}.${CLIXON_VERSION_PATCH}\""
|
CLIXON_VERSION="\"${CLIXON_VERSION_MAJOR}.${CLIXON_VERSION_MINOR}.${CLIXON_VERSION_PATCH}.PRE\""
|
||||||
# Fix to specific version (eg 3.5) or head (3)
|
# Fix to specific version (eg 3.5) or head (3)
|
||||||
CLIGEN_VERSION="3"
|
CLIGEN_VERSION="3"
|
||||||
if test "$prefix" = "NONE"; then
|
if test "$prefix" = "NONE"; then
|
||||||
|
|
@ -77,6 +78,7 @@ AC_SUBST(CFLAGS)
|
||||||
AC_SUBST(LDFLAGS)
|
AC_SUBST(LDFLAGS)
|
||||||
AC_SUBST(INCLUDES)
|
AC_SUBST(INCLUDES)
|
||||||
AC_SUBST(CPPFLAGS)
|
AC_SUBST(CPPFLAGS)
|
||||||
|
AC_SUBST(INSTALLFLAGS)
|
||||||
AC_SUBST(LIBS)
|
AC_SUBST(LIBS)
|
||||||
AC_SUBST(OBJ_SUFFIX)
|
AC_SUBST(OBJ_SUFFIX)
|
||||||
AC_SUBST(AR_SUFFIX)
|
AC_SUBST(AR_SUFFIX)
|
||||||
|
|
@ -85,7 +87,6 @@ AC_SUBST(EXE_SUFFIX)
|
||||||
AC_SUBST(AR)
|
AC_SUBST(AR)
|
||||||
AC_SUBST(RANLIB)
|
AC_SUBST(RANLIB)
|
||||||
AC_SUBST(with_restconf) # If yes, compile apps/restconf
|
AC_SUBST(with_restconf) # If yes, compile apps/restconf
|
||||||
AC_SUBST(with_keyvalue) # If yes, compile datastore/keyvalue
|
|
||||||
#
|
#
|
||||||
AC_PROG_CC()
|
AC_PROG_CC()
|
||||||
AC_PROG_CPP
|
AC_PROG_CPP
|
||||||
|
|
@ -94,10 +95,9 @@ CPPFLAGS="-DHAVE_CONFIG_H ${CPPFLAGS}"
|
||||||
|
|
||||||
AC_MSG_RESULT(compiler is $CC)
|
AC_MSG_RESULT(compiler is $CC)
|
||||||
|
|
||||||
CFLAGS="${CFLAGS} -Wall"
|
|
||||||
|
|
||||||
AC_MSG_RESULT(CPPFLAGS is $CPPFLAGS)
|
AC_MSG_RESULT(CPPFLAGS is $CPPFLAGS)
|
||||||
AC_MSG_RESULT(CFLAGS is $CFLAGS)
|
AC_MSG_RESULT(CFLAGS is $CFLAGS)
|
||||||
|
AC_MSG_RESULT(INSTALLFLAGS is $INSTALLFLAGS)
|
||||||
|
|
||||||
AC_PROG_YACC
|
AC_PROG_YACC
|
||||||
AC_PROG_LEX
|
AC_PROG_LEX
|
||||||
|
|
@ -142,25 +142,6 @@ if test "x${with_restconf}" == xyes; then
|
||||||
AC_CHECK_LIB(fcgi, FCGX_Init,, AC_MSG_ERROR([libfcgi-dev missing]))
|
AC_CHECK_LIB(fcgi, FCGX_Init,, AC_MSG_ERROR([libfcgi-dev missing]))
|
||||||
fi
|
fi
|
||||||
|
|
||||||
# This is for keyvalue datastore (and qdbm)
|
|
||||||
AC_ARG_WITH([keyvalue],
|
|
||||||
[AS_HELP_STRING([--with-keyvalue],[enable support for key-value xmldb datastore])],
|
|
||||||
[],
|
|
||||||
[with_keyvalue=no])
|
|
||||||
if test "x${with_keyvalue}" == xyes; then
|
|
||||||
# This is for qdbm
|
|
||||||
AC_ARG_WITH(qdbm, [ --with-qdbm=dir Use QDBM here, if keyvalue ] )
|
|
||||||
if test "${with_qdbm}"; then
|
|
||||||
echo "Using QDBM here: ${with_qdbm}"
|
|
||||||
CPPFLAGS="-I${with_qdbm}/include ${CPPFLAGS}"
|
|
||||||
LDFLAGS="-L${with_qdbm}/lib ${LDFLAGS}"
|
|
||||||
fi
|
|
||||||
# Problem: depot.h may be in qdbm/depot.h.
|
|
||||||
AC_CHECK_HEADERS(depot.h,,[AC_CHECK_HEADERS(qdbm/depot.h,,AC_MSG_ERROR(libqdbm-dev required))])
|
|
||||||
AC_CHECK_LIB(qdbm, dpopen,, AC_MSG_ERROR(libqdbm-dev required))
|
|
||||||
AC_CONFIG_FILES(datastore/keyvalue/Makefile)
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Set default config file location
|
# Set default config file location
|
||||||
AC_ARG_WITH([configfile],
|
AC_ARG_WITH([configfile],
|
||||||
[AS_HELP_STRING([--with-configfile=FILE],[set default path to config file])],
|
[AS_HELP_STRING([--with-configfile=FILE],[set default path to config file])],
|
||||||
|
|
@ -193,7 +174,6 @@ AC_DEFINE_UNQUOTED(CLIXON_DEFAULT_CONFIG,"${DEFAULT_CONFIG}",[Location for apps
|
||||||
|
|
||||||
AH_BOTTOM([#include <clixon_custom.h>])
|
AH_BOTTOM([#include <clixon_custom.h>])
|
||||||
|
|
||||||
# See also datastore/keyvalue/Makefile in with_keyvalue clause above
|
|
||||||
AC_OUTPUT(Makefile
|
AC_OUTPUT(Makefile
|
||||||
lib/Makefile
|
lib/Makefile
|
||||||
lib/src/Makefile
|
lib/src/Makefile
|
||||||
|
|
|
||||||
|
|
@ -45,6 +45,7 @@ localstatedir = @localstatedir@
|
||||||
sysconfdir = @sysconfdir@
|
sysconfdir = @sysconfdir@
|
||||||
CC = @CC@
|
CC = @CC@
|
||||||
CFLAGS = @CFLAGS@
|
CFLAGS = @CFLAGS@
|
||||||
|
INSTALLFLAGS = @INSTALLFLAGS@
|
||||||
LDFLAGS = @LDFLAGS@
|
LDFLAGS = @LDFLAGS@
|
||||||
LIBS = @LIBS@
|
LIBS = @LIBS@
|
||||||
with_restconf = @with_restconf@
|
with_restconf = @with_restconf@
|
||||||
|
|
@ -68,9 +69,6 @@ INCLUDES = -I. -I$(top_srcdir)/lib/src -I$(top_srcdir)/lib -I$(top_srcdir)/inclu
|
||||||
|
|
||||||
|
|
||||||
SUBDIRS = text
|
SUBDIRS = text
|
||||||
ifeq ($(with_keyvalue),yes)
|
|
||||||
SUBDIRS += keyvalue
|
|
||||||
endif
|
|
||||||
|
|
||||||
.PHONY: all clean depend install $(SUBDIRS)
|
.PHONY: all clean depend install $(SUBDIRS)
|
||||||
|
|
||||||
|
|
@ -104,8 +102,8 @@ install-include:
|
||||||
do (cd $$i ; $(MAKE) $(MFLAGS) $@)||exit 1; done;
|
do (cd $$i ; $(MAKE) $(MFLAGS) $@)||exit 1; done;
|
||||||
|
|
||||||
install: $(APPL)
|
install: $(APPL)
|
||||||
install -d $(DESTDIR)$(bindir)
|
install -d -m 0755 $(DESTDIR)$(bindir)
|
||||||
install $(APPL) $(DESTDIR)$(bindir)
|
install -m 0755 $(INSTALLFLAGS) $(APPL) $(DESTDIR)$(bindir)
|
||||||
for i in $(SUBDIRS); \
|
for i in $(SUBDIRS); \
|
||||||
do (cd $$i && $(MAKE) $(MFLAGS) $@)||exit 1; done
|
do (cd $$i && $(MAKE) $(MFLAGS) $@)||exit 1; done
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -33,11 +33,11 @@
|
||||||
|
|
||||||
* Examples:
|
* Examples:
|
||||||
|
|
||||||
./datastore_client -d candidate -b /usr/local/var/routing -p /home/olof/src/clixon/datastore/keyvalue/keyvalue.so -y /usr/local/share/routing/yang -m ietf-ip get /
|
./datastore_client -d candidate -b /usr/local/var/example -p /home/olof/src/clixon/datastore/keyvalue/keyvalue.so -y /usr/local/share/example/yang -m ietf-ip get /
|
||||||
|
|
||||||
sudo ./datastore_client -d candidate -b /usr/local/var/routing -p /home/olof/src/clixon/datastore/keyvalue/keyvalue.so -y /usr/local/share/routing/yang -m ietf-ip put merge /interfaces/interface=eth66 '<config>eth66</config>'
|
sudo ./datastore_client -d candidate -b /usr/local/var/example -p /home/olof/src/clixon/datastore/keyvalue/keyvalue.so -y /usr/local/share/example/yang -m ietf-ip put merge /interfaces/interface=eth66 '<config>eth66</config>'
|
||||||
|
|
||||||
sudo ./datastore_client -d candidate -b /usr/local/var/routing -p /home/olof/src/clixon/datastore/keyvalue/keyvalue.so -y /usr/local/share/routing/yang -m ietf-ip put merge / '<config><interfaces><interface><name>eth0</name><enabled>true</enabled></interface></interfaces></config>'
|
sudo ./datastore_client -d candidate -b /usr/local/var/example -p /home/olof/src/clixon/datastore/keyvalue/keyvalue.so -y /usr/local/share/example/yang -m ietf-ip put merge / '<config><interfaces><interface><name>eth0</name><enabled>true</enabled></interface></interfaces></config>'
|
||||||
|
|
||||||
*/
|
*/
|
||||||
|
|
||||||
|
|
@ -124,6 +124,7 @@ main(int argc, char **argv)
|
||||||
cxobj *xt = NULL;
|
cxobj *xt = NULL;
|
||||||
int i;
|
int i;
|
||||||
char *xpath;
|
char *xpath;
|
||||||
|
cbuf *cbret = NULL;
|
||||||
|
|
||||||
/* In the startup, logs to stderr & debug flag set later */
|
/* In the startup, logs to stderr & debug flag set later */
|
||||||
clicon_log_init(__PROGRAM__, LOG_INFO, CLICON_LOG_STDERR);
|
clicon_log_init(__PROGRAM__, LOG_INFO, CLICON_LOG_STDERR);
|
||||||
|
|
@ -261,7 +262,9 @@ main(int argc, char **argv)
|
||||||
goto done;
|
goto done;
|
||||||
if (xml_rootchild(xt, 0, &xt) < 0)
|
if (xml_rootchild(xt, 0, &xt) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (xmldb_put(h, db, op, xt) < 0)
|
if ((cbret = cbuf_new()) == NULL)
|
||||||
|
goto done;
|
||||||
|
if (xmldb_put(h, db, op, xt, cbret) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
else if (strcmp(cmd, "copy")==0){
|
else if (strcmp(cmd, "copy")==0){
|
||||||
|
|
@ -325,6 +328,8 @@ main(int argc, char **argv)
|
||||||
if (xmldb_plugin_unload(h) < 0)
|
if (xmldb_plugin_unload(h) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
done:
|
done:
|
||||||
|
if (cbret)
|
||||||
|
cbuf_free(cbret);
|
||||||
if (xt)
|
if (xt)
|
||||||
xml_free(xt);
|
xml_free(xt);
|
||||||
if (h)
|
if (h)
|
||||||
|
|
|
||||||
|
|
@ -47,6 +47,7 @@ sysconfdir = @sysconfdir@
|
||||||
VPATH = @srcdir@
|
VPATH = @srcdir@
|
||||||
CC = @CC@
|
CC = @CC@
|
||||||
CFLAGS = @CFLAGS@ -rdynamic -fPIC
|
CFLAGS = @CFLAGS@ -rdynamic -fPIC
|
||||||
|
INSTALLFLAGS = @INSTALLFLAGS@
|
||||||
LDFLAGS = @LDFLAGS@
|
LDFLAGS = @LDFLAGS@
|
||||||
LIBS = @LIBS@
|
LIBS = @LIBS@
|
||||||
DATASTORE = keyvalue
|
DATASTORE = keyvalue
|
||||||
|
|
@ -80,8 +81,8 @@ distclean: clean
|
||||||
$(CC) $(INCLUDES) $(CPPFLAGS) $(CFLAGS) -c $<
|
$(CC) $(INCLUDES) $(CPPFLAGS) $(CFLAGS) -c $<
|
||||||
|
|
||||||
install: $(PLUGIN)
|
install: $(PLUGIN)
|
||||||
install -d $(DESTDIR)$(libdir)/xmldb
|
install -d -m 0755 $(DESTDIR)$(libdir)/xmldb
|
||||||
install $(PLUGIN) $(DESTDIR)$(libdir)/xmldb
|
install -m 0644 $(INSTALLFLAGS) $(PLUGIN) $(DESTDIR)$(libdir)/xmldb
|
||||||
|
|
||||||
install-include:
|
install-include:
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -211,7 +211,7 @@ append_listkeys(cbuf *ckey,
|
||||||
xml_name(xt), keyname);
|
xml_name(xt), keyname);
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
if (percent_encode(xml_body(xkey), &bodyenc) < 0)
|
if (uri_percent_encode(xml_body(xkey), &bodyenc) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (i++)
|
if (i++)
|
||||||
cprintf(ckey, ",");
|
cprintf(ckey, ",");
|
||||||
|
|
@ -312,7 +312,7 @@ get(char *dbname,
|
||||||
restval++;
|
restval++;
|
||||||
}
|
}
|
||||||
if (i == 1){ /* spec->module->node */
|
if (i == 1){ /* spec->module->node */
|
||||||
if ((y = yang_find_topnode(ys, name, 0)) == NULL){
|
if ((y = yang_find_topnode(ys, name, YC_DATANODE)) == NULL){
|
||||||
clicon_err(OE_UNIX, errno, "No yang node found: %s", name);
|
clicon_err(OE_UNIX, errno, "No yang node found: %s", name);
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
|
|
@ -328,7 +328,7 @@ get(char *dbname,
|
||||||
* If xml element is a leaf-list, then the next element is expected to
|
* If xml element is a leaf-list, then the next element is expected to
|
||||||
* be a value
|
* be a value
|
||||||
*/
|
*/
|
||||||
if (percent_decode(restval, &argdec) < 0)
|
if (uri_percent_decode(restval, &argdec) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if ((xc = xml_find(x, name))==NULL ||
|
if ((xc = xml_find(x, name))==NULL ||
|
||||||
(xb = xml_find(xc, argdec))==NULL){
|
(xb = xml_find(xc, argdec))==NULL){
|
||||||
|
|
@ -373,7 +373,7 @@ get(char *dbname,
|
||||||
if (j>=nvalvec)
|
if (j>=nvalvec)
|
||||||
break;
|
break;
|
||||||
arg = valvec[j++];
|
arg = valvec[j++];
|
||||||
if (percent_decode(arg, &argdec) < 0)
|
if (uri_percent_decode(arg, &argdec) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
cprintf(cb, "[%s=%s]", cv_string_get(cvi), argdec);
|
cprintf(cb, "[%s=%s]", cv_string_get(cvi), argdec);
|
||||||
free(argdec);
|
free(argdec);
|
||||||
|
|
@ -391,7 +391,7 @@ get(char *dbname,
|
||||||
break;
|
break;
|
||||||
arg = valvec[j++];
|
arg = valvec[j++];
|
||||||
keyname = cv_string_get(cvi);
|
keyname = cv_string_get(cvi);
|
||||||
if (percent_decode(arg, &argdec) < 0)
|
if (uri_percent_decode(arg, &argdec) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (create_keyvalues(xc,
|
if (create_keyvalues(xc,
|
||||||
ykey,
|
ykey,
|
||||||
|
|
@ -681,7 +681,7 @@ put(char *dbfile,
|
||||||
goto done;
|
goto done;
|
||||||
break;
|
break;
|
||||||
case Y_LEAF_LIST:
|
case Y_LEAF_LIST:
|
||||||
if (percent_encode(body, &bodyenc) < 0)
|
if (uri_percent_encode(body, &bodyenc) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
cprintf(cbxk, "=%s", bodyenc);
|
cprintf(cbxk, "=%s", bodyenc);
|
||||||
break;
|
break;
|
||||||
|
|
@ -799,7 +799,7 @@ kv_put(xmldb_handle xh,
|
||||||
}
|
}
|
||||||
// clicon_log(LOG_WARNING, "%s", __FUNCTION__);
|
// clicon_log(LOG_WARNING, "%s", __FUNCTION__);
|
||||||
while ((x = xml_child_each(xt, x, CX_ELMNT)) != NULL){
|
while ((x = xml_child_each(xt, x, CX_ELMNT)) != NULL){
|
||||||
if ((ys = yang_find_topnode(yspec, xml_name(x), 0)) == NULL){
|
if ((ys = yang_find_topnode(yspec, xml_name(x), YC_DATANODE)) == NULL){
|
||||||
clicon_err(OE_UNIX, errno, "No yang node found: %s", xml_name(x));
|
clicon_err(OE_UNIX, errno, "No yang node found: %s", xml_name(x));
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
|
|
|
||||||
|
|
@ -47,6 +47,7 @@ HOST_VENDOR = @host_vendor@
|
||||||
VPATH = @srcdir@
|
VPATH = @srcdir@
|
||||||
CC = @CC@
|
CC = @CC@
|
||||||
CFLAGS = @CFLAGS@ -rdynamic -fPIC
|
CFLAGS = @CFLAGS@ -rdynamic -fPIC
|
||||||
|
INSTALLFLAGS = @INSTALLFLAGS@
|
||||||
LDFLAGS = @LDFLAGS@
|
LDFLAGS = @LDFLAGS@
|
||||||
LIBS = @LIBS@
|
LIBS = @LIBS@
|
||||||
DATASTORE = text
|
DATASTORE = text
|
||||||
|
|
@ -84,8 +85,8 @@ distclean: clean
|
||||||
$(CC) $(INCLUDES) $(CPPFLAGS) $(CFLAGS) -c $<
|
$(CC) $(INCLUDES) $(CPPFLAGS) $(CFLAGS) -c $<
|
||||||
|
|
||||||
install: $(PLUGIN)
|
install: $(PLUGIN)
|
||||||
install -d $(DESTDIR)$(libdir)/xmldb
|
install -d -m 0755 $(DESTDIR)$(libdir)/xmldb
|
||||||
install $(PLUGIN) $(DESTDIR)$(libdir)/xmldb
|
install -m 0644 $(INSTALLFLAGS) $(PLUGIN) $(DESTDIR)$(libdir)/xmldb
|
||||||
|
|
||||||
install-include:
|
install-include:
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -560,6 +560,7 @@ text_get(xmldb_handle xh,
|
||||||
* @param[in] x0p Parent of x0
|
* @param[in] x0p Parent of x0
|
||||||
* @param[in] x1 xml tree which modifies base
|
* @param[in] x1 xml tree which modifies base
|
||||||
* @param[in] op OP_MERGE, OP_REPLACE, OP_REMOVE, etc
|
* @param[in] op OP_MERGE, OP_REPLACE, OP_REMOVE, etc
|
||||||
|
* @param[out] cbret Initialized cligen buffer. Contains return XML or "".
|
||||||
* Assume x0 and x1 are same on entry and that y is the spec
|
* Assume x0 and x1 are same on entry and that y is the spec
|
||||||
* @see put in clixon_keyvalue.c
|
* @see put in clixon_keyvalue.c
|
||||||
*/
|
*/
|
||||||
|
|
@ -568,7 +569,8 @@ text_modify(cxobj *x0,
|
||||||
yang_node *y0,
|
yang_node *y0,
|
||||||
cxobj *x0p,
|
cxobj *x0p,
|
||||||
cxobj *x1,
|
cxobj *x1,
|
||||||
enum operation_type op)
|
enum operation_type op,
|
||||||
|
cbuf *cbret)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
char *opstr;
|
char *opstr;
|
||||||
|
|
@ -594,8 +596,9 @@ text_modify(cxobj *x0,
|
||||||
switch(op){
|
switch(op){
|
||||||
case OP_CREATE:
|
case OP_CREATE:
|
||||||
if (x0){
|
if (x0){
|
||||||
clicon_err(OE_XML, 0, "Object to create already exists");
|
if (netconf_data_exists(cbret, "Data already exists; cannot create new resource") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
goto ok;
|
||||||
}
|
}
|
||||||
case OP_NONE: /* fall thru */
|
case OP_NONE: /* fall thru */
|
||||||
case OP_MERGE:
|
case OP_MERGE:
|
||||||
|
|
@ -631,8 +634,9 @@ text_modify(cxobj *x0,
|
||||||
break;
|
break;
|
||||||
case OP_DELETE:
|
case OP_DELETE:
|
||||||
if (x0==NULL){
|
if (x0==NULL){
|
||||||
clicon_err(OE_XML, 0, "Object to delete does not exist");
|
if (netconf_data_missing(cbret, "Data does not exist; cannot delete resource") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
goto ok;
|
||||||
}
|
}
|
||||||
case OP_REMOVE: /* fall thru */
|
case OP_REMOVE: /* fall thru */
|
||||||
if (x0){
|
if (x0){
|
||||||
|
|
@ -647,8 +651,9 @@ text_modify(cxobj *x0,
|
||||||
switch(op){
|
switch(op){
|
||||||
case OP_CREATE:
|
case OP_CREATE:
|
||||||
if (x0){
|
if (x0){
|
||||||
clicon_err(OE_XML, 0, "Object to create already exists");
|
if (netconf_data_exists(cbret, "Data already exists; cannot create new resource") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
goto ok;
|
||||||
}
|
}
|
||||||
case OP_REPLACE: /* fall thru */
|
case OP_REPLACE: /* fall thru */
|
||||||
if (x0){
|
if (x0){
|
||||||
|
|
@ -704,14 +709,18 @@ text_modify(cxobj *x0,
|
||||||
while ((x1c = xml_child_each(x1, x1c, CX_ELMNT)) != NULL) {
|
while ((x1c = xml_child_each(x1, x1c, CX_ELMNT)) != NULL) {
|
||||||
x1cname = xml_name(x1c);
|
x1cname = xml_name(x1c);
|
||||||
yc = yang_find_datanode(y0, x1cname);
|
yc = yang_find_datanode(y0, x1cname);
|
||||||
if (text_modify(x0vec[i++], (yang_node*)yc, x0, x1c, op) < 0)
|
if (text_modify(x0vec[i++], (yang_node*)yc, x0, x1c, op, cbret) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
/* If xml return - ie netconf error xml tree, then stop and return OK */
|
||||||
|
if (cbuf_len(cbret))
|
||||||
|
goto ok;
|
||||||
}
|
}
|
||||||
break;
|
break;
|
||||||
case OP_DELETE:
|
case OP_DELETE:
|
||||||
if (x0==NULL){
|
if (x0==NULL){
|
||||||
clicon_err(OE_XML, 0, "Object to delete does not exist");
|
if (netconf_data_missing(cbret, "Data does not exist; cannot delete resource") < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
goto ok;
|
||||||
}
|
}
|
||||||
case OP_REMOVE: /* fall thru */
|
case OP_REMOVE: /* fall thru */
|
||||||
if (x0)
|
if (x0)
|
||||||
|
|
@ -721,27 +730,29 @@ text_modify(cxobj *x0,
|
||||||
break;
|
break;
|
||||||
} /* CONTAINER switch op */
|
} /* CONTAINER switch op */
|
||||||
} /* else Y_CONTAINER */
|
} /* else Y_CONTAINER */
|
||||||
// ok:
|
|
||||||
xml_sort(x0p, NULL);
|
xml_sort(x0p, NULL);
|
||||||
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
if (x0vec)
|
if (x0vec)
|
||||||
free(x0vec);
|
free(x0vec);
|
||||||
return retval;
|
return retval;
|
||||||
}
|
} /* text_modify */
|
||||||
|
|
||||||
/*! Modify a top-level base tree x0 with modification tree x1
|
/*! Modify a top-level base tree x0 with modification tree x1
|
||||||
* @param[in] x0 Base xml tree (can be NULL in add scenarios)
|
* @param[in] x0 Base xml tree (can be NULL in add scenarios)
|
||||||
* @param[in] x1 xml tree which modifies base
|
* @param[in] x1 xml tree which modifies base
|
||||||
* @param[in] yspec Top-level yang spec (if y is NULL)
|
* @param[in] yspec Top-level yang spec (if y is NULL)
|
||||||
* @param[in] op OP_MERGE, OP_REPLACE, OP_REMOVE, etc
|
* @param[in] op OP_MERGE, OP_REPLACE, OP_REMOVE, etc
|
||||||
|
* @param[out] cbret Initialized cligen buffer. Contains return XML or "".
|
||||||
* @see text_modify
|
* @see text_modify
|
||||||
*/
|
*/
|
||||||
static int
|
static int
|
||||||
text_modify_top(cxobj *x0,
|
text_modify_top(cxobj *x0,
|
||||||
cxobj *x1,
|
cxobj *x1,
|
||||||
yang_spec *yspec,
|
yang_spec *yspec,
|
||||||
enum operation_type op)
|
enum operation_type op,
|
||||||
|
cbuf *cbret)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
char *x1cname; /* child name */
|
char *x1cname; /* child name */
|
||||||
|
|
@ -759,7 +770,7 @@ text_modify_top(cxobj *x0,
|
||||||
if (xml_operation(opstr, &op) < 0)
|
if (xml_operation(opstr, &op) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Special case if x1 is empty, top-level only <config/> */
|
/* Special case if x1 is empty, top-level only <config/> */
|
||||||
if (!xml_child_nr(x1)){
|
if (xml_child_nr(x1) == 0){
|
||||||
if (xml_child_nr(x0)) /* base tree not empty */
|
if (xml_child_nr(x0)) /* base tree not empty */
|
||||||
switch(op){
|
switch(op){
|
||||||
case OP_DELETE:
|
case OP_DELETE:
|
||||||
|
|
@ -775,31 +786,43 @@ text_modify_top(cxobj *x0,
|
||||||
else /* base tree empty */
|
else /* base tree empty */
|
||||||
switch(op){
|
switch(op){
|
||||||
case OP_DELETE:
|
case OP_DELETE:
|
||||||
clicon_err(OE_XML, 0, "Object to delete does not exist");
|
if (netconf_data_missing(cbret, "Data does not exist; cannot delete resource") < 0)
|
||||||
|
goto done;
|
||||||
|
goto ok;
|
||||||
break;
|
break;
|
||||||
default:
|
default:
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
/* Special case top-level replace */
|
||||||
|
if (op == OP_REPLACE || op == OP_DELETE){
|
||||||
|
x0c = NULL;
|
||||||
|
while ((x0c = xml_child_i(x0, 0)) != 0)
|
||||||
|
xml_purge(x0c);
|
||||||
|
}
|
||||||
/* Loop through children of the modification tree */
|
/* Loop through children of the modification tree */
|
||||||
x1c = NULL;
|
x1c = NULL;
|
||||||
while ((x1c = xml_child_each(x1, x1c, CX_ELMNT)) != NULL) {
|
while ((x1c = xml_child_each(x1, x1c, CX_ELMNT)) != NULL) {
|
||||||
x1cname = xml_name(x1c);
|
x1cname = xml_name(x1c);
|
||||||
/* Get yang spec of the child */
|
/* Get yang spec of the child */
|
||||||
if ((yc = yang_find_topnode(yspec, x1cname, 0)) == NULL){
|
if ((yc = yang_find_topnode(yspec, x1cname, YC_DATANODE)) == NULL){
|
||||||
clicon_err(OE_YANG, ENOENT, "No yang spec");
|
clicon_err(OE_YANG, ENOENT, "XML node %s/%s has no corresponding yang specification (Invalid XML or wrong Yang spec?", x1, x1cname);
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
/* See if there is a corresponding node in the base tree */
|
/* See if there is a corresponding node in the base tree */
|
||||||
if (match_base_child(x0, x1c, &x0c, yc) < 0)
|
if (match_base_child(x0, x1c, &x0c, yc) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (text_modify(x0c, (yang_node*)yc, x0, x1c, op) < 0)
|
if (text_modify(x0c, (yang_node*)yc, x0, x1c, op, cbret) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
/* If xml return - ie netconf error xml tree, then stop and return OK */
|
||||||
|
if (cbuf_len(cbret))
|
||||||
|
goto ok;
|
||||||
}
|
}
|
||||||
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
return retval;
|
return retval;
|
||||||
}
|
} /* text_modify_top */
|
||||||
|
|
||||||
/*! For containers without presence and no children, remove
|
/*! For containers without presence and no children, remove
|
||||||
* @param[in] x XML tree node
|
* @param[in] x XML tree node
|
||||||
|
|
@ -846,7 +869,8 @@ int
|
||||||
text_put(xmldb_handle xh,
|
text_put(xmldb_handle xh,
|
||||||
const char *db,
|
const char *db,
|
||||||
enum operation_type op,
|
enum operation_type op,
|
||||||
cxobj *x1)
|
cxobj *x1,
|
||||||
|
cbuf *cbret)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
struct text_handle *th = handle(xh);
|
struct text_handle *th = handle(xh);
|
||||||
|
|
@ -857,7 +881,15 @@ text_put(xmldb_handle xh,
|
||||||
yang_spec *yspec;
|
yang_spec *yspec;
|
||||||
cxobj *x0 = NULL;
|
cxobj *x0 = NULL;
|
||||||
struct db_element *de = NULL;
|
struct db_element *de = NULL;
|
||||||
|
int cbretlocal = 0; /* Set if cbret is NULL on entry */
|
||||||
|
|
||||||
|
if (cbret == NULL){
|
||||||
|
if ((cbret = cbuf_new()) == NULL){
|
||||||
|
clicon_err(OE_XML, errno, "cbuf_new");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
cbretlocal++;
|
||||||
|
}
|
||||||
if ((yspec = th->th_yangspec) == NULL){
|
if ((yspec = th->th_yangspec) == NULL){
|
||||||
clicon_err(OE_YANG, ENOENT, "No yang spec");
|
clicon_err(OE_YANG, ENOENT, "No yang spec");
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -922,8 +954,11 @@ text_put(xmldb_handle xh,
|
||||||
* Modify base tree x with modification x1. This is where the
|
* Modify base tree x with modification x1. This is where the
|
||||||
* new tree is made.
|
* new tree is made.
|
||||||
*/
|
*/
|
||||||
if (text_modify_top(x0, x1, yspec, op) < 0)
|
if (text_modify_top(x0, x1, yspec, op, cbret) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
/* If xml return - ie netconf error xml tree, then stop and return OK */
|
||||||
|
if (cbuf_len(cbret))
|
||||||
|
goto ok;
|
||||||
|
|
||||||
/* Remove NONE nodes if all subs recursively are also NONE */
|
/* Remove NONE nodes if all subs recursively are also NONE */
|
||||||
if (xml_tree_prune_flagged_sub(x0, XML_FLAG_NONE, 0, NULL) <0)
|
if (xml_tree_prune_flagged_sub(x0, XML_FLAG_NONE, 0, NULL) <0)
|
||||||
|
|
@ -973,8 +1008,11 @@ text_put(xmldb_handle xh,
|
||||||
}
|
}
|
||||||
else if (clicon_xml2file(f, x0, 0, th->th_pretty) < 0)
|
else if (clicon_xml2file(f, x0, 0, th->th_pretty) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
if (cbretlocal && cbret)
|
||||||
|
cbuf_free(cbret);
|
||||||
if (f != NULL)
|
if (f != NULL)
|
||||||
fclose(f);
|
fclose(f);
|
||||||
if (dbfile)
|
if (dbfile)
|
||||||
|
|
@ -1381,7 +1419,7 @@ main(int argc,
|
||||||
op = OP_REMOVE;
|
op = OP_REMOVE;
|
||||||
else
|
else
|
||||||
usage(argv[0]);
|
usage(argv[0]);
|
||||||
if (xmldb_put(h, db, op, NULL, xn) < 0)
|
if (xmldb_put(h, db, op, NULL, xn, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
|
|
|
||||||
|
|
@ -40,7 +40,7 @@
|
||||||
* Prototypes
|
* Prototypes
|
||||||
*/
|
*/
|
||||||
int text_get(xmldb_handle h, const char *db, char *xpath, int config, cxobj **xtop);
|
int text_get(xmldb_handle h, const char *db, char *xpath, int config, cxobj **xtop);
|
||||||
int text_put(xmldb_handle h, const char *db, enum operation_type op, cxobj *xt);
|
int text_put(xmldb_handle h, const char *db, enum operation_type op, cxobj *xt, cbuf *cbret);
|
||||||
int text_dump(FILE *f, char *dbfilename, char *rxkey);
|
int text_dump(FILE *f, char *dbfilename, char *rxkey);
|
||||||
int text_copy(xmldb_handle h, const char *from, const char *to);
|
int text_copy(xmldb_handle h, const char *from, const char *to);
|
||||||
int text_lock(xmldb_handle h, const char *db, int pid);
|
int text_lock(xmldb_handle h, const char *db, int pid);
|
||||||
|
|
|
||||||
|
|
@ -743,7 +743,7 @@ WARN_LOGFILE =
|
||||||
# spaces.
|
# spaces.
|
||||||
# Note: If this tag is empty the current directory is searched.
|
# Note: If this tag is empty the current directory is searched.
|
||||||
|
|
||||||
INPUT = ../lib/src/ ../lib/clicon/ ../apps/cli/ ../apps/config/ ../apps/netconf ../apps/dbctrl ../datastore
|
INPUT = ../lib/src/ ../lib/clicon/ ../apps/cli/ ../apps/config/ ../apps/netconf ../apps/dbctrl ../datastore ../datastore/text
|
||||||
|
|
||||||
# This tag can be used to specify the character encoding of the source files
|
# This tag can be used to specify the character encoding of the source files
|
||||||
# that doxygen parses. Internally doxygen uses the UTF-8 encoding. Doxygen uses
|
# that doxygen parses. Internally doxygen uses the UTF-8 encoding. Doxygen uses
|
||||||
|
|
|
||||||
|
|
@ -743,7 +743,7 @@ WARN_LOGFILE =
|
||||||
# spaces.
|
# spaces.
|
||||||
# Note: If this tag is empty the current directory is searched.
|
# Note: If this tag is empty the current directory is searched.
|
||||||
|
|
||||||
INPUT = ../lib/src/ ../lib/clicon/ ../apps/cli/ ../apps/backend/ ../apps/restconf/ ../apps/netconf ../apps/dbctrl ../datastore
|
INPUT = ../lib/src/ ../lib/clicon/ ../apps/cli/ ../apps/backend/ ../apps/restconf/ ../apps/netconf ../apps/dbctrl ../datastore ../datastore/text
|
||||||
|
|
||||||
# This tag can be used to specify the character encoding of the source files
|
# This tag can be used to specify the character encoding of the source files
|
||||||
# that doxygen parses. Internally doxygen uses the UTF-8 encoding. Doxygen uses
|
# that doxygen parses. Internally doxygen uses the UTF-8 encoding. Doxygen uses
|
||||||
|
|
|
||||||
96
doc/FAQ.md
96
doc/FAQ.md
|
|
@ -1,4 +1,4 @@
|
||||||
# Clixon FAQ
|
i# Clixon FAQ
|
||||||
|
|
||||||
## What is Clixon?
|
## What is Clixon?
|
||||||
|
|
||||||
|
|
@ -24,7 +24,7 @@ Clixon is written in C. The plugins are written in C. The CLI
|
||||||
specification uses cligen (http://cligen.se)
|
specification uses cligen (http://cligen.se)
|
||||||
|
|
||||||
## How to best understand Clixon?
|
## How to best understand Clixon?
|
||||||
Run the ietf yang routing example, in the example directory.
|
Run the Clixon example, in the example directory.
|
||||||
|
|
||||||
## How do you build and install Clixon (and the example)?
|
## How do you build and install Clixon (and the example)?
|
||||||
Clixon:
|
Clixon:
|
||||||
|
|
@ -56,14 +56,14 @@ Build using 'make doc' and aim your browser at doc/html/index.html or
|
||||||
use the web resource: http://clicon.org/ref/index.html
|
use the web resource: http://clicon.org/ref/index.html
|
||||||
|
|
||||||
## How do you run the example?
|
## How do you run the example?
|
||||||
- Start a backend server: 'clixon_backend -Ff /usr/local/etc/routing.xml'
|
- Start a backend server: 'clixon_backend -Ff /usr/local/etc/example.xml'
|
||||||
- Start a cli session: clixon_cli -f /usr/local/etc/routing.xml
|
- Start a cli session: clixon_cli -f /usr/local/etc/example.xml
|
||||||
- Start a netconf session: clixon_netconf -f /usr/local/etc/routing.xml
|
- Start a netconf session: clixon_netconf -f /usr/local/etc/example.xml
|
||||||
|
|
||||||
## How is configuration data stored?
|
## How is configuration data stored?
|
||||||
Configuration data is stored in an XML datastore. The default is a
|
Configuration data is stored in an XML datastore. The default is a
|
||||||
text-based datastore. In the example the datastore are regular files found in
|
text-based datastore. In the example the datastore are regular files found in
|
||||||
/usr/local/var/routing/.
|
/usr/local/var/example/.
|
||||||
|
|
||||||
## What is validate and commit?
|
## What is validate and commit?
|
||||||
Clixon follows netconf in its validate and commit semantics.
|
Clixon follows netconf in its validate and commit semantics.
|
||||||
|
|
@ -79,15 +79,15 @@ is the core functionality of a clixon system.
|
||||||
|
|
||||||
Clixon options are stored in an XML configuration file. The default
|
Clixon options are stored in an XML configuration file. The default
|
||||||
configuration file is /usr/local/etc/clixon.xml. The example
|
configuration file is /usr/local/etc/clixon.xml. The example
|
||||||
configuration file is installed at /usr/local/etc/routing.xml. The
|
configuration file is installed at /usr/local/etc/example.xml. The
|
||||||
YANG specification for the configuration file is clixon-config.yang.
|
YANG specification for the configuration file is clixon-config.yang.
|
||||||
|
|
||||||
You can change where CLixon looks for the configuration FILE as follows:
|
You can change where CLixon looks for the configuration FILE as follows:
|
||||||
# Provide -f FILE option when starting a program (eg clixon_backend -f FILE)
|
- Provide -f FILE option when starting a program (eg clixon_backend -f FILE)
|
||||||
# Provide --with-configfile=FILE when configuring
|
- Provide --with-configfile=FILE when configuring
|
||||||
# Provide --with-sysconfig=<dir> when configuring, then FILE is <dir>/clixon.xml
|
- Provide --with-sysconfig=<dir> when configuring, then FILE is <dir>/clixon.xml
|
||||||
# Provide --sysconfig=<dir> when configuring then FILE is <dir>/etc/clixon.xml
|
- Provide --sysconfig=<dir> when configuring then FILE is <dir>/etc/clixon.xml
|
||||||
# FILE is /usr/local/etc/clixon.xml
|
- FILE is /usr/local/etc/clixon.xml
|
||||||
|
|
||||||
## Can I run Clixon as docker containers?
|
## Can I run Clixon as docker containers?
|
||||||
Yes, the example works as docker containers as well. backend and cli needs a
|
Yes, the example works as docker containers as well. backend and cli needs a
|
||||||
|
|
@ -109,12 +109,12 @@ You may also push the containers with 'make push' but you may then consider chan
|
||||||
|
|
||||||
As an alternative to cli configuration, you can use netconf. Easiest is to just pipe netconf commands to the clixon_netconf application.
|
As an alternative to cli configuration, you can use netconf. Easiest is to just pipe netconf commands to the clixon_netconf application.
|
||||||
Example:
|
Example:
|
||||||
echo "<rpc><get-config><source><candidate/></source><configuration/></get-config></rpc>]]>]]>" | clixon_netconf -f /usr/local/etc/routing.xml
|
echo "<rpc><get-config><source><candidate/></source><configuration/></get-config></rpc>]]>]]>" | clixon_netconf -f /usr/local/etc/example.xml
|
||||||
|
|
||||||
However, more useful is to run clixon_netconf as an SSH
|
However, more useful is to run clixon_netconf as an SSH
|
||||||
subsystem. Register the subsystem in /etc/sshd_config:
|
subsystem. Register the subsystem in /etc/sshd_config:
|
||||||
```
|
```
|
||||||
Subsystem netconf /usr/local/bin/clixon_netconf -f /usr/local/etc/routing.xml
|
Subsystem netconf /usr/local/bin/clixon_netconf -f /usr/local/etc/example.xml
|
||||||
```
|
```
|
||||||
and then invoke it from a client using
|
and then invoke it from a client using
|
||||||
```
|
```
|
||||||
|
|
@ -149,7 +149,7 @@ cli>
|
||||||
```
|
```
|
||||||
or via netconf:
|
or via netconf:
|
||||||
```
|
```
|
||||||
clixon_netconf -qf /usr/local/etc/routing.xml
|
clixon_netconf -qf /usr/local/etc/example.xml
|
||||||
<rpc><create-subscription><stream>ROUTING</stream></create-subscription></rpc>]]>]]>
|
<rpc><create-subscription><stream>ROUTING</stream></create-subscription></rpc>]]>]]>
|
||||||
<rpc-reply><ok/></rpc-reply>]]>]]>
|
<rpc-reply><ok/></rpc-reply>]]>]]>
|
||||||
<notification><event>Routing notification</event></notification>]]>]]>
|
<notification><event>Routing notification</event></notification>]]>]]>
|
||||||
|
|
@ -194,18 +194,39 @@ clixon_backend ... -c extra.xml
|
||||||
```
|
```
|
||||||
|
|
||||||
The second way is by programming the plugin_reset() in the backend
|
The second way is by programming the plugin_reset() in the backend
|
||||||
plugin. The example code contains an example on how to do this (see plugin_reset() in routing_backend.c).
|
plugin. The example code contains an example on how to do this (see plugin_reset() in example_backend.c).
|
||||||
|
|
||||||
## I want to program. How do I extend the example?
|
## I want to program. How do I extend the example?
|
||||||
- routing.xml - Change the configuration file
|
See [../apps/example]
|
||||||
|
- example.xml - Change the configuration file
|
||||||
- The yang specifications - This is the central part. It changes the XML, database and the config cli.
|
- The yang specifications - This is the central part. It changes the XML, database and the config cli.
|
||||||
- routing_cli.cli - Change the fixed part of the CLI commands
|
- example_cli.cli - Change the fixed part of the CLI commands
|
||||||
- routing_cli.c - Cli C-commands are placed here.
|
- example_cli.c - Cli C-commands are placed here.
|
||||||
- routing_backend.c - Commit and validate functions.
|
- example_backend.c - Commit and validate functions.
|
||||||
- routing_netconf.c - Modify semantics of netconf commands.
|
- example_netconf.c - Netconf plugin
|
||||||
|
- example_restconf.c - Add restconf authentication, etc.
|
||||||
|
|
||||||
|
## How is a plugin initiated?
|
||||||
|
Each plugin is initiated with an API struct followed by a plugin init function as follows:
|
||||||
|
```
|
||||||
|
static clixon_plugin_api api = {
|
||||||
|
"example", /* name */
|
||||||
|
clixon_plugin_init,
|
||||||
|
plugin_start,
|
||||||
|
... /* more functions here */
|
||||||
|
}
|
||||||
|
clixon_plugin_api *
|
||||||
|
clixon_plugin_init(clicon_handle h)
|
||||||
|
{
|
||||||
|
...
|
||||||
|
return &api; /* Return NULL on error */
|
||||||
|
}
|
||||||
|
```
|
||||||
|
For more info see [../example/README.md]
|
||||||
|
|
||||||
|
|
||||||
## How do I write a commit function?
|
## How do I write a commit function?
|
||||||
In the example, you write a commit function in routing_backend.c.
|
In the example, you write a commit function in example_backend.c.
|
||||||
Every time a commit is made, transaction_commit() is called in the
|
Every time a commit is made, transaction_commit() is called in the
|
||||||
backend. It has a 'transaction_data td' argument which is used to fetch
|
backend. It has a 'transaction_data td' argument which is used to fetch
|
||||||
information on added, deleted and changed entries. You access this
|
information on added, deleted and changed entries. You access this
|
||||||
|
|
@ -235,9 +256,9 @@ More are found in the doxygen reference.
|
||||||
|
|
||||||
## How do I write a CLI callback function?
|
## How do I write a CLI callback function?
|
||||||
|
|
||||||
1. You add an entry in routing_cli.cli
|
1. You add an entry in example_cli.cli
|
||||||
> example("This is a comment") <var:int32>("This is a variable"), mycallback("myarg");
|
> example("This is a comment") <var:int32>("This is a variable"), mycallback("myarg");
|
||||||
2. Then define a function in routing_cli.c
|
2. Then define a function in example_cli.c
|
||||||
> mycallback(clicon_handle h, cvec *cvv, cvec *arv)
|
> mycallback(clicon_handle h, cvec *cvv, cvec *arv)
|
||||||
where 'cvv' contains the value of the variable 'var' and 'argv' contains the string "myarg".
|
where 'cvv' contains the value of the variable 'var' and 'argv' contains the string "myarg".
|
||||||
|
|
||||||
|
|
@ -283,10 +304,10 @@ implement the RFC, you need to register an RPC callback in the backend plugin:
|
||||||
Example:
|
Example:
|
||||||
```
|
```
|
||||||
int
|
int
|
||||||
plugin_init(clicon_handle h)
|
clixon_plugin_init(clicon_handle h)
|
||||||
{
|
{
|
||||||
...
|
...
|
||||||
backend_rpc_cb_register(h, fib_route, NULL, "fib-route");
|
rpc_callback_register(h, fib_route, NULL, "fib-route");
|
||||||
...
|
...
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
|
@ -295,12 +316,31 @@ And then define the callback itself:
|
||||||
static int
|
static int
|
||||||
fib_route(clicon_handle h, /* Clicon handle */
|
fib_route(clicon_handle h, /* Clicon handle */
|
||||||
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
||||||
struct client_entry *ce, /* Client session */
|
|
||||||
cbuf *cbret, /* Reply eg <rpc-reply>... */
|
cbuf *cbret, /* Reply eg <rpc-reply>... */
|
||||||
void *arg) /* Argument given at register */
|
void *arg, /* Client session */
|
||||||
|
void *regarg) /* Argument given at register */
|
||||||
{
|
{
|
||||||
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
Here, the callback is over-simplified.
|
Here, the callback is over-simplified.
|
||||||
|
|
||||||
|
## How do I write an authentication callback?
|
||||||
|
|
||||||
|
A restconf call may need to be authenticated.
|
||||||
|
You can specify an authentication callback for restconf as follows:
|
||||||
|
```
|
||||||
|
int
|
||||||
|
plugin_credentials(clicon_handle h,
|
||||||
|
void *arg)
|
||||||
|
{
|
||||||
|
FCGX_Request *r = (FCGX_Request *)arg;
|
||||||
|
...
|
||||||
|
clicon_username_set(h, user);
|
||||||
|
```
|
||||||
|
|
||||||
|
To authenticate, the callback needs to return the value 1 and supply a username.
|
||||||
|
|
||||||
|
See [../apps/example/example_restconf.c] plugin_credentials() for
|
||||||
|
an example of HTTP basic auth.
|
||||||
|
|
|
||||||
|
|
@ -48,8 +48,8 @@ distclean: clean
|
||||||
rm -f Makefile *~ .depend clixonrc
|
rm -f Makefile *~ .depend clixonrc
|
||||||
|
|
||||||
install: clixonrc
|
install: clixonrc
|
||||||
install -m 755 -d $(DESTDIR)$(sysconfdir)
|
install -m 0755 -d $(DESTDIR)$(sysconfdir)
|
||||||
install -m 755 clixonrc $(DESTDIR)$(sysconfdir)
|
install -m 0644 clixonrc $(DESTDIR)$(sysconfdir)
|
||||||
|
|
||||||
install-include:
|
install-include:
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -38,27 +38,29 @@ bindir = @bindir@
|
||||||
includedir = @includedir@
|
includedir = @includedir@
|
||||||
datarootdir = @datarootdir@
|
datarootdir = @datarootdir@
|
||||||
|
|
||||||
APPNAME = routing
|
APPNAME = example
|
||||||
CC = @CC@
|
CC = @CC@
|
||||||
CFLAGS = @CFLAGS@ -rdynamic -fPIC
|
CFLAGS = @CFLAGS@ -rdynamic -fPIC
|
||||||
|
INSTALLFLAGS = @INSTALLFLAGS@
|
||||||
|
|
||||||
INCLUDES = -I$(includedir) @INCLUDES@
|
INCLUDES = -I$(includedir) @INCLUDES@
|
||||||
|
|
||||||
BE_PLUGIN = $(APPNAME)_backend.so
|
BE_PLUGIN = $(APPNAME)_backend.so
|
||||||
|
BE2_PLUGIN = $(APPNAME)_backend_nacm.so
|
||||||
CLI_PLUGIN = $(APPNAME)_cli.so
|
CLI_PLUGIN = $(APPNAME)_cli.so
|
||||||
NETCONF_PLUGIN = $(APPNAME)_netconf.so
|
NETCONF_PLUGIN = $(APPNAME)_netconf.so
|
||||||
|
RESTCONF_PLUGIN = $(APPNAME)_restconf.so
|
||||||
|
|
||||||
PLUGINS = $(BE_PLUGIN) $(CLI_PLUGIN) $(NETCONF_PLUGIN)
|
PLUGINS = $(BE_PLUGIN) $(BE2_PLUGIN) $(CLI_PLUGIN) $(NETCONF_PLUGIN) $(RESTCONF_PLUGIN)
|
||||||
|
|
||||||
all: $(PLUGINS)
|
all: $(PLUGINS)
|
||||||
|
|
||||||
# Note: clixon.mk has a rule for:
|
# Note: clixon.mk has rules for clixon_DBSPECDIR, clixon_SYSCONFDIR, etc used below
|
||||||
# $(APPNAME.conf)
|
|
||||||
-include $(DESTDIR)$(datarootdir)/clixon/clixon.mk
|
-include $(DESTDIR)$(datarootdir)/clixon/clixon.mk
|
||||||
|
|
||||||
CLISPECS = routing_cli.cli
|
CLISPECS = $(APPNAME)_cli.cli
|
||||||
|
|
||||||
#YANGSPECS = $(APPNAME).yang
|
YANGSPECS = $(APPNAME).yang
|
||||||
YANGSPECS += ietf-yang-types@2013-07-15.yang
|
YANGSPECS += ietf-yang-types@2013-07-15.yang
|
||||||
YANGSPECS += ietf-inet-types@2013-07-15.yang
|
YANGSPECS += ietf-inet-types@2013-07-15.yang
|
||||||
YANGSPECS += ietf-interfaces@2014-05-08.yang
|
YANGSPECS += ietf-interfaces@2014-05-08.yang
|
||||||
|
|
@ -67,28 +69,39 @@ YANGSPECS += ietf-routing@2014-10-26.yang
|
||||||
YANGSPECS += ietf-ipv4-unicast-routing@2014-10-26.yang
|
YANGSPECS += ietf-ipv4-unicast-routing@2014-10-26.yang
|
||||||
YANGSPECS += ietf-ipv6-unicast-routing@2014-10-26.yang
|
YANGSPECS += ietf-ipv6-unicast-routing@2014-10-26.yang
|
||||||
YANGSPECS += ietf-ipsec@2016-03-09.yang
|
YANGSPECS += ietf-ipsec@2016-03-09.yang
|
||||||
YANGSPECS += example.yang
|
|
||||||
|
|
||||||
# Backend plugin
|
# Backend plugin
|
||||||
BE_SRC = routing_backend.c
|
BE_SRC = $(APPNAME)_backend.c
|
||||||
BE_OBJ = $(BE_SRC:%.c=%.o)
|
BE_OBJ = $(BE_SRC:%.c=%.o)
|
||||||
$(BE_PLUGIN): $(BE_OBJ)
|
$(BE_PLUGIN): $(BE_OBJ)
|
||||||
$(CC) -shared -o $@ -lc $<
|
$(CC) -Wall -shared -o $@ -lc $<
|
||||||
|
|
||||||
|
# Secondary NACM backend plugin
|
||||||
|
BE2_SRC = $(APPNAME)_backend_nacm.c
|
||||||
|
BE2_OBJ = $(BE2_SRC:%.c=%.o)
|
||||||
|
$(BE2_PLUGIN): $(BE2_OBJ)
|
||||||
|
$(CC) -Wall -shared -o $@ -lc $<
|
||||||
|
|
||||||
# CLI frontend plugin
|
# CLI frontend plugin
|
||||||
CLI_SRC = routing_cli.c
|
CLI_SRC = $(APPNAME)_cli.c
|
||||||
CLI_OBJ = $(CLI_SRC:%.c=%.o)
|
CLI_OBJ = $(CLI_SRC:%.c=%.o)
|
||||||
$(CLI_PLUGIN): $(CLI_OBJ)
|
$(CLI_PLUGIN): $(CLI_OBJ)
|
||||||
$(CC) -shared -o $@ -lc $^
|
$(CC) -Wall -shared -o $@ -lc $^
|
||||||
|
|
||||||
# NETCONF frontend plugin
|
# NETCONF frontend plugin
|
||||||
NETCONF_SRC = routing_netconf.c
|
NETCONF_SRC = $(APPNAME)_netconf.c
|
||||||
NETCONF_OBJ = $(NETCONF_SRC:%.c=%.o)
|
NETCONF_OBJ = $(NETCONF_SRC:%.c=%.o)
|
||||||
$(NETCONF_PLUGIN): $(NETCONF_OBJ)
|
$(NETCONF_PLUGIN): $(NETCONF_OBJ)
|
||||||
$(CC) -shared -o $@ -lc $^
|
$(CC) -Wall -shared -o $@ -lc $^
|
||||||
|
|
||||||
SRC = $(BE_SRC) $(CLI_SRC) $(NETCONF_SRC)
|
# RESTCONF frontend plugin
|
||||||
OBJS = $(BE_OBJ) $(CLI_OBJ) $(NETCONF_OBJ)
|
RESTCONF_SRC = $(APPNAME)_restconf.c
|
||||||
|
RESTCONF_OBJ = $(RESTCONF_SRC:%.c=%.o)
|
||||||
|
$(RESTCONF_PLUGIN): $(RESTCONF_OBJ)
|
||||||
|
$(CC) -Wall -shared -o $@ -lc $^
|
||||||
|
|
||||||
|
SRC = $(BE_SRC) $(BE2_SRC) $(CLI_SRC) $(NETCONF_SRC) $(RESTCONF_SRC)
|
||||||
|
OBJS = $(BE_OBJ) $(BE2_OBJ) $(CLI_OBJ) $(NETCONF_OBJ) $(RESTCONF_OBJ)
|
||||||
|
|
||||||
clean:
|
clean:
|
||||||
rm -f $(PLUGINS) $(OBJS)
|
rm -f $(PLUGINS) $(OBJS)
|
||||||
|
|
@ -98,20 +111,22 @@ distclean: clean
|
||||||
rm -f Makefile *~ .depend
|
rm -f Makefile *~ .depend
|
||||||
(cd docker && $(MAKE) $(MFLAGS) $@)
|
(cd docker && $(MAKE) $(MFLAGS) $@)
|
||||||
|
|
||||||
install: $(YANGSPECS) $(CLISPECS) $(BE_PLUGIN) $(CLI_PLUGIN) $(NETCONF_PLUGIN) $(APPNAME).xml
|
install: $(YANGSPECS) $(CLISPECS) $(BE_PLUGIN) $(BE2_PLUGIN) $(CLI_PLUGIN) $(NETCONF_PLUGIN) $(RESTCONF_PLUGIN) $(APPNAME).xml
|
||||||
install -d $(DESTDIR)$(clixon_SYSCONFDIR)
|
install -d -m 0755 $(DESTDIR)$(clixon_SYSCONFDIR)
|
||||||
install $(APPNAME).xml $(DESTDIR)$(clixon_SYSCONFDIR)
|
install -m 0644 $(APPNAME).xml $(DESTDIR)$(clixon_SYSCONFDIR)
|
||||||
install -d $(DESTDIR)$(clixon_DBSPECDIR)/yang
|
install -d -m 0755 $(DESTDIR)$(clixon_DBSPECDIR)/yang
|
||||||
install $(YANGSPECS) $(DESTDIR)$(clixon_DBSPECDIR)/yang
|
install -m 0644 $(YANGSPECS) $(DESTDIR)$(clixon_DBSPECDIR)/yang
|
||||||
install -d $(DESTDIR)$(clixon_LIBDIR)/cli
|
install -d -m 0755 $(DESTDIR)$(clixon_LIBDIR)/cli
|
||||||
install $(CLI_PLUGIN) $(DESTDIR)$(clixon_LIBDIR)/cli;
|
install -m 0644 $(INSTALLFLAGS) $(CLI_PLUGIN) $(DESTDIR)$(clixon_LIBDIR)/cli
|
||||||
install -d $(DESTDIR)$(clixon_LIBDIR)/backend
|
install -d -m 0755 $(DESTDIR)$(clixon_LIBDIR)/backend
|
||||||
install $(BE_PLUGIN) $(DESTDIR)$(clixon_LIBDIR)/backend;
|
install -m 0644 $(INSTALLFLAGS) $(BE_PLUGIN) $(BE2_PLUGIN) $(DESTDIR)$(clixon_LIBDIR)/backend
|
||||||
install -d $(DESTDIR)$(clixon_LIBDIR)/netconf
|
install -d -m 0755 $(DESTDIR)$(clixon_LIBDIR)/netconf
|
||||||
install $(NETCONF_PLUGIN) $(DESTDIR)$(clixon_LIBDIR)/netconf;
|
install -m 0644 $(INSTALLFLAGS) $(NETCONF_PLUGIN) $(DESTDIR)$(clixon_LIBDIR)/netconf
|
||||||
install -d $(DESTDIR)$(clixon_LIBDIR)/clispec
|
install -d -m 0755 $(DESTDIR)$(clixon_LIBDIR)/restconf
|
||||||
install $(CLISPECS) $(DESTDIR)$(clixon_LIBDIR)/clispec;
|
install -m 0644 $(INSTALLFLAGS) $(RESTCONF_PLUGIN) $(DESTDIR)$(clixon_LIBDIR)/restconf
|
||||||
install -d $(DESTDIR)$(clixon_LOCALSTATEDIR)
|
install -d -m 0755 $(DESTDIR)$(clixon_LIBDIR)/clispec
|
||||||
|
install -m 0644 $(CLISPECS) $(DESTDIR)$(clixon_LIBDIR)/clispec
|
||||||
|
install -d -m 0755 $(DESTDIR)$(clixon_LOCALSTATEDIR)
|
||||||
(cd docker && $(MAKE) $(MFLAGS) $@)
|
(cd docker && $(MAKE) $(MFLAGS) $@)
|
||||||
|
|
||||||
uninstall:
|
uninstall:
|
||||||
|
|
|
||||||
|
|
@ -1,4 +1,20 @@
|
||||||
# Clixon yang routing example
|
# Clixon example
|
||||||
|
|
||||||
|
This directory contains a Clixon example which includes a simple
|
||||||
|
routing example. It contains the following files:
|
||||||
|
* example.xml The configuration file. See yang/clixon-config@<date>.yang for all available fields.
|
||||||
|
* example.yang The yang spec of the example. It mainly includes ietf routing and IP modules.
|
||||||
|
* example_cli.cli CLIgen specification.
|
||||||
|
* example_cli.c CLI callback plugin containing functions called in the cli file above: a generic callback (`mycallback`) and an RPC (`fib_route_rpc`).
|
||||||
|
* example_backend.c Backend callback plugin including example of:
|
||||||
|
* transaction callbacks (validate/commit),
|
||||||
|
* notification,
|
||||||
|
* rpc handler
|
||||||
|
* state-data handler, ie non-config data
|
||||||
|
* example_backend_nacm.c Secondary backend plugin. Plugins are loaded alphabetically.
|
||||||
|
* example_restconf.c Restconf callback plugin containing an HTTP basic authentication callback
|
||||||
|
* example_netconf.c Netconf callback plugin
|
||||||
|
* Makefile.in Example makefile where plugins are built and installed
|
||||||
|
|
||||||
## Compile and run
|
## Compile and run
|
||||||
```
|
```
|
||||||
|
|
@ -7,15 +23,23 @@
|
||||||
```
|
```
|
||||||
Start backend:
|
Start backend:
|
||||||
```
|
```
|
||||||
clixon_backend -f /usr/local/etc/routing.xml -I
|
clixon_backend -f /usr/local/etc/example.xml -I
|
||||||
```
|
```
|
||||||
Edit cli:
|
Edit cli:
|
||||||
```
|
```
|
||||||
clixon_cli -f /usr/local/etc/routing.xml
|
clixon_cli -f /usr/local/etc/example.xml
|
||||||
```
|
```
|
||||||
Send netconf command:
|
Send netconf command:
|
||||||
```
|
```
|
||||||
clixon_netconf -f /usr/local/etc/routing.xml
|
clixon_netconf -f /usr/local/etc/example.xml
|
||||||
|
```
|
||||||
|
Start clixon restconf daemon
|
||||||
|
```
|
||||||
|
> sudo su -c "/www-data/clixon_restconf -f /usr/local/etc/example.xml " -s /bin/sh www-data
|
||||||
|
```
|
||||||
|
Send restconf command
|
||||||
|
```
|
||||||
|
curl -G http://127.0.0.1/restconf/data
|
||||||
```
|
```
|
||||||
|
|
||||||
## Setting data example using netconf
|
## Setting data example using netconf
|
||||||
|
|
@ -65,6 +89,38 @@ Routing notification
|
||||||
...
|
...
|
||||||
```
|
```
|
||||||
|
|
||||||
|
## Initializing a plugin
|
||||||
|
|
||||||
|
The example includes a restonf, netconf, CLI and two backend plugins.
|
||||||
|
Each plugin is initiated with an API struct followed by a plugin init function.
|
||||||
|
The content of the API struct is different depending on what kind of plugin it is.
|
||||||
|
The plugin init function may also include registering RPC functions, see below is for a backend.
|
||||||
|
```
|
||||||
|
static clixon_plugin_api api = {
|
||||||
|
"example", /* name */
|
||||||
|
clixon_plugin_init,
|
||||||
|
plugin_start,
|
||||||
|
plugin_exit,
|
||||||
|
.ca_reset=plugin_reset,/* reset */
|
||||||
|
.ca_statedata=plugin_statedata, /* statedata */
|
||||||
|
.ca_trans_begin=NULL, /* trans begin */
|
||||||
|
.ca_trans_validate=transaction_validate,/* trans validate */
|
||||||
|
.ca_trans_complete=NULL, /* trans complete */
|
||||||
|
.ca_trans_commit=transaction_commit, /* trans commit */
|
||||||
|
.ca_trans_end=NULL, /* trans end */
|
||||||
|
.ca_trans_abort=NULL /* trans abort */
|
||||||
|
};
|
||||||
|
|
||||||
|
clixon_plugin_api *
|
||||||
|
clixon_plugin_init(clicon_handle h)
|
||||||
|
{
|
||||||
|
/* Optional callback registration for RPC calls */
|
||||||
|
rpc_callback_register(h, fib_route, NULL, "fib-route");
|
||||||
|
/* Return plugin API */
|
||||||
|
return &api; /* Return NULL on error */
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
## Operation data
|
## Operation data
|
||||||
|
|
||||||
Clixon implements Yang RPC operations by an extension mechanism. The
|
Clixon implements Yang RPC operations by an extension mechanism. The
|
||||||
|
|
@ -95,18 +151,18 @@ In the backend, a callback is registered (fib_route()) which handles the RPC.
|
||||||
static int
|
static int
|
||||||
fib_route(clicon_handle h,
|
fib_route(clicon_handle h,
|
||||||
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
||||||
struct client_entry *ce, /* Client session */
|
|
||||||
cbuf *cbret, /* Reply eg <rpc-reply>... */
|
cbuf *cbret, /* Reply eg <rpc-reply>... */
|
||||||
void *arg) /* Argument given at register */
|
void *arg, /* Client session */
|
||||||
|
void *regarg) /* Argument given at register */
|
||||||
{
|
{
|
||||||
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
int
|
int
|
||||||
plugin_init(clicon_handle h)
|
clixon_plugin_init(clicon_handle h)
|
||||||
{
|
{
|
||||||
...
|
...
|
||||||
backend_rpc_cb_register(h, fib_route, NULL, "fib-route");
|
rpc_callback_register(h, fib_route, NULL, "fib-route");
|
||||||
...
|
...
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
|
@ -114,7 +170,7 @@ plugin_init(clicon_handle h)
|
||||||
|
|
||||||
Netconf <get> and restconf GET also returns state data, in contrast to
|
Netconf <get> and restconf GET also returns state data, in contrast to
|
||||||
config data.
|
config data.
|
||||||
|
p
|
||||||
In YANG state data is specified with "config false;". In the example, interface-state is state data.
|
In YANG state data is specified with "config false;". In the example, interface-state is state data.
|
||||||
|
|
||||||
To return state data, you need to write a backend state data callback
|
To return state data, you need to write a backend state data callback
|
||||||
|
|
@ -126,8 +182,15 @@ a real example would poll or get the interface counters via a system
|
||||||
call, as well as use the "xpath" argument to identify the requested
|
call, as well as use the "xpath" argument to identify the requested
|
||||||
state data.
|
state data.
|
||||||
|
|
||||||
|
## Authentication and NACM
|
||||||
|
The example contains some stubs for authorization according to [RFC8341(NACM)](https://tools.ietf.org/html/rfc8341):
|
||||||
|
* A basic auth HTTP callback, see: example_restconf_credentials() containing three example users: adm1, wilma, and guest, according to the examples in Appendix A in the RFC.
|
||||||
|
* A NACM backend plugin reporting the mandatory NACM state variables.
|
||||||
|
|
||||||
|
|
||||||
## Run as docker container
|
## Run as docker container
|
||||||
|
|
||||||
|
(Note not updated)
|
||||||
```
|
```
|
||||||
cd docker
|
cd docker
|
||||||
# look in README
|
# look in README
|
||||||
|
|
|
||||||
20
example/example.xml
Normal file
20
example/example.xml
Normal file
|
|
@ -0,0 +1,20 @@
|
||||||
|
<config>
|
||||||
|
<CLICON_CONFIGFILE>/usr/local/etc/example.xml</CLICON_CONFIGFILE>
|
||||||
|
<CLICON_YANG_DIR>/usr/local/share/example/yang</CLICON_YANG_DIR>
|
||||||
|
<CLICON_YANG_MODULE_MAIN>example</CLICON_YANG_MODULE_MAIN>
|
||||||
|
<CLICON_CLI_MODE>example</CLICON_CLI_MODE>
|
||||||
|
<CLICON_BACKEND_DIR>/usr/local/lib/example/backend</CLICON_BACKEND_DIR>
|
||||||
|
<CLICON_NETCONF_DIR>/usr/local/lib/example/netconf</CLICON_NETCONF_DIR>
|
||||||
|
<CLICON_RESTCONF_DIR>/usr/local/lib/example/restconf</CLICON_RESTCONF_DIR>
|
||||||
|
<CLICON_CLI_DIR>/usr/local/lib/example/cli</CLICON_CLI_DIR>
|
||||||
|
<CLICON_CLISPEC_DIR>/usr/local/lib/example/clispec</CLICON_CLISPEC_DIR>
|
||||||
|
<CLICON_SOCK>/usr/local/var/example/example.sock</CLICON_SOCK>
|
||||||
|
<CLICON_BACKEND_PIDFILE>/usr/local/var/example/example.pidfile</CLICON_BACKEND_PIDFILE>
|
||||||
|
<CLICON_CLI_GENMODEL_COMPLETION>1</CLICON_CLI_GENMODEL_COMPLETION>
|
||||||
|
<CLICON_CLI_GENMODEL_TYPE>VARS</CLICON_CLI_GENMODEL_TYPE>
|
||||||
|
<CLICON_XMLDB_DIR>/usr/local/var/example</CLICON_XMLDB_DIR>
|
||||||
|
<CLICON_XMLDB_PLUGIN>/usr/local/lib/xmldb/text.so</CLICON_XMLDB_PLUGIN>
|
||||||
|
<CLICON_CLI_LINESCROLLING>0</CLICON_CLI_LINESCROLLING>
|
||||||
|
<CLICON_STARTUP_MODE>init</CLICON_STARTUP_MODE>
|
||||||
|
<CLICON_NACM_MODE>disabled</CLICON_NACM_MODE>
|
||||||
|
</config>
|
||||||
|
|
@ -1,10 +1,30 @@
|
||||||
module example {
|
module example {
|
||||||
|
prefix ex;
|
||||||
import ietf-ip {
|
import ietf-ip {
|
||||||
prefix ip;
|
prefix ip;
|
||||||
}
|
}
|
||||||
import ietf-routing {
|
import ietf-routing {
|
||||||
prefix rt;
|
prefix rt;
|
||||||
}
|
}
|
||||||
|
import ietf-netconf-acm {
|
||||||
|
prefix nacm;
|
||||||
|
}
|
||||||
description
|
description
|
||||||
"Example code that includes ietf-ip and ietf-routing";
|
"Example code that includes ietf-ip and ietf-routing";
|
||||||
|
rpc client-rpc {
|
||||||
|
description "Example local client-side RPC that is processed by the
|
||||||
|
the netconf/restconf and not sent to the backend.
|
||||||
|
This is a clixon implementation detail: some rpc:s
|
||||||
|
are better processed by the client for API or perf reasons";
|
||||||
|
input {
|
||||||
|
leaf request {
|
||||||
|
type string;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
output {
|
||||||
|
leaf result{
|
||||||
|
type string;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
|
||||||
|
|
@ -77,12 +77,14 @@ transaction_commit(clicon_handle h,
|
||||||
int i;
|
int i;
|
||||||
size_t len;
|
size_t len;
|
||||||
|
|
||||||
|
clicon_debug(1, "%s", __FUNCTION__);
|
||||||
/* Get all added i/fs */
|
/* Get all added i/fs */
|
||||||
if (xpath_vec_flag(target, "//interface", XML_FLAG_ADD, &vec, &len) < 0)
|
if (xpath_vec_flag(target, "//interface", XML_FLAG_ADD, &vec, &len) < 0)
|
||||||
return -1;
|
return -1;
|
||||||
if (debug)
|
if (debug)
|
||||||
for (i=0; i<len; i++) /* Loop over added i/fs */
|
for (i=0; i<len; i++) /* Loop over added i/fs */
|
||||||
xml_print(stdout, vec[i]); /* Print the added interface */
|
xml_print(stdout, vec[i]); /* Print the added interface */
|
||||||
|
// done:
|
||||||
if (vec)
|
if (vec)
|
||||||
free(vec);
|
free(vec);
|
||||||
return 0;
|
return 0;
|
||||||
|
|
@ -119,13 +121,15 @@ notification_timer_setup(clicon_handle h)
|
||||||
return event_reg_timeout(t, notification_timer, h, "notification timer");
|
return event_reg_timeout(t, notification_timer, h, "notification timer");
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! IETF Routing fib-route rpc */
|
/*! IETF Routing fib-route rpc
|
||||||
|
* @see ietf-routing@2014-10-26.yang (fib-route)
|
||||||
|
*/
|
||||||
static int
|
static int
|
||||||
fib_route(clicon_handle h, /* Clicon handle */
|
fib_route(clicon_handle h, /* Clicon handle */
|
||||||
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
||||||
struct client_entry *ce, /* Client session */
|
|
||||||
cbuf *cbret, /* Reply eg <rpc-reply>... */
|
cbuf *cbret, /* Reply eg <rpc-reply>... */
|
||||||
void *arg) /* Argument given at register */
|
void *arg, /* Client session */
|
||||||
|
void *regarg) /* Argument given at register */
|
||||||
{
|
{
|
||||||
cprintf(cbret, "<rpc-reply><route>"
|
cprintf(cbret, "<rpc-reply><route>"
|
||||||
"<address-family>ipv4</address-family>"
|
"<address-family>ipv4</address-family>"
|
||||||
|
|
@ -134,25 +138,32 @@ fib_route(clicon_handle h, /* Clicon handle */
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Smallest possible RPC declaration for test */
|
/*! IETF Routing route-count rpc
|
||||||
static int
|
* @see ietf-routing@2014-10-26.yang (route-count)
|
||||||
empty(clicon_handle h, /* Clicon handle */
|
*/
|
||||||
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
|
||||||
struct client_entry *ce, /* Client session */
|
|
||||||
cbuf *cbret, /* Reply eg <rpc-reply>... */
|
|
||||||
void *arg) /* Argument given at register */
|
|
||||||
{
|
|
||||||
cprintf(cbret, "<rpc-reply/>");
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! IETF Routing route-count rpc */
|
|
||||||
static int
|
static int
|
||||||
route_count(clicon_handle h,
|
route_count(clicon_handle h,
|
||||||
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
||||||
struct client_entry *ce, /* Client session */
|
|
||||||
cbuf *cbret, /* Reply eg <rpc-reply>... */
|
cbuf *cbret, /* Reply eg <rpc-reply>... */
|
||||||
void *arg) /* Argument given at register */
|
void *arg,
|
||||||
|
void *regarg) /* Argument given at register */
|
||||||
|
{
|
||||||
|
cprintf(cbret, "<rpc-reply><number-of-routes>42</number-of-routes></rpc-reply>");
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Smallest possible RPC declaration for test
|
||||||
|
* Yang/XML:
|
||||||
|
* If the RPC operation invocation succeeded and no output parameters
|
||||||
|
* are returned, the <rpc-reply> contains a single <ok/> element defined
|
||||||
|
* in [RFC6241].
|
||||||
|
*/
|
||||||
|
static int
|
||||||
|
empty(clicon_handle h, /* Clicon handle */
|
||||||
|
cxobj *xe, /* Request: <rpc><xn></rpc> */
|
||||||
|
cbuf *cbret, /* Reply eg <rpc-reply>... */
|
||||||
|
void *arg, /* client_entry */
|
||||||
|
void *regarg) /* Argument given at register */
|
||||||
{
|
{
|
||||||
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
cprintf(cbret, "<rpc-reply><ok/></rpc-reply>");
|
||||||
return 0;
|
return 0;
|
||||||
|
|
@ -190,39 +201,6 @@ plugin_statedata(clicon_handle h,
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Plugin initialization. Create rpc callbacks
|
|
||||||
* plugin_init is called as soon as the plugin has been loaded and is
|
|
||||||
* assumed initialize the plugin's internal state if any as well as register
|
|
||||||
* any callbacks, configuration dependencies.
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
plugin_init(clicon_handle h)
|
|
||||||
{
|
|
||||||
int retval = -1;
|
|
||||||
|
|
||||||
if (notification_timer_setup(h) < 0)
|
|
||||||
goto done;
|
|
||||||
/* Register callback for routing rpc calls */
|
|
||||||
if (backend_rpc_cb_register(h, fib_route,
|
|
||||||
NULL,
|
|
||||||
"fib-route"/* Xml tag when callback is made */
|
|
||||||
) < 0)
|
|
||||||
goto done;
|
|
||||||
if (backend_rpc_cb_register(h, route_count,
|
|
||||||
NULL,
|
|
||||||
"route-count"/* Xml tag when callback is made */
|
|
||||||
) < 0)
|
|
||||||
goto done;
|
|
||||||
if (backend_rpc_cb_register(h, empty,
|
|
||||||
NULL,
|
|
||||||
"empty"/* Xml tag when callback is made */
|
|
||||||
) < 0)
|
|
||||||
goto done;
|
|
||||||
retval = 0;
|
|
||||||
done:
|
|
||||||
return retval;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Plugin state reset. Add xml or set state in backend machine.
|
/*! Plugin state reset. Add xml or set state in backend machine.
|
||||||
* Called in each backend plugin. plugin_reset is called after all plugins
|
* Called in each backend plugin. plugin_reset is called after all plugins
|
||||||
* have been initialized. This give the application a chance to reset
|
* have been initialized. This give the application a chance to reset
|
||||||
|
|
@ -250,7 +228,7 @@ plugin_reset(clicon_handle h,
|
||||||
if (xml_rootchild(xt, 0, &xt) < 0)
|
if (xml_rootchild(xt, 0, &xt) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Merge user reset state */
|
/* Merge user reset state */
|
||||||
if (xmldb_put(h, (char*)db, OP_MERGE, xt) < 0)
|
if (xmldb_put(h, (char*)db, OP_MERGE, xt, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
|
@ -278,3 +256,54 @@ plugin_start(clicon_handle h,
|
||||||
{
|
{
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
clixon_plugin_api *clixon_plugin_init(clicon_handle h);
|
||||||
|
|
||||||
|
static clixon_plugin_api api = {
|
||||||
|
"example", /* name */
|
||||||
|
clixon_plugin_init, /* init */
|
||||||
|
plugin_start, /* start */
|
||||||
|
NULL, /* exit */
|
||||||
|
.ca_reset=plugin_reset, /* reset */
|
||||||
|
.ca_statedata=plugin_statedata, /* statedata */
|
||||||
|
.ca_trans_begin=NULL, /* trans begin */
|
||||||
|
.ca_trans_validate=transaction_validate,/* trans validate */
|
||||||
|
.ca_trans_complete=NULL, /* trans complete */
|
||||||
|
.ca_trans_commit=transaction_commit, /* trans commit */
|
||||||
|
.ca_trans_end=NULL, /* trans end */
|
||||||
|
.ca_trans_abort=NULL /* trans abort */
|
||||||
|
};
|
||||||
|
|
||||||
|
/*! Backend plugin initialization
|
||||||
|
* @param[in] h Clixon handle
|
||||||
|
* @retval NULL Error with clicon_err set
|
||||||
|
* @retval api Pointer to API struct
|
||||||
|
*/
|
||||||
|
clixon_plugin_api *
|
||||||
|
clixon_plugin_init(clicon_handle h)
|
||||||
|
{
|
||||||
|
clicon_debug(1, "%s backend", __FUNCTION__);
|
||||||
|
if (notification_timer_setup(h) < 0)
|
||||||
|
goto done;
|
||||||
|
/* Register callback for routing rpc calls */
|
||||||
|
if (rpc_callback_register(h, fib_route,
|
||||||
|
NULL,
|
||||||
|
"fib-route"/* Xml tag when callback is made */
|
||||||
|
) < 0)
|
||||||
|
goto done;
|
||||||
|
if (rpc_callback_register(h, route_count,
|
||||||
|
NULL,
|
||||||
|
"route-count"/* Xml tag when callback is made */
|
||||||
|
) < 0)
|
||||||
|
goto done;
|
||||||
|
if (rpc_callback_register(h, empty,
|
||||||
|
NULL,
|
||||||
|
"empty"/* Xml tag when callback is made */
|
||||||
|
) < 0)
|
||||||
|
goto done;
|
||||||
|
/* Return plugin API */
|
||||||
|
return &api;
|
||||||
|
done:
|
||||||
|
return NULL;
|
||||||
|
}
|
||||||
|
|
||||||
119
example/example_backend_nacm.c
Normal file
119
example/example_backend_nacm.c
Normal file
|
|
@ -0,0 +1,119 @@
|
||||||
|
/*
|
||||||
|
*
|
||||||
|
***** BEGIN LICENSE BLOCK *****
|
||||||
|
|
||||||
|
Copyright (C) 2009-2018 Olof Hagsand and Benny Holmgren
|
||||||
|
|
||||||
|
This file is part of CLIXON.
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
|
||||||
|
Alternatively, the contents of this file may be used under the terms of
|
||||||
|
the GNU General Public License Version 3 or later (the "GPL"),
|
||||||
|
in which case the provisions of the GPL are applicable instead
|
||||||
|
of those above. If you wish to allow use of your version of this file only
|
||||||
|
under the terms of the GPL, and not to allow others to
|
||||||
|
use your version of this file under the terms of Apache License version 2, indicate
|
||||||
|
your decision by deleting the provisions above and replace them with the
|
||||||
|
notice and other provisions required by the GPL. If you do not delete
|
||||||
|
the provisions above, a recipient may use your version of this file under
|
||||||
|
the terms of any one of the Apache License version 2 or the GPL.
|
||||||
|
|
||||||
|
***** END LICENSE BLOCK *****
|
||||||
|
|
||||||
|
*
|
||||||
|
* IETF yang routing example
|
||||||
|
* Secondary backend for testing more than one backend plugin
|
||||||
|
*/
|
||||||
|
|
||||||
|
|
||||||
|
#include <stdio.h>
|
||||||
|
#include <stdlib.h>
|
||||||
|
#include <string.h>
|
||||||
|
#include <errno.h>
|
||||||
|
#include <signal.h>
|
||||||
|
#include <unistd.h>
|
||||||
|
#include <sys/time.h>
|
||||||
|
|
||||||
|
/* clicon */
|
||||||
|
#include <cligen/cligen.h>
|
||||||
|
|
||||||
|
/* Clicon library functions. */
|
||||||
|
#include <clixon/clixon.h>
|
||||||
|
|
||||||
|
/* These include signatures for plugin and transaction callbacks. */
|
||||||
|
#include <clixon/clixon_backend.h>
|
||||||
|
|
||||||
|
|
||||||
|
/*! Called to get NACM state data
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] xpath String with XPATH syntax. or NULL for all
|
||||||
|
* @param[in] xtop XML tree, <config/> on entry.
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error
|
||||||
|
* @see xmldb_get
|
||||||
|
* @note this example code returns a static statedata used in testing.
|
||||||
|
* Real code would poll state
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
nacm_statedata(clicon_handle h,
|
||||||
|
char *xpath,
|
||||||
|
cxobj *xstate)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
cxobj **xvec = NULL;
|
||||||
|
|
||||||
|
/* Example of (static) statedata, real code would poll state */
|
||||||
|
if (xml_parse_string("<nacm>"
|
||||||
|
"<denied-data-writes>0</denied-data-writes>"
|
||||||
|
"<denied-operations>0</denied-operations>"
|
||||||
|
"<denied-notifications>0</denied-notifications>"
|
||||||
|
"</nacm>", NULL, &xstate) < 0)
|
||||||
|
goto done;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (xvec)
|
||||||
|
free(xvec);
|
||||||
|
return retval;
|
||||||
|
}
|
||||||
|
|
||||||
|
int
|
||||||
|
plugin_start(clicon_handle h,
|
||||||
|
int argc,
|
||||||
|
char **argv)
|
||||||
|
{
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
clixon_plugin_api *clixon_plugin_init(clicon_handle h);
|
||||||
|
|
||||||
|
static clixon_plugin_api api = {
|
||||||
|
"nacm", /* name */ /*--- Common fields. ---*/
|
||||||
|
clixon_plugin_init, /* init */
|
||||||
|
plugin_start, /* start */
|
||||||
|
NULL, /* exit */
|
||||||
|
.ca_reset=NULL, /* reset */
|
||||||
|
.ca_statedata=nacm_statedata, /* statedata */
|
||||||
|
};
|
||||||
|
|
||||||
|
/*! Backend plugin initialization
|
||||||
|
* @param[in] h Clixon handle
|
||||||
|
* @retval NULL Error with clicon_err set
|
||||||
|
* @retval api Pointer to API struct
|
||||||
|
*/
|
||||||
|
clixon_plugin_api *
|
||||||
|
clixon_plugin_init(clicon_handle h)
|
||||||
|
{
|
||||||
|
clicon_debug(1, "%s backend nacm", __FUNCTION__);
|
||||||
|
return &api;
|
||||||
|
}
|
||||||
|
|
@ -52,19 +52,6 @@
|
||||||
#include <clixon/clixon.h>
|
#include <clixon/clixon.h>
|
||||||
#include <clixon/clixon_cli.h>
|
#include <clixon/clixon_cli.h>
|
||||||
|
|
||||||
/*
|
|
||||||
* Plugin initialization
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
plugin_init(clicon_handle h)
|
|
||||||
{
|
|
||||||
struct timeval tv;
|
|
||||||
|
|
||||||
gettimeofday(&tv, NULL);
|
|
||||||
srandom(tv.tv_usec);
|
|
||||||
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Example cli function */
|
/*! Example cli function */
|
||||||
int
|
int
|
||||||
|
|
@ -107,7 +94,7 @@ fib_route_rpc(clicon_handle h,
|
||||||
/* User supplied variable in CLI command */
|
/* User supplied variable in CLI command */
|
||||||
instance = cvec_find(cvv, "instance"); /* get a cligen variable from vector */
|
instance = cvec_find(cvv, "instance"); /* get a cligen variable from vector */
|
||||||
/* Create XML for fib-route netconf RPC */
|
/* Create XML for fib-route netconf RPC */
|
||||||
if (xml_parse_va(&xtop, NULL, "<rpc><fib-route><routing-instance-name>%s</routing-instance-name></fib-route></rpc>", instance) < 0)
|
if (xml_parse_va(&xtop, NULL, "<rpc><fib-route><routing-instance-name>%s</routing-instance-name></fib-route></rpc>", cv_string_get(instance)) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
/* Skip top-level */
|
/* Skip top-level */
|
||||||
xrpc = xml_child_i(xtop, 0);
|
xrpc = xml_child_i(xtop, 0);
|
||||||
|
|
@ -125,3 +112,28 @@ fib_route_rpc(clicon_handle h,
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
static clixon_plugin_api api = {
|
||||||
|
"example", /* name */
|
||||||
|
clixon_plugin_init, /* init */
|
||||||
|
NULL, /* start */
|
||||||
|
NULL, /* exit */
|
||||||
|
.ca_prompt=NULL, /* cli_prompthook_t */
|
||||||
|
.ca_suspend=NULL, /* cligen_susp_cb_t */
|
||||||
|
.ca_interrupt=NULL, /* cligen_interrupt_cb_t */
|
||||||
|
};
|
||||||
|
|
||||||
|
/*! CLI plugin initialization
|
||||||
|
* @param[in] h Clixon handle
|
||||||
|
* @retval NULL Error with clicon_err set
|
||||||
|
* @retval api Pointer to API struct
|
||||||
|
*/
|
||||||
|
clixon_plugin_api *
|
||||||
|
clixon_plugin_init(clicon_handle h)
|
||||||
|
{
|
||||||
|
struct timeval tv;
|
||||||
|
|
||||||
|
gettimeofday(&tv, NULL);
|
||||||
|
srandom(tv.tv_usec);
|
||||||
|
|
||||||
|
return &api;
|
||||||
|
}
|
||||||
|
|
@ -1,7 +1,7 @@
|
||||||
# Common CLI syntax for both server and PMNode operatio mode
|
# Common CLI syntax for both server and PMNode operatio mode
|
||||||
CLICON_MODE="routing";
|
CLICON_MODE="example";
|
||||||
CLICON_PROMPT="%U@%H> ";
|
CLICON_PROMPT="%U@%H> ";
|
||||||
CLICON_PLUGIN="routing_cli";
|
CLICON_PLUGIN="example_cli";
|
||||||
|
|
||||||
# Note, when switching to PT, change datamodel to only @datamodel
|
# Note, when switching to PT, change datamodel to only @datamodel
|
||||||
set @datamodel:example, cli_set();
|
set @datamodel:example, cli_set();
|
||||||
|
|
@ -30,6 +30,7 @@ compare("Compare running and candidate"), compare_dbs((int32)1);
|
||||||
|
|
||||||
show("Show a particular state of the system"){
|
show("Show a particular state of the system"){
|
||||||
xpath("Show configuration") <xpath:string>("XPATH expression"), show_conf_xpath("candidate");
|
xpath("Show configuration") <xpath:string>("XPATH expression"), show_conf_xpath("candidate");
|
||||||
|
version("Show version"), cli_show_version("candidate", "text", "/");
|
||||||
compare("Compare candidate and running databases"), compare_dbs((int32)0);{
|
compare("Compare candidate and running databases"), compare_dbs((int32)0);{
|
||||||
xml("Show comparison in xml"), compare_dbs((int32)0);
|
xml("Show comparison in xml"), compare_dbs((int32)0);
|
||||||
text("Show comparison in text"), compare_dbs((int32)1);
|
text("Show comparison in text"), compare_dbs((int32)1);
|
||||||
|
|
@ -46,18 +46,7 @@
|
||||||
#include <clixon/clixon.h>
|
#include <clixon/clixon.h>
|
||||||
#include <clixon/clixon_netconf.h>
|
#include <clixon/clixon_netconf.h>
|
||||||
|
|
||||||
|
/*! Plugin start
|
||||||
/*
|
|
||||||
* Plugin initialization
|
|
||||||
*/
|
|
||||||
int
|
|
||||||
plugin_init(clicon_handle h)
|
|
||||||
{
|
|
||||||
return 0;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*
|
|
||||||
* Plugin start
|
|
||||||
* Called once everything has been initialized, right before
|
* Called once everything has been initialized, right before
|
||||||
* the main event loop is entered.
|
* the main event loop is entered.
|
||||||
*/
|
*/
|
||||||
|
|
@ -73,3 +62,40 @@ plugin_exit(clicon_handle h)
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*! Local example netconf rpc callback
|
||||||
|
*/
|
||||||
|
int netconf_client_rpc(clicon_handle h,
|
||||||
|
cxobj *xn,
|
||||||
|
cbuf *cbret,
|
||||||
|
void *arg,
|
||||||
|
void *regarg)
|
||||||
|
{
|
||||||
|
clicon_debug(1, "%s restconf", __FUNCTION__);
|
||||||
|
cprintf(cbret, "<rpc-reply><result>ok</result></rpc-reply>");
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
clixon_plugin_api * clixon_plugin_init(clicon_handle h);
|
||||||
|
|
||||||
|
static struct clixon_plugin_api api = {
|
||||||
|
"example", /* name */
|
||||||
|
clixon_plugin_init, /* init */
|
||||||
|
plugin_start, /* start */
|
||||||
|
plugin_exit /* exit */
|
||||||
|
};
|
||||||
|
|
||||||
|
/*! Netconf plugin initialization
|
||||||
|
* @param[in] h Clixon handle
|
||||||
|
* @retval NULL Error with clicon_err set
|
||||||
|
* @retval api Pointer to API struct
|
||||||
|
*/
|
||||||
|
clixon_plugin_api *
|
||||||
|
clixon_plugin_init(clicon_handle h)
|
||||||
|
{
|
||||||
|
clicon_debug(1, "%s restconf", __FUNCTION__);
|
||||||
|
/* Register local netconf rpc client (note not backend rpc client) */
|
||||||
|
if (rpc_callback_register(h, netconf_client_rpc, NULL, "client-rpc") < 0)
|
||||||
|
return NULL;
|
||||||
|
return &api;
|
||||||
|
}
|
||||||
|
|
||||||
332
example/example_restconf.c
Normal file
332
example/example_restconf.c
Normal file
|
|
@ -0,0 +1,332 @@
|
||||||
|
/*
|
||||||
|
*
|
||||||
|
***** BEGIN LICENSE BLOCK *****
|
||||||
|
|
||||||
|
Copyright (C) 2009-2018 Olof Hagsand and Benny Holmgren
|
||||||
|
|
||||||
|
This file is part of CLIXON.
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
|
||||||
|
Alternatively, the contents of this file may be used under the terms of
|
||||||
|
the GNU General Public License Version 3 or later (the "GPL"),
|
||||||
|
in which case the provisions of the GPL are applicable instead
|
||||||
|
of those above. If you wish to allow use of your version of this file only
|
||||||
|
under the terms of the GPL, and not to allow others to
|
||||||
|
use your version of this file under the terms of Apache License version 2,
|
||||||
|
indicate your decision by deleting the provisions above and replace them with
|
||||||
|
the notice and other provisions required by the GPL. If you do not delete
|
||||||
|
the provisions above, a recipient may use your version of this file under
|
||||||
|
the terms of any one of the Apache License version 2 or the GPL.
|
||||||
|
|
||||||
|
***** END LICENSE BLOCK *****
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
|
||||||
|
#include <stdlib.h>
|
||||||
|
#include <string.h>
|
||||||
|
#include <unistd.h>
|
||||||
|
#include <errno.h>
|
||||||
|
#include <ctype.h>
|
||||||
|
#include <signal.h>
|
||||||
|
#include <fcgi_stdio.h>
|
||||||
|
#include <curl/curl.h>
|
||||||
|
|
||||||
|
/* cligen */
|
||||||
|
#include <cligen/cligen.h>
|
||||||
|
|
||||||
|
/* clicon */
|
||||||
|
#include <clixon/clixon.h>
|
||||||
|
#include <clixon/clixon_restconf.h>
|
||||||
|
|
||||||
|
static const char Base64[] =
|
||||||
|
"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
|
||||||
|
static const char Pad64 = '=';
|
||||||
|
|
||||||
|
/* Use http basic auth. Set by starting restonf with:
|
||||||
|
clixon_restconf ... -- -a
|
||||||
|
*/
|
||||||
|
static int basic_auth = 0;
|
||||||
|
|
||||||
|
/* skips all whitespace anywhere.
|
||||||
|
converts characters, four at a time, starting at (or after)
|
||||||
|
src from base - 64 numbers into three 8 bit bytes in the target area.
|
||||||
|
it returns the number of data bytes stored at the target, or -1 on error.
|
||||||
|
@note what is copyright of this?
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
b64_decode(const char *src,
|
||||||
|
char *target,
|
||||||
|
size_t targsize)
|
||||||
|
{
|
||||||
|
int tarindex, state, ch;
|
||||||
|
char *pos;
|
||||||
|
|
||||||
|
state = 0;
|
||||||
|
tarindex = 0;
|
||||||
|
|
||||||
|
while ((ch = *src++) != '\0') {
|
||||||
|
if (isspace(ch)) /* Skip whitespace anywhere. */
|
||||||
|
continue;
|
||||||
|
|
||||||
|
if (ch == Pad64)
|
||||||
|
break;
|
||||||
|
|
||||||
|
pos = strchr(Base64, ch);
|
||||||
|
if (pos == 0) /* A non-base64 character. */
|
||||||
|
return (-1);
|
||||||
|
|
||||||
|
switch (state) {
|
||||||
|
case 0:
|
||||||
|
if (target) {
|
||||||
|
if ((size_t)tarindex >= targsize)
|
||||||
|
return (-1);
|
||||||
|
target[tarindex] = (pos - Base64) << 2;
|
||||||
|
}
|
||||||
|
state = 1;
|
||||||
|
break;
|
||||||
|
case 1:
|
||||||
|
if (target) {
|
||||||
|
if ((size_t)tarindex + 1 >= targsize)
|
||||||
|
return (-1);
|
||||||
|
target[tarindex] |= (pos - Base64) >> 4;
|
||||||
|
target[tarindex+1] = ((pos - Base64) & 0x0f)
|
||||||
|
<< 4 ;
|
||||||
|
}
|
||||||
|
tarindex++;
|
||||||
|
state = 2;
|
||||||
|
break;
|
||||||
|
case 2:
|
||||||
|
if (target) {
|
||||||
|
if ((size_t)tarindex + 1 >= targsize)
|
||||||
|
return (-1);
|
||||||
|
target[tarindex] |= (pos - Base64) >> 2;
|
||||||
|
target[tarindex+1] = ((pos - Base64) & 0x03)
|
||||||
|
<< 6;
|
||||||
|
}
|
||||||
|
tarindex++;
|
||||||
|
state = 3;
|
||||||
|
break;
|
||||||
|
case 3:
|
||||||
|
if (target) {
|
||||||
|
if ((size_t)tarindex >= targsize)
|
||||||
|
return (-1);
|
||||||
|
target[tarindex] |= (pos - Base64);
|
||||||
|
}
|
||||||
|
tarindex++;
|
||||||
|
state = 0;
|
||||||
|
break;
|
||||||
|
default:
|
||||||
|
return -1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/*
|
||||||
|
* We are done decoding Base-64 chars. Let's see if we ended
|
||||||
|
* on a byte boundary, and/or with erroneous trailing characters.
|
||||||
|
*/
|
||||||
|
|
||||||
|
if (ch == Pad64) { /* We got a pad char. */
|
||||||
|
ch = *src++; /* Skip it, get next. */
|
||||||
|
switch (state) {
|
||||||
|
case 0: /* Invalid = in first position */
|
||||||
|
case 1: /* Invalid = in second position */
|
||||||
|
return (-1);
|
||||||
|
|
||||||
|
case 2: /* Valid, means one byte of info */
|
||||||
|
/* Skip any number of spaces. */
|
||||||
|
for ((void)NULL; ch != '\0'; ch = *src++)
|
||||||
|
if (!isspace(ch))
|
||||||
|
break;
|
||||||
|
/* Make sure there is another trailing = sign. */
|
||||||
|
if (ch != Pad64)
|
||||||
|
return (-1);
|
||||||
|
ch = *src++; /* Skip the = */
|
||||||
|
/* Fall through to "single trailing =" case. */
|
||||||
|
/* FALLTHROUGH */
|
||||||
|
|
||||||
|
case 3: /* Valid, means two bytes of info */
|
||||||
|
/*
|
||||||
|
* We know this char is an =. Is there anything but
|
||||||
|
* whitespace after it?
|
||||||
|
*/
|
||||||
|
for ((void)NULL; ch != '\0'; ch = *src++)
|
||||||
|
if (!isspace(ch))
|
||||||
|
return (-1);
|
||||||
|
|
||||||
|
/*
|
||||||
|
* Now make sure for cases 2 and 3 that the "extra"
|
||||||
|
* bits that slopped past the last full byte were
|
||||||
|
* zeros. If we don't check them, they become a
|
||||||
|
* subliminal channel.
|
||||||
|
*/
|
||||||
|
if (target && target[tarindex] != 0)
|
||||||
|
return (-1);
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
/*
|
||||||
|
* We ended by seeing the end of the string. Make sure we
|
||||||
|
* have no partial bytes lying around.
|
||||||
|
*/
|
||||||
|
if (state != 0)
|
||||||
|
return (-1);
|
||||||
|
}
|
||||||
|
|
||||||
|
return (tarindex);
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Process a rest request that requires (cookie) "authentication"
|
||||||
|
* @param[in] h Clixon handle
|
||||||
|
* @param[in] arg Argument. Here: Fastcgi request handle
|
||||||
|
* @retval -1 Fatal error
|
||||||
|
* @retval 0 Unauth
|
||||||
|
* @retval 1 Auth
|
||||||
|
* @note: Three hardwired users: adm1, wilma, guest w password "bar".
|
||||||
|
* Enabled by passing -- -a to the main function
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
example_restconf_credentials(clicon_handle h,
|
||||||
|
void *arg)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
FCGX_Request *r = (FCGX_Request *)arg;
|
||||||
|
cxobj *xt = NULL;
|
||||||
|
char *auth;
|
||||||
|
char *user = NULL;
|
||||||
|
char *passwd;
|
||||||
|
char *passwd2 = "";
|
||||||
|
size_t authlen;
|
||||||
|
cbuf *cb = NULL;
|
||||||
|
int ret;
|
||||||
|
|
||||||
|
/* HTTP basic authentication not enabled, pass with user "none" */
|
||||||
|
if (basic_auth==0)
|
||||||
|
goto ok;
|
||||||
|
/* At this point in the code we must use HTTP basic authentication */
|
||||||
|
if ((auth = FCGX_GetParam("HTTP_AUTHORIZATION", r->envp)) == NULL)
|
||||||
|
goto fail;
|
||||||
|
if (strlen(auth) < strlen("Basic "))
|
||||||
|
goto fail;
|
||||||
|
if (strncmp("Basic ", auth, strlen("Basic ")))
|
||||||
|
goto fail;
|
||||||
|
auth += strlen("Basic ");
|
||||||
|
authlen = strlen(auth)*2;
|
||||||
|
if ((user = malloc(authlen)) == NULL){
|
||||||
|
clicon_err(OE_UNIX, errno, "malloc");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
memset(user, 0, authlen);
|
||||||
|
if ((ret = b64_decode(auth, user, authlen)) < 0)
|
||||||
|
goto done;
|
||||||
|
/* auth string is on the format user:passwd */
|
||||||
|
if ((passwd = index(user,':')) == NULL)
|
||||||
|
goto fail;
|
||||||
|
*passwd = '\0';
|
||||||
|
passwd++;
|
||||||
|
clicon_debug(1, "%s http user:%s passwd:%s", __FUNCTION__, user, passwd);
|
||||||
|
/* Here get auth sub-tree whjere all the users are */
|
||||||
|
if ((cb = cbuf_new()) == NULL)
|
||||||
|
goto done;
|
||||||
|
/* Hardcoded user/passwd */
|
||||||
|
if (strcmp(user, "wilma")==0 || strcmp(user, "adm1")==0 ||
|
||||||
|
strcmp(user, "quest")==0){
|
||||||
|
passwd2 = "bar";
|
||||||
|
}
|
||||||
|
if (strcmp(passwd, passwd2))
|
||||||
|
goto fail;
|
||||||
|
retval = 1;
|
||||||
|
clicon_debug(1, "%s user:%s", __FUNCTION__, user);
|
||||||
|
if (clicon_username_set(h, user) < 0)
|
||||||
|
goto done;
|
||||||
|
ok: /* authenticated */
|
||||||
|
retval = 1;
|
||||||
|
done: /* error */
|
||||||
|
clicon_debug(1, "%s retval:%d", __FUNCTION__, retval);
|
||||||
|
if (user)
|
||||||
|
free(user);
|
||||||
|
if (cb)
|
||||||
|
cbuf_free(cb);
|
||||||
|
if (xt)
|
||||||
|
xml_free(xt);
|
||||||
|
return retval;
|
||||||
|
fail: /* unauthenticated */
|
||||||
|
retval = 0;
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Local example restconf rpc callback
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
restconf_client_rpc(clicon_handle h,
|
||||||
|
cxobj *xn,
|
||||||
|
cbuf *cbret,
|
||||||
|
void *arg,
|
||||||
|
void *regarg)
|
||||||
|
{
|
||||||
|
// FCGX_Request *r = (FCGX_Request *)arg;
|
||||||
|
clicon_debug(1, "%s", __FUNCTION__);
|
||||||
|
cprintf(cbret, "<rpc-reply><result>ok</result></rpc-reply>");
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Start example restonf plugin. Set authentication method
|
||||||
|
* Arguments are argc/argv after --
|
||||||
|
* Currently defined: -a enable http basic authentication
|
||||||
|
* Note hardwired users adm1, wilma and guest
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
example_restconf_start(clicon_handle h,
|
||||||
|
int argc,
|
||||||
|
char **argv)
|
||||||
|
{
|
||||||
|
char c;
|
||||||
|
|
||||||
|
clicon_debug(1, "%s argc:%d", __FUNCTION__, argc);
|
||||||
|
optind = 1;
|
||||||
|
opterr = 0;
|
||||||
|
while ((c = getopt(argc, argv, "a")) != -1){
|
||||||
|
switch (c) {
|
||||||
|
case 'a':
|
||||||
|
basic_auth = 1;
|
||||||
|
break;
|
||||||
|
default:
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
clixon_plugin_api * clixon_plugin_init(clicon_handle h);
|
||||||
|
|
||||||
|
static clixon_plugin_api api = {
|
||||||
|
"example", /* name */
|
||||||
|
clixon_plugin_init, /* init */
|
||||||
|
example_restconf_start,/* start */
|
||||||
|
NULL, /* exit */
|
||||||
|
.ca_auth=example_restconf_credentials /* auth */
|
||||||
|
};
|
||||||
|
|
||||||
|
/*! Restconf plugin initialization
|
||||||
|
* @param[in] h Clixon handle
|
||||||
|
* @retval NULL Error with clicon_err set
|
||||||
|
* @retval api Pointer to API struct
|
||||||
|
*/
|
||||||
|
clixon_plugin_api *
|
||||||
|
clixon_plugin_init(clicon_handle h)
|
||||||
|
{
|
||||||
|
clicon_debug(1, "%s restconf", __FUNCTION__);
|
||||||
|
/* Register local netconf rpc client (note not backend rpc client) */
|
||||||
|
if (rpc_callback_register(h, restconf_client_rpc, NULL, "client-rpc") < 0)
|
||||||
|
return NULL;
|
||||||
|
return &api;
|
||||||
|
}
|
||||||
|
|
@ -1,17 +0,0 @@
|
||||||
# Main YANG module first parsed by parser (in CLICON_YANG_DIR). eg clicon.yang.
|
|
||||||
|
|
||||||
# Startup CLI mode. This should match the CLICON_MODE in your startup clispec file
|
|
||||||
CLICON_CLI_MODE routing
|
|
||||||
|
|
||||||
# Option used to construct initial yang file:
|
|
||||||
# <module>[@<revision>]
|
|
||||||
#CLICON_YANG_MODULE_MAIN ietf-ip
|
|
||||||
CLICON_YANG_MODULE_MAIN example
|
|
||||||
|
|
||||||
# Option used to construct initial yang file:
|
|
||||||
# <module>[@<revision>]
|
|
||||||
#CLICON_YANG_MODULE_REVISION 2014-06-16
|
|
||||||
|
|
||||||
# Set to 0 if you want CLI to wrap to next line.
|
|
||||||
# Set to 1 if you want CLI to scroll sideways when approaching right margin
|
|
||||||
CLICON_CLI_LINESCROLLING 0
|
|
||||||
|
|
@ -1,18 +0,0 @@
|
||||||
<config>
|
|
||||||
<CLICON_CONFIGFILE>/usr/local/etc/routing.xml</CLICON_CONFIGFILE>
|
|
||||||
<CLICON_YANG_DIR>/usr/local/share/routing/yang</CLICON_YANG_DIR>
|
|
||||||
<CLICON_YANG_MODULE_MAIN>example</CLICON_YANG_MODULE_MAIN>
|
|
||||||
<CLICON_CLI_MODE>routing</CLICON_CLI_MODE>
|
|
||||||
<CLICON_BACKEND_DIR>/usr/local/lib/routing/backend</CLICON_BACKEND_DIR>
|
|
||||||
<CLICON_NETCONF_DIR>/usr/local/lib/routing/netconf</CLICON_NETCONF_DIR>
|
|
||||||
<CLICON_RESTCONF_DIR>/usr/local/lib/routing/restconf</CLICON_RESTCONF_DIR>
|
|
||||||
<CLICON_CLI_DIR>/usr/local/lib/routing/cli</CLICON_CLI_DIR>
|
|
||||||
<CLICON_CLISPEC_DIR>/usr/local/lib/routing/clispec</CLICON_CLISPEC_DIR>
|
|
||||||
<CLICON_SOCK>/usr/local/var/routing/routing.sock</CLICON_SOCK>
|
|
||||||
<CLICON_BACKEND_PIDFILE>/usr/local/var/routing/routing.pidfile</CLICON_BACKEND_PIDFILE>
|
|
||||||
<CLICON_CLI_GENMODEL_COMPLETION>1</CLICON_CLI_GENMODEL_COMPLETION>
|
|
||||||
<CLICON_XMLDB_DIR>/usr/local/var/routing</CLICON_XMLDB_DIR>
|
|
||||||
<CLICON_XMLDB_PLUGIN>/usr/local/lib/xmldb/text.so</CLICON_XMLDB_PLUGIN>
|
|
||||||
<CLICON_CLI_LINESCROLLING>0</CLICON_CLI_LINESCROLLING>
|
|
||||||
<CLICON_STARTUP_MODE>init</CLICON_STARTUP_MODE>
|
|
||||||
</config>
|
|
||||||
|
|
@ -27,9 +27,6 @@
|
||||||
/* Define to 1 if you have the <crypt.h> header file. */
|
/* Define to 1 if you have the <crypt.h> header file. */
|
||||||
#undef HAVE_CRYPT_H
|
#undef HAVE_CRYPT_H
|
||||||
|
|
||||||
/* Define to 1 if you have the <depot.h> header file. */
|
|
||||||
#undef HAVE_DEPOT_H
|
|
||||||
|
|
||||||
/* Define to 1 if you have the `inet_aton' function. */
|
/* Define to 1 if you have the `inet_aton' function. */
|
||||||
#undef HAVE_INET_ATON
|
#undef HAVE_INET_ATON
|
||||||
|
|
||||||
|
|
@ -54,9 +51,6 @@
|
||||||
/* Define to 1 if you have the `nsl' library (-lnsl). */
|
/* Define to 1 if you have the `nsl' library (-lnsl). */
|
||||||
#undef HAVE_LIBNSL
|
#undef HAVE_LIBNSL
|
||||||
|
|
||||||
/* Define to 1 if you have the `qdbm' library (-lqdbm). */
|
|
||||||
#undef HAVE_LIBQDBM
|
|
||||||
|
|
||||||
/* Define to 1 if you have the `socket' library (-lsocket). */
|
/* Define to 1 if you have the `socket' library (-lsocket). */
|
||||||
#undef HAVE_LIBSOCKET
|
#undef HAVE_LIBSOCKET
|
||||||
|
|
||||||
|
|
@ -66,9 +60,6 @@
|
||||||
/* Define to 1 if you have the <memory.h> header file. */
|
/* Define to 1 if you have the <memory.h> header file. */
|
||||||
#undef HAVE_MEMORY_H
|
#undef HAVE_MEMORY_H
|
||||||
|
|
||||||
/* Define to 1 if you have the <qdbm/depot.h> header file. */
|
|
||||||
#undef HAVE_QDBM_DEPOT_H
|
|
||||||
|
|
||||||
/* Define to 1 if you have the `sigaction' function. */
|
/* Define to 1 if you have the `sigaction' function. */
|
||||||
#undef HAVE_SIGACTION
|
#undef HAVE_SIGACTION
|
||||||
|
|
||||||
|
|
|
||||||
142
include/clixon_config.h.in~
Normal file
142
include/clixon_config.h.in~
Normal file
|
|
@ -0,0 +1,142 @@
|
||||||
|
/* include/clixon_config.h.in. Generated from configure.ac by autoheader. */
|
||||||
|
|
||||||
|
/* Clixon data dir for system yang files etc */
|
||||||
|
#undef CLIXON_DATADIR
|
||||||
|
|
||||||
|
/* Location for apps to find default config file */
|
||||||
|
#undef CLIXON_DEFAULT_CONFIG
|
||||||
|
|
||||||
|
/* Clixon major release */
|
||||||
|
#undef CLIXON_VERSION_MAJOR
|
||||||
|
|
||||||
|
/* Clixon minor release */
|
||||||
|
#undef CLIXON_VERSION_MINOR
|
||||||
|
|
||||||
|
/* Clixon path version */
|
||||||
|
#undef CLIXON_VERSION_PATCH
|
||||||
|
|
||||||
|
/* Clixon version string */
|
||||||
|
#undef CLIXON_VERSION_STRING
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `alphasort' function. */
|
||||||
|
#undef HAVE_ALPHASORT
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <cligen/cligen.h> header file. */
|
||||||
|
#undef HAVE_CLIGEN_CLIGEN_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <crypt.h> header file. */
|
||||||
|
#undef HAVE_CRYPT_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <depot.h> header file. */
|
||||||
|
#undef HAVE_DEPOT_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `inet_aton' function. */
|
||||||
|
#undef HAVE_INET_ATON
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <inttypes.h> header file. */
|
||||||
|
#undef HAVE_INTTYPES_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `cligen' library (-lcligen). */
|
||||||
|
#undef HAVE_LIBCLIGEN
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `crypt' library (-lcrypt). */
|
||||||
|
#undef HAVE_LIBCRYPT
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `dl' library (-ldl). */
|
||||||
|
#undef HAVE_LIBDL
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `fcgi' library (-lfcgi). */
|
||||||
|
#undef HAVE_LIBFCGI
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `m' library (-lm). */
|
||||||
|
#undef HAVE_LIBM
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `nsl' library (-lnsl). */
|
||||||
|
#undef HAVE_LIBNSL
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `qdbm' library (-lqdbm). */
|
||||||
|
#undef HAVE_LIBQDBM
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `socket' library (-lsocket). */
|
||||||
|
#undef HAVE_LIBSOCKET
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <linux/if_vlan.h> header file. */
|
||||||
|
#undef HAVE_LINUX_IF_VLAN_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <memory.h> header file. */
|
||||||
|
#undef HAVE_MEMORY_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <qdbm/depot.h> header file. */
|
||||||
|
#undef HAVE_QDBM_DEPOT_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `sigaction' function. */
|
||||||
|
#undef HAVE_SIGACTION
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `sigvec' function. */
|
||||||
|
#undef HAVE_SIGVEC
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <stdint.h> header file. */
|
||||||
|
#undef HAVE_STDINT_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <stdlib.h> header file. */
|
||||||
|
#undef HAVE_STDLIB_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <strings.h> header file. */
|
||||||
|
#undef HAVE_STRINGS_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <string.h> header file. */
|
||||||
|
#undef HAVE_STRING_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `strlcpy' function. */
|
||||||
|
#undef HAVE_STRLCPY
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `strndup' function. */
|
||||||
|
#undef HAVE_STRNDUP
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `strsep' function. */
|
||||||
|
#undef HAVE_STRSEP
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `strverscmp' function. */
|
||||||
|
#undef HAVE_STRVERSCMP
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <sys/stat.h> header file. */
|
||||||
|
#undef HAVE_SYS_STAT_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <sys/types.h> header file. */
|
||||||
|
#undef HAVE_SYS_TYPES_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <sys/ucred.h> header file. */
|
||||||
|
#undef HAVE_SYS_UCRED_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <unistd.h> header file. */
|
||||||
|
#undef HAVE_UNISTD_H
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `versionsort' function. */
|
||||||
|
#undef HAVE_VERSIONSORT
|
||||||
|
|
||||||
|
/* Define to the address where bug reports for this package should be sent. */
|
||||||
|
#undef PACKAGE_BUGREPORT
|
||||||
|
|
||||||
|
/* Define to the full name of this package. */
|
||||||
|
#undef PACKAGE_NAME
|
||||||
|
|
||||||
|
/* Define to the full name and version of this package. */
|
||||||
|
#undef PACKAGE_STRING
|
||||||
|
|
||||||
|
/* Define to the one symbol short name of this package. */
|
||||||
|
#undef PACKAGE_TARNAME
|
||||||
|
|
||||||
|
/* Define to the home page for this package. */
|
||||||
|
#undef PACKAGE_URL
|
||||||
|
|
||||||
|
/* Define to the version of this package. */
|
||||||
|
#undef PACKAGE_VERSION
|
||||||
|
|
||||||
|
/* Define to 1 if you have the ANSI C header files. */
|
||||||
|
#undef STDC_HEADERS
|
||||||
|
|
||||||
|
/* Define to 1 if `lex' declares `yytext' as a `char *' by default, not a
|
||||||
|
`char[]'. */
|
||||||
|
#undef YYTEXT_POINTER
|
||||||
|
|
||||||
|
#include <clixon_custom.h>
|
||||||
134
include/clixon_config.h~
Normal file
134
include/clixon_config.h~
Normal file
|
|
@ -0,0 +1,134 @@
|
||||||
|
/* include/clixon_config.h. Generated from clixon_config.h.in by configure. */
|
||||||
|
/* include/clixon_config.h.in. Generated from configure.ac by autoheader. */
|
||||||
|
|
||||||
|
/* Clixon major release */
|
||||||
|
#define CLIXON_VERSION_MAJOR 3
|
||||||
|
|
||||||
|
/* Clixon minor release */
|
||||||
|
#define CLIXON_VERSION_MINOR 3
|
||||||
|
|
||||||
|
/* Clixon path version */
|
||||||
|
#define CLIXON_VERSION_PATCH 2
|
||||||
|
|
||||||
|
/* Clixon version string */
|
||||||
|
#define CLIXON_VERSION_STRING "3.3.2"
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `alphasort' function. */
|
||||||
|
#define HAVE_ALPHASORT 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <cligen/cligen.h> header file. */
|
||||||
|
#define HAVE_CLIGEN_CLIGEN_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <crypt.h> header file. */
|
||||||
|
#define HAVE_CRYPT_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <depot.h> header file. */
|
||||||
|
/* #undef HAVE_DEPOT_H */
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `inet_aton' function. */
|
||||||
|
#define HAVE_INET_ATON 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <inttypes.h> header file. */
|
||||||
|
#define HAVE_INTTYPES_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `crypt' library (-lcrypt). */
|
||||||
|
#define HAVE_LIBCRYPT 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `dl' library (-ldl). */
|
||||||
|
#define HAVE_LIBDL 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `fcgi' library (-lfcgi). */
|
||||||
|
#define HAVE_LIBFCGI 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `m' library (-lm). */
|
||||||
|
#define HAVE_LIBM 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `nsl' library (-lnsl). */
|
||||||
|
#define HAVE_LIBNSL 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `qdbm' library (-lqdbm). */
|
||||||
|
#define HAVE_LIBQDBM 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `socket' library (-lsocket). */
|
||||||
|
/* #undef HAVE_LIBSOCKET */
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <linux/if_vlan.h> header file. */
|
||||||
|
#define HAVE_LINUX_IF_VLAN_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <memory.h> header file. */
|
||||||
|
#define HAVE_MEMORY_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <qdbm/depot.h> header file. */
|
||||||
|
#define HAVE_QDBM_DEPOT_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `sigaction' function. */
|
||||||
|
#define HAVE_SIGACTION 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `sigvec' function. */
|
||||||
|
#define HAVE_SIGVEC 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <stdint.h> header file. */
|
||||||
|
#define HAVE_STDINT_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <stdlib.h> header file. */
|
||||||
|
#define HAVE_STDLIB_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <strings.h> header file. */
|
||||||
|
#define HAVE_STRINGS_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <string.h> header file. */
|
||||||
|
#define HAVE_STRING_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `strlcpy' function. */
|
||||||
|
/* #undef HAVE_STRLCPY */
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `strndup' function. */
|
||||||
|
#define HAVE_STRNDUP 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `strsep' function. */
|
||||||
|
#define HAVE_STRSEP 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `strverscmp' function. */
|
||||||
|
#define HAVE_STRVERSCMP 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <sys/stat.h> header file. */
|
||||||
|
#define HAVE_SYS_STAT_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <sys/types.h> header file. */
|
||||||
|
#define HAVE_SYS_TYPES_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <sys/ucred.h> header file. */
|
||||||
|
/* #undef HAVE_SYS_UCRED_H */
|
||||||
|
|
||||||
|
/* Define to 1 if you have the <unistd.h> header file. */
|
||||||
|
#define HAVE_UNISTD_H 1
|
||||||
|
|
||||||
|
/* Define to 1 if you have the `versionsort' function. */
|
||||||
|
#define HAVE_VERSIONSORT 1
|
||||||
|
|
||||||
|
/* Define to the address where bug reports for this package should be sent. */
|
||||||
|
#define PACKAGE_BUGREPORT ""
|
||||||
|
|
||||||
|
/* Define to the full name of this package. */
|
||||||
|
#define PACKAGE_NAME ""
|
||||||
|
|
||||||
|
/* Define to the full name and version of this package. */
|
||||||
|
#define PACKAGE_STRING ""
|
||||||
|
|
||||||
|
/* Define to the one symbol short name of this package. */
|
||||||
|
#define PACKAGE_TARNAME ""
|
||||||
|
|
||||||
|
/* Define to the home page for this package. */
|
||||||
|
#define PACKAGE_URL ""
|
||||||
|
|
||||||
|
/* Define to the version of this package. */
|
||||||
|
#define PACKAGE_VERSION ""
|
||||||
|
|
||||||
|
/* Define to 1 if you have the ANSI C header files. */
|
||||||
|
#define STDC_HEADERS 1
|
||||||
|
|
||||||
|
/* Define to 1 if `lex' declares `yytext' as a `char *' by default, not a
|
||||||
|
`char[]'. */
|
||||||
|
#define YYTEXT_POINTER 1
|
||||||
|
|
||||||
|
#include <clixon_custom.h>
|
||||||
|
|
@ -44,8 +44,8 @@ depend:
|
||||||
install:
|
install:
|
||||||
|
|
||||||
install-include:
|
install-include:
|
||||||
install -m 755 -d $(DESTDIR)$(includedir)/clixon
|
install -m 0755 -d $(DESTDIR)$(includedir)/clixon
|
||||||
install -m 644 *.h $(DESTDIR)$(includedir)/clixon
|
install -m 0644 *.h $(DESTDIR)$(includedir)/clixon
|
||||||
|
|
||||||
uninstall:
|
uninstall:
|
||||||
rm -rf $(DESTDIR)$(includedir)/clixon
|
rm -rf $(DESTDIR)$(includedir)/clixon
|
||||||
|
|
|
||||||
|
|
@ -83,6 +83,7 @@
|
||||||
#include <clixon/clixon_xml_db.h>
|
#include <clixon/clixon_xml_db.h>
|
||||||
#include <clixon/clixon_xsl.h>
|
#include <clixon/clixon_xsl.h>
|
||||||
#include <clixon/clixon_json.h>
|
#include <clixon/clixon_json.h>
|
||||||
|
#include <clixon/clixon_netconf_lib.h>
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Global variables generated by Makefile
|
* Global variables generated by Makefile
|
||||||
|
|
|
||||||
|
|
@ -50,6 +50,9 @@ typedef struct {float a;} *clicon_handle;
|
||||||
typedef void *clicon_handle;
|
typedef void *clicon_handle;
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
|
/* The dynamicically loadable plugin object handle (should be in clixon_plugin.h) */
|
||||||
|
typedef void *plghndl_t;
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Prototypes
|
* Prototypes
|
||||||
*/
|
*/
|
||||||
|
|
|
||||||
66
lib/clixon/clixon_netconf_lib.h
Normal file
66
lib/clixon/clixon_netconf_lib.h
Normal file
|
|
@ -0,0 +1,66 @@
|
||||||
|
/*
|
||||||
|
*
|
||||||
|
***** BEGIN LICENSE BLOCK *****
|
||||||
|
|
||||||
|
Copyright (C) 2009-2018 Olof Hagsand and Benny Holmgren
|
||||||
|
|
||||||
|
This file is part of CLIXON.
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
|
||||||
|
Alternatively, the contents of this file may be used under the terms of
|
||||||
|
the GNU General Public License Version 3 or later (the "GPL"),
|
||||||
|
in which case the provisions of the GPL are applicable instead
|
||||||
|
of those above. If you wish to allow use of your version of this file only
|
||||||
|
under the terms of the GPL, and not to allow others to
|
||||||
|
use your version of this file under the terms of Apache License version 2,
|
||||||
|
indicate your decision by deleting the provisions above and replace them with
|
||||||
|
the notice and other provisions required by the GPL. If you do not delete
|
||||||
|
the provisions above, a recipient may use your version of this file under
|
||||||
|
the terms of any one of the Apache License version 2 or the GPL.
|
||||||
|
|
||||||
|
***** END LICENSE BLOCK *****
|
||||||
|
|
||||||
|
* Netconf library functions. See RFC6241
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
#ifndef _CLIXON_NETCONF_LIB_H
|
||||||
|
#define _CLIXON_NETCONF_LIB_H
|
||||||
|
|
||||||
|
/*
|
||||||
|
* Prototypes
|
||||||
|
*/
|
||||||
|
int netconf_in_use(cbuf *cb, char *type, char *message);
|
||||||
|
int netconf_invalid_value(cbuf *cb, char *type, char *message);
|
||||||
|
int netconf_too_big(cbuf *cb, char *type, char *message);
|
||||||
|
int netconf_missing_attribute(cbuf *cb, char *type, char *info, char *message);
|
||||||
|
int netconf_bad_attribute(cbuf *cb, char *type, char *info, char *message);
|
||||||
|
int netconf_unknown_attribute(cbuf *cb, char *type, char *info, char *message);
|
||||||
|
int netconf_missing_element(cbuf *cb, char *type, char *info, char *message);
|
||||||
|
int netconf_bad_element(cbuf *cb, char *type, char *info, char *message);
|
||||||
|
int netconf_unknown_element(cbuf *cb, char *type, char *info, char *message);
|
||||||
|
int netconf_unknown_namespace(cbuf *cb, char *type, char *info, char *message);
|
||||||
|
int netconf_access_denied(cbuf *cb, char *type, char *message);
|
||||||
|
int netconf_access_denied_xml(cxobj **xret, char *type, char *message);
|
||||||
|
int netconf_lock_denied(cbuf *cb, char *info, char *message);
|
||||||
|
int netconf_resource_denied(cbuf *cb, char *type, char *message);
|
||||||
|
int netconf_rollback_failed(cbuf *cb, char *type, char *message);
|
||||||
|
int netconf_data_exists(cbuf *cb, char *message);
|
||||||
|
int netconf_data_missing(cbuf *cb, char *message);
|
||||||
|
int netconf_operation_not_supported(cbuf *cb, char *type, char *message);
|
||||||
|
int netconf_operation_failed(cbuf *cb, char *type, char *message);
|
||||||
|
int netconf_operation_failed_xml(cxobj **xret, char *type, char *message);
|
||||||
|
int netconf_malformed_message(cbuf *cb, char *message);
|
||||||
|
int netconf_malformed_message_xml(cxobj **xret, char *message);
|
||||||
|
|
||||||
|
#endif /* _CLIXON_NETCONF_LIB_H */
|
||||||
|
|
@ -43,23 +43,26 @@
|
||||||
*/
|
*/
|
||||||
/* default group membership to access config unix socket */
|
/* default group membership to access config unix socket */
|
||||||
#define CLICON_SOCK_GROUP "clicon"
|
#define CLICON_SOCK_GROUP "clicon"
|
||||||
/* Default name of master plugin */
|
|
||||||
#define CLICON_MASTER_PLUGIN "master"
|
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Types
|
* Types
|
||||||
*/
|
*/
|
||||||
|
|
||||||
/*! Controls how keywords a generated in CLI syntax / prints from object model
|
/*! Controls how keywords a generated in CLI syntax / prints from object model
|
||||||
* Example syntax a.b[] $!x $y:
|
* Example YANG:
|
||||||
* NONE: a b <x> <y>;
|
* list a {
|
||||||
* VARS: a b <x> y <y>;
|
* key x;
|
||||||
* ALL: a b x <x> y <y>;
|
* leaf x;
|
||||||
|
* leaf y;
|
||||||
|
* }
|
||||||
|
* NONE: a <x> <y>;
|
||||||
|
* VARS: a <x> y <y>;
|
||||||
|
* ALL: a x <x> y <y>;
|
||||||
*/
|
*/
|
||||||
enum genmodel_type{
|
enum genmodel_type{
|
||||||
GT_ERR =-1, /* Error */
|
GT_ERR =-1, /* Error */
|
||||||
GT_NONE=0, /* No extra keywords */
|
GT_NONE=0, /* No extra keywords */
|
||||||
GT_VARS, /* Keywords on non-index variables */
|
GT_VARS, /* Keywords on non-key variables */
|
||||||
GT_ALL, /* Keywords on all variables */
|
GT_ALL, /* Keywords on all variables */
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
@ -137,9 +140,6 @@ static inline char *clicon_sock_group(clicon_handle h){
|
||||||
static inline char *clicon_backend_pidfile(clicon_handle h){
|
static inline char *clicon_backend_pidfile(clicon_handle h){
|
||||||
return clicon_option_str(h, "CLICON_BACKEND_PIDFILE");
|
return clicon_option_str(h, "CLICON_BACKEND_PIDFILE");
|
||||||
}
|
}
|
||||||
static inline char *clicon_master_plugin(clicon_handle h){
|
|
||||||
return clicon_option_str(h, "CLICON_MASTER_PLUGIN");
|
|
||||||
}
|
|
||||||
static inline char *clicon_xmldb_dir(clicon_handle h){
|
static inline char *clicon_xmldb_dir(clicon_handle h){
|
||||||
return clicon_option_str(h, "CLICON_XMLDB_DIR");
|
return clicon_option_str(h, "CLICON_XMLDB_DIR");
|
||||||
}
|
}
|
||||||
|
|
@ -179,4 +179,9 @@ int clicon_xmldb_api_set(clicon_handle h, void *xa_api);
|
||||||
void *clicon_xmldb_handle_get(clicon_handle h);
|
void *clicon_xmldb_handle_get(clicon_handle h);
|
||||||
int clicon_xmldb_handle_set(clicon_handle h, void *xh);
|
int clicon_xmldb_handle_set(clicon_handle h, void *xh);
|
||||||
|
|
||||||
|
/**/
|
||||||
|
/* Set and get authorized user name */
|
||||||
|
char *clicon_username_get(clicon_handle h);
|
||||||
|
int clicon_username_set(clicon_handle h, void *username);
|
||||||
|
|
||||||
#endif /* _CLIXON_OPTIONS_H_ */
|
#endif /* _CLIXON_OPTIONS_H_ */
|
||||||
|
|
|
||||||
|
|
@ -38,14 +38,32 @@
|
||||||
#ifndef _CLIXON_PLUGIN_H_
|
#ifndef _CLIXON_PLUGIN_H_
|
||||||
#define _CLIXON_PLUGIN_H_
|
#define _CLIXON_PLUGIN_H_
|
||||||
|
|
||||||
|
/*
|
||||||
|
* Constants
|
||||||
|
*/
|
||||||
|
/* Hardcoded plugin symbol. Must exist in all plugins to kickstart */
|
||||||
|
#define CLIXON_PLUGIN_INIT "clixon_plugin_init"
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Types
|
* Types
|
||||||
*/
|
*/
|
||||||
/* The dynamicically loadable plugin object handle */
|
/* Dynamicically loadable plugin object handle. @see return value of dlopen(3) */
|
||||||
typedef void *plghndl_t;
|
typedef void *plghndl_t;
|
||||||
|
|
||||||
/* Find plugin by name callback. XXX Should be clicon internal */
|
/*! Registered RPC callback function
|
||||||
typedef void *(find_plugin_t)(clicon_handle, char *);
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] xn Request: <rpc><xn></rpc>
|
||||||
|
* @param[out] cbret Return xml tree, eg <rpc-reply>..., <rpc-error..
|
||||||
|
* @param[in] arg Domain specific arg, ec client-entry or FCGX_Request
|
||||||
|
* @param[in] regarg User argument given at rpc_callback_register()
|
||||||
|
*/
|
||||||
|
typedef int (*clicon_rpc_cb)(
|
||||||
|
clicon_handle h,
|
||||||
|
cxobj *xn,
|
||||||
|
cbuf *cbret,
|
||||||
|
void *arg,
|
||||||
|
void *regarg
|
||||||
|
);
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Prototypes
|
* Prototypes
|
||||||
|
|
@ -56,37 +74,135 @@ typedef void *(find_plugin_t)(clicon_handle, char *);
|
||||||
* Backend see config_plugin.c
|
* Backend see config_plugin.c
|
||||||
*/
|
*/
|
||||||
|
|
||||||
/*! Called when plugin loaded. Only mandadory callback. All others optional
|
|
||||||
* @see plginit_t
|
|
||||||
*/
|
|
||||||
#define PLUGIN_INIT "plugin_init"
|
|
||||||
typedef int (plginit_t)(clicon_handle); /* Plugin Init */
|
|
||||||
|
|
||||||
/* Called when backend started with cmd-line arguments from daemon call.
|
/* Called when backend started with cmd-line arguments from daemon call.
|
||||||
* @see plgstart_t
|
* Call plugin start functions with argc/argv multiple arguments.
|
||||||
|
* Typically the argc/argv are the ones appearing after "--", eg
|
||||||
|
* clicon_cli -f /etc/clicon.xml -- -a myopt
|
||||||
*/
|
*/
|
||||||
#define PLUGIN_START "plugin_start"
|
|
||||||
typedef int (plgstart_t)(clicon_handle, int, char **); /* Plugin start */
|
typedef int (plgstart_t)(clicon_handle, int, char **); /* Plugin start */
|
||||||
|
|
||||||
/* Called just before plugin unloaded.
|
/* Called just before plugin unloaded.
|
||||||
*/
|
*/
|
||||||
#define PLUGIN_EXIT "plugin_exit"
|
|
||||||
typedef int (plgexit_t)(clicon_handle); /* Plugin exit */
|
typedef int (plgexit_t)(clicon_handle); /* Plugin exit */
|
||||||
|
|
||||||
/*! Called by restconf
|
/*! Called by restconf to check credentials and return username
|
||||||
* Returns 0 if credentials OK, -1 if failed
|
|
||||||
*/
|
*/
|
||||||
#define PLUGIN_CREDENTIALS "plugin_credentials"
|
|
||||||
/* Plugin credentials
|
/* Plugin authorization. Set username option (or not)
|
||||||
* username should be freed after use
|
* @param[in] Clicon handle
|
||||||
|
* @param[in] void*, eg Fastcgihandle request restconf
|
||||||
|
* @retval 0 if credentials OK
|
||||||
|
* @retval -1 credentials not OK
|
||||||
*/
|
*/
|
||||||
typedef int (plgcredentials_t)(clicon_handle, void *, char **username);
|
typedef int (plgauth_t)(clicon_handle, void *);
|
||||||
|
|
||||||
/* Find a function in global namespace or a plugin. XXX clicon internal */
|
typedef int (plgreset_t)(clicon_handle h, const char *db); /* Reset system status */
|
||||||
void *clicon_find_func(clicon_handle h, char *plugin, char *func);
|
typedef int (plgstatedata_t)(clicon_handle h, char *xpath, cxobj *xtop);
|
||||||
|
|
||||||
plghndl_t plugin_load (clicon_handle h, char *file, int dlflags);
|
typedef void *transaction_data;
|
||||||
|
|
||||||
int plugin_unload(clicon_handle h, plghndl_t *handle);
|
/* Transaction callbacks */
|
||||||
|
typedef int (trans_cb_t)(clicon_handle h, transaction_data td);
|
||||||
|
|
||||||
|
/* Hook to override default prompt with explicit function
|
||||||
|
* Format prompt before each getline
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] mode Cligen syntax mode
|
||||||
|
* @retval prompt Prompt to prepend all CLigen command lines
|
||||||
|
*/
|
||||||
|
typedef char *(cli_prompthook_t)(clicon_handle, char *mode);
|
||||||
|
|
||||||
|
/* plugin init struct for the api
|
||||||
|
* Note: Implicit init function
|
||||||
|
*/
|
||||||
|
struct clixon_plugin_api;
|
||||||
|
typedef struct clixon_plugin_api* (plginit2_t)(clicon_handle); /* Clixon plugin Init */
|
||||||
|
|
||||||
|
struct clixon_plugin_api{
|
||||||
|
/*--- Common fields. ---*/
|
||||||
|
char ca_name[PATH_MAX]; /* Name of plugin (given by plugin) */
|
||||||
|
plginit2_t *ca_init; /* Clixon plugin Init (implicit) */
|
||||||
|
plgstart_t *ca_start; /* Plugin start */
|
||||||
|
plgexit_t *ca_exit; /* Plugin exit */
|
||||||
|
union {
|
||||||
|
struct {
|
||||||
|
cli_prompthook_t *ci_prompt; /* Prompt hook */
|
||||||
|
cligen_susp_cb_t *ci_suspend; /* Ctrl-Z hook, see cligen getline */
|
||||||
|
cligen_interrupt_cb_t *ci_interrupt; /* Ctrl-C, see cligen getline */
|
||||||
|
} cau_cli;
|
||||||
|
struct {
|
||||||
|
plgauth_t *cr_auth; /* Auth credentials */
|
||||||
|
} cau_restconf;
|
||||||
|
struct {
|
||||||
|
} cau_netconf;
|
||||||
|
struct {
|
||||||
|
plgreset_t *cb_reset; /* Reset system status (backend only) */
|
||||||
|
plgstatedata_t *cb_statedata; /* Get state data from plugin (backend only) */
|
||||||
|
trans_cb_t *cb_trans_begin; /* Transaction start */
|
||||||
|
trans_cb_t *cb_trans_validate; /* Transaction validation */
|
||||||
|
trans_cb_t *cb_trans_complete; /* Transaction validation complete */
|
||||||
|
trans_cb_t *cb_trans_commit; /* Transaction commit */
|
||||||
|
trans_cb_t *cb_trans_end; /* Transaction completed */
|
||||||
|
trans_cb_t *cb_trans_abort; /* Transaction aborted */
|
||||||
|
} cau_backend;
|
||||||
|
|
||||||
|
} u;
|
||||||
|
};
|
||||||
|
/* Access fields */
|
||||||
|
#define ca_prompt u.cau_cli.ci_prompt
|
||||||
|
#define ca_suspend u.cau_cli.ci_suspend
|
||||||
|
#define ca_interrupt u.cau_cli.ci_interrupt
|
||||||
|
#define ca_auth u.cau_restconf.cr_auth
|
||||||
|
#define ca_reset u.cau_backend.cb_reset
|
||||||
|
#define ca_statedata u.cau_backend.cb_statedata
|
||||||
|
#define ca_trans_begin u.cau_backend.cb_trans_begin
|
||||||
|
#define ca_trans_validate u.cau_backend.cb_trans_validate
|
||||||
|
#define ca_trans_complete u.cau_backend.cb_trans_complete
|
||||||
|
#define ca_trans_commit u.cau_backend.cb_trans_commit
|
||||||
|
#define ca_trans_end u.cau_backend.cb_trans_end
|
||||||
|
#define ca_trans_abort u.cau_backend.cb_trans_abort
|
||||||
|
|
||||||
|
typedef struct clixon_plugin_api clixon_plugin_api;
|
||||||
|
|
||||||
|
/* Internal plugin structure with dlopen() handle and plugin_api
|
||||||
|
*/
|
||||||
|
struct clixon_plugin{
|
||||||
|
char cp_name[PATH_MAX]; /* Plugin filename. Note api ca_name is given by plugin itself */
|
||||||
|
plghndl_t cp_handle; /* Handle to plugin using dlopen(3) */
|
||||||
|
clixon_plugin_api cp_api;
|
||||||
|
};
|
||||||
|
typedef struct clixon_plugin clixon_plugin;
|
||||||
|
|
||||||
|
/*
|
||||||
|
* Prototypes
|
||||||
|
*/
|
||||||
|
|
||||||
|
/*! Plugin initialization function. Must appear in all plugins
|
||||||
|
* @param[in] h Clixon handle
|
||||||
|
* @retval api Pointer to API struct
|
||||||
|
* @see CLIXON_PLUGIN_INIT default symbol
|
||||||
|
*/
|
||||||
|
clixon_plugin_api *clixon_plugin_init(clicon_handle h);
|
||||||
|
|
||||||
|
clixon_plugin *clixon_plugin_each(clicon_handle h, clixon_plugin *cpprev);
|
||||||
|
|
||||||
|
clixon_plugin *clixon_plugin_each_revert(clicon_handle h, clixon_plugin *cpprev, int nr);
|
||||||
|
|
||||||
|
clixon_plugin *clixon_plugin_find(clicon_handle h, char *name);
|
||||||
|
|
||||||
|
int clixon_plugins_load(clicon_handle h, char *function, char *dir, char *regexp);
|
||||||
|
|
||||||
|
int clixon_plugin_start(clicon_handle h, int argc, char **argv);
|
||||||
|
|
||||||
|
int clixon_plugin_exit(clicon_handle h);
|
||||||
|
|
||||||
|
int clixon_plugin_auth(clicon_handle h, void *arg);
|
||||||
|
|
||||||
|
/* rpc callback API */
|
||||||
|
int rpc_callback_register(clicon_handle h, clicon_rpc_cb cb, void *arg, char *tag);
|
||||||
|
|
||||||
|
int rpc_callback_delete_all(void);
|
||||||
|
|
||||||
|
int rpc_callback_call(clicon_handle h, cxobj *xe, cbuf *cbret, void *arg);
|
||||||
|
|
||||||
#endif /* _CLIXON_PLUGIN_H_ */
|
#endif /* _CLIXON_PLUGIN_H_ */
|
||||||
|
|
|
||||||
|
|
@ -74,8 +74,9 @@ static inline char * strdup4(char *str)
|
||||||
char **clicon_strsep(char *string, char *delim, int *nvec0);
|
char **clicon_strsep(char *string, char *delim, int *nvec0);
|
||||||
char *clicon_strjoin (int argc, char **argv, char *delim);
|
char *clicon_strjoin (int argc, char **argv, char *delim);
|
||||||
int str2cvec(char *string, char delim1, char delim2, cvec **cvp);
|
int str2cvec(char *string, char delim1, char delim2, cvec **cvp);
|
||||||
int percent_encode(char *str, char **escp);
|
int uri_percent_encode(char *str, char **escp);
|
||||||
int percent_decode(char *esc, char **str);
|
int uri_percent_decode(char *esc, char **str);
|
||||||
|
int xml_chardata_encode(char *str, char **escp);
|
||||||
const char *clicon_int2str(const map_str2int *mstab, int i);
|
const char *clicon_int2str(const map_str2int *mstab, int i);
|
||||||
int clicon_str2int(const map_str2int *mstab, char *str);
|
int clicon_str2int(const map_str2int *mstab, char *str);
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -142,8 +142,11 @@ int clicon_xml2file(FILE *f, cxobj *xn, int level, int prettyprint);
|
||||||
int clicon_xml2cbuf(cbuf *xf, cxobj *xn, int level, int prettyprint);
|
int clicon_xml2cbuf(cbuf *xf, cxobj *xn, int level, int prettyprint);
|
||||||
int xml_parse_file(int fd, char *endtag, yang_spec *yspec, cxobj **xt);
|
int xml_parse_file(int fd, char *endtag, yang_spec *yspec, cxobj **xt);
|
||||||
int xml_parse_string(const char *str, yang_spec *yspec, cxobj **xml_top);
|
int xml_parse_string(const char *str, yang_spec *yspec, cxobj **xml_top);
|
||||||
|
#if defined(__GNUC__) && __GNUC__ >= 3
|
||||||
|
int xml_parse_va(cxobj **xt, yang_spec *yspec, const char *format, ...) __attribute__ ((format (printf, 3, 4)));
|
||||||
|
#else
|
||||||
int xml_parse_va(cxobj **xt, yang_spec *yspec, const char *format, ...);
|
int xml_parse_va(cxobj **xt, yang_spec *yspec, const char *format, ...);
|
||||||
|
#endif
|
||||||
int xmltree2cbuf(cbuf *cb, cxobj *x, int level);
|
int xmltree2cbuf(cbuf *cb, cxobj *x, int level);
|
||||||
int xml_copy_one(cxobj *xn0, cxobj *xn1);
|
int xml_copy_one(cxobj *xn0, cxobj *xn1);
|
||||||
int xml_copy(cxobj *x0, cxobj *x1);
|
int xml_copy(cxobj *x0, cxobj *x1);
|
||||||
|
|
|
||||||
|
|
@ -78,7 +78,7 @@ typedef int (xmldb_setopt_t)(xmldb_handle xh, char *optname, void *value);
|
||||||
typedef int (xmldb_get_t)(xmldb_handle xh, const char *db, char *xpath, int config, cxobj **xtop);
|
typedef int (xmldb_get_t)(xmldb_handle xh, const char *db, char *xpath, int config, cxobj **xtop);
|
||||||
|
|
||||||
/* Type of xmldb put function */
|
/* Type of xmldb put function */
|
||||||
typedef int (xmldb_put_t)(xmldb_handle xh, const char *db, enum operation_type op, cxobj *xt);
|
typedef int (xmldb_put_t)(xmldb_handle xh, const char *db, enum operation_type op, cxobj *xt, cbuf *cbret);
|
||||||
|
|
||||||
/* Type of xmldb copy function */
|
/* Type of xmldb copy function */
|
||||||
typedef int (xmldb_copy_t)(xmldb_handle xh, const char *from, const char *to);
|
typedef int (xmldb_copy_t)(xmldb_handle xh, const char *from, const char *to);
|
||||||
|
|
@ -139,7 +139,7 @@ int xmldb_disconnect(clicon_handle h);
|
||||||
int xmldb_getopt(clicon_handle h, char *optname, void **value);
|
int xmldb_getopt(clicon_handle h, char *optname, void **value);
|
||||||
int xmldb_setopt(clicon_handle h, char *optname, void *value);
|
int xmldb_setopt(clicon_handle h, char *optname, void *value);
|
||||||
int xmldb_get(clicon_handle h, const char *db, char *xpath, int config, cxobj **xtop);
|
int xmldb_get(clicon_handle h, const char *db, char *xpath, int config, cxobj **xtop);
|
||||||
int xmldb_put(clicon_handle h, const char *db, enum operation_type op, cxobj *xt);
|
int xmldb_put(clicon_handle h, const char *db, enum operation_type op, cxobj *xt, cbuf *cbret);
|
||||||
int xmldb_copy(clicon_handle h, const char *from, const char *to);
|
int xmldb_copy(clicon_handle h, const char *from, const char *to);
|
||||||
int xmldb_lock(clicon_handle h, const char *db, int pid);
|
int xmldb_lock(clicon_handle h, const char *db, int pid);
|
||||||
int xmldb_unlock(clicon_handle h, const char *db);
|
int xmldb_unlock(clicon_handle h, const char *db);
|
||||||
|
|
|
||||||
|
|
@ -64,8 +64,8 @@ int xml_spec_populate(cxobj *x, void *arg);
|
||||||
int api_path2xpath_cvv(yang_spec *yspec, cvec *cvv, int offset, cbuf *xpath);
|
int api_path2xpath_cvv(yang_spec *yspec, cvec *cvv, int offset, cbuf *xpath);
|
||||||
int api_path2xpath(yang_spec *yspec, char *api_path, cbuf *xpath);
|
int api_path2xpath(yang_spec *yspec, char *api_path, cbuf *xpath);
|
||||||
int api_path2xml(char *api_path, yang_spec *yspec, cxobj *xtop,
|
int api_path2xml(char *api_path, yang_spec *yspec, cxobj *xtop,
|
||||||
int schemanode, cxobj **xpathp, yang_node **ypathp);
|
yang_class nodeclass, cxobj **xpathp, yang_node **ypathp);
|
||||||
int xml_merge(cxobj *x0, cxobj *x1, yang_spec *yspec);
|
int xml_merge(cxobj *x0, cxobj *x1, yang_spec *yspec, char **reason);
|
||||||
int yang_enum_int_value(cxobj *node, int32_t *val);
|
int yang_enum_int_value(cxobj *node, int32_t *val);
|
||||||
|
|
||||||
#endif /* _CLIXON_XML_MAP_H_ */
|
#endif /* _CLIXON_XML_MAP_H_ */
|
||||||
|
|
|
||||||
|
|
@ -31,6 +31,9 @@
|
||||||
|
|
||||||
***** END LICENSE BLOCK *****
|
***** END LICENSE BLOCK *****
|
||||||
|
|
||||||
|
* Yang functions
|
||||||
|
* @see https://tools.ietf.org/html/rfc6020 YANG 1.0
|
||||||
|
* @see https://tools.ietf.org/html/rfc7950 YANG 1.1
|
||||||
*/
|
*/
|
||||||
|
|
||||||
#ifndef _CLIXON_YANG_H_
|
#ifndef _CLIXON_YANG_H_
|
||||||
|
|
@ -114,6 +117,7 @@ enum rfc_6020{
|
||||||
Y_TYPEDEF,
|
Y_TYPEDEF,
|
||||||
Y_UNIQUE,
|
Y_UNIQUE,
|
||||||
Y_UNITS,
|
Y_UNITS,
|
||||||
|
Y_UNKNOWN,
|
||||||
Y_USES,
|
Y_USES,
|
||||||
Y_VALUE,
|
Y_VALUE,
|
||||||
Y_WHEN,
|
Y_WHEN,
|
||||||
|
|
@ -122,14 +126,45 @@ enum rfc_6020{
|
||||||
Y_SPEC /* XXX: NOTE NOT YANG STATEMENT, reserved for top level spec */
|
Y_SPEC /* XXX: NOTE NOT YANG STATEMENT, reserved for top level spec */
|
||||||
};
|
};
|
||||||
|
|
||||||
|
/* Type used to group yang nodes used in some functions
|
||||||
|
* See RFC7950 Sec 3
|
||||||
|
*/
|
||||||
|
enum yang_class{
|
||||||
|
YC_NONE, /* Someting else,... */
|
||||||
|
YC_DATANODE, /* See yang_datanode() */
|
||||||
|
YC_DATADEFINITION, /* See yang_datadefinition() */
|
||||||
|
YC_SCHEMANODE /* See yang_schemanode() */
|
||||||
|
};
|
||||||
|
typedef enum yang_class yang_class;
|
||||||
|
|
||||||
#define YANG_FLAG_MARK 0x01 /* Marker for dynamic algorithms, eg expand */
|
#define YANG_FLAG_MARK 0x01 /* Marker for dynamic algorithms, eg expand */
|
||||||
|
|
||||||
/* Yang data node */
|
/* Yang data node
|
||||||
|
* See RFC7950 Sec 3:
|
||||||
|
* o data node: A node in the schema tree that can be instantiated in a
|
||||||
|
* data tree. One of container, leaf, leaf-list, list, anydata, and
|
||||||
|
* anyxml.
|
||||||
|
*/
|
||||||
#define yang_datanode(y) ((y)->ys_keyword == Y_CONTAINER || (y)->ys_keyword == Y_LEAF || (y)->ys_keyword == Y_LIST || (y)->ys_keyword == Y_LEAF_LIST || (y)->ys_keyword == Y_ANYXML)
|
#define yang_datanode(y) ((y)->ys_keyword == Y_CONTAINER || (y)->ys_keyword == Y_LEAF || (y)->ys_keyword == Y_LIST || (y)->ys_keyword == Y_LEAF_LIST || (y)->ys_keyword == Y_ANYXML)
|
||||||
|
|
||||||
/* Yang schema node */
|
/* Yang data definition statement
|
||||||
|
* See RFC 7950 Sec 3:
|
||||||
|
* o data definition statement: A statement that defines new data
|
||||||
|
* nodes. One of "container", "leaf", "leaf-list", "list", "choice",
|
||||||
|
* "case", "augment", "uses", "anydata", and "anyxml".
|
||||||
|
*/
|
||||||
|
#define yang_datadefinition(y) (yang_datanode(y) || (y)->ys_keyword == Y_CHOICE || (y)->ys_keyword == Y_CASE || (y)->ys_keyword == Y_AUGMENT || (y)->ys_keyword == Y_USES)
|
||||||
|
|
||||||
|
|
||||||
|
/* Yang schema node .
|
||||||
|
* See RFC 7950 Sec 3:
|
||||||
|
* o schema node: A node in the schema tree. One of action, container,
|
||||||
|
* leaf, leaf-list, list, choice, case, rpc, input, output,
|
||||||
|
* notification, anydata, and anyxml.
|
||||||
|
*/
|
||||||
#define yang_schemanode(y) (yang_datanode(y) || (y)->ys_keyword == Y_RPC || (y)->ys_keyword == Y_CHOICE || (y)->ys_keyword == Y_CASE || (y)->ys_keyword == Y_INPUT || (y)->ys_keyword == Y_OUTPUT || (y)->ys_keyword == Y_NOTIFICATION)
|
#define yang_schemanode(y) (yang_datanode(y) || (y)->ys_keyword == Y_RPC || (y)->ys_keyword == Y_CHOICE || (y)->ys_keyword == Y_CASE || (y)->ys_keyword == Y_INPUT || (y)->ys_keyword == Y_OUTPUT || (y)->ys_keyword == Y_NOTIFICATION)
|
||||||
|
|
||||||
|
|
||||||
typedef struct yang_stmt yang_stmt; /* forward */
|
typedef struct yang_stmt yang_stmt; /* forward */
|
||||||
|
|
||||||
/*! Yang type cache. Yang type statements can cache all typedef info here
|
/*! Yang type cache. Yang type statements can cache all typedef info here
|
||||||
|
|
@ -161,7 +196,9 @@ struct yang_stmt{
|
||||||
leaf-list,
|
leaf-list,
|
||||||
config: boolean true or false
|
config: boolean true or false
|
||||||
mandatory: boolean true or false
|
mandatory: boolean true or false
|
||||||
fraction-digits for fraction-digits */
|
fraction-digits for fraction-digits
|
||||||
|
unkown-stmt (argument)
|
||||||
|
*/
|
||||||
cvec *ys_cvec; /* List of stmt-specific variables
|
cvec *ys_cvec; /* List of stmt-specific variables
|
||||||
Y_RANGE: range_min, range_max
|
Y_RANGE: range_min, range_max
|
||||||
Y_LIST: vector of keys
|
Y_LIST: vector of keys
|
||||||
|
|
@ -206,15 +243,15 @@ yang_stmt *ys_dup(yang_stmt *old);
|
||||||
int yn_insert(yang_node *yn_parent, yang_stmt *ys_child);
|
int yn_insert(yang_node *yn_parent, yang_stmt *ys_child);
|
||||||
yang_stmt *yn_each(yang_node *yn, yang_stmt *ys);
|
yang_stmt *yn_each(yang_node *yn, yang_stmt *ys);
|
||||||
char *yang_key2str(int keyword);
|
char *yang_key2str(int keyword);
|
||||||
char *ytype_prefix(yang_stmt *ys);
|
char *yarg_prefix(yang_stmt *ys);
|
||||||
char *ytype_id(yang_stmt *ys);
|
char *yarg_id(yang_stmt *ys);
|
||||||
yang_stmt *ys_module(yang_stmt *ys);
|
yang_stmt *ys_module(yang_stmt *ys);
|
||||||
yang_spec *ys_spec(yang_stmt *ys);
|
yang_spec *ys_spec(yang_stmt *ys);
|
||||||
yang_stmt *yang_find_module_by_prefix(yang_stmt *ys, char *prefix);
|
yang_stmt *yang_find_module_by_prefix(yang_stmt *ys, char *prefix);
|
||||||
yang_stmt *yang_find(yang_node *yn, int keyword, char *argument);
|
yang_stmt *yang_find(yang_node *yn, int keyword, char *argument);
|
||||||
yang_stmt *yang_find_datanode(yang_node *yn, char *argument);
|
yang_stmt *yang_find_datanode(yang_node *yn, char *argument);
|
||||||
yang_stmt *yang_find_schemanode(yang_node *yn, char *argument);
|
yang_stmt *yang_find_schemanode(yang_node *yn, char *argument);
|
||||||
yang_stmt *yang_find_topnode(yang_spec *ysp, char *name, int schemanode);
|
yang_stmt *yang_find_topnode(yang_spec *ysp, char *name, yang_class class);
|
||||||
int yang_order(yang_stmt *y);
|
int yang_order(yang_stmt *y);
|
||||||
int yang_print(FILE *f, yang_node *yn);
|
int yang_print(FILE *f, yang_node *yn);
|
||||||
int yang_print_cbuf(cbuf *cb, yang_node *yn, int marginal);
|
int yang_print_cbuf(cbuf *cb, yang_node *yn, int marginal);
|
||||||
|
|
@ -223,11 +260,11 @@ int yang_parse(clicon_handle h, const char *yang_dir,
|
||||||
int yang_apply(yang_node *yn, enum rfc_6020 key, yang_applyfn_t fn,
|
int yang_apply(yang_node *yn, enum rfc_6020 key, yang_applyfn_t fn,
|
||||||
void *arg);
|
void *arg);
|
||||||
int yang_abs_schema_nodeid(yang_spec *yspec, char *schema_nodeid,
|
int yang_abs_schema_nodeid(yang_spec *yspec, char *schema_nodeid,
|
||||||
yang_stmt **yres);
|
enum rfc_6020 keyword, yang_stmt **yres);
|
||||||
int yang_desc_schema_nodeid(yang_node *yn, char *schema_nodeid,
|
int yang_desc_schema_nodeid(yang_node *yn, char *schema_nodeid,
|
||||||
yang_stmt **yres);
|
enum rfc_6020 keyword, yang_stmt **yres);
|
||||||
cg_var *ys_parse(yang_stmt *ys, enum cv_type cvtype);
|
cg_var *ys_parse(yang_stmt *ys, enum cv_type cvtype);
|
||||||
int ys_parse_sub(yang_stmt *ys);
|
int ys_parse_sub(yang_stmt *ys, char *extra);
|
||||||
int yang_mandatory(yang_stmt *ys);
|
int yang_mandatory(yang_stmt *ys);
|
||||||
int yang_config(yang_stmt *ys);
|
int yang_config(yang_stmt *ys);
|
||||||
yang_spec *yang_spec_netconf(clicon_handle h);
|
yang_spec *yang_spec_netconf(clicon_handle h);
|
||||||
|
|
|
||||||
|
|
@ -68,7 +68,6 @@ char *cv2yang_type(enum cv_type cv_type);
|
||||||
yang_stmt *yang_find_identity(yang_stmt *ys, char *identity);
|
yang_stmt *yang_find_identity(yang_stmt *ys, char *identity);
|
||||||
int ys_cv_validate(cg_var *cv, yang_stmt *ys, char **reason);
|
int ys_cv_validate(cg_var *cv, yang_stmt *ys, char **reason);
|
||||||
int clicon_type2cv(char *type, char *rtype, enum cv_type *cvtype);
|
int clicon_type2cv(char *type, char *rtype, enum cv_type *cvtype);
|
||||||
char *ytype_id(yang_stmt *ys);
|
|
||||||
int yang_type_get(yang_stmt *ys, char **otype, yang_stmt **restype,
|
int yang_type_get(yang_stmt *ys, char **otype, yang_stmt **restype,
|
||||||
int *options, cg_var **mincv, cg_var **maxcv, char **pattern,
|
int *options, cg_var **mincv, cg_var **maxcv, char **pattern,
|
||||||
uint8_t *fraction_digits);
|
uint8_t *fraction_digits);
|
||||||
|
|
|
||||||
|
|
@ -52,6 +52,7 @@ CLIXON_MINOR = @CLIXON_VERSION_MINOR@
|
||||||
VPATH = @srcdir@
|
VPATH = @srcdir@
|
||||||
CC = @CC@
|
CC = @CC@
|
||||||
CFLAGS = -fPIC @CFLAGS@
|
CFLAGS = -fPIC @CFLAGS@
|
||||||
|
INSTALLFLAGS = @INSTALLFLAGS@
|
||||||
LDFLAGS = @LDFLAGS@
|
LDFLAGS = @LDFLAGS@
|
||||||
LIBS = @LIBS@
|
LIBS = @LIBS@
|
||||||
|
|
||||||
|
|
@ -68,7 +69,7 @@ SRC = clixon_sig.c clixon_log.c clixon_err.c clixon_event.c \
|
||||||
clixon_json.c clixon_yang.c clixon_yang_type.c \
|
clixon_json.c clixon_yang.c clixon_yang_type.c \
|
||||||
clixon_hash.c clixon_options.c clixon_plugin.c \
|
clixon_hash.c clixon_options.c clixon_plugin.c \
|
||||||
clixon_proto.c clixon_proto_client.c \
|
clixon_proto.c clixon_proto_client.c \
|
||||||
clixon_xsl.c clixon_sha1.c clixon_xml_db.c
|
clixon_xsl.c clixon_sha1.c clixon_xml_db.c clixon_netconf_lib.c
|
||||||
|
|
||||||
YACCOBJS := lex.clixon_xml_parse.o clixon_xml_parse.tab.o \
|
YACCOBJS := lex.clixon_xml_parse.o clixon_xml_parse.tab.o \
|
||||||
lex.clixon_yang_parse.o clixon_yang_parse.tab.o \
|
lex.clixon_yang_parse.o clixon_yang_parse.tab.o \
|
||||||
|
|
@ -181,8 +182,8 @@ install: install-lib
|
||||||
install-include:
|
install-include:
|
||||||
|
|
||||||
install-lib: $(MYLIB)
|
install-lib: $(MYLIB)
|
||||||
install -m 755 -d $(DESTDIR)$(libdir)
|
install -m 0755 -d $(DESTDIR)$(libdir)
|
||||||
install -m 755 $(MYLIB) $(DESTDIR)$(libdir)
|
install -m 0644 $(INSTALLFLAGS) $(MYLIB) $(DESTDIR)$(libdir)
|
||||||
ln -sf $(MYLIB) $(DESTDIR)$(libdir)/$(MYLIBSO) # -l:libclixon.so.3
|
ln -sf $(MYLIB) $(DESTDIR)$(libdir)/$(MYLIBSO) # -l:libclixon.so.3
|
||||||
ln -sf $(MYLIBSO) $(DESTDIR)$(libdir)/$(MYLIBLINK) # -l:libclixon.so
|
ln -sf $(MYLIBSO) $(DESTDIR)$(libdir)/$(MYLIBLINK) # -l:libclixon.so
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -62,8 +62,7 @@
|
||||||
#include "clixon_string.h"
|
#include "clixon_string.h"
|
||||||
#include "clixon_file.h"
|
#include "clixon_file.h"
|
||||||
|
|
||||||
/*
|
/*! qsort "compar" for directory alphabetically sorting, see qsort(3)
|
||||||
* qsort function
|
|
||||||
*/
|
*/
|
||||||
static int
|
static int
|
||||||
clicon_file_dirent_sort(const void* arg1,
|
clicon_file_dirent_sort(const void* arg1,
|
||||||
|
|
@ -79,8 +78,7 @@ clicon_file_dirent_sort(const void* arg1,
|
||||||
#endif /* HAVE_STRVERSCMP */
|
#endif /* HAVE_STRVERSCMP */
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*! Return alphabetically sorted files from a directory matching regexp
|
||||||
/*! Return sorted matching files from a directory
|
|
||||||
* @param[in] dir Directory path
|
* @param[in] dir Directory path
|
||||||
* @param[out] ent Entries pointer, will be filled in with dir entries. Free
|
* @param[out] ent Entries pointer, will be filled in with dir entries. Free
|
||||||
* after use
|
* after use
|
||||||
|
|
@ -120,16 +118,13 @@ clicon_file_dirent(const char *dir,
|
||||||
struct dirent *new = NULL;
|
struct dirent *new = NULL;
|
||||||
struct dirent *dvecp = NULL;
|
struct dirent *dvecp = NULL;
|
||||||
|
|
||||||
|
|
||||||
*ent = NULL;
|
*ent = NULL;
|
||||||
nent = 0;
|
nent = 0;
|
||||||
|
|
||||||
if (regexp && (res = regcomp(&re, regexp, REG_EXTENDED)) != 0) {
|
if (regexp && (res = regcomp(&re, regexp, REG_EXTENDED)) != 0) {
|
||||||
regerror(res, &re, errbuf, sizeof(errbuf));
|
regerror(res, &re, errbuf, sizeof(errbuf));
|
||||||
clicon_err(OE_DB, 0, "regcomp: %s", errbuf);
|
clicon_err(OE_DB, 0, "regcomp: %s", errbuf);
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
|
|
||||||
if ((dirp = opendir(dir)) == NULL) {
|
if ((dirp = opendir(dir)) == NULL) {
|
||||||
if (errno == ENOENT) /* Dir does not exist -> return 0 matches */
|
if (errno == ENOENT) /* Dir does not exist -> return 0 matches */
|
||||||
retval = 0;
|
retval = 0;
|
||||||
|
|
@ -137,7 +132,6 @@ clicon_file_dirent(const char *dir,
|
||||||
clicon_err(OE_UNIX, errno, "opendir(%s)", dir);
|
clicon_err(OE_UNIX, errno, "opendir(%s)", dir);
|
||||||
goto quit;
|
goto quit;
|
||||||
}
|
}
|
||||||
|
|
||||||
for (res = readdir_r(dirp, &dent, &dresp);
|
for (res = readdir_r(dirp, &dent, &dresp);
|
||||||
dresp;
|
dresp;
|
||||||
res = readdir_r(dirp, &dent, &dresp)) {
|
res = readdir_r(dirp, &dent, &dresp)) {
|
||||||
|
|
@ -162,7 +156,6 @@ clicon_file_dirent(const char *dir,
|
||||||
if ((type & st.st_mode) == 0)
|
if ((type & st.st_mode) == 0)
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
|
|
||||||
if ((tmp = realloc(new, (nent+1)*sizeof(*dvecp))) == NULL) {
|
if ((tmp = realloc(new, (nent+1)*sizeof(*dvecp))) == NULL) {
|
||||||
clicon_err(OE_UNIX, errno, "realloc");
|
clicon_err(OE_UNIX, errno, "realloc");
|
||||||
goto quit;
|
goto quit;
|
||||||
|
|
|
||||||
|
|
@ -50,9 +50,9 @@
|
||||||
#include "clixon_queue.h"
|
#include "clixon_queue.h"
|
||||||
#include "clixon_hash.h"
|
#include "clixon_hash.h"
|
||||||
#include "clixon_handle.h"
|
#include "clixon_handle.h"
|
||||||
|
#include "clixon_log.h"
|
||||||
#include "clixon_err.h"
|
#include "clixon_err.h"
|
||||||
#include "clixon_yang.h"
|
#include "clixon_yang.h"
|
||||||
#include "clixon_plugin.h"
|
|
||||||
#include "clixon_options.h"
|
#include "clixon_options.h"
|
||||||
|
|
||||||
#define CLICON_MAGIC 0x99aafabe
|
#define CLICON_MAGIC 0x99aafabe
|
||||||
|
|
@ -61,7 +61,8 @@
|
||||||
|
|
||||||
/*! Internal structure of basic handle. Also header of all other handles.
|
/*! Internal structure of basic handle. Also header of all other handles.
|
||||||
* @note If you change here, you must also change the structs below:
|
* @note If you change here, you must also change the structs below:
|
||||||
* @see struct cli_handle, struct backend_handle
|
* @see struct cli_handle
|
||||||
|
* @see struct backend_handle
|
||||||
*/
|
*/
|
||||||
struct clicon_handle {
|
struct clicon_handle {
|
||||||
int ch_magic; /* magic (HDR) */
|
int ch_magic; /* magic (HDR) */
|
||||||
|
|
@ -70,6 +71,9 @@ struct clicon_handle {
|
||||||
};
|
};
|
||||||
|
|
||||||
/*! Internal call to allocate a CLICON handle.
|
/*! Internal call to allocate a CLICON handle.
|
||||||
|
*
|
||||||
|
* @param[in] size Size of handle (internal) struct.
|
||||||
|
* @retval h Clicon handle
|
||||||
*
|
*
|
||||||
* There may be different variants of handles with some common options.
|
* There may be different variants of handles with some common options.
|
||||||
* So far the only common options is a MAGIC cookie for sanity checks and
|
* So far the only common options is a MAGIC cookie for sanity checks and
|
||||||
|
|
@ -102,6 +106,7 @@ clicon_handle_init0(int size)
|
||||||
|
|
||||||
/*! Basic CLICON init functions returning a handle for API access.
|
/*! Basic CLICON init functions returning a handle for API access.
|
||||||
*
|
*
|
||||||
|
* @retval h Clicon handle
|
||||||
* This is the first call to CLICON basic API which returns a handle to be
|
* This is the first call to CLICON basic API which returns a handle to be
|
||||||
* used in the API functions. There are other clicon_init functions for more
|
* used in the API functions. There are other clicon_init functions for more
|
||||||
* elaborate applications (cli/backend/netconf). This should be used by the most
|
* elaborate applications (cli/backend/netconf). This should be used by the most
|
||||||
|
|
@ -114,6 +119,7 @@ clicon_handle_init(void)
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Deallocate clicon handle, including freeing handle data.
|
/*! Deallocate clicon handle, including freeing handle data.
|
||||||
|
* @param[in] h Clicon handle
|
||||||
* @Note: handle 'h' cannot be used in calls after this
|
* @Note: handle 'h' cannot be used in calls after this
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
|
|
@ -131,9 +137,10 @@ clicon_handle_exit(clicon_handle h)
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
/*! Check struct magic number for sanity checks
|
||||||
* Check struct magic number for sanity checks
|
* @param[in] h Clicon handle
|
||||||
* return 0 if OK, -1 if fail.
|
* @retval 0 Sanity check OK
|
||||||
|
* @retval -1 Sanity check failed
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
clicon_handle_check(clicon_handle h)
|
clicon_handle_check(clicon_handle h)
|
||||||
|
|
@ -144,8 +151,8 @@ clicon_handle_check(clicon_handle h)
|
||||||
return ch->ch_magic == CLICON_MAGIC ? 0 : -1;
|
return ch->ch_magic == CLICON_MAGIC ? 0 : -1;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
/*! Return clicon options (hash-array) given a handle.
|
||||||
* Return clicon options (hash-array) given a handle.
|
* @param[in] h Clicon handle
|
||||||
*/
|
*/
|
||||||
clicon_hash_t *
|
clicon_hash_t *
|
||||||
clicon_options(clicon_handle h)
|
clicon_options(clicon_handle h)
|
||||||
|
|
@ -155,8 +162,8 @@ clicon_options(clicon_handle h)
|
||||||
return ch->ch_copt;
|
return ch->ch_copt;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*
|
/*! Return clicon data (hash-array) given a handle.
|
||||||
* Return clicon data (hash-array) given a handle.
|
* @param[in] h Clicon handle
|
||||||
*/
|
*/
|
||||||
clicon_hash_t *
|
clicon_hash_t *
|
||||||
clicon_data(clicon_handle h)
|
clicon_data(clicon_handle h)
|
||||||
|
|
@ -165,4 +172,3 @@ clicon_data(clicon_handle h)
|
||||||
|
|
||||||
return ch->ch_data;
|
return ch->ch_data;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -216,6 +216,9 @@ json_str_escape(char *str)
|
||||||
for (i=0;i<strlen(str);i++)
|
for (i=0;i<strlen(str);i++)
|
||||||
switch (str[i]){
|
switch (str[i]){
|
||||||
case '\n':
|
case '\n':
|
||||||
|
snew[j++]='\\';
|
||||||
|
snew[j++]='n';
|
||||||
|
break;
|
||||||
case '\"':
|
case '\"':
|
||||||
case '\\':
|
case '\\':
|
||||||
snew[j++]='\\';
|
snew[j++]='\\';
|
||||||
|
|
@ -301,10 +304,12 @@ xml2json1_cbuf(cbuf *cb,
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
case NO_ARRAY:
|
case NO_ARRAY:
|
||||||
if (!flat)
|
if (!flat){
|
||||||
cprintf(cb, "%*s\"%s\": ",
|
cprintf(cb, "%*s\"", pretty?(level*JSON_INDENT):0, "");
|
||||||
pretty?(level*JSON_INDENT):0, "",
|
if (xml_namespace(x))
|
||||||
xml_name(x));
|
cprintf(cb, "%s:", xml_namespace(x));
|
||||||
|
cprintf(cb, "%s\": ", xml_name(x));
|
||||||
|
}
|
||||||
switch (childt){
|
switch (childt){
|
||||||
case NULL_CHILD:
|
case NULL_CHILD:
|
||||||
cprintf(cb, "null");
|
cprintf(cb, "null");
|
||||||
|
|
@ -320,9 +325,10 @@ xml2json1_cbuf(cbuf *cb,
|
||||||
break;
|
break;
|
||||||
case FIRST_ARRAY:
|
case FIRST_ARRAY:
|
||||||
case SINGLE_ARRAY:
|
case SINGLE_ARRAY:
|
||||||
cprintf(cb, "%*s\"%s\": ",
|
cprintf(cb, "%*s\"", pretty?(level*JSON_INDENT):0, "");
|
||||||
pretty?(level*JSON_INDENT):0, "",
|
if (xml_namespace(x))
|
||||||
xml_name(x));
|
cprintf(cb, "%s:", xml_namespace(x));
|
||||||
|
cprintf(cb, "%s\": ", xml_name(x));
|
||||||
level++;
|
level++;
|
||||||
cprintf(cb, "[%s%*s",
|
cprintf(cb, "[%s%*s",
|
||||||
pretty?"\n":"",
|
pretty?"\n":"",
|
||||||
|
|
|
||||||
|
|
@ -89,6 +89,7 @@ exp ({integer}|{real})[eE][+-]{integer}
|
||||||
%%
|
%%
|
||||||
<START>[ \t]
|
<START>[ \t]
|
||||||
<START>\n { _JY->jy_linenum++; }
|
<START>\n { _JY->jy_linenum++; }
|
||||||
|
<START>\r { }
|
||||||
<START><<EOF>> { return J_EOF; }
|
<START><<EOF>> { return J_EOF; }
|
||||||
<START>\{ { return *yytext; }
|
<START>\{ { return *yytext; }
|
||||||
<START>\} { return *yytext; }
|
<START>\} { return *yytext; }
|
||||||
|
|
|
||||||
936
lib/src/clixon_netconf_lib.c
Normal file
936
lib/src/clixon_netconf_lib.c
Normal file
|
|
@ -0,0 +1,936 @@
|
||||||
|
/*
|
||||||
|
*
|
||||||
|
***** BEGIN LICENSE BLOCK *****
|
||||||
|
|
||||||
|
Copyright (C) 2009-2018 Olof Hagsand and Benny Holmgren
|
||||||
|
|
||||||
|
This file is part of CLIXON.
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
|
||||||
|
Alternatively, the contents of this file may be used under the terms of
|
||||||
|
the GNU General Public License Version 3 or later (the "GPL"),
|
||||||
|
in which case the provisions of the GPL are applicable instead
|
||||||
|
of those above. If you wish to allow use of your version of this file only
|
||||||
|
under the terms of the GPL, and not to allow others to
|
||||||
|
use your version of this file under the terms of Apache License version 2,
|
||||||
|
indicate your decision by deleting the provisions above and replace them with
|
||||||
|
the notice and other provisions required by the GPL. If you do not delete
|
||||||
|
the provisions above, a recipient may use your version of this file under
|
||||||
|
the terms of any one of the Apache License version 2 or the GPL.
|
||||||
|
|
||||||
|
***** END LICENSE BLOCK *****
|
||||||
|
|
||||||
|
* Netconf library functions. See RFC6241
|
||||||
|
*/
|
||||||
|
|
||||||
|
#ifdef HAVE_CONFIG_H
|
||||||
|
#include "clixon_config.h" /* generated by config & autoconf */
|
||||||
|
#endif
|
||||||
|
|
||||||
|
#include <stdio.h>
|
||||||
|
#include <stdlib.h>
|
||||||
|
#include <unistd.h>
|
||||||
|
#include <errno.h>
|
||||||
|
#include <string.h>
|
||||||
|
#include <limits.h>
|
||||||
|
#include <fnmatch.h>
|
||||||
|
#include <stdint.h>
|
||||||
|
#include <assert.h>
|
||||||
|
|
||||||
|
/* cligen */
|
||||||
|
#include <cligen/cligen.h>
|
||||||
|
|
||||||
|
/* clixon */
|
||||||
|
#include "clixon_queue.h"
|
||||||
|
#include "clixon_hash.h"
|
||||||
|
#include "clixon_string.h"
|
||||||
|
#include "clixon_err.h"
|
||||||
|
#include "clixon_handle.h"
|
||||||
|
#include "clixon_yang.h"
|
||||||
|
#include "clixon_log.h"
|
||||||
|
#include "clixon_xml.h"
|
||||||
|
#include "clixon_netconf_lib.h"
|
||||||
|
|
||||||
|
/*! Create Netconf in-use error XML tree according to RFC 6241 Appendix A
|
||||||
|
*
|
||||||
|
* The request requires a resource that already is in use.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "application" or "protocol"
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_in_use(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>in-use</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf invalid-value error XML tree according to RFC 6241 Appendix A
|
||||||
|
*
|
||||||
|
* The request specifies an unacceptable value for one or more parameters.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "application" or "protocol"
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_invalid_value(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>invalid-value</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf too-big error XML tree according to RFC 6241 Appendix A
|
||||||
|
*
|
||||||
|
* The request or response (that would be generated) is
|
||||||
|
* too large for the implementation to handle.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "transport", "rpc", "application", "protocol"
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_too_big(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>too-big</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf missing-attribute error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* An expected attribute is missing.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "rpc", "application" or "protocol"
|
||||||
|
* @param[in] info bad-attribute or bad-element xml
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_missing_attribute(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *info,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>missing-attribute</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-info>%s</error-info>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type, info) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf bad-attribute error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* An attribute value is not correct; e.g., wrong type,
|
||||||
|
* out of range, pattern mismatch.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "rpc", "application" or "protocol"
|
||||||
|
* @param[in] info bad-attribute or bad-element xml
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_bad_attribute(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *info,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>bad-attribute</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-info>%s</error-info>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type, info) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf unknwon-attribute error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* An unexpected attribute is present.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "rpc", "application" or "protocol"
|
||||||
|
* @param[in] info bad-attribute or bad-element xml
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_unknown_attribute(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *info,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>unknown-attribute</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-info>%s</error-info>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type, info) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf missing-element error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* An expected element is missing.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "application" or "protocol"
|
||||||
|
* @param[in] info bad-element xml
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_missing_element(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *info,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>missing-element</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-info>%s</error-info>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type, info) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf bad-element error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* An element value is not correct; e.g., wrong type, out of range,
|
||||||
|
* pattern mismatch.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "application" or "protocol"
|
||||||
|
* @param[in] info bad-element xml
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_bad_element(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *info,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>bad-element</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-info>%s</error-info>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type, info) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf unknown-element error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* An unexpected element is present.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "application" or "protocol"
|
||||||
|
* @param[in] info bad-element xml
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_unknown_element(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *info,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>unknown-element</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-info>%s</error-info>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type, info) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf unknown-namespace error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* An unexpected namespace is present.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "application" or "protocol"
|
||||||
|
* @param[in] info bad-element or bad-namespace xml
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_unknown_namespace(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *info,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>unknown-namespace</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-info>%s</error-info>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type, info) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf access-denied error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* An expected element is missing.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "application" or "protocol"
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_access_denied(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>access-denied</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf access-denied error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* An expected element is missing.
|
||||||
|
* @param[out] xret Error XML tree
|
||||||
|
* @param[in] type Error type: "application" or "protocol"
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_access_denied_xml(cxobj **xret,
|
||||||
|
char *type,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval =-1;
|
||||||
|
cxobj *xerr;
|
||||||
|
|
||||||
|
if (*xret == NULL){
|
||||||
|
if ((*xret = xml_new("rpc-reply", NULL, NULL)) == NULL)
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
else if (xml_name_set(*xret, "rpc-reply") < 0)
|
||||||
|
goto done;
|
||||||
|
if ((xerr = xml_new("rpc-error", *xret, NULL)) == NULL)
|
||||||
|
goto done;
|
||||||
|
if (xml_parse_va(&xerr, NULL, "<error-tag>access-denied</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-severity>error</error-severity>", type) < 0)
|
||||||
|
goto done;
|
||||||
|
if (message && xml_parse_va(&xerr, NULL, "<error-message>%s</error-message>",
|
||||||
|
message) < 0)
|
||||||
|
goto done;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
return retval;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf lock-denied error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* Access to the requested lock is denied because the lock is currently held
|
||||||
|
* by another entity.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] info session-id xml
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_lock_denied(cbuf *cb,
|
||||||
|
char *info,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>lock-denied</error-tag>"
|
||||||
|
"<error-type>protocol</error-type>"
|
||||||
|
"<error-info>%s</error-info>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
info) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf resource-denied error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* An expected element is missing.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "transport, "rpc", "application", "protocol"
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_resource_denied(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>resource-denied</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf rollback-failed error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* Request to roll back some configuration change (via rollback-on-error or
|
||||||
|
* <discard-changes> operations) was not completed for some reason.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "application" or "protocol"
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_rollback_failed(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>rollback-failed</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf data-exists error XML tree according to RFC 6241 Appendix A
|
||||||
|
*
|
||||||
|
* Request could not be completed because the relevant
|
||||||
|
* data model content already exists. For example,
|
||||||
|
* a "create" operation was attempted on data that already exists.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_data_exists(cbuf *cb,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>data-exists</error-tag>"
|
||||||
|
"<error-type>application</error-type>"
|
||||||
|
"<error-severity>error</error-severity>") <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf data-missing error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* Request could not be completed because the relevant data model content
|
||||||
|
* does not exist. For example, a "delete" operation was attempted on
|
||||||
|
* data that does not exist.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_data_missing(cbuf *cb,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>data-missing</error-tag>"
|
||||||
|
"<error-type>application</error-type>"
|
||||||
|
"<error-severity>error</error-severity>") <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf operation-not-supported error XML according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* Request could not be completed because the requested operation is not
|
||||||
|
* supported by this implementation.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "application" or "protocol"
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_operation_not_supported(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>operation-not-supported</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf operation-failed error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* Request could not be completed because the requested operation failed for
|
||||||
|
* some reason not covered by any other error condition.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] type Error type: "rpc", "application" or "protocol"
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_operation_failed(cbuf *cb,
|
||||||
|
char *type,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>operation-failed</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-severity>error</error-severity>",
|
||||||
|
type) <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") < 0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf operation-failed error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* Request could not be completed because the requested operation failed for
|
||||||
|
* some reason not covered by any other error condition.
|
||||||
|
* @param[out] xret Error XML tree
|
||||||
|
* @param[in] type Error type: "rpc", "application" or "protocol"
|
||||||
|
* @param[in] message Error message
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_operation_failed_xml(cxobj **xret,
|
||||||
|
char *type,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval =-1;
|
||||||
|
cxobj *xerr;
|
||||||
|
|
||||||
|
if (*xret == NULL){
|
||||||
|
if ((*xret = xml_new("rpc-reply", NULL, NULL)) == NULL)
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
else if (xml_name_set(*xret, "rpc-reply") < 0)
|
||||||
|
goto done;
|
||||||
|
if ((xerr = xml_new("rpc-error", *xret, NULL)) == NULL)
|
||||||
|
goto done;
|
||||||
|
if (xml_parse_va(&xerr, NULL, "<error-tag>operation-failed</error-tag>"
|
||||||
|
"<error-type>%s</error-type>"
|
||||||
|
"<error-severity>error</error-severity>", type) < 0)
|
||||||
|
goto done;
|
||||||
|
if (message && xml_parse_va(&xerr, NULL, "<error-message>%s</error-message>",
|
||||||
|
message) < 0)
|
||||||
|
goto done;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
return retval;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf malformed-message error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* A message could not be handled because it failed to be parsed correctly.
|
||||||
|
* For example, the message is not well-formed XML or it uses an
|
||||||
|
* invalid character set.
|
||||||
|
* @param[out] cb CLIgen buf. Error XML is written in this buffer
|
||||||
|
* @param[in] message Error message
|
||||||
|
* @note New in :base:1.1
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_malformed_message(cbuf *cb,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *encstr = NULL;
|
||||||
|
|
||||||
|
if (cprintf(cb, "<rpc-reply><rpc-error>"
|
||||||
|
"<error-tag>malformed-message</error-tag>"
|
||||||
|
"<error-type>rpc</error-type>"
|
||||||
|
"<error-severity>error</error-severity>") <0)
|
||||||
|
goto err;
|
||||||
|
if (message){
|
||||||
|
if (xml_chardata_encode(message, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
if (cprintf(cb, "<error-message>%s</error-message>", encstr) < 0)
|
||||||
|
goto err;
|
||||||
|
}
|
||||||
|
if (cprintf(cb, "</rpc-error></rpc-reply>") <0)
|
||||||
|
goto err;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
|
return retval;
|
||||||
|
err:
|
||||||
|
clicon_err(OE_XML, errno, "cprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Create Netconf malformed-message error XML tree according to RFC 6241 App A
|
||||||
|
*
|
||||||
|
* A message could not be handled because it failed to be parsed correctly.
|
||||||
|
* For example, the message is not well-formed XML or it uses an
|
||||||
|
* invalid character set.
|
||||||
|
* @param[out] xret Error XML tree
|
||||||
|
* @param[in] message Error message
|
||||||
|
* @note New in :base:1.1
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
netconf_malformed_message_xml(cxobj **xret,
|
||||||
|
char *message)
|
||||||
|
{
|
||||||
|
int retval =-1;
|
||||||
|
cxobj *xerr;
|
||||||
|
|
||||||
|
if (*xret == NULL){
|
||||||
|
if ((*xret = xml_new("rpc-reply", NULL, NULL)) == NULL)
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
else if (xml_name_set(*xret, "rpc-reply") < 0)
|
||||||
|
goto done;
|
||||||
|
if ((xerr = xml_new("rpc-error", *xret, NULL)) == NULL)
|
||||||
|
goto done;
|
||||||
|
if (xml_parse_va(&xerr, NULL, "<error-tag>malformed-message</error-tag>"
|
||||||
|
"<error-type>rpc</error-type>"
|
||||||
|
"<error-severity>error</error-severity>") < 0)
|
||||||
|
goto done;
|
||||||
|
if (message && xml_parse_va(&xerr, NULL, "<error-message>%s</error-message>",
|
||||||
|
message) < 0)
|
||||||
|
goto done;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
return retval;
|
||||||
|
}
|
||||||
|
|
@ -64,9 +64,9 @@
|
||||||
#include "clixon_handle.h"
|
#include "clixon_handle.h"
|
||||||
#include "clixon_log.h"
|
#include "clixon_log.h"
|
||||||
#include "clixon_yang.h"
|
#include "clixon_yang.h"
|
||||||
#include "clixon_plugin.h"
|
|
||||||
#include "clixon_options.h"
|
#include "clixon_options.h"
|
||||||
#include "clixon_xml.h"
|
#include "clixon_xml.h"
|
||||||
|
#include "clixon_plugin.h"
|
||||||
#include "clixon_xsl.h"
|
#include "clixon_xsl.h"
|
||||||
#include "clixon_xml_map.h"
|
#include "clixon_xml_map.h"
|
||||||
|
|
||||||
|
|
@ -715,3 +715,32 @@ clicon_xmldb_handle_set(clicon_handle h,
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/*! Get authorized user name
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @retval xh XMLDB storage handle. If not connected return NULL
|
||||||
|
*/
|
||||||
|
char *
|
||||||
|
clicon_username_get(clicon_handle h)
|
||||||
|
{
|
||||||
|
clicon_hash_t *cdat = clicon_data(h);
|
||||||
|
|
||||||
|
return (char*)hash_value(cdat, "username", NULL);
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Set authorized user name
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] xh XMLDB storage handle. If NULL reset it
|
||||||
|
* @note Just keep note of it, dont allocate it or so.
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
clicon_username_set(clicon_handle h,
|
||||||
|
void *username)
|
||||||
|
{
|
||||||
|
clicon_hash_t *cdat = clicon_data(h);
|
||||||
|
|
||||||
|
if (username == NULL)
|
||||||
|
return hash_del(cdat, "username");
|
||||||
|
return hash_add(cdat, "username", username, strlen(username)+1)==NULL?-1:0;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -38,68 +38,155 @@
|
||||||
|
|
||||||
#include <stdio.h>
|
#include <stdio.h>
|
||||||
#include <stdlib.h>
|
#include <stdlib.h>
|
||||||
|
#include <stdint.h>
|
||||||
#include <string.h>
|
#include <string.h>
|
||||||
#include <errno.h>
|
#include <errno.h>
|
||||||
#include <dlfcn.h>
|
#include <dlfcn.h>
|
||||||
|
#include <dirent.h>
|
||||||
|
|
||||||
|
#include <sys/stat.h>
|
||||||
|
#include <sys/param.h>
|
||||||
|
|
||||||
|
/* cligen */
|
||||||
|
#include <cligen/cligen.h>
|
||||||
|
|
||||||
#include "clixon_err.h"
|
#include "clixon_err.h"
|
||||||
#include "clixon_queue.h"
|
#include "clixon_queue.h"
|
||||||
#include "clixon_hash.h"
|
#include "clixon_hash.h"
|
||||||
#include "clixon_log.h"
|
#include "clixon_log.h"
|
||||||
|
#include "clixon_file.h"
|
||||||
#include "clixon_handle.h"
|
#include "clixon_handle.h"
|
||||||
|
#include "clixon_yang.h"
|
||||||
|
#include "clixon_xml.h"
|
||||||
#include "clixon_plugin.h"
|
#include "clixon_plugin.h"
|
||||||
|
|
||||||
|
/* List of plugins XXX
|
||||||
static find_plugin_t *
|
* 1. Place in clixon handle not global variables
|
||||||
clicon_find_plugin(clicon_handle h)
|
* 2. Use qelem circular lists
|
||||||
{
|
|
||||||
void *p;
|
|
||||||
find_plugin_t *fp = NULL;
|
|
||||||
clicon_hash_t *data = clicon_data(h);
|
|
||||||
|
|
||||||
if ((p = hash_value(data, "CLICON_FIND_PLUGIN", NULL)) != NULL)
|
|
||||||
memcpy(&fp, p, sizeof(fp));
|
|
||||||
|
|
||||||
return fp;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/*! Return a function pointer based on name of plugin and function.
|
|
||||||
* If plugin is specified, ask daemon registered function to return
|
|
||||||
* the dlsym handle of the plugin.
|
|
||||||
*/
|
*/
|
||||||
void *
|
static clixon_plugin *_clixon_plugins = NULL; /* List of plugins (of client) */
|
||||||
clicon_find_func(clicon_handle h, char *plugin, char *func)
|
static int _clixon_nplugins = 0; /* Number of plugins */
|
||||||
|
|
||||||
|
/*! Iterator over clixon plugins
|
||||||
|
*
|
||||||
|
* @note Never manipulate the plugin during operation or using the
|
||||||
|
* same object recursively
|
||||||
|
*
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] plugin previous plugin, or NULL on init
|
||||||
|
* @code
|
||||||
|
* clicon_plugin *cp = NULL;
|
||||||
|
* while ((cp = clixon_plugin_each(h, cp)) != NULL) {
|
||||||
|
* ...
|
||||||
|
* }
|
||||||
|
* @endcode
|
||||||
|
* @note Not optimized, alwasy iterates from the start of the list
|
||||||
|
*/
|
||||||
|
clixon_plugin *
|
||||||
|
clixon_plugin_each(clicon_handle h,
|
||||||
|
clixon_plugin *cpprev)
|
||||||
{
|
{
|
||||||
find_plugin_t *plgget;
|
int i;
|
||||||
void *dlhandle = NULL;
|
clixon_plugin *cp;
|
||||||
|
clixon_plugin *cpnext = NULL;
|
||||||
|
|
||||||
if (plugin) {
|
if (cpprev == NULL)
|
||||||
/* find clicon_plugin_get() in global namespace */
|
cpnext = _clixon_plugins;
|
||||||
if ((plgget = clicon_find_plugin(h)) == NULL) {
|
else{
|
||||||
clicon_err(OE_UNIX, errno, "Specified plugin not supported");
|
for (i = 0; i < _clixon_nplugins; i++) {
|
||||||
|
cp = &_clixon_plugins[i];
|
||||||
|
if (cp == cpprev)
|
||||||
|
break;
|
||||||
|
cp = NULL;
|
||||||
|
}
|
||||||
|
if (cp && i < _clixon_nplugins-1)
|
||||||
|
cpnext = &_clixon_plugins[i+1];
|
||||||
|
}
|
||||||
|
return cpnext;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Reverse iterator over clixon plugins, iterater from nr to 0
|
||||||
|
*
|
||||||
|
* @note Never manipulate the plugin during operation or using the
|
||||||
|
* same object recursively
|
||||||
|
*
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] plugin previous plugin, or NULL on init
|
||||||
|
* @code
|
||||||
|
* clicon_plugin *cp = NULL;
|
||||||
|
* while ((cp = clixon_plugin_each_revert(h, cp, nr)) != NULL) {
|
||||||
|
* ...
|
||||||
|
* }
|
||||||
|
* @endcode
|
||||||
|
* @note Not optimized, alwasy iterates from the start of the list
|
||||||
|
*/
|
||||||
|
clixon_plugin *
|
||||||
|
clixon_plugin_each_revert(clicon_handle h,
|
||||||
|
clixon_plugin *cpprev,
|
||||||
|
int nr)
|
||||||
|
{
|
||||||
|
int i;
|
||||||
|
clixon_plugin *cp;
|
||||||
|
clixon_plugin *cpnext = NULL;
|
||||||
|
|
||||||
|
if (cpprev == NULL)
|
||||||
|
cpnext = &_clixon_plugins[nr-1];
|
||||||
|
else{
|
||||||
|
for (i = nr-1; i >= 0; i--) {
|
||||||
|
cp = &_clixon_plugins[i];
|
||||||
|
if (cp == cpprev)
|
||||||
|
break;
|
||||||
|
cp = NULL;
|
||||||
|
}
|
||||||
|
if (cp && i > 0)
|
||||||
|
cpnext = &_clixon_plugins[i-1];
|
||||||
|
}
|
||||||
|
return cpnext;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Find plugin by name
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] name Plugin name
|
||||||
|
* @retval p Plugin if found
|
||||||
|
* @retval NULL Not found
|
||||||
|
*/
|
||||||
|
clixon_plugin *
|
||||||
|
clixon_plugin_find(clicon_handle h,
|
||||||
|
char *name)
|
||||||
|
{
|
||||||
|
int i;
|
||||||
|
clixon_plugin *cp = NULL;
|
||||||
|
|
||||||
|
for (i = 0; i < _clixon_nplugins; i++) {
|
||||||
|
cp = &_clixon_plugins[i];
|
||||||
|
if (strcmp(cp->cp_name, name) == 0)
|
||||||
|
return cp;
|
||||||
|
}
|
||||||
return NULL;
|
return NULL;
|
||||||
}
|
}
|
||||||
dlhandle = plgget(h, plugin);
|
|
||||||
}
|
|
||||||
|
|
||||||
return dlsym(dlhandle, func);
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! Load a dynamic plugin object and call its init-function
|
/*! Load a dynamic plugin object and call its init-function
|
||||||
* Note 'file' may be destructively modified
|
|
||||||
* @param[in] h Clicon handle
|
* @param[in] h Clicon handle
|
||||||
* @param[in] file Which plugin to load
|
* @param[in] file Which plugin to load
|
||||||
|
* @param[in] function Which function symbol to load and call
|
||||||
* @param[in] dlflags See man(3) dlopen
|
* @param[in] dlflags See man(3) dlopen
|
||||||
|
* @retval cp Clixon plugin structure
|
||||||
|
* @retval NULL Error
|
||||||
|
* @see clixon_plugins_load Load all plugins
|
||||||
*/
|
*/
|
||||||
plghndl_t
|
static clixon_plugin *
|
||||||
plugin_load(clicon_handle h,
|
plugin_load_one(clicon_handle h,
|
||||||
char *file,
|
char *file,
|
||||||
|
char *function,
|
||||||
int dlflags)
|
int dlflags)
|
||||||
{
|
{
|
||||||
char *error;
|
char *error;
|
||||||
void *handle = NULL;
|
void *handle = NULL;
|
||||||
plginit_t *initfn;
|
plginit2_t *initfn;
|
||||||
|
clixon_plugin_api *api = NULL;
|
||||||
|
clixon_plugin *cp = NULL;
|
||||||
|
char *name;
|
||||||
|
char *p;
|
||||||
|
|
||||||
clicon_debug(1, "%s", __FUNCTION__);
|
clicon_debug(1, "%s", __FUNCTION__);
|
||||||
dlerror(); /* Clear any existing error */
|
dlerror(); /* Clear any existing error */
|
||||||
|
|
@ -108,53 +195,310 @@ plugin_load(clicon_handle h,
|
||||||
clicon_err(OE_PLUGIN, errno, "dlopen: %s\n", error ? error : "Unknown error");
|
clicon_err(OE_PLUGIN, errno, "dlopen: %s\n", error ? error : "Unknown error");
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
/* call plugin_init() if defined */
|
/* call plugin_init() if defined, eg CLIXON_PLUGIN_INIT or CLIXON_BACKEND_INIT */
|
||||||
if ((initfn = dlsym(handle, PLUGIN_INIT)) == NULL){
|
if ((initfn = dlsym(handle, function)) == NULL){
|
||||||
clicon_err(OE_PLUGIN, errno, "Failed to find plugin_init when loading restconf plugin %s", file);
|
clicon_err(OE_PLUGIN, errno, "Failed to find %s when loading clixon plugin %s", CLIXON_PLUGIN_INIT, file);
|
||||||
goto err;
|
goto err;
|
||||||
}
|
}
|
||||||
if ((error = (char*)dlerror()) != NULL) {
|
if ((error = (char*)dlerror()) != NULL) {
|
||||||
clicon_err(OE_UNIX, 0, "dlsym: %s: %s", file, error);
|
clicon_err(OE_UNIX, 0, "dlsym: %s: %s", file, error);
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
if (initfn(h) != 0) {
|
if ((api = initfn(h)) == NULL) {
|
||||||
clicon_err(OE_PLUGIN, errno, "Failed to initiate %s", strrchr(file,'/')?strchr(file, '/'):file);
|
clicon_err(OE_PLUGIN, errno, "Failed to initiate %s", strrchr(file,'/')?strchr(file, '/'):file);
|
||||||
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
if (!clicon_errno) /* sanity: log if clicon_err() is not called ! */
|
||||||
clicon_err(OE_DB, 0, "Unknown error: %s: plugin_init does not make clicon_err call on error",
|
clicon_err(OE_DB, 0, "Unknown error: %s: plugin_init does not make clicon_err call on error",
|
||||||
file);
|
file);
|
||||||
goto err;
|
goto err;
|
||||||
}
|
}
|
||||||
|
/* Note: sizeof clixon_plugin_api which is largest of clixon_plugin_api:s */
|
||||||
|
if ((cp = (clixon_plugin *)malloc(sizeof(struct clixon_plugin))) == NULL){
|
||||||
|
clicon_err(OE_UNIX, errno, "malloc");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
memset(cp, 0, sizeof(struct clixon_plugin));
|
||||||
|
cp->cp_handle = handle;
|
||||||
|
/* Extract string after last '/' in filename, if any */
|
||||||
|
name = strrchr(file, '/') ? strrchr(file, '/')+1 : file;
|
||||||
|
/* strip extension, eg .so from name */
|
||||||
|
if ((p=strrchr(name, '.')) != NULL)
|
||||||
|
*p = '\0';
|
||||||
|
/* Copy name to struct */
|
||||||
|
memcpy(cp->cp_name, name, strlen(name)+1);
|
||||||
|
|
||||||
|
snprintf(cp->cp_name, sizeof(cp->cp_name), "%*s",
|
||||||
|
(int)strlen(name), name);
|
||||||
|
cp->cp_api = *api;
|
||||||
|
clicon_debug(1, "%s", __FUNCTION__);
|
||||||
done:
|
done:
|
||||||
return handle;
|
return cp;
|
||||||
err:
|
err:
|
||||||
if (handle)
|
if (handle)
|
||||||
dlclose(handle);
|
dlclose(handle);
|
||||||
return NULL;
|
return NULL;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*! Load a set of plugin objects from a directory and and call their init-function
|
||||||
/*! Unload a plugin
|
|
||||||
* @param[in] h Clicon handle
|
* @param[in] h Clicon handle
|
||||||
* @param[in] handle Clicon handle
|
* @param[in] function Which function symbol to load and call (eg CLIXON_PLUGIN_INIT)
|
||||||
|
* @param[in] dir Directory. .so files in this dir will be loaded.
|
||||||
|
* @param[in] regexp Regexp for matching files in plugin directory. Default *.so.
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
plugin_unload(clicon_handle h,
|
clixon_plugins_load(clicon_handle h,
|
||||||
plghndl_t *handle)
|
char *function,
|
||||||
|
char *dir,
|
||||||
|
char *regexp)
|
||||||
{
|
{
|
||||||
int retval = 0;
|
int retval = -1;
|
||||||
char *error;
|
int ndp;
|
||||||
|
struct dirent *dp = NULL;
|
||||||
|
int i;
|
||||||
|
char filename[MAXPATHLEN];
|
||||||
|
clixon_plugin *cp;
|
||||||
|
|
||||||
|
clicon_debug(1, "%s", __FUNCTION__);
|
||||||
|
/* Get plugin objects names from plugin directory */
|
||||||
|
if((ndp = clicon_file_dirent(dir, &dp,
|
||||||
|
regexp?regexp:"(.so)$", S_IFREG))<0)
|
||||||
|
goto done;
|
||||||
|
/* Load all plugins */
|
||||||
|
for (i = 0; i < ndp; i++) {
|
||||||
|
snprintf(filename, MAXPATHLEN-1, "%s/%s", dir, dp[i].d_name);
|
||||||
|
clicon_debug(1, "DEBUG: Loading plugin '%.*s' ...",
|
||||||
|
(int)strlen(filename), filename);
|
||||||
|
if ((cp = plugin_load_one(h, filename, function, RTLD_NOW)) == NULL)
|
||||||
|
goto done;
|
||||||
|
_clixon_nplugins++;
|
||||||
|
if ((_clixon_plugins = realloc(_clixon_plugins, _clixon_nplugins*sizeof(clixon_plugin))) == NULL) {
|
||||||
|
clicon_err(OE_UNIX, errno, "realloc");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
_clixon_plugins[_clixon_nplugins-1] = *cp;
|
||||||
|
free(cp);
|
||||||
|
}
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (dp)
|
||||||
|
free(dp);
|
||||||
|
return retval;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Call plugin_start in all plugins
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] argc
|
||||||
|
* @param[in] argv
|
||||||
|
* Call plugin start functions (if defined) with argc/argv multiple
|
||||||
|
* arguments.
|
||||||
|
* Typically the argc/argv are the ones appearing after "--", eg
|
||||||
|
* clicon_cli -f /etc/clicon.xml -- -a myopt
|
||||||
|
* In the example above argc=3 and
|
||||||
|
* argv[0]: clicon_cli
|
||||||
|
* argv[1]: -a
|
||||||
|
* argv[2]: myopt
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
clixon_plugin_start(clicon_handle h,
|
||||||
|
int argc,
|
||||||
|
char **argv)
|
||||||
|
{
|
||||||
|
clixon_plugin *cp;
|
||||||
|
int i;
|
||||||
|
plgstart_t *startfn; /* Plugin start */
|
||||||
|
|
||||||
|
for (i = 0; i < _clixon_nplugins; i++) {
|
||||||
|
cp = &_clixon_plugins[i];
|
||||||
|
if ((startfn = cp->cp_api.ca_start) == NULL)
|
||||||
|
continue;
|
||||||
|
// optind = 0;
|
||||||
|
if (startfn(h, argc, argv) < 0) {
|
||||||
|
clicon_debug(1, "plugin_start() failed\n");
|
||||||
|
return -1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Unload all plugins: call exit function and close shared handle
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
clixon_plugin_exit(clicon_handle h)
|
||||||
|
{
|
||||||
|
clixon_plugin *cp;
|
||||||
plgexit_t *exitfn;
|
plgexit_t *exitfn;
|
||||||
|
int i;
|
||||||
|
char *error;
|
||||||
|
|
||||||
/* Call exit function is it exists */
|
for (i = 0; i < _clixon_nplugins; i++) {
|
||||||
exitfn = dlsym(handle, PLUGIN_EXIT);
|
cp = &_clixon_plugins[i];
|
||||||
if (dlerror() == NULL)
|
if ((exitfn = cp->cp_api.ca_exit) == NULL)
|
||||||
exitfn(h);
|
continue;
|
||||||
|
if (exitfn(h) < 0) {
|
||||||
dlerror(); /* Clear any existing error */
|
clicon_debug(1, "plugin_exit() failed\n");
|
||||||
if (dlclose(handle) != 0) {
|
return -1;
|
||||||
|
}
|
||||||
|
if (dlclose(cp->cp_handle) != 0) {
|
||||||
error = (char*)dlerror();
|
error = (char*)dlerror();
|
||||||
clicon_err(OE_PLUGIN, errno, "dlclose: %s\n", error ? error : "Unknown error");
|
clicon_err(OE_PLUGIN, errno, "dlclose: %s\n", error ? error : "Unknown error");
|
||||||
/* Just report */
|
}
|
||||||
|
}
|
||||||
|
if (_clixon_plugins){
|
||||||
|
free(_clixon_plugins);
|
||||||
|
_clixon_plugins = NULL;
|
||||||
|
}
|
||||||
|
_clixon_nplugins = 0;
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/*! Run the restconf user-defined credentials callback if present
|
||||||
|
* Find first authentication callback and call that, then return.
|
||||||
|
* The callback is to set the authenticated user
|
||||||
|
* @param[in] h Clicon handle
|
||||||
|
* @param[in] arg Argument, such as fastcgi handler for restconf
|
||||||
|
* @retval -1 Error
|
||||||
|
* @retval 0 Not authenticated
|
||||||
|
* @retval 1 Authenticated
|
||||||
|
* @note If authenticated either a callback was called and clicon_username_set()
|
||||||
|
* Or no callback was found.
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
clixon_plugin_auth(clicon_handle h,
|
||||||
|
void *arg)
|
||||||
|
{
|
||||||
|
clixon_plugin *cp;
|
||||||
|
int i;
|
||||||
|
plgauth_t *authfn; /* Plugin auth */
|
||||||
|
int retval = 1;
|
||||||
|
|
||||||
|
for (i = 0; i < _clixon_nplugins; i++) {
|
||||||
|
cp = &_clixon_plugins[i];
|
||||||
|
if ((authfn = cp->cp_api.ca_auth) == NULL)
|
||||||
|
continue;
|
||||||
|
if ((retval = authfn(h, arg)) < 0) {
|
||||||
|
clicon_debug(1, "plugin_auth() failed\n");
|
||||||
|
return -1;
|
||||||
|
}
|
||||||
|
break;
|
||||||
}
|
}
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*--------------------------------------------------------------------
|
||||||
|
* RPC callbacks for both client/frontend and backend plugins.
|
||||||
|
* RPC callbacks are explicitly registered in the plugin_init() function
|
||||||
|
* with a tag and a function
|
||||||
|
* WHen the the tag is encountered, the callback is called.
|
||||||
|
* Primarily backend, but also netconf and restconf frontend plugins.
|
||||||
|
* CLI frontend so far have direct callbacks, ie functions in the cligen
|
||||||
|
* specification are directly dlsym:ed to the CLI plugin.
|
||||||
|
* It would be possible to use this rpc registering API for CLI plugins as well.
|
||||||
|
*
|
||||||
|
* @note may have a problem if callbacks are of different types
|
||||||
|
*/
|
||||||
|
typedef struct {
|
||||||
|
qelem_t rc_qelem; /* List header */
|
||||||
|
clicon_rpc_cb rc_callback; /* RPC Callback */
|
||||||
|
void *rc_arg; /* Application specific argument to cb */
|
||||||
|
char *rc_tag; /* Xml/json tag when matched, callback called */
|
||||||
|
} rpc_callback_t;
|
||||||
|
|
||||||
|
/* List of rpc callback entries */
|
||||||
|
static rpc_callback_t *rpc_cb_list = NULL;
|
||||||
|
|
||||||
|
/*! Register a RPC callback
|
||||||
|
* Called from plugin to register a callback for a specific netconf XML tag.
|
||||||
|
*
|
||||||
|
* @param[in] h clicon handle
|
||||||
|
* @param[in] cb, Callback called
|
||||||
|
* @param[in] arg, Domain-specific argument to send to callback
|
||||||
|
* @param[in] tag Xml tag when callback is made
|
||||||
|
* @see rpc_callback_call
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
rpc_callback_register(clicon_handle h,
|
||||||
|
clicon_rpc_cb cb,
|
||||||
|
void *arg,
|
||||||
|
char *tag)
|
||||||
|
{
|
||||||
|
rpc_callback_t *rc;
|
||||||
|
|
||||||
|
if ((rc = malloc(sizeof(rpc_callback_t))) == NULL) {
|
||||||
|
clicon_err(OE_DB, errno, "malloc: %s", strerror(errno));
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
memset (rc, 0, sizeof (*rc));
|
||||||
|
rc->rc_callback = cb;
|
||||||
|
rc->rc_arg = arg;
|
||||||
|
rc->rc_tag = strdup(tag); /* XXX strdup memleak */
|
||||||
|
INSQ(rc, rpc_cb_list);
|
||||||
|
return 0;
|
||||||
|
done:
|
||||||
|
if (rc){
|
||||||
|
if (rc->rc_tag)
|
||||||
|
free(rc->rc_tag);
|
||||||
|
free(rc);
|
||||||
|
}
|
||||||
|
return -1;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Delete all RPC callbacks
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
rpc_callback_delete_all(void)
|
||||||
|
{
|
||||||
|
rpc_callback_t *rc;
|
||||||
|
|
||||||
|
while((rc = rpc_cb_list) != NULL) {
|
||||||
|
DELQ(rc, rpc_cb_list, rpc_callback_t *);
|
||||||
|
if (rc->rc_tag)
|
||||||
|
free(rc->rc_tag);
|
||||||
|
free(rc);
|
||||||
|
}
|
||||||
|
return 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
/*! Search RPC callbacks and invoke if XML match with tag
|
||||||
|
*
|
||||||
|
* @param[in] h clicon handle
|
||||||
|
* @param[in] xn Sub-tree (under xorig) at child of rpc: <rpc><xn></rpc>.
|
||||||
|
* @param[out] xret Return XML, error or OK
|
||||||
|
* @param[in] arg Domain-speific arg (eg client_entry)
|
||||||
|
*
|
||||||
|
* @retval -1 Error
|
||||||
|
* @retval 0 OK, not found handler.
|
||||||
|
* @retval 1 OK, handler called
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
rpc_callback_call(clicon_handle h,
|
||||||
|
cxobj *xe,
|
||||||
|
cbuf *cbret,
|
||||||
|
void *arg)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
rpc_callback_t *rc;
|
||||||
|
|
||||||
|
if (rpc_cb_list == NULL)
|
||||||
|
return 0;
|
||||||
|
rc = rpc_cb_list;
|
||||||
|
do {
|
||||||
|
if (strcmp(rc->rc_tag, xml_name(xe)) == 0){
|
||||||
|
if ((retval = rc->rc_callback(h, xe, cbret, arg, rc->rc_arg)) < 0){
|
||||||
|
clicon_debug(1, "%s Error in: %s", __FUNCTION__, rc->rc_tag);
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
else{
|
||||||
|
retval = 1; /* handled */
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
rc = NEXTQ(rpc_callback_t *, rc);
|
||||||
|
} while (rc != rpc_cb_list);
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
clicon_debug(1, "%s retval:%d", __FUNCTION__, retval);
|
||||||
|
return retval;
|
||||||
|
}
|
||||||
|
|
|
||||||
|
|
@ -47,6 +47,7 @@
|
||||||
#include <errno.h>
|
#include <errno.h>
|
||||||
#include <assert.h>
|
#include <assert.h>
|
||||||
#include <unistd.h>
|
#include <unistd.h>
|
||||||
|
#include <sys/param.h>
|
||||||
#include <sys/stat.h>
|
#include <sys/stat.h>
|
||||||
#include <sys/socket.h>
|
#include <sys/socket.h>
|
||||||
#include <sys/syslog.h>
|
#include <sys/syslog.h>
|
||||||
|
|
@ -60,9 +61,9 @@
|
||||||
#include "clixon_hash.h"
|
#include "clixon_hash.h"
|
||||||
#include "clixon_handle.h"
|
#include "clixon_handle.h"
|
||||||
#include "clixon_yang.h"
|
#include "clixon_yang.h"
|
||||||
#include "clixon_plugin.h"
|
|
||||||
#include "clixon_options.h"
|
#include "clixon_options.h"
|
||||||
#include "clixon_xml.h"
|
#include "clixon_xml.h"
|
||||||
|
#include "clixon_plugin.h"
|
||||||
#include "clixon_xsl.h"
|
#include "clixon_xsl.h"
|
||||||
#include "clixon_proto.h"
|
#include "clixon_proto.h"
|
||||||
#include "clixon_err.h"
|
#include "clixon_err.h"
|
||||||
|
|
@ -90,6 +91,7 @@ clicon_rpc_msg(clicon_handle h,
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
yang_spec *yspec;
|
yang_spec *yspec;
|
||||||
|
|
||||||
|
clicon_debug(1, "%s request:%s", __FUNCTION__, msg->op_body);
|
||||||
if ((sock = clicon_sock(h)) == NULL){
|
if ((sock = clicon_sock(h)) == NULL){
|
||||||
clicon_err(OE_FATAL, 0, "CLICON_SOCK option not set");
|
clicon_err(OE_FATAL, 0, "CLICON_SOCK option not set");
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -200,7 +202,7 @@ clicon_rpc_netconf_xml(clicon_handle h,
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Generate clicon error function call from Netconf error message
|
/*! Generate and log clicon error function call from Netconf error message
|
||||||
* @param[in] xerr Netconf error message on the level: <rpc-reply><rpc-error>
|
* @param[in] xerr Netconf error message on the level: <rpc-reply><rpc-error>
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
|
|
@ -264,10 +266,14 @@ clicon_rpc_get_config(clicon_handle h,
|
||||||
cbuf *cb = NULL;
|
cbuf *cb = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xd;
|
cxobj *xd;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((cb = cbuf_new()) == NULL)
|
if ((cb = cbuf_new()) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
cprintf(cb, "<rpc><get-config><source><%s/></source>", db);
|
cprintf(cb, "<rpc");
|
||||||
|
if ((username = clicon_username_get(h)) != NULL)
|
||||||
|
cprintf(cb, " username=\"%s\"", username);
|
||||||
|
cprintf(cb, "><get-config><source><%s/></source>", db);
|
||||||
if (xpath && strlen(xpath))
|
if (xpath && strlen(xpath))
|
||||||
cprintf(cb, "<filter type=\"xpath\" select=\"%s\"/>", xpath);
|
cprintf(cb, "<filter type=\"xpath\" select=\"%s\"/>", xpath);
|
||||||
cprintf(cb, "</get-config></rpc>");
|
cprintf(cb, "</get-config></rpc>");
|
||||||
|
|
@ -303,7 +309,7 @@ clicon_rpc_get_config(clicon_handle h,
|
||||||
* @param[in] op Operation on database item: OP_MERGE, OP_REPLACE
|
* @param[in] op Operation on database item: OP_MERGE, OP_REPLACE
|
||||||
* @param[in] xml XML string. Ex: <config><a>..</a><b>...</b></config>
|
* @param[in] xml XML string. Ex: <config><a>..</a><b>...</b></config>
|
||||||
* @retval 0 OK
|
* @retval 0 OK
|
||||||
* @retval -1 Error
|
* @retval -1 Error and logged to syslog
|
||||||
* @note xml arg need to have <config> as top element
|
* @note xml arg need to have <config> as top element
|
||||||
* @code
|
* @code
|
||||||
* if (clicon_rpc_edit_config(h, "running", OP_MERGE,
|
* if (clicon_rpc_edit_config(h, "running", OP_MERGE,
|
||||||
|
|
@ -322,10 +328,14 @@ clicon_rpc_edit_config(clicon_handle h,
|
||||||
cbuf *cb = NULL;
|
cbuf *cb = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((cb = cbuf_new()) == NULL)
|
if ((cb = cbuf_new()) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
cprintf(cb, "<rpc><edit-config><target><%s/></target>", db);
|
cprintf(cb, "<rpc");
|
||||||
|
if ((username = clicon_username_get(h)) != NULL)
|
||||||
|
cprintf(cb, " username=\"%s\"", username);
|
||||||
|
cprintf(cb, "><edit-config><target><%s/></target>", db);
|
||||||
cprintf(cb, "<default-operation>%s</default-operation>",
|
cprintf(cb, "<default-operation>%s</default-operation>",
|
||||||
xml_operation2str(op));
|
xml_operation2str(op));
|
||||||
if (xmlstr)
|
if (xmlstr)
|
||||||
|
|
@ -356,6 +366,8 @@ clicon_rpc_edit_config(clicon_handle h,
|
||||||
* @param[in] h CLICON handle
|
* @param[in] h CLICON handle
|
||||||
* @param[in] db1 src database, eg "running"
|
* @param[in] db1 src database, eg "running"
|
||||||
* @param[in] db2 dst database, eg "startup"
|
* @param[in] db2 dst database, eg "startup"
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
* @code
|
* @code
|
||||||
* if (clicon_rpc_copy_config(h, "running", "startup") < 0)
|
* if (clicon_rpc_copy_config(h, "running", "startup") < 0)
|
||||||
* err;
|
* err;
|
||||||
|
|
@ -370,8 +382,12 @@ clicon_rpc_copy_config(clicon_handle h,
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><copy-config><source><%s/></source><target><%s/></target></copy-config></rpc>", db1, db2)) == NULL)
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><copy-config><source><%s/></source><target><%s/></target></copy-config></rpc>",
|
||||||
|
username?username:"",
|
||||||
|
db1, db2)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -391,6 +407,8 @@ clicon_rpc_copy_config(clicon_handle h,
|
||||||
/*! Send a request to backend to delete a config database
|
/*! Send a request to backend to delete a config database
|
||||||
* @param[in] h CLICON handle
|
* @param[in] h CLICON handle
|
||||||
* @param[in] db database, eg "running"
|
* @param[in] db database, eg "running"
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
* @code
|
* @code
|
||||||
* if (clicon_rpc_delete_config(h, "startup") < 0)
|
* if (clicon_rpc_delete_config(h, "startup") < 0)
|
||||||
* err;
|
* err;
|
||||||
|
|
@ -404,8 +422,11 @@ clicon_rpc_delete_config(clicon_handle h,
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><delete-config><target><%s/></target></delete-config></rpc>", db)) == NULL)
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><delete-config><target><%s/></target></delete-config></rpc>",
|
||||||
|
username?username:"", db)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -425,6 +446,8 @@ clicon_rpc_delete_config(clicon_handle h,
|
||||||
/*! Lock a database
|
/*! Lock a database
|
||||||
* @param[in] h CLICON handle
|
* @param[in] h CLICON handle
|
||||||
* @param[in] db database, eg "running"
|
* @param[in] db database, eg "running"
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
clicon_rpc_lock(clicon_handle h,
|
clicon_rpc_lock(clicon_handle h,
|
||||||
|
|
@ -434,8 +457,11 @@ clicon_rpc_lock(clicon_handle h,
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><lock><target><%s/></target></lock></rpc>", db)) == NULL)
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><lock><target><%s/></target></lock></rpc>",
|
||||||
|
username?username:"", db)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -455,6 +481,8 @@ clicon_rpc_lock(clicon_handle h,
|
||||||
/*! Unlock a database
|
/*! Unlock a database
|
||||||
* @param[in] h CLICON handle
|
* @param[in] h CLICON handle
|
||||||
* @param[in] db database, eg "running"
|
* @param[in] db database, eg "running"
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
clicon_rpc_unlock(clicon_handle h,
|
clicon_rpc_unlock(clicon_handle h,
|
||||||
|
|
@ -464,8 +492,10 @@ clicon_rpc_unlock(clicon_handle h,
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><unlock><target><%s/></target></unlock></rpc>", db)) == NULL)
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><unlock><target><%s/></target></unlock></rpc>", username?username:"", db)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -512,10 +542,14 @@ clicon_rpc_get(clicon_handle h,
|
||||||
cbuf *cb = NULL;
|
cbuf *cb = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xd;
|
cxobj *xd;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((cb = cbuf_new()) == NULL)
|
if ((cb = cbuf_new()) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
cprintf(cb, "<rpc><get>");
|
cprintf(cb, "<rpc");
|
||||||
|
if ((username = clicon_username_get(h)) != NULL)
|
||||||
|
cprintf(cb, " username=\"%s\"", username);
|
||||||
|
cprintf(cb, "><get>");
|
||||||
if (xpath && strlen(xpath))
|
if (xpath && strlen(xpath))
|
||||||
cprintf(cb, "<filter type=\"xpath\" select=\"%s\"/>", xpath);
|
cprintf(cb, "<filter type=\"xpath\" select=\"%s\"/>", xpath);
|
||||||
cprintf(cb, "</get></rpc>");
|
cprintf(cb, "</get></rpc>");
|
||||||
|
|
@ -547,6 +581,8 @@ clicon_rpc_get(clicon_handle h,
|
||||||
|
|
||||||
/*! Close a (user) session
|
/*! Close a (user) session
|
||||||
* @param[in] h CLICON handle
|
* @param[in] h CLICON handle
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
clicon_rpc_close_session(clicon_handle h)
|
clicon_rpc_close_session(clicon_handle h)
|
||||||
|
|
@ -555,8 +591,11 @@ clicon_rpc_close_session(clicon_handle h)
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><close-session/></rpc>")) == NULL)
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><close-session/></rpc>",
|
||||||
|
username?username:"")) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -576,6 +615,8 @@ clicon_rpc_close_session(clicon_handle h)
|
||||||
/*! Kill other user sessions
|
/*! Kill other user sessions
|
||||||
* @param[in] h CLICON handle
|
* @param[in] h CLICON handle
|
||||||
* @param[in] session_id Session id of other user session
|
* @param[in] session_id Session id of other user session
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
clicon_rpc_kill_session(clicon_handle h,
|
clicon_rpc_kill_session(clicon_handle h,
|
||||||
|
|
@ -585,8 +626,11 @@ clicon_rpc_kill_session(clicon_handle h,
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><kill-session><session-id>%d</session-id></kill-session></rpc>", session_id)) == NULL)
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><kill-session><session-id>%d</session-id></kill-session></rpc>",
|
||||||
|
username?username:"", session_id)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -607,6 +651,7 @@ clicon_rpc_kill_session(clicon_handle h,
|
||||||
* @param[in] h CLICON handle
|
* @param[in] h CLICON handle
|
||||||
* @param[in] db Name of database
|
* @param[in] db Name of database
|
||||||
* @retval 0 OK
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
clicon_rpc_validate(clicon_handle h,
|
clicon_rpc_validate(clicon_handle h,
|
||||||
|
|
@ -616,8 +661,10 @@ clicon_rpc_validate(clicon_handle h,
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><validate><source><%s/></source></validate></rpc>", db)) == NULL)
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><validate><source><%s/></source></validate></rpc>", username?username:"", db)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -637,6 +684,7 @@ clicon_rpc_validate(clicon_handle h,
|
||||||
/*! Commit changes send a commit request to backend daemon
|
/*! Commit changes send a commit request to backend daemon
|
||||||
* @param[in] h CLICON handle
|
* @param[in] h CLICON handle
|
||||||
* @retval 0 OK
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
clicon_rpc_commit(clicon_handle h)
|
clicon_rpc_commit(clicon_handle h)
|
||||||
|
|
@ -645,8 +693,10 @@ clicon_rpc_commit(clicon_handle h)
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><commit/></rpc>")) == NULL)
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><commit/></rpc>", username?username:"")) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -666,6 +716,7 @@ clicon_rpc_commit(clicon_handle h)
|
||||||
/*! Discard all changes in candidate / revert to running
|
/*! Discard all changes in candidate / revert to running
|
||||||
* @param[in] h CLICON handle
|
* @param[in] h CLICON handle
|
||||||
* @retval 0 OK
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
clicon_rpc_discard_changes(clicon_handle h)
|
clicon_rpc_discard_changes(clicon_handle h)
|
||||||
|
|
@ -674,8 +725,10 @@ clicon_rpc_discard_changes(clicon_handle h)
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><discard-changes/></rpc>")) == NULL)
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><discard-changes/></rpc>", username?username:"")) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -697,6 +750,9 @@ clicon_rpc_discard_changes(clicon_handle h)
|
||||||
* @param{in] stream name of notificatio/log stream (CLICON is predefined)
|
* @param{in] stream name of notificatio/log stream (CLICON is predefined)
|
||||||
* @param{in] filter message filter, eg xpath for xml notifications
|
* @param{in] filter message filter, eg xpath for xml notifications
|
||||||
* @param[out] s0 socket returned where notification mesages will appear
|
* @param[out] s0 socket returned where notification mesages will appear
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
|
|
||||||
* @note When using netconf create-subsrciption,status and format is not supported
|
* @note When using netconf create-subsrciption,status and format is not supported
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
|
|
@ -709,11 +765,14 @@ clicon_rpc_create_subscription(clicon_handle h,
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><create-subscription>"
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><create-subscription>"
|
||||||
"<stream>%s</stream>"
|
"<stream>%s</stream>"
|
||||||
"<filter>%s</filter>"
|
"<filter>%s</filter>"
|
||||||
"</create-subscription></rpc>",
|
"</create-subscription></rpc>",
|
||||||
|
username?username:"",
|
||||||
stream?stream:"", filter?filter:"")) == NULL)
|
stream?stream:"", filter?filter:"")) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, s0) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, s0) < 0)
|
||||||
|
|
@ -734,6 +793,8 @@ clicon_rpc_create_subscription(clicon_handle h,
|
||||||
/*! Send a debug request to backend server
|
/*! Send a debug request to backend server
|
||||||
* @param[in] h CLICON handle
|
* @param[in] h CLICON handle
|
||||||
* @param[in] level Debug level
|
* @param[in] level Debug level
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error and logged to syslog
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
clicon_rpc_debug(clicon_handle h,
|
clicon_rpc_debug(clicon_handle h,
|
||||||
|
|
@ -743,8 +804,10 @@ clicon_rpc_debug(clicon_handle h,
|
||||||
struct clicon_msg *msg = NULL;
|
struct clicon_msg *msg = NULL;
|
||||||
cxobj *xret = NULL;
|
cxobj *xret = NULL;
|
||||||
cxobj *xerr;
|
cxobj *xerr;
|
||||||
|
char *username;
|
||||||
|
|
||||||
if ((msg = clicon_msg_encode("<rpc><debug><level>%d</level></debug></rpc>", level)) == NULL)
|
username = clicon_username_get(h);
|
||||||
|
if ((msg = clicon_msg_encode("<rpc username=\"%s\"><debug><level>%d</level></debug></rpc>", username?username:"", level)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
if (clicon_rpc_msg(h, msg, &xret, NULL) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
|
||||||
|
|
@ -140,7 +140,7 @@ clicon_strjoin(int argc,
|
||||||
}
|
}
|
||||||
|
|
||||||
static int
|
static int
|
||||||
unreserved(unsigned char in)
|
uri_unreserved(unsigned char in)
|
||||||
{
|
{
|
||||||
switch(in) {
|
switch(in) {
|
||||||
case '0': case '1': case '2': case '3': case '4':
|
case '0': case '1': case '2': case '3': case '4':
|
||||||
|
|
@ -163,11 +163,17 @@ unreserved(unsigned char in)
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Percent encoding according to RFC 3896
|
/*! Percent encoding according to RFC 3986 URI Syntax
|
||||||
* @param[out] esc Deallocate with free()
|
* @param[in] str Not-encoded input string
|
||||||
|
* @param[out] escp Encoded/escaped malloced output string
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error
|
||||||
|
* @see RFC 3986 Uniform Resource Identifier (URI): Generic Syntax
|
||||||
|
* @see uri_percent_decode
|
||||||
|
* @see xml_chardata_encode
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
percent_encode(char *str,
|
uri_percent_encode(char *str,
|
||||||
char **escp)
|
char **escp)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
|
|
@ -184,7 +190,7 @@ percent_encode(char *str,
|
||||||
memset(esc, 0, len);
|
memset(esc, 0, len);
|
||||||
j = 0;
|
j = 0;
|
||||||
for (i=0; i<strlen(str); i++){
|
for (i=0; i<strlen(str); i++){
|
||||||
if (unreserved(str[i]))
|
if (uri_unreserved(str[i]))
|
||||||
esc[j++] = str[i];
|
esc[j++] = str[i];
|
||||||
else{
|
else{
|
||||||
snprintf(&esc[j], 4, "%%%02X", str[i]&0xff);
|
snprintf(&esc[j], 4, "%%%02X", str[i]&0xff);
|
||||||
|
|
@ -199,11 +205,16 @@ percent_encode(char *str,
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Percent decoding according to RFC 3896
|
/*! Percent decoding according to RFC 3986 URI Syntax
|
||||||
* @param[out] str Deallocate with free()
|
* @param[in] esc Escaped/encoded input string
|
||||||
|
* @param[out] strp Decoded malloced output string. Deallocate with free()
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error
|
||||||
|
* @see RFC 3986 Uniform Resource Identifier (URI): Generic Syntax
|
||||||
|
* @see uri_percent_encode
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
percent_decode(char *esc,
|
uri_percent_decode(char *esc,
|
||||||
char **strp)
|
char **strp)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
|
|
@ -243,6 +254,98 @@ percent_decode(char *esc,
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*! Escape characters according to XML definition
|
||||||
|
* @param[in] str Not-encoded input string
|
||||||
|
* @param[out] escp Encoded/escaped malloced output string
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error
|
||||||
|
* @see https://www.w3.org/TR/2008/REC-xml-20081126/#syntax chapter 2.6
|
||||||
|
* @see uri_percent_encode
|
||||||
|
* @see AMPERSAND mode in clixon_xml_parse.l
|
||||||
|
* @code
|
||||||
|
* char *encstr = NULL;
|
||||||
|
* char *val = "a<>b";
|
||||||
|
* if (xml_chardata_encode(str, &encstr) < 0)
|
||||||
|
* err;
|
||||||
|
* if (encstr)
|
||||||
|
* free(encstr);
|
||||||
|
* @endcode
|
||||||
|
* Essentially encode as follows:
|
||||||
|
* & -> "& " must
|
||||||
|
* < -> "< " must
|
||||||
|
* > -> "> " must for backward compatibility
|
||||||
|
* ' -> "' " may
|
||||||
|
* ' -> "" " may
|
||||||
|
* Optionally >
|
||||||
|
*/
|
||||||
|
int
|
||||||
|
xml_chardata_encode(char *str,
|
||||||
|
char **escp)
|
||||||
|
{
|
||||||
|
int retval = -1;
|
||||||
|
char *esc = NULL;
|
||||||
|
int l;
|
||||||
|
int len;
|
||||||
|
int i, j;
|
||||||
|
|
||||||
|
len = 0;
|
||||||
|
for (i=0; i<strlen(str); i++){
|
||||||
|
switch (str[i]){
|
||||||
|
case '&':
|
||||||
|
len += strlen("& ");
|
||||||
|
break;
|
||||||
|
case '<':
|
||||||
|
len += strlen("< ");
|
||||||
|
break;
|
||||||
|
case '>':
|
||||||
|
len += strlen("> ");
|
||||||
|
break;
|
||||||
|
default:
|
||||||
|
len++;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
len++; /* trailing \0 */
|
||||||
|
if ((esc = malloc(len)) == NULL){
|
||||||
|
clicon_err(OE_UNIX, errno, "malloc");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
memset(esc, 0, len);
|
||||||
|
j = 0;
|
||||||
|
for (i=0; i<strlen(str); i++){
|
||||||
|
switch (str[i]){
|
||||||
|
case '&':
|
||||||
|
if ((l=snprintf(&esc[j], 7, "& ")) < 0){
|
||||||
|
clicon_err(OE_UNIX, errno, "snprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
j += l;
|
||||||
|
break;
|
||||||
|
case '<':
|
||||||
|
if ((l=snprintf(&esc[j], 6, "< ")) < 0){
|
||||||
|
clicon_err(OE_UNIX, errno, "snprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
j += l;
|
||||||
|
break;
|
||||||
|
case '>':
|
||||||
|
if ((l=snprintf(&esc[j], 6, "> ")) < 0){
|
||||||
|
clicon_err(OE_UNIX, errno, "snprintf");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
j += l;
|
||||||
|
break;
|
||||||
|
default:
|
||||||
|
esc[j++] = str[i];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
*escp = esc;
|
||||||
|
retval = 0;
|
||||||
|
done:
|
||||||
|
if (retval < 0 && esc)
|
||||||
|
free(esc);
|
||||||
|
return retval;
|
||||||
|
}
|
||||||
|
|
||||||
/*! Split a string into a cligen variable vector using 1st and 2nd delimiter
|
/*! Split a string into a cligen variable vector using 1st and 2nd delimiter
|
||||||
* Split a string first into elements delimited by delim1, then into
|
* Split a string first into elements delimited by delim1, then into
|
||||||
* pairs delimited by delim2.
|
* pairs delimited by delim2.
|
||||||
|
|
@ -295,7 +398,7 @@ str2cvec(char *string,
|
||||||
*(snext++) = '\0';
|
*(snext++) = '\0';
|
||||||
if ((val = index(s, delim2)) != NULL){
|
if ((val = index(s, delim2)) != NULL){
|
||||||
*(val++) = '\0';
|
*(val++) = '\0';
|
||||||
if (percent_decode(val, &valu) < 0)
|
if (uri_percent_decode(val, &valu) < 0)
|
||||||
goto err;
|
goto err;
|
||||||
if ((cv = cvec_add(cvv, CGV_STRING)) == NULL){
|
if ((cv = cvec_add(cvv, CGV_STRING)) == NULL){
|
||||||
clicon_err(OE_UNIX, errno, "cvec_add");
|
clicon_err(OE_UNIX, errno, "cvec_add");
|
||||||
|
|
|
||||||
|
|
@ -57,7 +57,6 @@
|
||||||
#include "clixon_err.h"
|
#include "clixon_err.h"
|
||||||
#include "clixon_log.h"
|
#include "clixon_log.h"
|
||||||
#include "clixon_string.h"
|
#include "clixon_string.h"
|
||||||
|
|
||||||
#include "clixon_queue.h"
|
#include "clixon_queue.h"
|
||||||
#include "clixon_hash.h"
|
#include "clixon_hash.h"
|
||||||
#include "clixon_handle.h"
|
#include "clixon_handle.h"
|
||||||
|
|
@ -165,7 +164,7 @@ xml_name_set(cxobj *xn,
|
||||||
}
|
}
|
||||||
if (name){
|
if (name){
|
||||||
if ((xn->x_name = strdup(name)) == NULL){
|
if ((xn->x_name = strdup(name)) == NULL){
|
||||||
clicon_err(OE_XML, errno, "%s: strdup", __FUNCTION__);
|
clicon_err(OE_XML, errno, "strdup");
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
@ -198,7 +197,7 @@ xml_namespace_set(cxobj *xn,
|
||||||
}
|
}
|
||||||
if (namespace){
|
if (namespace){
|
||||||
if ((xn->x_namespace = strdup(namespace)) == NULL){
|
if ((xn->x_namespace = strdup(namespace)) == NULL){
|
||||||
clicon_err(OE_XML, errno, "%s: strdup", __FUNCTION__);
|
clicon_err(OE_XML, errno, "strdup");
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
@ -289,7 +288,7 @@ xml_value_set(cxobj *xn,
|
||||||
}
|
}
|
||||||
if (val){
|
if (val){
|
||||||
if ((xn->x_value = strdup(val)) == NULL){
|
if ((xn->x_value = strdup(val)) == NULL){
|
||||||
clicon_err(OE_XML, errno, "%s: strdup", __FUNCTION__);
|
clicon_err(OE_XML, errno, "strdup");
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
@ -434,7 +433,7 @@ xml_child_i_set(cxobj *xt,
|
||||||
|
|
||||||
/*! Iterator over xml children objects
|
/*! Iterator over xml children objects
|
||||||
*
|
*
|
||||||
* NOTE: Never manipulate the child-list during operation or using the
|
* @note Never manipulate the child-list during operation or using the
|
||||||
* same object recursively, the function uses an internal field to remember the
|
* same object recursively, the function uses an internal field to remember the
|
||||||
* index used. It works as long as the same object is not iterated concurrently.
|
* index used. It works as long as the same object is not iterated concurrently.
|
||||||
*
|
*
|
||||||
|
|
@ -481,7 +480,7 @@ xml_child_append(cxobj *x,
|
||||||
x->x_childvec_len++;
|
x->x_childvec_len++;
|
||||||
x->x_childvec = realloc(x->x_childvec, x->x_childvec_len*sizeof(cxobj*));
|
x->x_childvec = realloc(x->x_childvec, x->x_childvec_len*sizeof(cxobj*));
|
||||||
if (x->x_childvec == NULL){
|
if (x->x_childvec == NULL){
|
||||||
clicon_err(OE_XML, errno, "%s: realloc", __FUNCTION__);
|
clicon_err(OE_XML, errno, "realloc");
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
x->x_childvec[x->x_childvec_len-1] = xc;
|
x->x_childvec[x->x_childvec_len-1] = xc;
|
||||||
|
|
@ -539,7 +538,7 @@ xml_new(char *name,
|
||||||
cxobj *x;
|
cxobj *x;
|
||||||
|
|
||||||
if ((x = malloc(sizeof(cxobj))) == NULL){
|
if ((x = malloc(sizeof(cxobj))) == NULL){
|
||||||
clicon_err(OE_XML, errno, "%s: malloc", __FUNCTION__);
|
clicon_err(OE_XML, errno, "malloc");
|
||||||
return NULL;
|
return NULL;
|
||||||
}
|
}
|
||||||
memset(x, 0, sizeof(cxobj));
|
memset(x, 0, sizeof(cxobj));
|
||||||
|
|
@ -951,7 +950,7 @@ xml_free(cxobj *x)
|
||||||
* XML printing functions. Output a parse tree to file, string cligen buf
|
* XML printing functions. Output a parse tree to file, string cligen buf
|
||||||
*------------------------------------------------------------------------*/
|
*------------------------------------------------------------------------*/
|
||||||
|
|
||||||
/*! Print an XML tree structure to an output stream
|
/*! Print an XML tree structure to an output stream and encode chars "<>&"
|
||||||
*
|
*
|
||||||
* Uses clicon_xml2cbuf internally
|
* Uses clicon_xml2cbuf internally
|
||||||
*
|
*
|
||||||
|
|
@ -976,13 +975,17 @@ clicon_xml2file(FILE *f,
|
||||||
int hasbody;
|
int hasbody;
|
||||||
int haselement;
|
int haselement;
|
||||||
char *val;
|
char *val;
|
||||||
|
char *encstr = NULL; /* xml encoded string */
|
||||||
|
|
||||||
name = xml_name(x);
|
name = xml_name(x);
|
||||||
namespace = xml_namespace(x);
|
namespace = xml_namespace(x);
|
||||||
switch(xml_type(x)){
|
switch(xml_type(x)){
|
||||||
case CX_BODY:
|
case CX_BODY:
|
||||||
if ((val = xml_value(x)) != NULL) /* incomplete tree */
|
if ((val = xml_value(x)) == NULL) /* incomplete tree */
|
||||||
fprintf(f, "%s", xml_value(x));
|
break;
|
||||||
|
if (xml_chardata_encode(val, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
fprintf(f, "%s", encstr);
|
||||||
break;
|
break;
|
||||||
case CX_ATTR:
|
case CX_ATTR:
|
||||||
fprintf(f, " ");
|
fprintf(f, " ");
|
||||||
|
|
@ -1045,6 +1048,8 @@ clicon_xml2file(FILE *f,
|
||||||
}/* switch */
|
}/* switch */
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
@ -1064,8 +1069,7 @@ xml_print(FILE *f,
|
||||||
return clicon_xml2file(f, xn, 0, 1);
|
return clicon_xml2file(f, xn, 0, 1);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/*! Print an XML tree structure to a cligen buffer and encode chars "<>&"
|
||||||
/*! Print an XML tree structure to a cligen buffer
|
|
||||||
*
|
*
|
||||||
* @param[in,out] cb Cligen buffer to write to
|
* @param[in,out] cb Cligen buffer to write to
|
||||||
* @param[in] xn Clicon xml tree
|
* @param[in] xn Clicon xml tree
|
||||||
|
|
@ -1094,12 +1098,18 @@ clicon_xml2cbuf(cbuf *cb,
|
||||||
int hasbody;
|
int hasbody;
|
||||||
int haselement;
|
int haselement;
|
||||||
char *namespace;
|
char *namespace;
|
||||||
|
char *encstr = NULL; /* xml encoded string */
|
||||||
|
char *val;
|
||||||
|
|
||||||
name = xml_name(x);
|
name = xml_name(x);
|
||||||
namespace = xml_namespace(x);
|
namespace = xml_namespace(x);
|
||||||
switch(xml_type(x)){
|
switch(xml_type(x)){
|
||||||
case CX_BODY:
|
case CX_BODY:
|
||||||
cprintf(cb, "%s", xml_value(x));
|
if ((val = xml_value(x)) == NULL) /* incomplete tree */
|
||||||
|
break;
|
||||||
|
if (xml_chardata_encode(val, &encstr) < 0)
|
||||||
|
goto done;
|
||||||
|
cprintf(cb, "%s", encstr);
|
||||||
break;
|
break;
|
||||||
case CX_ATTR:
|
case CX_ATTR:
|
||||||
cprintf(cb, " ");
|
cprintf(cb, " ");
|
||||||
|
|
@ -1131,7 +1141,6 @@ clicon_xml2cbuf(cbuf *cb,
|
||||||
default:
|
default:
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Check for special case <a/> instead of <a></a> */
|
/* Check for special case <a/> instead of <a></a> */
|
||||||
if (hasbody==0 && haselement==0)
|
if (hasbody==0 && haselement==0)
|
||||||
cprintf(cb, "/>");
|
cprintf(cb, "/>");
|
||||||
|
|
@ -1159,6 +1168,8 @@ clicon_xml2cbuf(cbuf *cb,
|
||||||
}/* switch */
|
}/* switch */
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
if (encstr)
|
||||||
|
free(encstr);
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
/*! Print actual xml tree datastructures (not xml), mainly for debugging
|
/*! Print actual xml tree datastructures (not xml), mainly for debugging
|
||||||
|
|
@ -1303,15 +1314,14 @@ xml_parse_file(int fd,
|
||||||
if (endtag != NULL)
|
if (endtag != NULL)
|
||||||
endtaglen = strlen(endtag);
|
endtaglen = strlen(endtag);
|
||||||
if ((xmlbuf = malloc(xmlbuflen)) == NULL){
|
if ((xmlbuf = malloc(xmlbuflen)) == NULL){
|
||||||
clicon_err(OE_XML, errno, "%s: malloc", __FUNCTION__);
|
clicon_err(OE_XML, errno, "malloc");
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
memset(xmlbuf, 0, xmlbuflen);
|
memset(xmlbuf, 0, xmlbuflen);
|
||||||
ptr = xmlbuf;
|
ptr = xmlbuf;
|
||||||
while (1){
|
while (1){
|
||||||
if ((ret = read(fd, &ch, 1)) < 0){
|
if ((ret = read(fd, &ch, 1)) < 0){
|
||||||
clicon_err(OE_XML, errno, "%s: read: [pid:%d]\n",
|
clicon_err(OE_XML, errno, "read: [pid:%d]\n",
|
||||||
__FUNCTION__,
|
|
||||||
(int)getpid());
|
(int)getpid());
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
|
@ -1334,7 +1344,7 @@ xml_parse_file(int fd,
|
||||||
oldxmlbuflen = xmlbuflen;
|
oldxmlbuflen = xmlbuflen;
|
||||||
xmlbuflen *= 2;
|
xmlbuflen *= 2;
|
||||||
if ((xmlbuf = realloc(xmlbuf, xmlbuflen)) == NULL){
|
if ((xmlbuf = realloc(xmlbuf, xmlbuflen)) == NULL){
|
||||||
clicon_err(OE_XML, errno, "%s: realloc", __FUNCTION__);
|
clicon_err(OE_XML, errno, "realloc");
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
memset(xmlbuf+oldxmlbuflen, 0, xmlbuflen-oldxmlbuflen);
|
memset(xmlbuf+oldxmlbuflen, 0, xmlbuflen-oldxmlbuflen);
|
||||||
|
|
@ -1424,10 +1434,7 @@ xml_parse_va(cxobj **xtop,
|
||||||
va_start(args, format);
|
va_start(args, format);
|
||||||
len = vsnprintf(str, len, format, args) + 1;
|
len = vsnprintf(str, len, format, args) + 1;
|
||||||
va_end(args);
|
va_end(args);
|
||||||
if (*xtop == NULL)
|
if (xml_parse_string(str, yspec, xtop) < 0)
|
||||||
if ((*xtop = xml_new(XML_TOP_SYMBOL, NULL, NULL)) == NULL)
|
|
||||||
goto done;
|
|
||||||
if (_xml_parse(str, yspec, *xtop) < 0)
|
|
||||||
goto done;
|
goto done;
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
|
@ -1447,7 +1454,7 @@ xml_copy_one(cxobj *x0,
|
||||||
xml_type_set(x1, xml_type(x0));
|
xml_type_set(x1, xml_type(x0));
|
||||||
if (xml_value(x0)){ /* malloced string */
|
if (xml_value(x0)){ /* malloced string */
|
||||||
if ((x1->x_value = strdup(x0->x_value)) == NULL){
|
if ((x1->x_value = strdup(x0->x_value)) == NULL){
|
||||||
clicon_err(OE_XML, errno, "%s: strdup", __FUNCTION__);
|
clicon_err(OE_XML, errno, "strdup");
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
@ -1456,7 +1463,7 @@ xml_copy_one(cxobj *x0,
|
||||||
return -1;
|
return -1;
|
||||||
if (xml_cv_get(x0)){
|
if (xml_cv_get(x0)){
|
||||||
if ((cv1 = cv_dup(xml_cv_get(x0))) == NULL){
|
if ((cv1 = cv_dup(xml_cv_get(x0))) == NULL){
|
||||||
clicon_err(OE_XML, errno, "%s: cv_dup", __FUNCTION__);
|
clicon_err(OE_XML, errno, "cv_dup");
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
if ((xml_cv_set(x1, cv1)) < 0)
|
if ((xml_cv_set(x1, cv1)) < 0)
|
||||||
|
|
@ -1553,7 +1560,7 @@ cxvec_append(cxobj *x,
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
|
|
||||||
if ((*vec = realloc(*vec, sizeof(cxobj *) * (*len+1))) == NULL){
|
if ((*vec = realloc(*vec, sizeof(cxobj *) * (*len+1))) == NULL){
|
||||||
clicon_err(OE_XML, errno, "%s: realloc", __FUNCTION__);
|
clicon_err(OE_XML, errno, "realloc");
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
(*vec)[(*len)++] = x;
|
(*vec)[(*len)++] = x;
|
||||||
|
|
|
||||||
|
|
@ -43,9 +43,11 @@
|
||||||
#include <fcntl.h>
|
#include <fcntl.h>
|
||||||
#include <time.h>
|
#include <time.h>
|
||||||
#include <signal.h>
|
#include <signal.h>
|
||||||
|
#include <libgen.h>
|
||||||
#include <sys/time.h>
|
#include <sys/time.h>
|
||||||
#include <sys/wait.h>
|
#include <sys/wait.h>
|
||||||
#include <libgen.h>
|
#include <sys/param.h>
|
||||||
|
|
||||||
|
|
||||||
/* cligen */
|
/* cligen */
|
||||||
#include <cligen/cligen.h>
|
#include <cligen/cligen.h>
|
||||||
|
|
@ -322,7 +324,7 @@ xmldb_setopt(clicon_handle h,
|
||||||
* @param[in] dbname Name of database to search in (filename including dir path
|
* @param[in] dbname Name of database to search in (filename including dir path
|
||||||
* @param[in] xpath String with XPATH syntax. or NULL for all
|
* @param[in] xpath String with XPATH syntax. or NULL for all
|
||||||
* @param[in] config If set only configuration data, else also state
|
* @param[in] config If set only configuration data, else also state
|
||||||
* @param[out] xtop Single XML tree. Free with xml_free()
|
* @param[out] xret Single return XML tree. Free with xml_free()
|
||||||
* @retval 0 OK
|
* @retval 0 OK
|
||||||
* @retval -1 Error
|
* @retval -1 Error
|
||||||
* @code
|
* @code
|
||||||
|
|
@ -339,7 +341,7 @@ xmldb_get(clicon_handle h,
|
||||||
const char *db,
|
const char *db,
|
||||||
char *xpath,
|
char *xpath,
|
||||||
int config,
|
int config,
|
||||||
cxobj **xtop)
|
cxobj **xret)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
xmldb_handle xh;
|
xmldb_handle xh;
|
||||||
|
|
@ -357,11 +359,11 @@ xmldb_get(clicon_handle h,
|
||||||
clicon_err(OE_DB, 0, "Not connected to datastore plugin");
|
clicon_err(OE_DB, 0, "Not connected to datastore plugin");
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
retval = xa->xa_get_fn(xh, db, xpath, config, xtop);
|
retval = xa->xa_get_fn(xh, db, xpath, config, xret);
|
||||||
#if DEBUG
|
#if DEBUG
|
||||||
if (retval == 0) {
|
if (retval == 0) {
|
||||||
cbuf *cb = cbuf_new();
|
cbuf *cb = cbuf_new();
|
||||||
clicon_xml2cbuf(cb, *xtop, 0, 0);
|
clicon_xml2cbuf(cb, *xret, 0, 0);
|
||||||
clicon_log(LOG_WARNING, "%s: db:%s xpath:%s xml:%s",
|
clicon_log(LOG_WARNING, "%s: db:%s xpath:%s xml:%s",
|
||||||
__FUNCTION__, db, xpath, cbuf_get(cb));
|
__FUNCTION__, db, xpath, cbuf_get(cb));
|
||||||
cbuf_free(cb);
|
cbuf_free(cb);
|
||||||
|
|
@ -377,25 +379,29 @@ xmldb_get(clicon_handle h,
|
||||||
* @param[in] db running or candidate
|
* @param[in] db running or candidate
|
||||||
* @param[in] op Top-level operation, can be superceded by other op in tree
|
* @param[in] op Top-level operation, can be superceded by other op in tree
|
||||||
* @param[in] xt xml-tree. Top-level symbol is dummy
|
* @param[in] xt xml-tree. Top-level symbol is dummy
|
||||||
|
* @param[out] cbret Initialized cligen buffer or NULL. On exit contains XML or "".
|
||||||
* @retval 0 OK
|
* @retval 0 OK
|
||||||
* @retval -1 Error
|
* @retval -1 Error
|
||||||
* The xml may contain the "operation" attribute which defines the operation.
|
* The xml may contain the "operation" attribute which defines the operation.
|
||||||
* @code
|
* @code
|
||||||
* cxobj *xt;
|
* cxobj *xt;
|
||||||
|
* cxobj *xret = NULL;
|
||||||
* if (xml_parse_string("<a>17</a>", yspec, &xt) < 0)
|
* if (xml_parse_string("<a>17</a>", yspec, &xt) < 0)
|
||||||
* err;
|
* err;
|
||||||
* if (xmldb_put(xh, "running", OP_MERGE, xt) < 0)
|
* if (xmldb_put(xh, "running", OP_MERGE, xt, cbret) < 0)
|
||||||
* err;
|
* err;
|
||||||
* @endcode
|
* @endcode
|
||||||
* @note that you can add both config data and state data. In comparison,
|
* @note that you can add both config data and state data. In comparison,
|
||||||
* xmldb_get has a parameter to get config data only.
|
* xmldb_get has a parameter to get config data only.
|
||||||
|
* @note if xret is non-null, it may contain error message
|
||||||
*
|
*
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
xmldb_put(clicon_handle h,
|
xmldb_put(clicon_handle h,
|
||||||
const char *db,
|
const char *db,
|
||||||
enum operation_type op,
|
enum operation_type op,
|
||||||
cxobj *xt)
|
cxobj *xt,
|
||||||
|
cbuf *cbret)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
xmldb_handle xh;
|
xmldb_handle xh;
|
||||||
|
|
@ -425,7 +431,7 @@ xmldb_put(clicon_handle h,
|
||||||
cbuf_free(cb);
|
cbuf_free(cb);
|
||||||
}
|
}
|
||||||
#endif
|
#endif
|
||||||
retval = xa->xa_put_fn(xh, db, op, xt);
|
retval = xa->xa_put_fn(xh, db, op, xt, cbret);
|
||||||
done:
|
done:
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
|
||||||
|
|
@ -61,10 +61,11 @@
|
||||||
#include <errno.h>
|
#include <errno.h>
|
||||||
#include <ctype.h>
|
#include <ctype.h>
|
||||||
#include <string.h>
|
#include <string.h>
|
||||||
#include <arpa/inet.h>
|
|
||||||
#include <assert.h>
|
|
||||||
#include <syslog.h>
|
#include <syslog.h>
|
||||||
#include <fcntl.h>
|
#include <fcntl.h>
|
||||||
|
#include <assert.h>
|
||||||
|
#include <arpa/inet.h>
|
||||||
|
#include <sys/param.h>
|
||||||
#include <netinet/in.h>
|
#include <netinet/in.h>
|
||||||
|
|
||||||
/* cligen */
|
/* cligen */
|
||||||
|
|
@ -79,28 +80,15 @@
|
||||||
#include "clixon_string.h"
|
#include "clixon_string.h"
|
||||||
#include "clixon_yang.h"
|
#include "clixon_yang.h"
|
||||||
#include "clixon_yang_type.h"
|
#include "clixon_yang_type.h"
|
||||||
#include "clixon_plugin.h"
|
|
||||||
#include "clixon_options.h"
|
#include "clixon_options.h"
|
||||||
#include "clixon_xml.h"
|
#include "clixon_xml.h"
|
||||||
|
#include "clixon_plugin.h"
|
||||||
#include "clixon_xsl.h"
|
#include "clixon_xsl.h"
|
||||||
#include "clixon_log.h"
|
#include "clixon_log.h"
|
||||||
#include "clixon_err.h"
|
#include "clixon_err.h"
|
||||||
#include "clixon_xml_sort.h"
|
#include "clixon_xml_sort.h"
|
||||||
#include "clixon_xml_map.h"
|
#include "clixon_xml_map.h"
|
||||||
|
|
||||||
/*
|
|
||||||
* A node is a leaf if it contains a body.
|
|
||||||
*/
|
|
||||||
static cxobj *
|
|
||||||
leaf(cxobj *xn)
|
|
||||||
{
|
|
||||||
cxobj *xc = NULL;
|
|
||||||
|
|
||||||
while ((xc = xml_child_each(xn, xc, CX_BODY)) != NULL)
|
|
||||||
break;
|
|
||||||
return xc;
|
|
||||||
}
|
|
||||||
|
|
||||||
/*! x is element and has eactly one child which in turn has none */
|
/*! x is element and has eactly one child which in turn has none */
|
||||||
static int
|
static int
|
||||||
tleaf(cxobj *x)
|
tleaf(cxobj *x)
|
||||||
|
|
@ -117,6 +105,7 @@ tleaf(cxobj *x)
|
||||||
|
|
||||||
/*! Translate XML -> TEXT
|
/*! Translate XML -> TEXT
|
||||||
* @param[in] level print 4 spaces per level in front of each line
|
* @param[in] level print 4 spaces per level in front of each line
|
||||||
|
* XXX rewrite using YANG and remove encrypted password KLUDGE
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
xml2txt(FILE *f,
|
xml2txt(FILE *f,
|
||||||
|
|
@ -127,25 +116,18 @@ xml2txt(FILE *f,
|
||||||
int children=0;
|
int children=0;
|
||||||
char *term = NULL;
|
char *term = NULL;
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
int encr=0;
|
|
||||||
|
|
||||||
xe = NULL; /* count children */
|
xe = NULL; /* count children */
|
||||||
while ((xe = xml_child_each(x, xe, -1)) != NULL)
|
while ((xe = xml_child_each(x, xe, -1)) != NULL)
|
||||||
children++;
|
children++;
|
||||||
if (!children){
|
if (!children){
|
||||||
if (xml_type(x) == CX_BODY){
|
if (xml_type(x) == CX_BODY){
|
||||||
/* Kludge for escaping encrypted passwords */
|
|
||||||
if (strcmp(xml_name(xml_parent(x)), "encrypted-password")==0)
|
|
||||||
encr++;
|
|
||||||
term = xml_value(x);
|
term = xml_value(x);
|
||||||
}
|
}
|
||||||
else{
|
else{
|
||||||
fprintf(f, "%*s", 4*level, "");
|
fprintf(f, "%*s", 4*level, "");
|
||||||
term = xml_name(x);
|
term = xml_name(x);
|
||||||
}
|
}
|
||||||
if (encr)
|
|
||||||
fprintf(f, "\"%s\";\n", term);
|
|
||||||
else
|
|
||||||
fprintf(f, "%s;\n", term);
|
fprintf(f, "%s;\n", term);
|
||||||
retval = 0;
|
retval = 0;
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -183,67 +165,60 @@ xml2cli(FILE *f,
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
cxobj *xe = NULL;
|
cxobj *xe = NULL;
|
||||||
char *term;
|
cbuf *cbpre = NULL;
|
||||||
int bool;
|
yang_stmt *ys;
|
||||||
int nr;
|
int match;
|
||||||
int i;
|
char *body;
|
||||||
cbuf *cbpre;
|
|
||||||
|
|
||||||
|
ys = xml_spec(x);
|
||||||
|
if (ys->ys_keyword == Y_LEAF || ys->ys_keyword == Y_LEAF_LIST){
|
||||||
|
if (prepend0)
|
||||||
|
fprintf(f, "%s", prepend0);
|
||||||
|
body = xml_body(x);
|
||||||
|
if (gt == GT_ALL || gt == GT_VARS)
|
||||||
|
fprintf(f, "%s ", xml_name(x));
|
||||||
|
if (index(body, ' '))
|
||||||
|
fprintf(f, "\"%s\"", body);
|
||||||
|
else
|
||||||
|
fprintf(f, "%s", body);
|
||||||
|
fprintf(f, "\n");
|
||||||
|
goto ok;
|
||||||
|
}
|
||||||
/* Create prepend variable string */
|
/* Create prepend variable string */
|
||||||
if ((cbpre = cbuf_new()) == NULL){
|
if ((cbpre = cbuf_new()) == NULL){
|
||||||
clicon_err(OE_PLUGIN, errno, "cbuf_new");
|
clicon_err(OE_PLUGIN, errno, "cbuf_new");
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
nr = xml_child_nr(x);
|
|
||||||
if (!nr){
|
|
||||||
if (xml_type(x) == CX_BODY)
|
|
||||||
term = xml_value(x);
|
|
||||||
else
|
|
||||||
term = xml_name(x);
|
|
||||||
if (prepend0)
|
|
||||||
fprintf(f, "%s ", prepend0);
|
|
||||||
if (index(term, ' '))
|
|
||||||
fprintf(f, "\"%s\"\n", term);
|
|
||||||
else
|
|
||||||
fprintf(f, "%s\n", term);
|
|
||||||
retval = 0;
|
|
||||||
goto done;
|
|
||||||
}
|
|
||||||
if (prepend0)
|
if (prepend0)
|
||||||
cprintf(cbpre, "%s", prepend0);
|
cprintf(cbpre, "%s", prepend0);
|
||||||
/* bool determines when to print a variable keyword:
|
|
||||||
!leaf T for all (ie parameter)
|
|
||||||
index GT_NONE F
|
|
||||||
index GT_VARS F
|
|
||||||
index GT_ALL T
|
|
||||||
!index GT_NONE F
|
|
||||||
!index GT_VARS T
|
|
||||||
!index GT_ALL T
|
|
||||||
*/
|
|
||||||
bool = !leaf(x) || gt == GT_ALL || (gt == GT_VARS);
|
|
||||||
// bool = (!x->xn_index || gt == GT_ALL);
|
|
||||||
if (bool){
|
|
||||||
if (cbuf_len(cbpre))
|
|
||||||
cprintf(cbpre, " ");
|
|
||||||
cprintf(cbpre, "%s ", xml_name(x));
|
cprintf(cbpre, "%s ", xml_name(x));
|
||||||
}
|
|
||||||
|
if (ys->ys_keyword == Y_LIST){
|
||||||
|
/* If list then first loop through keys */
|
||||||
xe = NULL;
|
xe = NULL;
|
||||||
/* First child is unique, then add that, before looping. */
|
|
||||||
i = 0;
|
|
||||||
while ((xe = xml_child_each(x, xe, -1)) != NULL){
|
while ((xe = xml_child_each(x, xe, -1)) != NULL){
|
||||||
/* Dont call this if it is index and there are other following */
|
if ((match = yang_key_match((yang_node*)ys, xml_name(xe))) < 0)
|
||||||
if (0 && i < nr-1)
|
|
||||||
;
|
|
||||||
else
|
|
||||||
if (xml2cli(f, xe, cbuf_get(cbpre), gt) < 0)
|
|
||||||
goto done;
|
goto done;
|
||||||
if (0){ /* assume index is first, otherwise need one more while */
|
if (!match)
|
||||||
|
continue;
|
||||||
if (gt == GT_ALL)
|
if (gt == GT_ALL)
|
||||||
cprintf(cbpre, "%s ", xml_name(xe));
|
cprintf(cbpre, "%s ", xml_name(xe));
|
||||||
cprintf(cbpre, " %s", xml_value(xml_child_i(xe, 0)));
|
cprintf(cbpre, "%s ", xml_body(xe));
|
||||||
}
|
}
|
||||||
i++;
|
|
||||||
}
|
}
|
||||||
|
/* Then loop through all other (non-keys) */
|
||||||
|
xe = NULL;
|
||||||
|
while ((xe = xml_child_each(x, xe, -1)) != NULL){
|
||||||
|
if (ys->ys_keyword == Y_LIST){
|
||||||
|
if ((match = yang_key_match((yang_node*)ys, xml_name(xe))) < 0)
|
||||||
|
goto done;
|
||||||
|
if (match)
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
if (xml2cli(f, xe, cbuf_get(cbpre), gt) < 0)
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
if (cbpre)
|
if (cbpre)
|
||||||
|
|
@ -268,7 +243,6 @@ validate_leafref(cxobj *xt,
|
||||||
char *leafrefbody;
|
char *leafrefbody;
|
||||||
char *leafbody;
|
char *leafbody;
|
||||||
|
|
||||||
|
|
||||||
if ((leafrefbody = xml_body(xt)) == NULL)
|
if ((leafrefbody = xml_body(xt)) == NULL)
|
||||||
return 0;
|
return 0;
|
||||||
if ((ypath = yang_find((yang_node*)ytype, Y_PATH, NULL)) == NULL){
|
if ((ypath = yang_find((yang_node*)ytype, Y_PATH, NULL)) == NULL){
|
||||||
|
|
@ -316,9 +290,11 @@ xml_yang_validate_add(cxobj *xt,
|
||||||
yang_stmt *ys;
|
yang_stmt *ys;
|
||||||
char *body;
|
char *body;
|
||||||
|
|
||||||
/* if not given by argument (overide) use default link */
|
/* if not given by argument (overide) use default link
|
||||||
if ((ys = xml_spec(xt)) != NULL){
|
and !Node has a config sub-statement and it is false */
|
||||||
|
if ((ys = xml_spec(xt)) != NULL && yang_config(ys) != 0){
|
||||||
switch (ys->ys_keyword){
|
switch (ys->ys_keyword){
|
||||||
|
case Y_INPUT:
|
||||||
case Y_LIST:
|
case Y_LIST:
|
||||||
/* fall thru */
|
/* fall thru */
|
||||||
case Y_CONTAINER:
|
case Y_CONTAINER:
|
||||||
|
|
@ -326,6 +302,8 @@ xml_yang_validate_add(cxobj *xt,
|
||||||
yc = ys->ys_stmt[i];
|
yc = ys->ys_stmt[i];
|
||||||
if (yc->ys_keyword != Y_LEAF)
|
if (yc->ys_keyword != Y_LEAF)
|
||||||
continue;
|
continue;
|
||||||
|
if (yang_config(yc)==0)
|
||||||
|
continue;
|
||||||
if (yang_mandatory(yc) && xml_find(xt, yc->ys_argument)==NULL){
|
if (yang_mandatory(yc) && xml_find(xt, yc->ys_argument)==NULL){
|
||||||
clicon_err(OE_CFG, 0,"Missing mandatory variable: %s",
|
clicon_err(OE_CFG, 0,"Missing mandatory variable: %s",
|
||||||
yc->ys_argument);
|
yc->ys_argument);
|
||||||
|
|
@ -385,8 +363,10 @@ xml_yang_validate_all(cxobj *xt,
|
||||||
yang_stmt *ys;
|
yang_stmt *ys;
|
||||||
yang_stmt *ytype;
|
yang_stmt *ytype;
|
||||||
|
|
||||||
/* if not given by argument (overide) use default link */
|
/* if not given by argument (overide) use default link
|
||||||
if ((ys = xml_spec(xt)) != NULL){
|
and !Node has a config sub-statement and it is false */
|
||||||
|
if ((ys = xml_spec(xt)) != NULL &&
|
||||||
|
yang_config(ys) != 0){
|
||||||
switch (ys->ys_keyword){
|
switch (ys->ys_keyword){
|
||||||
case Y_LEAF:
|
case Y_LEAF:
|
||||||
/* fall thru */
|
/* fall thru */
|
||||||
|
|
@ -587,7 +567,7 @@ yang_next(yang_node *y,
|
||||||
yang_stmt *ys;
|
yang_stmt *ys;
|
||||||
|
|
||||||
if (y->yn_keyword == Y_SPEC)
|
if (y->yn_keyword == Y_SPEC)
|
||||||
ys = yang_find_topnode((yang_spec*)y, name, 0);
|
ys = yang_find_topnode((yang_spec*)y, name, YC_DATANODE);
|
||||||
else
|
else
|
||||||
ys = yang_find_datanode(y, name);
|
ys = yang_find_datanode(y, name);
|
||||||
if (ys == NULL)
|
if (ys == NULL)
|
||||||
|
|
@ -833,7 +813,6 @@ yang2api_path_fmt(yang_stmt *ys,
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
||||||
/*! Transform an xml key format and a vector of values to an XML key
|
/*! Transform an xml key format and a vector of values to an XML key
|
||||||
* Used for actual key, eg in clicon_rpc_change(), xmldb_put_xkey()
|
* Used for actual key, eg in clicon_rpc_change(), xmldb_put_xkey()
|
||||||
* Example:
|
* Example:
|
||||||
|
|
@ -896,7 +875,7 @@ api_path_fmt2api_path(char *api_path_fmt,
|
||||||
clicon_err(OE_UNIX, errno, "cv2str_dup");
|
clicon_err(OE_UNIX, errno, "cv2str_dup");
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
if (percent_encode(str, &strenc) < 0)
|
if (uri_percent_encode(str, &strenc) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
cprintf(cb, "%s", strenc);
|
cprintf(cb, "%s", strenc);
|
||||||
free(strenc); strenc = NULL;
|
free(strenc); strenc = NULL;
|
||||||
|
|
@ -1313,7 +1292,7 @@ xml_spec_populate(cxobj *x,
|
||||||
(yp = xml_spec(xp)) != NULL)
|
(yp = xml_spec(xp)) != NULL)
|
||||||
y = yang_find_datanode((yang_node*)yp, xml_name(x));
|
y = yang_find_datanode((yang_node*)yp, xml_name(x));
|
||||||
else
|
else
|
||||||
y = yang_find_topnode(yspec, name, 0); /* still NULL for config */
|
y = yang_find_topnode(yspec, name, YC_DATANODE); /* still NULL for config */
|
||||||
#endif
|
#endif
|
||||||
if (y)
|
if (y)
|
||||||
xml_spec_set(x, y);
|
xml_spec_set(x, y);
|
||||||
|
|
@ -1367,7 +1346,7 @@ api_path2xpath_cvv(yang_spec *yspec,
|
||||||
clicon_debug(1, "[%d] cvname:%s", i, name);
|
clicon_debug(1, "[%d] cvname:%s", i, name);
|
||||||
clicon_debug(1, "cv2str%d", cv2str(cv, NULL, 0));
|
clicon_debug(1, "cv2str%d", cv2str(cv, NULL, 0));
|
||||||
if (i == offset){
|
if (i == offset){
|
||||||
if ((y = yang_find_topnode(yspec, name, 0)) == NULL){
|
if ((y = yang_find_topnode(yspec, name, YC_DATANODE)) == NULL){
|
||||||
clicon_err(OE_UNIX, errno, "No yang node found: %s", name);
|
clicon_err(OE_UNIX, errno, "No yang node found: %s", name);
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
|
|
@ -1448,7 +1427,7 @@ api_path2xpath(yang_spec *yspec,
|
||||||
* @param[in] nvec Length of vec
|
* @param[in] nvec Length of vec
|
||||||
* @param[in] x0 Xpath tree so far
|
* @param[in] x0 Xpath tree so far
|
||||||
* @param[in] y0 Yang spec for x0
|
* @param[in] y0 Yang spec for x0
|
||||||
* @param[in] schemanode If set use schema nodes otherwise data nodes.
|
* @param[in] nodeclass Set to schema nodes, data nodes, etc
|
||||||
* @param[out] xpathp Resulting xml tree
|
* @param[out] xpathp Resulting xml tree
|
||||||
* @param[out] ypathp Yang spec matching xpathp
|
* @param[out] ypathp Yang spec matching xpathp
|
||||||
* @see api_path2xml
|
* @see api_path2xml
|
||||||
|
|
@ -1458,7 +1437,7 @@ api_path2xml_vec(char **vec,
|
||||||
int nvec,
|
int nvec,
|
||||||
cxobj *x0,
|
cxobj *x0,
|
||||||
yang_node *y0,
|
yang_node *y0,
|
||||||
int schemanode,
|
yang_class nodeclass,
|
||||||
cxobj **xpathp,
|
cxobj **xpathp,
|
||||||
yang_node **ypathp)
|
yang_node **ypathp)
|
||||||
{
|
{
|
||||||
|
|
@ -1490,7 +1469,7 @@ api_path2xml_vec(char **vec,
|
||||||
if ((restval_enc = index(name, '=')) != NULL){
|
if ((restval_enc = index(name, '=')) != NULL){
|
||||||
*restval_enc = '\0';
|
*restval_enc = '\0';
|
||||||
restval_enc++;
|
restval_enc++;
|
||||||
if (percent_decode(restval_enc, &restval) < 0)
|
if (uri_percent_decode(restval_enc, &restval) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
/* Split into prefix and localname, ignore prefix for now */
|
/* Split into prefix and localname, ignore prefix for now */
|
||||||
|
|
@ -1500,10 +1479,10 @@ api_path2xml_vec(char **vec,
|
||||||
name = local;
|
name = local;
|
||||||
}
|
}
|
||||||
if (y0->yn_keyword == Y_SPEC){ /* top-node */
|
if (y0->yn_keyword == Y_SPEC){ /* top-node */
|
||||||
y = yang_find_topnode((yang_spec*)y0, name, schemanode);
|
y = yang_find_topnode((yang_spec*)y0, name, nodeclass);
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
y = schemanode?yang_find_schemanode((yang_node*)y0, name):
|
y = (nodeclass==YC_SCHEMANODE)?yang_find_schemanode((yang_node*)y0, name):
|
||||||
yang_find_datanode((yang_node*)y0, name);
|
yang_find_datanode((yang_node*)y0, name);
|
||||||
}
|
}
|
||||||
if (y == NULL){
|
if (y == NULL){
|
||||||
|
|
@ -1572,7 +1551,7 @@ api_path2xml_vec(char **vec,
|
||||||
}
|
}
|
||||||
if (api_path2xml_vec(vec+1, nvec-1,
|
if (api_path2xml_vec(vec+1, nvec-1,
|
||||||
x, (yang_node*)y,
|
x, (yang_node*)y,
|
||||||
schemanode,
|
nodeclass,
|
||||||
xpathp, ypathp) < 0)
|
xpathp, ypathp) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
retval = 0;
|
retval = 0;
|
||||||
|
|
@ -1588,7 +1567,7 @@ api_path2xml_vec(char **vec,
|
||||||
* @param[in] api_path API-path as defined in RFC 8040
|
* @param[in] api_path API-path as defined in RFC 8040
|
||||||
* @param[in] yspec Yang spec
|
* @param[in] yspec Yang spec
|
||||||
* @param[in,out] xtop Incoming XML tree
|
* @param[in,out] xtop Incoming XML tree
|
||||||
* @param[in] schemanode If set use schema nodes otherwise data nodes.
|
* @param[in] nodeclass Set to schema nodes, data nodes, etc
|
||||||
* @param[out] xbotp Resulting xml tree (end of xpath)
|
* @param[out] xbotp Resulting xml tree (end of xpath)
|
||||||
* @param[out] ybotp Yang spec matching xbotp
|
* @param[out] ybotp Yang spec matching xbotp
|
||||||
* @example
|
* @example
|
||||||
|
|
@ -1605,7 +1584,7 @@ int
|
||||||
api_path2xml(char *api_path,
|
api_path2xml(char *api_path,
|
||||||
yang_spec *yspec,
|
yang_spec *yspec,
|
||||||
cxobj *xtop,
|
cxobj *xtop,
|
||||||
int schemanode,
|
yang_class nodeclass,
|
||||||
cxobj **xbotp,
|
cxobj **xbotp,
|
||||||
yang_node **ybotp)
|
yang_node **ybotp)
|
||||||
{
|
{
|
||||||
|
|
@ -1614,8 +1593,8 @@ api_path2xml(char *api_path,
|
||||||
int nvec;
|
int nvec;
|
||||||
|
|
||||||
if (*api_path!='/'){
|
if (*api_path!='/'){
|
||||||
clicon_err(OE_DB, 0, "Invalid key: %s", api_path);
|
clicon_log(LOG_WARNING, "Invalid key: %s (must start with '/')", api_path);
|
||||||
goto done;
|
goto ok;
|
||||||
}
|
}
|
||||||
if ((vec = clicon_strsep(api_path, "/", &nvec)) == NULL)
|
if ((vec = clicon_strsep(api_path, "/", &nvec)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -1628,9 +1607,10 @@ api_path2xml(char *api_path,
|
||||||
}
|
}
|
||||||
nvec--; /* NULL-terminated */
|
nvec--; /* NULL-terminated */
|
||||||
if (api_path2xml_vec(vec+1, nvec,
|
if (api_path2xml_vec(vec+1, nvec,
|
||||||
xtop, (yang_node*)yspec, schemanode,
|
xtop, (yang_node*)yspec, nodeclass,
|
||||||
xbotp, ybotp) < 0)
|
xbotp, ybotp) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
if (vec)
|
if (vec)
|
||||||
|
|
@ -1643,6 +1623,9 @@ api_path2xml(char *api_path,
|
||||||
* @param[in] y0 Yang spec corresponding to xml-node x0. NULL if x0 is NULL
|
* @param[in] y0 Yang spec corresponding to xml-node x0. NULL if x0 is NULL
|
||||||
* @param[in] x0p Parent of x0
|
* @param[in] x0p Parent of x0
|
||||||
* @param[in] x1 xml tree which modifies base
|
* @param[in] x1 xml tree which modifies base
|
||||||
|
* @param[out] reason If retval=0 a malloced string
|
||||||
|
* @retval 0 OK. If reason is set, Yang error
|
||||||
|
* @retval -1 Error
|
||||||
* Assume x0 and x1 are same on entry and that y is the spec
|
* Assume x0 and x1 are same on entry and that y is the spec
|
||||||
* @see put in clixon_keyvalue.c
|
* @see put in clixon_keyvalue.c
|
||||||
*/
|
*/
|
||||||
|
|
@ -1650,7 +1633,8 @@ static int
|
||||||
xml_merge1(cxobj *x0,
|
xml_merge1(cxobj *x0,
|
||||||
yang_node *y0,
|
yang_node *y0,
|
||||||
cxobj *x0p,
|
cxobj *x0p,
|
||||||
cxobj *x1)
|
cxobj *x1,
|
||||||
|
char **reason)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
char *x1name;
|
char *x1name;
|
||||||
|
|
@ -1698,24 +1682,35 @@ xml_merge1(cxobj *x0,
|
||||||
x1cname = xml_name(x1c);
|
x1cname = xml_name(x1c);
|
||||||
/* Get yang spec of the child */
|
/* Get yang spec of the child */
|
||||||
if ((yc = yang_find_datanode(y0, x1cname)) == NULL){
|
if ((yc = yang_find_datanode(y0, x1cname)) == NULL){
|
||||||
clicon_err(OE_YANG, errno, "No yang node found: %s", x1cname);
|
if (reason && (*reason = strdup("XML node has no corresponding yang specification (Invalid XML or wrong Yang spec?")) == NULL){
|
||||||
|
clicon_err(OE_UNIX, errno, "strdup");
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
|
break;
|
||||||
|
}
|
||||||
/* See if there is a corresponding node in the base tree */
|
/* See if there is a corresponding node in the base tree */
|
||||||
x0c = NULL;
|
x0c = NULL;
|
||||||
if (yc && match_base_child(x0, x1c, &x0c, yc) < 0)
|
if (yc && match_base_child(x0, x1c, &x0c, yc) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (xml_merge1(x0c, (yang_node*)yc, x0, x1c) < 0)
|
if (xml_merge1(x0c, (yang_node*)yc, x0, x1c, reason) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
if (*reason != NULL)
|
||||||
|
goto ok;
|
||||||
}
|
}
|
||||||
} /* else Y_CONTAINER */
|
} /* else Y_CONTAINER */
|
||||||
// ok:
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Merge XML trees x1 into x0 according to yang spec yspec
|
/*! Merge XML trees x1 into x0 according to yang spec yspec
|
||||||
|
* @param[in] x0 Base xml tree (can be NULL in add scenarios)
|
||||||
|
* @param[in] x1 xml tree which modifies base
|
||||||
|
* @param[in] yspec Yang spec
|
||||||
|
* @param[out] reason If retval=0 a malloced string. Needs to be freed by caller
|
||||||
|
* @retval 0 OK. If reason is set, Yang error
|
||||||
|
* @retval -1 Error
|
||||||
* @note both x0 and x1 need to be top-level trees
|
* @note both x0 and x1 need to be top-level trees
|
||||||
* @see text_modify_top as more generic variant (in datastore text)
|
* @see text_modify_top as more generic variant (in datastore text)
|
||||||
* @note returns -1 if YANG do not match, you may want to have a softer error
|
* @note returns -1 if YANG do not match, you may want to have a softer error
|
||||||
|
|
@ -1723,7 +1718,8 @@ xml_merge1(cxobj *x0,
|
||||||
int
|
int
|
||||||
xml_merge(cxobj *x0,
|
xml_merge(cxobj *x0,
|
||||||
cxobj *x1,
|
cxobj *x1,
|
||||||
yang_spec *yspec)
|
yang_spec *yspec,
|
||||||
|
char **reason)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
char *x1cname; /* child name */
|
char *x1cname; /* child name */
|
||||||
|
|
@ -1736,17 +1732,22 @@ xml_merge(cxobj *x0,
|
||||||
while ((x1c = xml_child_each(x1, x1c, CX_ELMNT)) != NULL) {
|
while ((x1c = xml_child_each(x1, x1c, CX_ELMNT)) != NULL) {
|
||||||
x1cname = xml_name(x1c);
|
x1cname = xml_name(x1c);
|
||||||
/* Get yang spec of the child */
|
/* Get yang spec of the child */
|
||||||
if ((yc = yang_find_topnode(yspec, x1cname, 0)) == NULL){
|
if ((yc = yang_find_topnode(yspec, x1cname, YC_DATANODE)) == NULL){
|
||||||
clicon_err(OE_YANG, ENOENT, "No yang spec");
|
if (reason && (*reason = strdup("XML node has no corresponding yang specification (Invalid XML or wrong Yang spec?")) == NULL){
|
||||||
|
clicon_err(OE_UNIX, errno, "strdup");
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
|
break;
|
||||||
|
}
|
||||||
/* See if there is a corresponding node in the base tree */
|
/* See if there is a corresponding node in the base tree */
|
||||||
if (match_base_child(x0, x1c, &x0c, yc) < 0)
|
if (match_base_child(x0, x1c, &x0c, yc) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (xml_merge1(x0c, (yang_node*)yc, x0, x1c) < 0)
|
if (xml_merge1(x0c, (yang_node*)yc, x0, x1c, reason) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
if (*reason != NULL)
|
||||||
|
break;
|
||||||
}
|
}
|
||||||
retval = 0;
|
retval = 0; /* OK */
|
||||||
done:
|
done:
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
|
||||||
|
|
@ -51,6 +51,7 @@ struct xml_parse_yacc_arg{
|
||||||
cxobj *ya_xparent; /* xml parent element*/
|
cxobj *ya_xparent; /* xml parent element*/
|
||||||
int ya_skipspace; /* If set, remove all non-terminal bodies (strip pretty-print) */
|
int ya_skipspace; /* If set, remove all non-terminal bodies (strip pretty-print) */
|
||||||
yang_spec *ya_yspec; /* If set, top-level yang-spec */
|
yang_spec *ya_yspec; /* If set, top-level yang-spec */
|
||||||
|
int ya_lex_state; /* lex start condition (AMPERSAND) */
|
||||||
};
|
};
|
||||||
|
|
||||||
extern char *clixon_xml_parsetext;
|
extern char *clixon_xml_parsetext;
|
||||||
|
|
|
||||||
|
|
@ -76,6 +76,7 @@ int clixon_xml_parsewrap(void)
|
||||||
|
|
||||||
%x START
|
%x START
|
||||||
%s STATEA
|
%s STATEA
|
||||||
|
%s AMPERSAND
|
||||||
%s CMNT
|
%s CMNT
|
||||||
%s STR
|
%s STR
|
||||||
%s TEXTDECL
|
%s TEXTDECL
|
||||||
|
|
@ -98,14 +99,21 @@ int clixon_xml_parsewrap(void)
|
||||||
<START>\> { BEGIN(STATEA); return *clixon_xml_parsetext; }
|
<START>\> { BEGIN(STATEA); return *clixon_xml_parsetext; }
|
||||||
|
|
||||||
<START>\" { BEGIN(STR); return *clixon_xml_parsetext; }
|
<START>\" { BEGIN(STR); return *clixon_xml_parsetext; }
|
||||||
<START>. { clixon_xml_parselval.string = yytext; return CHAR; /*XXX:optimize*/ }
|
<START>. { clixon_xml_parselval.string = yytext; return CHARDATA; /*XXX:optimize*/ }
|
||||||
|
|
||||||
|
|
||||||
<STATEA>"</" { BEGIN(START); return BSLASH; }
|
<STATEA>"</" { BEGIN(START); return BSLASH; }
|
||||||
<STATEA>"<!--" { BEGIN(CMNT); return BCOMMENT; }
|
<STATEA>"<!--" { BEGIN(CMNT); return BCOMMENT; }
|
||||||
<STATEA>\< { BEGIN(START); return *clixon_xml_parsetext; }
|
<STATEA>\< { BEGIN(START); return *clixon_xml_parsetext; }
|
||||||
<STATEA>\n { clixon_xml_parselval.string = yytext;_YA->ya_linenum++; return (CHAR);}
|
<STATEA>& { _YA->ya_lex_state =STATEA;BEGIN(AMPERSAND);}
|
||||||
<STATEA>. { clixon_xml_parselval.string = yytext; return CHAR; /*XXX:optimize*/}
|
<STATEA>\n { clixon_xml_parselval.string = yytext;_YA->ya_linenum++; return (CHARDATA);}
|
||||||
|
<STATEA>. { clixon_xml_parselval.string = yytext; return CHARDATA; /*XXX:optimize*/}
|
||||||
|
/* @see xml_chardata_encode */
|
||||||
|
<AMPERSAND>"amp; " {BEGIN(_YA->ya_lex_state); clixon_xml_parselval.string = "&"; return CHARDATA;}
|
||||||
|
<AMPERSAND>"lt; " {BEGIN(_YA->ya_lex_state); clixon_xml_parselval.string = "<"; return CHARDATA;}
|
||||||
|
<AMPERSAND>"gt; " {BEGIN(_YA->ya_lex_state); clixon_xml_parselval.string = ">"; return CHARDATA;}
|
||||||
|
<AMPERSAND>"apos; " {BEGIN(_YA->ya_lex_state); clixon_xml_parselval.string = "'"; return CHARDATA;}
|
||||||
|
<AMPERSAND>"aquot; " {BEGIN(_YA->ya_lex_state); clixon_xml_parselval.string = "'"; return CHARDATA;}
|
||||||
|
|
||||||
|
|
||||||
<CMNT>"-->" { BEGIN(START); return ECOMMENT; }
|
<CMNT>"-->" { BEGIN(START); return ECOMMENT; }
|
||||||
<CMNT>\n _YA->ya_linenum++;
|
<CMNT>\n _YA->ya_linenum++;
|
||||||
|
|
@ -117,15 +125,15 @@ int clixon_xml_parsewrap(void)
|
||||||
<TEXTDECL>\" { BEGIN(STRDQ); return *clixon_xml_parsetext; }
|
<TEXTDECL>\" { BEGIN(STRDQ); return *clixon_xml_parsetext; }
|
||||||
<TEXTDECL>\' { BEGIN(STRSQ); return *clixon_xml_parsetext; }
|
<TEXTDECL>\' { BEGIN(STRSQ); return *clixon_xml_parsetext; }
|
||||||
|
|
||||||
<STR>[^\"]+ { clixon_xml_parselval.string = strdup(yytext); return CHAR; }
|
<STR>[^\"]+ { clixon_xml_parselval.string = strdup(yytext); return CHARDATA; }
|
||||||
<STR>\" { BEGIN(START); return *clixon_xml_parsetext; }
|
<STR>\" { BEGIN(START); return *clixon_xml_parsetext; }
|
||||||
|
|
||||||
<STRDQ>1\.[0-9]+ { clixon_xml_parselval.string = strdup(yytext); return CHAR; }
|
<STRDQ>1\.[0-9]+ { clixon_xml_parselval.string = strdup(yytext); return CHARDATA; }
|
||||||
<STRDQ>[^\"]+ { clixon_xml_parselval.string = strdup(yytext); return CHAR; }
|
<STRDQ>[^\"]+ { clixon_xml_parselval.string = strdup(yytext); return CHARDATA; }
|
||||||
<STRDQ>\" { BEGIN(TEXTDECL); return *clixon_xml_parsetext; }
|
<STRDQ>\" { BEGIN(TEXTDECL); return *clixon_xml_parsetext; }
|
||||||
|
|
||||||
<STRSQ>1\.[0-9]+ { clixon_xml_parselval.string = strdup(yytext); return CHAR; }
|
<STRSQ>1\.[0-9]+ { clixon_xml_parselval.string = strdup(yytext); return CHARDATA; }
|
||||||
<STRSQ>[^\']+ { clixon_xml_parselval.string = strdup(yytext); return CHAR; }
|
<STRSQ>[^\']+ { clixon_xml_parselval.string = strdup(yytext); return CHARDATA; }
|
||||||
<STRSQ>\' { BEGIN(TEXTDECL); return *clixon_xml_parsetext; }
|
<STRSQ>\' { BEGIN(TEXTDECL); return *clixon_xml_parsetext; }
|
||||||
|
|
||||||
%%
|
%%
|
||||||
|
|
|
||||||
|
|
@ -41,7 +41,7 @@
|
||||||
|
|
||||||
%start topxml
|
%start topxml
|
||||||
|
|
||||||
%token <string> NAME CHAR
|
%token <string> NAME CHARDATA
|
||||||
%token VER ENC
|
%token VER ENC
|
||||||
%token BSLASH ESLASH
|
%token BSLASH ESLASH
|
||||||
%token BTEXT ETEXT
|
%token BTEXT ETEXT
|
||||||
|
|
@ -329,15 +329,15 @@ topxml : list
|
||||||
dcl : BTEXT info encode ETEXT { clicon_debug(3, "dcl->info encode"); }
|
dcl : BTEXT info encode ETEXT { clicon_debug(3, "dcl->info encode"); }
|
||||||
;
|
;
|
||||||
|
|
||||||
info : VER '=' '\"' CHAR '\"'
|
info : VER '=' '\"' CHARDATA '\"'
|
||||||
{ if (xml_parse_version(_YA, $4) <0) YYABORT; }
|
{ if (xml_parse_version(_YA, $4) <0) YYABORT; }
|
||||||
| VER '=' '\'' CHAR '\''
|
| VER '=' '\'' CHARDATA '\''
|
||||||
{ if (xml_parse_version(_YA, $4) <0) YYABORT; }
|
{ if (xml_parse_version(_YA, $4) <0) YYABORT; }
|
||||||
|
|
|
|
||||||
;
|
;
|
||||||
|
|
||||||
encode : ENC '=' '\"' CHAR '\"' {free($4);}
|
encode : ENC '=' '\"' CHARDATA '\"' {free($4);}
|
||||||
| ENC '=' '\'' CHAR '\'' {free($4);}
|
| ENC '=' '\'' CHARDATA '\'' {free($4);}
|
||||||
;
|
;
|
||||||
|
|
||||||
element : '<' qname attrs element1
|
element : '<' qname attrs element1
|
||||||
|
|
@ -372,8 +372,8 @@ list : list content { clicon_debug(3, "list -> list content"); }
|
||||||
|
|
||||||
content : element { clicon_debug(3, "content -> element"); }
|
content : element { clicon_debug(3, "content -> element"); }
|
||||||
| comment { clicon_debug(3, "content -> comment"); }
|
| comment { clicon_debug(3, "content -> comment"); }
|
||||||
| CHAR { if (xml_parse_content(_YA, $1) < 0) YYABORT;
|
| CHARDATA { if (xml_parse_content(_YA, $1) < 0) YYABORT;
|
||||||
clicon_debug(3, "content -> CHAR %s", $1); }
|
clicon_debug(3, "content -> CHARDATA %s", $1); }
|
||||||
| { clicon_debug(3, "content -> "); }
|
| { clicon_debug(3, "content -> "); }
|
||||||
;
|
;
|
||||||
|
|
||||||
|
|
@ -394,7 +394,7 @@ attqname : NAME {$$ = $1;}
|
||||||
;
|
;
|
||||||
|
|
||||||
|
|
||||||
attvalue : '\"' CHAR '\"' { $$=$2; /* $2 must be consumed */}
|
attvalue : '\"' CHARDATA '\"' { $$=$2; /* $2 must be consumed */}
|
||||||
| '\"' '\"' { $$=strdup(""); /* $2 must be consumed */}
|
| '\"' '\"' { $$=strdup(""); /* $2 must be consumed */}
|
||||||
;
|
;
|
||||||
|
|
||||||
|
|
|
||||||
|
|
@ -93,7 +93,7 @@ xml_child_spec(char *name,
|
||||||
if (xp && (yparent = xml_spec(xp)) != NULL)
|
if (xp && (yparent = xml_spec(xp)) != NULL)
|
||||||
y = yang_find_datanode((yang_node*)yparent, name);
|
y = yang_find_datanode((yang_node*)yparent, name);
|
||||||
else if (yspec)
|
else if (yspec)
|
||||||
y = yang_find_topnode(yspec, name, 0); /* still NULL for config */
|
y = yang_find_topnode(yspec, name, YC_DATANODE); /* still NULL for config */
|
||||||
else
|
else
|
||||||
y = NULL;
|
y = NULL;
|
||||||
*yresult = y;
|
*yresult = y;
|
||||||
|
|
@ -167,7 +167,7 @@ xml_cmp(const void* arg1,
|
||||||
return equal;
|
return equal;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*!
|
/*! Compare xml object
|
||||||
* @param[in] yangi Yang order
|
* @param[in] yangi Yang order
|
||||||
* @param[in] keynr Length of keyvec/keyval vector when applicable
|
* @param[in] keynr Length of keyvec/keyval vector when applicable
|
||||||
* @param[in] keyvec Array of of yang key identifiers
|
* @param[in] keyvec Array of of yang key identifiers
|
||||||
|
|
@ -192,36 +192,38 @@ xml_cmp1(cxobj *x,
|
||||||
int i;
|
int i;
|
||||||
char *keyname;
|
char *keyname;
|
||||||
char *key;
|
char *key;
|
||||||
|
int match = 0;
|
||||||
|
|
||||||
/* Check if same yang spec (order in yang stmt list) */
|
/* Check if same yang spec (order in yang stmt list) */
|
||||||
switch (keyword){
|
switch (keyword){
|
||||||
case Y_CONTAINER: /* Match with name */
|
case Y_CONTAINER: /* Match with name */
|
||||||
case Y_LEAF: /* Match with name */
|
case Y_LEAF: /* Match with name */
|
||||||
return strcmp(name, xml_name(x));
|
match = strcmp(name, xml_name(x));
|
||||||
break;
|
break;
|
||||||
case Y_LEAF_LIST: /* Match with name and value */
|
case Y_LEAF_LIST: /* Match with name and value */
|
||||||
if (userorder && yang_find((yang_node*)y, Y_ORDERED_BY, "user") != NULL)
|
if (userorder && yang_find((yang_node*)y, Y_ORDERED_BY, "user") != NULL)
|
||||||
*userorder=1;
|
*userorder=1;
|
||||||
b=xml_body(x);
|
b=xml_body(x);
|
||||||
return strcmp(keyval[0], b);
|
match = strcmp(keyval[0], b);
|
||||||
break;
|
break;
|
||||||
case Y_LIST: /* Match with array of key values */
|
case Y_LIST: /* Match with array of key values */
|
||||||
if (userorder && yang_find((yang_node*)y, Y_ORDERED_BY, "user") != NULL)
|
if (userorder && yang_find((yang_node*)y, Y_ORDERED_BY, "user") != NULL)
|
||||||
*userorder=1;
|
*userorder=1;
|
||||||
|
/* All must match */
|
||||||
for (i=0; i<keynr; i++){
|
for (i=0; i<keynr; i++){
|
||||||
keyname = keyvec[i];
|
keyname = keyvec[i];
|
||||||
key = keyval[i];
|
key = keyval[i];
|
||||||
/* Eg return "e0" in <if><name>e0</name></name></if> given "name" */
|
/* Eg return "e0" in <if><name>e0</name></name></if> given "name" */
|
||||||
if ((b = xml_find_body(x, keyname)) == NULL)
|
if ((b = xml_find_body(x, keyname)) == NULL)
|
||||||
break; /* error case */
|
break; /* error case */
|
||||||
return strcmp(key, b);
|
if ((match = strcmp(key, b)) != 0)
|
||||||
|
break;
|
||||||
}
|
}
|
||||||
return 0;
|
|
||||||
break;
|
break;
|
||||||
default:
|
default:
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
return 0; /* should not reach here */
|
return match; /* should not reach here */
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Sort children of an XML node
|
/*! Sort children of an XML node
|
||||||
|
|
@ -522,7 +524,7 @@ xml_sort_verify(cxobj *x0,
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Given child tree x1c, find matching child in base tree x0
|
/*! Given child tree x1c, find matching child in base tree x0 and return as x0cp
|
||||||
* param[in] x0 Base tree node
|
* param[in] x0 Base tree node
|
||||||
* param[in] x1c Modification tree child
|
* param[in] x1c Modification tree child
|
||||||
* param[in] yc Yang spec of tree child
|
* param[in] yc Yang spec of tree child
|
||||||
|
|
@ -567,7 +569,10 @@ match_base_child(cxobj *x0,
|
||||||
break;
|
break;
|
||||||
case Y_LIST: /* Match with key values */
|
case Y_LIST: /* Match with key values */
|
||||||
cvk = yc->ys_cvec; /* Use Y_LIST cache, see ys_populate_list() */
|
cvk = yc->ys_cvec; /* Use Y_LIST cache, see ys_populate_list() */
|
||||||
/* Count number of key indexes */
|
/* Count number of key indexes
|
||||||
|
* Then create two vectors one with names and one with values of x1c,
|
||||||
|
* ec: keyvec: [a,b,c] keyval: [1,2,3]
|
||||||
|
*/
|
||||||
cvi = NULL; keynr = 0;
|
cvi = NULL; keynr = 0;
|
||||||
while ((cvi = cvec_each(cvk, cvi)) != NULL)
|
while ((cvi = cvec_each(cvk, cvi)) != NULL)
|
||||||
keynr++;
|
keynr++;
|
||||||
|
|
@ -591,7 +596,7 @@ match_base_child(cxobj *x0,
|
||||||
default:
|
default:
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
/* Get match */
|
/* Get match. Sorting mode(optimized) or not?*/
|
||||||
if (xml_child_sort==0)
|
if (xml_child_sort==0)
|
||||||
*x0cp = xml_match(x0, xml_name(x1c), yc->ys_keyword, keynr, keyvec, keyval);
|
*x0cp = xml_match(x0, xml_name(x1c), yc->ys_keyword, keynr, keyvec, keyval);
|
||||||
else{
|
else{
|
||||||
|
|
|
||||||
|
|
@ -32,6 +32,8 @@
|
||||||
***** END LICENSE BLOCK *****
|
***** END LICENSE BLOCK *****
|
||||||
|
|
||||||
* Yang functions
|
* Yang functions
|
||||||
|
* @see https://tools.ietf.org/html/rfc6020 YANG 1.0
|
||||||
|
* @see https://tools.ietf.org/html/rfc7950 YANG 1.1
|
||||||
*/
|
*/
|
||||||
|
|
||||||
#ifdef HAVE_CONFIG_H
|
#ifdef HAVE_CONFIG_H
|
||||||
|
|
@ -66,6 +68,7 @@
|
||||||
#include "clixon_file.h"
|
#include "clixon_file.h"
|
||||||
#include "clixon_yang.h"
|
#include "clixon_yang.h"
|
||||||
#include "clixon_hash.h"
|
#include "clixon_hash.h"
|
||||||
|
#include "clixon_xml.h"
|
||||||
#include "clixon_plugin.h"
|
#include "clixon_plugin.h"
|
||||||
#include "clixon_options.h"
|
#include "clixon_options.h"
|
||||||
#include "clixon_yang_type.h"
|
#include "clixon_yang_type.h"
|
||||||
|
|
@ -134,6 +137,7 @@ static const map_str2int ykmap[] = {
|
||||||
{"typedef", Y_TYPEDEF},
|
{"typedef", Y_TYPEDEF},
|
||||||
{"unique", Y_UNIQUE},
|
{"unique", Y_UNIQUE},
|
||||||
{"units", Y_UNITS},
|
{"units", Y_UNITS},
|
||||||
|
{"unknown", Y_UNKNOWN},
|
||||||
{"uses", Y_USES},
|
{"uses", Y_USES},
|
||||||
{"value", Y_VALUE},
|
{"value", Y_VALUE},
|
||||||
{"when", Y_WHEN},
|
{"when", Y_WHEN},
|
||||||
|
|
@ -401,6 +405,94 @@ yang_find(yang_node *yn,
|
||||||
}
|
}
|
||||||
return match ? ys : NULL;
|
return match ? ys : NULL;
|
||||||
}
|
}
|
||||||
|
#ifdef NOTYET
|
||||||
|
/*! Prototype more generic than yang_find_datanode and yang_find_schemanode
|
||||||
|
*/
|
||||||
|
yang_stmt *
|
||||||
|
yang_find_class(yang_node *yn,
|
||||||
|
char *argument,
|
||||||
|
yang_class class)
|
||||||
|
{
|
||||||
|
yang_stmt *ys = NULL;
|
||||||
|
yang_stmt *yc = NULL;
|
||||||
|
yang_stmt *ysmatch = NULL;
|
||||||
|
int i, j;
|
||||||
|
int ok;
|
||||||
|
|
||||||
|
for (i=0; i<yn->yn_len; i++){
|
||||||
|
ys = yn->yn_stmt[i];
|
||||||
|
switch(class){
|
||||||
|
case YC_NONE:
|
||||||
|
ok = 1;
|
||||||
|
break;
|
||||||
|
case YC_DATANODE:
|
||||||
|
ok = yang_datanode(ys);
|
||||||
|
break;
|
||||||
|
case YC_DATADEFINITION:
|
||||||
|
ok = yang_datadefinition(ys);
|
||||||
|
break;
|
||||||
|
case YC_SCHEMANODE:
|
||||||
|
ok = yang_schemanode(ys);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
if (!ok)
|
||||||
|
continue;
|
||||||
|
switch(class){
|
||||||
|
case YC_NONE:
|
||||||
|
if (argument == NULL)
|
||||||
|
ysmatch = ys;
|
||||||
|
else
|
||||||
|
if (ys->ys_argument && strcmp(argument, ys->ys_argument) == 0)
|
||||||
|
ysmatch = ys;
|
||||||
|
if (ysmatch)
|
||||||
|
goto match;
|
||||||
|
break;
|
||||||
|
case YC_DATANODE:
|
||||||
|
case YC_DATADEFINITION:
|
||||||
|
if (argument == NULL)
|
||||||
|
ysmatch = ys;
|
||||||
|
else
|
||||||
|
if (ys->ys_argument && strcmp(argument, ys->ys_argument) == 0)
|
||||||
|
ysmatch = ys;
|
||||||
|
if (ysmatch)
|
||||||
|
goto match;
|
||||||
|
break;
|
||||||
|
case YC_SCHEMANODE:
|
||||||
|
if (ys->ys_keyword == Y_CHOICE){ /* Look for its children */
|
||||||
|
for (j=0; j<ys->ys_len; j++){
|
||||||
|
yc = ys->ys_stmt[j];
|
||||||
|
if (yc->ys_keyword == Y_CASE) /* Look for its children */
|
||||||
|
ysmatch = yang_find_class((yang_node*)yc, argument, class);
|
||||||
|
else{
|
||||||
|
if (yang_schemanode(yc)){
|
||||||
|
if (argument == NULL)
|
||||||
|
ysmatch = yc;
|
||||||
|
else
|
||||||
|
if (yc->ys_argument && strcmp(argument, yc->ys_argument) == 0)
|
||||||
|
ysmatch = yc;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (ysmatch)
|
||||||
|
goto match;
|
||||||
|
}
|
||||||
|
} /* Y_CHOICE */
|
||||||
|
else{
|
||||||
|
if (argument == NULL)
|
||||||
|
ysmatch = ys;
|
||||||
|
else
|
||||||
|
if (ys->ys_argument && strcmp(argument, ys->ys_argument) == 0)
|
||||||
|
ysmatch = ys;
|
||||||
|
if (ysmatch)
|
||||||
|
goto match;
|
||||||
|
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
} /* switch */
|
||||||
|
} /* for */
|
||||||
|
match:
|
||||||
|
return ysmatch;
|
||||||
|
}
|
||||||
|
#endif /* NOTYET */
|
||||||
|
|
||||||
/*! Find child data node with matching argument (container, leaf, etc)
|
/*! Find child data node with matching argument (container, leaf, etc)
|
||||||
*
|
*
|
||||||
|
|
@ -454,6 +546,8 @@ yang_find_datanode(yang_node *yn,
|
||||||
}
|
}
|
||||||
|
|
||||||
/*! Find child schema node with matching argument (container, leaf, etc)
|
/*! Find child schema node with matching argument (container, leaf, etc)
|
||||||
|
* @param[in] yn Yang node, current context node.
|
||||||
|
* @param[in] argument if NULL, match any(first) argument.
|
||||||
* @note XXX unify code with yang_find_datanode?
|
* @note XXX unify code with yang_find_datanode?
|
||||||
* @see yang_find_datanode
|
* @see yang_find_datanode
|
||||||
*/
|
*/
|
||||||
|
|
@ -504,7 +598,7 @@ yang_find_schemanode(yang_node *yn,
|
||||||
/*! Find first matching data node in all (sub)modules in a yang spec
|
/*! Find first matching data node in all (sub)modules in a yang spec
|
||||||
*
|
*
|
||||||
* @param[in] ysp Yang specification
|
* @param[in] ysp Yang specification
|
||||||
* @param[in] name if NULL, match any(first) argument. XXX is that really a case?
|
* @param[in] argument if NULL, match any(first) argument. XXX is that really a case?
|
||||||
* @param[in] schemanode If set look for schema nodes, otherwise only data nodes
|
* @param[in] schemanode If set look for schema nodes, otherwise only data nodes
|
||||||
* A yang specification has modules as children which in turn can have
|
* A yang specification has modules as children which in turn can have
|
||||||
* syntax-nodes as children. This function goes through all the modules to
|
* syntax-nodes as children. This function goes through all the modules to
|
||||||
|
|
@ -513,8 +607,8 @@ yang_find_schemanode(yang_node *yn,
|
||||||
*/
|
*/
|
||||||
yang_stmt *
|
yang_stmt *
|
||||||
yang_find_topnode(yang_spec *ysp,
|
yang_find_topnode(yang_spec *ysp,
|
||||||
char *name,
|
char *argument,
|
||||||
int schemanode)
|
yang_class class)
|
||||||
{
|
{
|
||||||
yang_stmt *ys = NULL;
|
yang_stmt *ys = NULL;
|
||||||
yang_stmt *yc = NULL;
|
yang_stmt *yc = NULL;
|
||||||
|
|
@ -522,13 +616,22 @@ yang_find_topnode(yang_spec *ysp,
|
||||||
|
|
||||||
for (i=0; i<ysp->yp_len; i++){
|
for (i=0; i<ysp->yp_len; i++){
|
||||||
ys = ysp->yp_stmt[i];
|
ys = ysp->yp_stmt[i];
|
||||||
if (schemanode){
|
switch (class){
|
||||||
if ((yc = yang_find_schemanode((yang_node*)ys, name)) != NULL)
|
case YC_NONE:
|
||||||
|
if ((yc = yang_find((yang_node*)ys, 0, argument)) != NULL)
|
||||||
return yc;
|
return yc;
|
||||||
|
break;
|
||||||
|
case YC_DATANODE:
|
||||||
|
if ((yc = yang_find_datanode((yang_node*)ys, argument)) != NULL)
|
||||||
|
return yc;
|
||||||
|
break;
|
||||||
|
case YC_SCHEMANODE:
|
||||||
|
if ((yc = yang_find_schemanode((yang_node*)ys, argument)) != NULL)
|
||||||
|
return yc;
|
||||||
|
break;
|
||||||
|
case YC_DATADEFINITION:
|
||||||
|
break; /* nyi */
|
||||||
}
|
}
|
||||||
else
|
|
||||||
if ((yc = yang_find_datanode((yang_node*)ys, name)) != NULL)
|
|
||||||
return yc;
|
|
||||||
}
|
}
|
||||||
return NULL;
|
return NULL;
|
||||||
}
|
}
|
||||||
|
|
@ -668,13 +771,15 @@ ys_spec(yang_stmt *ys)
|
||||||
return (yang_spec*)ys;
|
return (yang_spec*)ys;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Extract id from type argument. two cases:
|
/* Assume argument is id on the type: <[prefix:]id>, return 'id'
|
||||||
* argument is prefix:id,
|
|
||||||
* argument is id,
|
|
||||||
* Just return string from id
|
* Just return string from id
|
||||||
|
* @param[in] ys A yang statement
|
||||||
|
* @retval NULL No id (argument is NULL)
|
||||||
|
* @retval id Pointer to identifier
|
||||||
|
* @see yarg_prefix
|
||||||
*/
|
*/
|
||||||
char*
|
char*
|
||||||
ytype_id(yang_stmt *ys)
|
yarg_id(yang_stmt *ys)
|
||||||
{
|
{
|
||||||
char *id;
|
char *id;
|
||||||
|
|
||||||
|
|
@ -685,13 +790,14 @@ ytype_id(yang_stmt *ys)
|
||||||
return id;
|
return id;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Extract prefix from type argument. two cases:
|
/* Assume argument is id on the type: <[prefix:]id>, return 'prefix'
|
||||||
* argument is prefix:id,
|
* @param[in] ys A yang statement
|
||||||
* argument is id,
|
* @retval NULL No prefix
|
||||||
* return either NULL or a new prefix string that needs to be freed by caller.
|
* @retval prefix Malloced string that needs to be freed by caller.
|
||||||
|
* @see yarg_id
|
||||||
*/
|
*/
|
||||||
char*
|
char*
|
||||||
ytype_prefix(yang_stmt *ys)
|
yarg_prefix(yang_stmt *ys)
|
||||||
{
|
{
|
||||||
char *id;
|
char *id;
|
||||||
char *prefix = NULL;
|
char *prefix = NULL;
|
||||||
|
|
@ -822,6 +928,10 @@ yang_print_cbuf(cbuf *cb,
|
||||||
yang_stmt *ys = NULL;
|
yang_stmt *ys = NULL;
|
||||||
|
|
||||||
while ((ys = yn_each(yn, ys)) != NULL) {
|
while ((ys = yn_each(yn, ys)) != NULL) {
|
||||||
|
if (ys->ys_keyword == Y_UNKNOWN){ /* dont print unknown - proxy for extension*/
|
||||||
|
cprintf(cb, "%*s", marginal-1, "");
|
||||||
|
}
|
||||||
|
else
|
||||||
cprintf(cb, "%*s%s", marginal, "", yang_key2str(ys->ys_keyword));
|
cprintf(cb, "%*s%s", marginal, "", yang_key2str(ys->ys_keyword));
|
||||||
if (ys->ys_argument){
|
if (ys->ys_argument){
|
||||||
if (quotedstring(ys->ys_argument))
|
if (quotedstring(ys->ys_argument))
|
||||||
|
|
@ -974,7 +1084,7 @@ ys_populate_range(yang_stmt *ys,
|
||||||
&options, NULL, NULL, NULL, &fraction_digits) < 0)
|
&options, NULL, NULL, NULL, &fraction_digits) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
restype = yrestype?yrestype->ys_argument:NULL;
|
restype = yrestype?yrestype->ys_argument:NULL;
|
||||||
origtype = ytype_id((yang_stmt*)yparent);
|
origtype = yarg_id((yang_stmt*)yparent);
|
||||||
/* This handles non-resolved also */
|
/* This handles non-resolved also */
|
||||||
if (clicon_type2cv(origtype, restype, &cvtype) < 0)
|
if (clicon_type2cv(origtype, restype, &cvtype) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
|
@ -1209,7 +1319,7 @@ yang_augment_node(yang_stmt *ys,
|
||||||
clicon_debug(1, "%s %s", __FUNCTION__, schema_nodeid);
|
clicon_debug(1, "%s %s", __FUNCTION__, schema_nodeid);
|
||||||
|
|
||||||
/* Find the target */
|
/* Find the target */
|
||||||
if (yang_abs_schema_nodeid(ysp, schema_nodeid, &yss) < 0)
|
if (yang_abs_schema_nodeid(ysp, schema_nodeid, -1, &yss) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (yss == NULL)
|
if (yss == NULL)
|
||||||
goto ok;
|
goto ok;
|
||||||
|
|
@ -1291,8 +1401,8 @@ yang_expand(yang_node *yn)
|
||||||
switch(ys->ys_keyword){
|
switch(ys->ys_keyword){
|
||||||
case Y_USES:
|
case Y_USES:
|
||||||
/* Split argument into prefix and name */
|
/* Split argument into prefix and name */
|
||||||
name = ytype_id(ys); /* This is uses/grouping name to resolve */
|
name = yarg_id(ys); /* This is uses/grouping name to resolve */
|
||||||
prefix = ytype_prefix(ys); /* And this its prefix */
|
prefix = yarg_prefix(ys); /* And this its prefix */
|
||||||
if (ys_grouping_resolve(ys, prefix, name, &ygrouping) < 0)
|
if (ys_grouping_resolve(ys, prefix, name, &ygrouping) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (prefix)
|
if (prefix)
|
||||||
|
|
@ -1638,7 +1748,7 @@ ys_schemanode_check(yang_stmt *ys,
|
||||||
/* fallthru */
|
/* fallthru */
|
||||||
case Y_REFINE:
|
case Y_REFINE:
|
||||||
case Y_UNIQUE:
|
case Y_UNIQUE:
|
||||||
if (yang_desc_schema_nodeid(yp, ys->ys_argument, &yres) < 0)
|
if (yang_desc_schema_nodeid(yp, ys->ys_argument, -1, &yres) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (yres == NULL){
|
if (yres == NULL){
|
||||||
clicon_err(OE_YANG, 0, "schemanode sanity check of %d %s",
|
clicon_err(OE_YANG, 0, "schemanode sanity check of %d %s",
|
||||||
|
|
@ -1649,7 +1759,7 @@ ys_schemanode_check(yang_stmt *ys,
|
||||||
break;
|
break;
|
||||||
case Y_DEVIATION:
|
case Y_DEVIATION:
|
||||||
yspec = ys_spec(ys);
|
yspec = ys_spec(ys);
|
||||||
if (yang_abs_schema_nodeid(yspec, ys->ys_argument, &yres) < 0)
|
if (yang_abs_schema_nodeid(yspec, ys->ys_argument, -1, &yres) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
if (yres == NULL){
|
if (yres == NULL){
|
||||||
clicon_err(OE_YANG, 0, "schemanode sanity check of %s", ys->ys_argument);
|
clicon_err(OE_YANG, 0, "schemanode sanity check of %s", ys->ys_argument);
|
||||||
|
|
@ -1792,6 +1902,7 @@ yang_apply(yang_node *yn,
|
||||||
* @param[in] yn Yang node. Find next yang stmt and return that if match.
|
* @param[in] yn Yang node. Find next yang stmt and return that if match.
|
||||||
* @param[in] vec Vector of nodeid's in a schema node identifier, eg a/b
|
* @param[in] vec Vector of nodeid's in a schema node identifier, eg a/b
|
||||||
* @param[in] nvec Length of vec
|
* @param[in] nvec Length of vec
|
||||||
|
* @param[in] keyword A schemode of this type, or -1 if any
|
||||||
* @param[out] yres Result yang statement node, or NULL if not found
|
* @param[out] yres Result yang statement node, or NULL if not found
|
||||||
* @retval -1 Error, with clicon_err called
|
* @retval -1 Error, with clicon_err called
|
||||||
* @retval 0 OK
|
* @retval 0 OK
|
||||||
|
|
@ -1800,6 +1911,7 @@ static int
|
||||||
schema_nodeid_vec(yang_node *yn,
|
schema_nodeid_vec(yang_node *yn,
|
||||||
char **vec,
|
char **vec,
|
||||||
int nvec,
|
int nvec,
|
||||||
|
enum rfc_6020 keyword,
|
||||||
yang_stmt **yres)
|
yang_stmt **yres)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
|
|
@ -1830,6 +1942,8 @@ schema_nodeid_vec(yang_node *yn,
|
||||||
ys = yn->yn_stmt[i];
|
ys = yn->yn_stmt[i];
|
||||||
if (!yang_schemanode(ys))
|
if (!yang_schemanode(ys))
|
||||||
continue;
|
continue;
|
||||||
|
if (keyword != -1 && keyword != ys->ys_keyword)
|
||||||
|
continue;
|
||||||
/* some keys dont have arguments, match on key */
|
/* some keys dont have arguments, match on key */
|
||||||
if (ys->ys_keyword == Y_INPUT || ys->ys_keyword == Y_OUTPUT){
|
if (ys->ys_keyword == Y_INPUT || ys->ys_keyword == Y_OUTPUT){
|
||||||
if (strcmp(nodeid, yang_key2str(ys->ys_keyword)) == 0){
|
if (strcmp(nodeid, yang_key2str(ys->ys_keyword)) == 0){
|
||||||
|
|
@ -1856,7 +1970,7 @@ schema_nodeid_vec(yang_node *yn,
|
||||||
goto ok;
|
goto ok;
|
||||||
}
|
}
|
||||||
/* recursive call using ynext */
|
/* recursive call using ynext */
|
||||||
if (schema_nodeid_vec(ynext, vec+1, nvec-1, yres) < 0)
|
if (schema_nodeid_vec(ynext, vec+1, nvec-1, keyword, yres) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
ok:
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
|
|
@ -1867,15 +1981,22 @@ schema_nodeid_vec(yang_node *yn,
|
||||||
/*! Given an absolute schema-nodeid (eg /a/b/c) find matching yang spec
|
/*! Given an absolute schema-nodeid (eg /a/b/c) find matching yang spec
|
||||||
* @param[in] yspec Yang specification.
|
* @param[in] yspec Yang specification.
|
||||||
* @param[in] schema_nodeid Absolute schema-node-id, ie /a/b
|
* @param[in] schema_nodeid Absolute schema-node-id, ie /a/b
|
||||||
* @retval NULL Error, with clicon_err called
|
* @param[in] keyword A schemode of this type, or -1 if any
|
||||||
* @retval yres First yang node matching schema nodeid
|
* @param[out] yres Result yang statement node, or NULL if not found
|
||||||
|
* @retval -1 Error, with clicon_err called
|
||||||
|
* @retval 0 OK (if yres set then found, if yres=0 then not found)
|
||||||
* Assume schema nodeid:s have prefixes, (actually the first).
|
* Assume schema nodeid:s have prefixes, (actually the first).
|
||||||
* @see yang_desc_schema_nodeid
|
* @see yang_desc_schema_nodeid
|
||||||
|
* @see RFC7950 6.5
|
||||||
|
o schema node: A node in the schema tree. One of action, container,
|
||||||
|
leaf, leaf-list, list, choice, case, rpc, input, output,
|
||||||
|
notification, anydata, and anyxml.
|
||||||
* Used in yang: deviation, top-level augment
|
* Used in yang: deviation, top-level augment
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
yang_abs_schema_nodeid(yang_spec *yspec,
|
yang_abs_schema_nodeid(yang_spec *yspec,
|
||||||
char *schema_nodeid,
|
char *schema_nodeid,
|
||||||
|
enum rfc_6020 keyword,
|
||||||
yang_stmt **yres)
|
yang_stmt **yres)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
|
|
@ -1885,6 +2006,7 @@ yang_abs_schema_nodeid(yang_spec *yspec,
|
||||||
char *id;
|
char *id;
|
||||||
char *prefix = NULL;
|
char *prefix = NULL;
|
||||||
yang_stmt *yprefix;
|
yang_stmt *yprefix;
|
||||||
|
yang_stmt *ys;
|
||||||
|
|
||||||
/* check absolute schema_nodeid */
|
/* check absolute schema_nodeid */
|
||||||
if (schema_nodeid[0] != '/'){
|
if (schema_nodeid[0] != '/'){
|
||||||
|
|
@ -1903,8 +2025,8 @@ yang_abs_schema_nodeid(yang_spec *yspec,
|
||||||
}
|
}
|
||||||
/* split <prefix>:<id> */
|
/* split <prefix>:<id> */
|
||||||
if ((id = strchr(vec[1], ':')) == NULL){ /* no prefix */
|
if ((id = strchr(vec[1], ':')) == NULL){ /* no prefix */
|
||||||
clicon_err(OE_YANG, 0, "Absolute schema nodeid must have prefix");
|
clicon_log(LOG_WARNING, "%s: Absolute schema nodeid must have prefix", __FUNCTION__);
|
||||||
goto done;
|
goto ok;
|
||||||
}
|
}
|
||||||
if ((prefix = strdup(vec[1])) == NULL){
|
if ((prefix = strdup(vec[1])) == NULL){
|
||||||
clicon_err(OE_UNIX, errno, "%s: strdup", __FUNCTION__);
|
clicon_err(OE_UNIX, errno, "%s: strdup", __FUNCTION__);
|
||||||
|
|
@ -1920,8 +2042,8 @@ yang_abs_schema_nodeid(yang_spec *yspec,
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if (ymod == NULL){ /* Try with topnode */
|
if (ymod == NULL){ /* Try with topnode */
|
||||||
yang_stmt *ys;
|
|
||||||
if ((ys = yang_find_topnode(yspec, id, 1)) == NULL){
|
if ((ys = yang_find_topnode(yspec, id, YC_SCHEMANODE)) == NULL){
|
||||||
clicon_err(OE_YANG, 0, "Module with id:%s:%s not found", prefix,id);
|
clicon_err(OE_YANG, 0, "Module with id:%s:%s not found", prefix,id);
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
|
|
@ -1930,8 +2052,9 @@ yang_abs_schema_nodeid(yang_spec *yspec,
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if (schema_nodeid_vec((yang_node*)ymod, vec+1, nvec-1, yres) < 0)
|
if (schema_nodeid_vec((yang_node*)ymod, vec+1, nvec-1, keyword, yres) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
|
ok: /* yres may not be set */
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
if (vec)
|
if (vec)
|
||||||
|
|
@ -1944,14 +2067,17 @@ yang_abs_schema_nodeid(yang_spec *yspec,
|
||||||
/*! Given a descendant schema-nodeid (eg a/b/c) find matching yang spec
|
/*! Given a descendant schema-nodeid (eg a/b/c) find matching yang spec
|
||||||
* @param[in] yn Yang node
|
* @param[in] yn Yang node
|
||||||
* @param[in] schema_nodeid Descendant schema-node-id, ie a/b
|
* @param[in] schema_nodeid Descendant schema-node-id, ie a/b
|
||||||
* @retval NULL Error, with clicon_err called
|
* @param[in] keyword A schemode of this type, or -1 if any
|
||||||
* @retval yres First yang node matching schema nodeid
|
* @param[out] yres First yang node matching schema nodeid
|
||||||
|
* @retval 0 OK
|
||||||
|
* @retval -1 Error, with clicon_err called
|
||||||
* @see yang_schema_nodeid
|
* @see yang_schema_nodeid
|
||||||
* Used in yang: unique, refine, uses augment
|
* Used in yang: unique, refine, uses augment
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
yang_desc_schema_nodeid(yang_node *yn,
|
yang_desc_schema_nodeid(yang_node *yn,
|
||||||
char *schema_nodeid,
|
char *schema_nodeid,
|
||||||
|
enum rfc_6020 keyword,
|
||||||
yang_stmt **yres)
|
yang_stmt **yres)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
|
|
@ -1967,7 +2093,7 @@ yang_desc_schema_nodeid(yang_node *yn,
|
||||||
}
|
}
|
||||||
if ((vec = clicon_strsep(schema_nodeid, "/", &nvec)) == NULL)
|
if ((vec = clicon_strsep(schema_nodeid, "/", &nvec)) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
if (schema_nodeid_vec(yn, vec, nvec, yres) < 0)
|
if (schema_nodeid_vec(yn, vec, nvec, keyword, yres) < 0)
|
||||||
goto done;
|
goto done;
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
|
@ -2016,6 +2142,8 @@ ys_parse(yang_stmt *ys,
|
||||||
* Specific syntax checks and variable creation for stand-alone yang statements.
|
* Specific syntax checks and variable creation for stand-alone yang statements.
|
||||||
* That is, siblings, etc, may not be there. Complete checks are made in
|
* That is, siblings, etc, may not be there. Complete checks are made in
|
||||||
* ys_populate instead.
|
* ys_populate instead.
|
||||||
|
* @param[in] ys yang statement
|
||||||
|
* @param[in] extra Yang extra for cornercases (unknown/extension)
|
||||||
*
|
*
|
||||||
* The cv:s created in parse-tree as follows:
|
* The cv:s created in parse-tree as follows:
|
||||||
* fraction-digits : Create cv as uint8, check limits [1:8] (must be made in 1st pass)
|
* fraction-digits : Create cv as uint8, check limits [1:8] (must be made in 1st pass)
|
||||||
|
|
@ -2023,13 +2151,19 @@ ys_parse(yang_stmt *ys,
|
||||||
* @see ys_populate
|
* @see ys_populate
|
||||||
*/
|
*/
|
||||||
int
|
int
|
||||||
ys_parse_sub(yang_stmt *ys)
|
ys_parse_sub(yang_stmt *ys,
|
||||||
|
char *extra)
|
||||||
{
|
{
|
||||||
int retval = -1;
|
int retval = -1;
|
||||||
|
int cvret;
|
||||||
|
char *reason = NULL;
|
||||||
|
yang_stmt *ymod;
|
||||||
|
uint8_t fd;
|
||||||
|
char *prefix = NULL;
|
||||||
|
char *name;
|
||||||
|
|
||||||
switch (ys->ys_keyword){
|
switch (ys->ys_keyword){
|
||||||
case Y_FRACTION_DIGITS:{
|
case Y_FRACTION_DIGITS:
|
||||||
uint8_t fd;
|
|
||||||
if (ys_parse(ys, CGV_UINT8) == NULL)
|
if (ys_parse(ys, CGV_UINT8) == NULL)
|
||||||
goto done;
|
goto done;
|
||||||
fd = cv_uint8_get(ys->ys_cv);
|
fd = cv_uint8_get(ys->ys_cv);
|
||||||
|
|
@ -2038,12 +2172,41 @@ ys_parse_sub(yang_stmt *ys)
|
||||||
goto done;
|
goto done;
|
||||||
}
|
}
|
||||||
break;
|
break;
|
||||||
|
case Y_UNKNOWN:
|
||||||
|
if (extra == NULL)
|
||||||
|
break;
|
||||||
|
/* Find extension, if found, store it as unknown, if not,
|
||||||
|
break for error */
|
||||||
|
prefix = yarg_prefix(ys); /* And this its prefix */
|
||||||
|
name = yarg_id(ys); /* This is the type to resolve */
|
||||||
|
if ((ymod = yang_find_module_by_prefix(ys, prefix)) == NULL)
|
||||||
|
goto ok; /* shouldnt happen */
|
||||||
|
if (yang_find((yang_node*)ymod, Y_EXTENSION, name) == NULL){
|
||||||
|
clicon_err(OE_YANG, errno, "Extension %s:%s not found", prefix, name);
|
||||||
|
goto done;
|
||||||
}
|
}
|
||||||
|
if ((ys->ys_cv = cv_new(CGV_STRING)) == NULL){
|
||||||
|
clicon_err(OE_YANG, errno, "%s: cv_new", __FUNCTION__);
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
if ((cvret = cv_parse1(extra, ys->ys_cv, &reason)) < 0){ /* error */
|
||||||
|
clicon_err(OE_YANG, errno, "parsing cv");
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
if (cvret == 0){ /* parsing failed */
|
||||||
|
clicon_err(OE_YANG, errno, "Parsing CV: %s", reason);
|
||||||
|
goto done;
|
||||||
|
}
|
||||||
|
free(extra);
|
||||||
|
break;
|
||||||
default:
|
default:
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
ok:
|
||||||
retval = 0;
|
retval = 0;
|
||||||
done:
|
done:
|
||||||
|
if (prefix)
|
||||||
|
free(prefix);
|
||||||
return retval;
|
return retval;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
||||||
Some files were not shown because too many files have changed in this diff Show more
Loading…
Add table
Add a link
Reference in a new issue